Help me asap please
what is the correct answer? Explain why too please. Will be marked Brainliest too!

Help Me Asap Pleasewhat Is The Correct Answer? Explain Why Too Please. Will Be Marked Brainliest Too!

Answers

Answer 1

Answer:

I think its the 3rd one.

Step-by-step explanation:

Answer 2

Answer:

The answer is 1/4 I'm positive

Step-by-step explanation:

Brainliest me


Related Questions

help me pls
_units^2

help me pls _units^2

Answers

Answer:

108 un²

Step-by-step explanation:

Area trapezoid = 1/2(Base 1 +Base 2) * height

1/2(9) * 24

9 * 12 = 108

108 un²

If my answer is incorrect, pls correct me!

If you like my answer and explanation, mark me as brainliest!

-Chetan K

easy brainliest, please help me..
-22 points in total with brainliest-
(only if you get it correct)

easy brainliest, please help me.. -22 points in total with brainliest-(only if you get it correct)
easy brainliest, please help me.. -22 points in total with brainliest-(only if you get it correct)

Answers

How many shots are there in the -22 big body

Answer:

Solution given:

arcCD=2×35=70°[inscribed angle is half to the central angle]

r=10in

area of segment :70360π×r²

:70360π×10²

=1759π in²

C.1759π in² is a right answer.

Here are two similar rectangles.
4 cm
4.8 cm
7 cm
Work out the area of the larger rectangle.

Here are two similar rectangles.4 cm4.8 cm7 cmWork out the area of the larger rectangle.

Answers

Answer:

40.32cm2

Step-by-step explanation

4*1.2=4.8

7*1.2=8.4

8.4*4.8=40.32

A rectangle is a two-dimensional shape where the length and width are different.

The length and width of the larger rectangle are 4.8 cm and 8.4 cm.

The area of the larger rectangle is 40.32 cm².

What is a rectangle?

A rectangle is a two-dimensional shape where the length and width are different.

The area of a rectangle is given as:

Area = Length x width

We have,

Two similar rectangles:

Smaller rectangles:

Length = 4 cm

Width = 7 cm

Larger rectangles:

Length = 4.8 cm

We need to find the width of the larger rectangle.

Since the two rectangles are similar.

4 cm = 4.8 cm

Multiply 7/4 on both sides.

7/4 x 4cm = 7/4 x 4.8 cm

7 cm = 8.4 cm

Now,

Larger rectangle:

Length = 4.8 cm

Width = 8.4 cm

Now,

The area of the larger rectangle:

Area = Length x width

Area = 4.8 x 8.4

Area = 40.32 cm²

Thus,

The area of the larger rectangle is 40.32 cm².

Learn more about rectangles here:

https://brainly.com/question/15019502

#SPJ5

DE =8 CM
DE = 4 CM
DE = 10 CM
DE = 6CM

DE =8 CMDE = 4 CMDE = 10 CMDE = 6CM

Answers

Answer:

DE = 6 cm

Step-by-step explanation:

The problem states these triangles are similar. Line BC is half the length of Line AB. So, Line DE should be half the length of Line AD.

Therefore, Line DE = 6 cm

Find the are of the trapezoid

Find the are of the trapezoid

Answers

Answer:

Step-by-step explanation:

52√3 ft²

Answer:

120 ft.

Step-by-step explanation:

I did it by adding 15 and 15, then dividing that by 2, and finally multiplying that by the height, which is 8, to get 120.

Hope this helps :)

Consecutive even integer word problem help please!!​​

Consecutive even integer word problem help please!!

Answers

Answer:

Width: 16 in.,  Length:  18 in.

Step-by-step explanation:

Consecute even/odd problems seem a bit weird at first.

You choose a variable to represent the first integer, say  n .  Assume it's even (no symbolic way to tell!).  If  n  is even, then the next consecutive integer is  n + 2.  You add two because you want to skip one integer.

Width:  n

Length:  n + 2

Area is length multiplied by width, so

n(n+2)=224n2+2n=224n2+2n224=0(n+14)(n16)=0n+14=0 or n16=0n=14 or n=16

The negative solution makes no sense, so use n = 16

Width: 16

Length: 18

Write the equation of the line in fully simplified slope-intercept form.​

Write the equation of the line in fully simplified slope-intercept form.

Answers

Answer:

y=-1/2 x-4

Step-by-step explanation:

y=mx+c

c is -4

m is rise/run so -1/2

Find the perimeter of the equilateral triangle 3x² + 5x + 12​

Find the perimeter of the equilateral triangle 3x + 5x + 12

Answers

Answer:

Perimeter is 9x² + 15x + 36

Step-by-step explanation:

perimeter=s×s×sp=3s

p is the perimeters is side

p=3(3x2+5x+12)\bluep=9x2+15x+36

11. the data shows mean concentrations (mg/l) of pollutants in rainwater leaving either green or conventional roofs. which would be needed to calculate the total amount of a pollutant leaving the roof during and following a rainstorm

Answers

The data shows mean concentrations (mg/l) of pollutants in rainwater leaving either green or conventional roofs. Correct Option is: (D)The Total Volume of Rainfall is needed to calculate the total amount of a pollutant leaving the roof during and following a rainstorm.

Volume:

Precipitation intensity is the water depth (mm) recorded during a shower divided by the duration of the shower (hours).

Expresses water depth per hour in millimeters (mm/hour).

rainfallintensity=totalamountofrainwater(mm)/durationoftherainfall(hours)

A volume is a measure of three-dimensional space. Often quantified numerically using SI units (such as cubic meters and liters) or using various imperial or US customary units (such as gallons, quarts, and cubic inches). The definition of length (cube) relates to volume. Container volume is generally understood to mean the capacity of the container. That is, the amount of liquid (gas or liquid) that the container can hold, not the amount of space that the container itself moves.

In ancient times, volume was measured using similarly shaped natural vessels and later standardized vessels. The volume of some simple 3D shapes can be easily calculated using arithmetic formulas. The volume of more complex shapes can be calculated using integral calculations if there is an equation that constrains the shape. Zero, one, and two dimensional objects have no volume. In four dimensions and above, a concept analogous to ordinary volumes is a hypervolume.

Volume of Rainfall:

The Average Rainfall = Depth x Radius x Radius x 3.14. The area at the top of the bucket (this is the area where rain is collected). Dividing the precipitation by this area will give you the precipitation.

Complete Question:

The data in the table show mean concentrations (mg/L)(mg/L) of pollutants in rainwater leaving either green or conventional roofs. Which of the following data would be needed to calculate the total amount of a pollutant leaving the roof during and following a rainstorm?

A) Distance from street level to roof

B) Duration of the rain event

C) Total number of plants on the roof

D) Total volume of rainfall

Learn more about Volume:

https://brainly.com/question/1578538

#SPJ4

3. For each of the following production functions, determine
whether it exhibits increasing, constant or decreasing returns to
scale:
a) Q = 2K + L
b) Q = 3L + L/K
c) Q = Min(2K,L)
d) Q = L*K

Answers

a) Increasing returns to scale

b) Decreasing returns to scale

c) Constant returns to scale

d) Increasing returns to scale

To determine whether each production function exhibits increasing, constant, or decreasing returns to scale, we need to analyze how the output (Q) changes when all inputs are proportionally scaled up.

a) Q = 2K + L

This production function exhibits increasing returns to scale because when all inputs (K and L) are increased proportionally, the output (Q) increases by a greater proportion. For example, if both K and L are doubled, the output will more than double.

b) Q = 3L + L/K

This production function exhibits decreasing returns to scale because when all inputs (L and K) are increased proportionally, the output (Q) increases, but at a diminishing rate. Doubling both L and K will result in an output increase, but not by a proportionally greater amount.

c) Q = Min(2K, L)

This production function exhibits constant returns to scale because when all inputs (K and L) are increased proportionally, the output (Q) increases by the same proportion. If both K and L are doubled, the output will also double.

d) Q = L * K

This production function exhibits increasing returns to scale because when all inputs (L and K) are increased proportionally, the output (Q) increases by a greater proportion. Doubling both L and K will result in an output increase by a factor of 4 (twice as many L and twice as many K).

To know more about factor visit:

brainly.com/question/14549998

#SPJ11

An angle is equal to 1/5 of its’ supplement. What is the measurement of that angle?

Answers

Two angles are Supplementary, when they add up to 180 degrees. Hence:

Let x and y be both angles (x is the angle we are looking for);

x + y = 180° (1)

x = 1/5y (2)

We need to solve the system of equations, as follows:

Replacing equation 2 on equation 1:

1/5y + y = 180

y = 150°

Replacing the value of y in equation 2:

x = 1/5(150)

x = 30°

ANSWER

The measurement of the angle is 30°

Please help.
Graph RST with vertices R(4,1), S(7,3), and T(6, 4) and its image after the glide reflection.
Translation: (x,y) →(x, y-1)
Reflection: in the y -axis.

Answers

Answer:

Points R(4,1) S(7,3) T(6,4) after translation

R(4-3, 1) S(7-3, 3) T(6-3, 4)

R'(1, 1) S'(4, 3) T'(3, 4)

Points R'(1, 1) S'(4, 3) T'(3, 4) after reflection

R''(1, -3) S''(4, -5) T''(3, -6)

Step-by-step explanation:

Answer:Step-by-step explanation:Points R(4,1) S(7,3) T(6,4) after translation R(4-3, 1) S(7-3, 3) T(6-3, 4) R'(1, 1) S'(4, 3) T'(3, 4) Points R'(1, 1) ...

A container of dried cilantro is 17 pounds heavier than a container of dried dill. their total weight is 253 pounds. the dried dill will be sold in one ounce bags. how many bags of dried dill can be made

Answers

1888 ounces bags of dried dill can be made

What is meant by Addition?

Addition: Addition is one of the four basic operations of arithmetic, the other three being subtraction, multiplication and division. The addition of two whole numbers results in the total amount or sum of those values combined

let us consider that, x = dried cilantro , y = dried dill

so by the given information we can write addition of dried cilantro an dried dill is equal to 253

x + y = 253

and also said that container of dried cilantro is 17 pounds heavier than that of container of dried dill so we can write, x = y + 17

substitute the value of x in the 1st equation

y + 17 + y = 253

2y + 17 = 253

2y = 253 - 17

2y = 236

y = 236/2

y = 118

so there is 118 pounds of

and it will be sold in 1 ounce bags

we know, 1 pound = 16 ounces

so 118 pounds = (118×16) = 1888 ounces

which will make 1888 ounces bags

To learn more about Addition visit:

brainly.com/question/28222269

#SPJ4

Answer:

You may make dried dill in 1888 ounce bags.

Step-by-step explanation:

What does addition mean?

One of the four fundamental operations in mathematics is addition. The other three are subtraction, multiplication, and division. When two whole numbers are added, the sum or total of those values is obtained.

Consider that x represents dried cilantro and y represents dry dill.

So, using the information provided, we can say that adding dry cilantro and dried dill equals 253.

x + y = 253

and added that a container of dried cilantro weighs 17 pounds more than a container of dried dill, leading us to derive the equation x = y + 17

substitute the value of x in the 1st equation

y + 17 + y = 253

2y + 17 = 253

2y = 253 - 17

2y = 236

y = 236/2

y = 118

so there is 118 pounds of

and it will be sold in 1 ounce bags

we know, 1 pound = 16 ounces

so 118 pounds = (118×16) = 1888 ounces

which will make 1888 ounces bags.

2. *** (204)+ 44) I V9+1 4. 3. Evaluate a3 – 5g + V34 - 30* if a = 2 and g = 3 ** Evaluate 9(2x + 7) + 8 + 777 + -3 2

Answers

For the part 1: the answer is 117, because:

((9+4)+(202)2)+22

we first need to solve what is in the parenthesis:

(13+102)+22

know we simplify the exponents:

(13+100)+4

then we make the sum in the parenthesis:

113+4=117

For the part 2: the answer is 33, because:

(204)2+((14+8)+42)

we solve first what is in the parenthesis that have no more parenthesis inside them:

52+(22+42)

then we simplify the exponent and make the addition inside the square root:

25+64=25+8=33

For the part 3: the answer will be -5, because:

a35g+3430×(g+12)

if a=2 ang g=3, we have that

=235(3)+3430×(42)

we will first solve the exponents and the square root:

=85(3)+4×(42)=85(3)+2

we now solve the multiplication:

=815+2

now, we make thee addition and the substraction:

=1015=5

For the part 4: the answer will be 26, because:

9(2x+7)+8+77+4

when x=-3, the expression will be:

9(2(3)+7)+8+77+4

we will first solve what is in the square root:

9(2(3)+7)+8+81=9(2(3)+7)+8+9

then we will solve the multiplication:

=9(6+7)+8+9

now we solve what's in the parenthesis:

=9(1)+8+9=9+8+9=26

without evaluating the expression, why is 3^4 -1 even

Answers

Without evaluating the expression, the sum of given expression is 80 is this why its even number.

What are expressions?

Using letters or alphabets to represent numbers without giving their exact values is the idea behind algebraic expressions. The fundamentals of algebra taught us how to express an unknown value using letters like x, y, and z. These letters are referred to here as variables.

In an algebraic expression, both constants and variables can be used. Any amount that is added before a variable and then multiplied by it is referred to as a coefficient.

An algebraic expression in mathematics is one that contains variables, constants, and algebraic operations (addition, subtraction, etc.). Expressions are built upon terms.

Calculate the power: 81

Calculate the sum or difference: 81 - 1

Answer is 80

Thus, here we know that 80 is an even number.

to know more about expression visit:

brainly.com/question/14083225

#SPJ1

1) Louis is dilating triangle ABC at right. He
multiplied each x-coordinate and y-coordinate of
triangle ABC by -2.
a. What are the new coordinates of the points?

Answers

To find the new coordinates of the points after Louis multiplied each x-coordinate and y-coordinate of triangle ABC by -2, we can use the following formulas:

New x-coordinate = -2 * old x-coordinate

New y-coordinate = -2 * old y-coordinate

Let's apply these formulas to each point in triangle ABC:

Point A: (-3, 4)

New x-coordinate of A = -2 * (-3) = 6

New y-coordinate of A = -2 * 4 = -8

New coordinates of A: (6, -8)

Point B: (1, 1)

New x-coordinate of B = -2 * 1 = -2

New y-coordinate of B = -2 * 1 = -2

New coordinates of B: (-2, -2)

Point C: (5, -2)

New x-coordinate of C = -2 * 5 = -10

New y-coordinate of C = -2 * (-2) = 4

New coordinates of C: (-10, 4)

Therefore, the new coordinates of the points after Louis multiplied each x-coordinate and y-coordinate of triangle ABC by -2 are:

A: (6, -8)

B: (-2, -2)

C: (-10, 4)

Can somebody simply these matrixs for me please I will give out brainlist to first correct answer

Can somebody simply these matrixs for me please I will give out brainlist to first correct answer

Answers

I think is D I am so sorry if I’m wrong

Answer:

I think it's D:)

Step-by-step explanation:

The Massachusetts Body of Liberties __________.Which shows two expressions that are equivalent to (Negative 7) (Negative 15) (Negative 5)?

Answers

Answer:

Step-by-step explanation:

The Massachusetts Body of Liberties were technically the first ever legal code system established by the colonists, and established a central court that had full rights and jurisdictions over the citizens.

There are 5 positions available in the new school. Of the applicant, 12 are men and 8 are women. In how many ways can 3 men and 2 women be chosen if they are equally considered?

Answers

There are 3080 ways 3 men and 2 women can be chosen if they are equally considered, using the multiplication principle of counting

What is the multiplication principle of counting

The multiplication principle states that if there are m ways to perform one task and n ways to perform another task, then there are m x n ways to perform both tasks together.

To find the number of ways to choose 3 men from the 12 men, we can use the formula for combination, which is: ⁿCᵣ = n! / (r! (n-r)!).

where n is the total number of men and r is the number of men chosen

so, the number of ways to choose 3 men from the 12 men = ¹²C₃ = 1.

Similarly, we evaluate the number of ways to choose 2 women from the 8 women

as = ⁸C₂ = 14

Now, using the multiplication principle, we can find the total number of ways 3 men and 2 women be chosen if they are equally considered.

220 x 14 = 3080

Therefore, there are 3080 ways 3 men and 2 women can be chosen if they are equally considered, using the multiplication principle of counting

Know more about multiplication principle here:https://brainly.com/question/10275154

#SPJ1

If you had 7 folders and you want to put the same number of pages in each folder. If you have a total of p pages how many pages will be in each folder? P+7 P-7 7p P/7

Answers

Answer:

P/7

Step-by-step explanation:

If you have p pages and you want 7 pages in all of them, you divide by 7 to get the exact amount in each folder

Answer:

P/7

Step-by-step explanation:

You have 7 folders, you want to put paper in it which will be (p). so you divide the number of pages of paper (p) by how many folders you have (7).

good luck!

how to slove cos 41=x/11

Answers

41=x/11

x=41×11

= 451

so the answer is 451

hope it hekps

Answer:

x=451

Step-by-step explanation:

41= x /11

(41)*(11)=( x /11 )*(11)

451=x

Find the value of x. ​

Find the value of x.

Answers

Answer:

d. 16 feet

Step-by-step explanation:

x² + 12² = 20²

x² + 144 = 400

x² + 144 - 144 = 400 - 144

x² = 256

√x² = √256

x = 16

help please!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!

help please!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!

Answers

Answer:

24 cm²

Step-by-step explanation:

The area of a rhombus is half the product of its diagonals.

Areaofarhombus=diagonal1diagonal22

Therefore, to find the area of the rhombus, we need to find the lengths of the diagonals AC and BD.

The diagonals of a rhombus are perpendicular bisectors of each other.

The point of intersection of the diagonals of rhombus ABCD is point O.

We can use the given information to find the lengths of BO and OC, then  double these to find diagonals AC and BD.

The sides of a rhombus are equal in length. Therefore, if the perimeter of rhombus ABCD is 20 cm, each side length is 5 cm.

Therefore, the hypotenuse of right triangle BOC is BC = 5 cm.

If the ratio of AC : BD = 4 : 3, then the ratio of OC : BO = 2 : 1.5.

Let OC = 2x and BO = 1.5x.

Use Pythagoras Theorem to find the value of x.

BO2+OC2=BC2(1.5x)2+(2x)2=521.52x2+22x2=252.25x2+4x2=256.25x2=25x2=4x2=4x=2

Therefore, to find the lengths of OC and BO, substitute x = 2:

OC=2x=2(2)=4cm

BO=1.5x=1.5(2)=3cm

As the diagonals of a rhombus bisect each other:

AC=2OC=24=8cm

BD=2BO=23=6cm

Finally, substitute the lengths of the diagonals into the formula for the area of a rhombus:

Extra close brace or missing open brace

Therefore, the area of rhombus ABCD is 24 cm².

Give cb/ba = de/ef find BA

Give cb/ba = de/ef find BA

Answers

The value of BA = 11.2

Determining the length of BA:

Here we use the condition CB/BA = DE/EF to determine the Length of BA

Substitute the lengthS of each side as per the given figure and solve the condition for the Length of the side BA.

Given that CB/BA = DE/EF

From the given figure,

CB = 7, DE = 5, and EF = 8  

Substitute the above values in the given condition

=> 7 /BA = 5 /8

Do cross multiplication

=> BA(5) = 7(8)

=> 5BA = 56

=> BA = 11.2

Therefore,

The value of BA = 11.2    

Learn more about Length of the side at

https://brainly.com/question/12386987

#SPJ1

how similar is the code for doing k-fold validation for least-squares regression vs. logistic regression

Answers

The code for k-fold validation in least-squares and logistic regression involves splitting the dataset into k folds, importing libraries, preprocessing, splitting, iterating over folds, fitting, predicting, evaluating performance, and calculating average performance metrics across all folds.

The code for performing k-fold validation for least-squares regression and logistic regression is quite similar. Both methods involve splitting the dataset into k folds, where k is the number of folds or subsets. The code for both models generally follows the same steps:

1. Import the necessary libraries, such as scikit-learn for machine learning tasks.
2. Load or preprocess the dataset.
3. Split the dataset into k folds using a cross-validation function like KFold or StratifiedKFold.
4. Iterate over the folds and perform the following steps:
  a. Split the data into training and testing sets based on the current fold.
  b. Fit the model on the training set.
  c. Predict the target variable on the testing set.
  d. Evaluate the model's performance using appropriate metrics, such as mean squared error for least-squares regression or accuracy, precision, and recall for logistic regression.
5. Calculate and store the average performance metric across all the folds.

While there may be minor differences in the specific implementation details, the overall structure and logic of the code for k-fold validation in both least-squares regression and logistic regression are similar.

To know more about logistic regression Visit:

https://brainly.com/question/32505018

#SPJ11

Help ASAP 15 Points

The hot water heater in the Alvarez's home holds 70 gallons of water. Each shower taken uses 5.4 gallons
of water. How much water is left after 3 showers. (Hint: Write an equation relating the number of showers and
the number of gallons left in the tank)

Answers

Answer:

53.8 gallons

Step-by-step explanation:

5.4*3=16.2

5.4 (gallons used per shower) * 3 (number of showers) = 16.2 (gallons used in 3 showers)

70-16.2=53.8

70 (Water in tank) - 16.2 (gallons used in 3 showers) = 53.8 (gallons of water left)

Hope this helps! Please brainliest!!!

Answer:

A(3) = 53.8 gallons left after 3 showers

Step-by-step explanation:

A(x) = volume of water left in tank = 70 gallons - (5.4 gallons)x, where x is the number of showers already taken.  

After  3 showers, the volume of water left is A(3) = 70 gal - (5.4 gallons)(3), or

A(3) = 53.8 gallons left after 3 showers

Express the answers to the following operations with the proper number of significant figures. (a) 8.370×1.3 ×10 (b) 4.265/2.0 (c) (1.2588×10 ^3)×(1.06×10 ^−2) (d) (1.11) ^1/2

Answers

The answers, rounded to the appropriate number of significant figures, are as follows:

(a) 1.088 ×102

(b) 2.132

(c) 1.3331 ×101 and

(d) 1.05.

Let's calculate the answers to the given operations using the appropriate number of significant figures.

(a) 8.370×1.3×10

To perform this multiplication, we multiply the decimal numbers and add the exponents of 10:

8.370 × 1.3 × 10 = 10.881 × 10 = 1.0881 × 102

Since the original numbers have four significant figures, we round the final answer to four significant figures:

1.088 × 102

(b) 4.265/2.0

For division, we divide the decimal numbers:

4.265 ÷ 2.0 = 2.1325

Since both numbers have four significant figures, the answer should be rounded to four significant figures:

2.132

(c) (1.2588×103)×(1.06×Double exponent: use braces to clarify)

To multiply these numbers, we multiply the decimal numbers and add the exponents:

(1.2588 × 103) × (1.06 × Double exponent: use braces to clarify) = 1.333128 × 101

Since the original numbers have five significant figures, we round the final answer to five significant figures:

1.3331 × 101

(d) Double exponent: use braces to clarify

To calculate the square root, we raise the number to the power of 1/2:

Double exponent: use braces to clarify= 1.0524

Since the original number has three significant figures, the answer should be rounded to three significant figures:

1.05

It's important to note that the significant figures in a result are determined by the original data and the operations performed. The final answers provided above reflect the appropriate number of significant figures based on the given information and the rules for significant figures.

For more such information on: significant figures

https://brainly.com/question/30169

#SPJ8

A recipe calls for 3 cups of flour to make 7 cookies. If Nancy made 98 cookies, how many cups of flour did she use?

Answers

Answer:

42

Step-by-step explanation:

7 cookies : 3cups

98 cookies: more

98

--- × 3 = 42 cups

7


Use the following statements to write a compound
statement for the disjunction -p or -q. Then find its truth
value.
p: There are 14 inches in 1 foot.
q: There are 3 feet in 1 yard.

Answers

The disjunction of -p or -q can be written as (-p) v (-q). So, we have to find the truth value of (-p) v (-q). So, the compound statement for the disjunction of -p or -q is (-p) v (-q), and its truth value is true.

using the following statements: p: There are 14 inches in 1 foot.

q: There are 3 feet in 1 yard.

Solution: We know that 1 foot = 12 inches, which means that there are 14 inches in 1 foot can be written as 14 < 12. But this statement is false because 14 is not less than 12. Therefore, the negation of this statement is true, which gives us (-p) as true.

Now, we know that 1 yard = 3 feet, which means that there are 3 feet in 1 yard can be written as 3 > 1. This statement is true because 3 is greater than 1. Therefore, the negation of this statement is false, which gives us (-q) as false.

Now, we can use the values of (-p) and (-q) to find the truth value of (-p) v (-q) using the disjunction rule. The truth value of (-p) v (-q) is true if either (-p) or (-q) is true or both (-p) and (-q) are true. Since (-p) is true and (-q) is false, the disjunction of (-p) v (-q) is true. Hence, the compound statement for the disjunction of -p or -q is (-p) v (-q), and its truth value is true.

For more questions on: compound statement

https://brainly.com/question/28794655

#SPJ8        

Assume a two-country two-good two-input model where the following relationships hold: (K/L)
U.S.

>(K/L)
Row

(K/L)
automobiles

>(K/L)
shoes

Where (K/L)
U.S.

is the capital-labor ratio in the United States, (K/L)
Row

is the capital-labor ratio in the Rest of the World, (K/L) automobiles indicates the capital-labor ratio in the production of automobiles, and (K/L)
shoes

indicates the capital-labor ratio in the production of shoes. Assume further that technology and tastes are the same in the United States and the Rest of the World. The relationships shown here indicate that, with no trade, in the United States: the price of shoes relative to automobiles is lower than in the Rest of the World. the relative labor endowment is higher than in the Rest of the World. the price of automobiles relative to shoes is lower than in the Rest of the World. the relative capital endowment is the same as in the Rest of the World.

Answers

The relationships described indicate that, without trade, the price of shoes relative to automobiles is lower in the United States compared to the Rest of the World.

How does the relative labor endowment in the United States compare to the Rest of the World?

In the given two-country two-good two-input model, the relationships suggest that the price of shoes relative to automobiles is lower in the United States compared to the Rest of the World. Let's now examine the relative labor endowment.

The relative labor endowment refers to the ratio of labor available in one country compared to another. Given that the capital-labor ratios for automobiles and shoes are higher in the United States than in the Rest of the World, it implies that the United States has a higher capital endowment relative to labor compared to the Rest of the World.

Since technology and tastes are assumed to be the same in both countries, the lower price of shoes relative to automobiles in the United States indicates that the labor input required for producing shoes is relatively higher in the United States compared to the Rest of the World.

This suggests that the United States has a higher labor endowment compared to the Rest of the World.

Therefore, based on the given relationships, we can conclude that the relative labor endowment in the United States is higher than in the Rest of the World.

Learn more about Rest of the World

brainly.com/question/31486223

#SPJ11

Other Questions
Write 55 in standard form.312532355 x 5 x 5 x 5 x 55 x 5 x 5 x 5 Suppose that you are given the following production function: Q=100K^0.6 L^0.4 Determine the marginal product of capital and the marginal product of labor when K = 25 and L= 100. the patient is 52 years old and has a history of hypertension. his cholesterol level is 245. he states his job is very stressful and he is recently going through a divorce. he admits to being overweight and has an inactive lifestyle. his father died of a stroke at age 60. he is worried about having a heart attack and/or stroke and wishes to change his lifestyle. among other advice, the nurse encourages the patient to eat more cold-water fish such as salmon. explain why eating more fish would be of benefit for this patient. Ariana invested $7500 in an account paying in interest rate of 2.9% compounded continuously assuming no deposits or withdrawals are made how much money to the nearest $10 would be in the account after 14 years true/false: if a function has no return statement, the flow of control moves to the next function in the file when the closing brace of the function body is reached. Mark Twain, American author and humourist, once wrote, "Work and play are words used to describe the same thing under differing circumstances." Is school work or play for you? Why? Use examples from your academic life to support your position in a coherent, meaningful, brief essay. How can a company decrease the energy cost of food production? reduce the distance of exports, distributing local foods to their own regions. distribute out-of-season produce to reduce the energy needed to store. use cleaner fuels or electric-powered vehicles for transporting food. reduce the distance of imported items used to make food products. 275964.618882 the nearest hundreth Por qu suele la ganadera tener una huella de carbono ms alto que otrosalimentos?(A) Porque hay ms fincas de ganado que de cultivo de otros alimentos.(B) Porque hay ms consumidores de ganado que de verduras.(C) Porque es ms difcil transportarlos que otros alimentos.(D) Porque se requiere ms energa para criar el ganado y hay ms residuos. according to research by jennifer jacquet, shaming works best to change human behavior when it is used to address a Contact with infected animals,What would be an example for that? your student loan payments are considered manageable if they consume less than ___% of your income. 0 HELP PLEASE!!!Which question is the best example of a causal research question?a. Which Americans participated in the women's suffrage movement?b. What is the difference between the 18th and 19th Amendments?c. How are constitutional amendments passed and ratified?d. How did Susan B. Anthony's work help pass the 19th Amendment? PLZ HELP ME ON THIS I NEED HELP ITS DUE ILL GIVE YOU BRAINLIEST!!!!!!!!!!!! you are implementing security at a local high school that is concerned with students accessing inappropriate material on the internet from the library's computers. the students use the computers to search the internet for research paper content. the school budget is limited. which content filtering option would you choose? answer block all content except for content you have identified as permissible. block specific dns domain names. allow all content except for the content you have identified as restricted. restrict content based on content categories. defination of photosynthesis HELP ASAP!!!!!!!!!!!!!! Identify the possible challenges & concerns related to cost and standard of living in United State What is the area of the figure? Rob started with this polynomial: x + 6x? - xHe subtracted another polynomial. 3The difference was: -4x + 11x - X-5What was the second polynomial?5x 5x + 52225x + 5x" - 53 2-5x + 5x + 521-5x 5x 5