Given that 4 NH3 + 5 O2 → 4 NO + 6 H2O, if 3.00 mol NH3 were made to react with excess of oxygen gas, the amount of H2O formed would be

Answers

Answer 1
Answer:

x mol H2O = 4.50 mol H2O

Step-by-step explanation:

From the balanced equation, we can see that for every 4 moles of NH3 that react, 6 moles of H2O are formed. Therefore, we can use a proportion to find the amount of H2O that would be formed if 3.00 mol of NH3 reacted:

4 mol NH3 : 6 mol H2O = 3.00 mol NH3 : x mol H2O

Solving for x, we get:

x mol H2O = (6 mol H2O / 4 mol NH3) * 3.00 mol NH3
x mol H2O = 4.50 mol H2O

Therefore, if 3.00 mol of NH3 were made to react with excess oxygen gas, 4.50 mol of H2O would be formed.

Related Questions

Identify
the Tectonic plate boundaries

Answers

Answer:

tectonic plates are practically just like blocks of rock that are in a bunch of places in our Earth

Explanation:

tectonic plates can be melted into lava and we have many tectonic plates for example the Pacific Plate or the Indian plate the African plate but those are just examples there are many more and when two plates crash into each other it creates a mountain and when they're separated apart it's a drift which makes like a giant crack in the earth practically

how can landforms be weathered?

Answers

Answer:

they can become smaller or start fall apart or aroud

Explanation:

The old, depressed house moaned as the wind blew.
Alliteration
Allusion
Assonance
Hyperbole
Metaphor
Onomatopoeia
Oxymoron
Personification
Simile

Answers

The sentence mentioned in the question is an example of personification.

What is personification?

Personification is a category of figurative language in which an inanimate or biotic factor is given human-like qualities and characteristics. The sentence in this question is an example of personification because in reality, a house cannot moan and is incapable of possessing a state of emotion or age. This is shown where the house is described as “old” and “depressed.” In actuality, a house is a structure comprised of objects that have no proneness to emotions and things humans can feel and grasp.

Answer Recap: This sentence is an example of personification.

lim f(x) x-3 lim f(x) x-1– lim f(x) x-17+ lim f(x) x3 lim f(x) x5
how do I find the limits using graphs

lim f(x) x-3 lim f(x) x-1 lim f(x) x-17+ lim f(x) x3 lim f(x) x5how do I find the limits using graphs

Answers

Explanation:

try this option (all the details are in the attachment).

lim f(x) x-3 lim f(x) x-1 lim f(x) x-17+ lim f(x) x3 lim f(x) x5how do I find the limits using graphs

I WILL GIVE 30 POINTS TO THOSE WHO ANSWER THIS QUESTION RIGHT NOOOO SCAMS PLEASE

I WILL GIVE 30 POINTS TO THOSE WHO ANSWER THIS QUESTION RIGHT NOOOO SCAMS PLEASE

Answers

The general gas equation, commonly referred to as the ideal gas law, represents the state of a fictitious ideal gas through an equation. Here the mass of helium gas required to pressurize 86 L tank to 201 atm is 2561.8 g.

According to the ideal gas law, the sum of the absolute temperature of the gas and the universal gas constant is equal to the product of the pressure and volume of one gram of an ideal gas.

The ideal gas equation is given as:

PV = nRT

n = PV / RT

56°C = 329 K

n = 201 × 86 / 0.08206 × 329 = 640.45 mol

Molar mass of 'He' = 4.00 g / mol

Mass =  640.45 × 4.00 = 2561.8 g

To know more about ideal gas law, visit;

https://brainly.com/question/30458409

#SPJ1

Which statement best describes the difference between a combustion reaction and a single-replacement reaction?
• Combustion reactions are always redox reactions.
• Combustion reactions are always exothermic.
• Single replacement reactions always involve oxygen.
• Single-replacement reactions are always combustion reactions.

Answers

Distinguishes a single-replacement reaction from a combustion reaction. One element in a compound is switched out for another in a single replacement reaction.

What does a combustion reaction look like?

The oxygen present in the air and the fuel, which is wood, continually react in a combustion process. While the fog you see is co2, the fire that is created is energy been released in a protracted exothermic process.

What happens when something burns?

An item quickly reacts with oxygen in the biological process of burning to create heat. The initial material is referred to as the feed, and the oxygen's source as the oxidizer. Although it is often a liquid for airplane propulsion, the fuel could be a hard, liquids, or gas.

To know more about combustion reaction visit:

https://brainly.com/question/13251946

#SPJ1

what are thetypes of luminous flame

Answers

Types of luminous flames:

1. Yellow Luminous Flame

2. Smoky Luminous Flame

3. Orange Luminous Flame

4. Blue Luminous Flame

Luminous flames are characterized by their visible glow, which is caused by the incomplete combustion of fuel. The presence of soot particles in the flame causes the emission of light. There are different types of luminous flames, which can be classified based on their fuel composition and burning conditions. Here are some common types of luminous flames:

1. Yellow Luminous Flame: This is the most common type of luminous flame, often seen in open fires, candles, and gas stoves. It appears yellow due to the presence of soot particles in the flame. Yellow flames indicate incomplete combustion of hydrocarbon fuels, such as methane, propane, or natural gas. The high carbon content in these fuels leads to the formation of soot, which emits visible light.

2. Smoky Luminous Flame: This type of flame is characterized by a significant amount of black smoke and soot production. It is commonly observed in poorly adjusted or malfunctioning burners or engines. The excessive presence of unburned fuel in the flame results in incomplete combustion and the emission of dark smoke particles.

3. Orange Luminous Flame: An orange flame indicates a higher combustion temperature compared to a yellow flame. It is often seen in more efficient burners or when burning fuels with a higher carbon content, such as oil or diesel. The higher temperature helps in burning more of the carbon particles, reducing the amount of soot and making the flame appear less yellow.

4. Blue Luminous Flame: A blue flame is typically associated with complete combustion. It indicates efficient burning of fuel, resulting in minimal soot formation. Blue flames are commonly observed in gas burners or Bunsen burners. The blue color is a result of the combustion of gases, such as methane, in the presence of sufficient oxygen.

It's important to note that the luminosity of a flame can vary depending on factors such as fuel-air mixture, combustion temperature, and the presence of impurities. Achieving complete combustion and minimizing the production of soot is desirable for efficient and cleaner burning processes.

for more questions on luminous

https://brainly.com/question/27163038

#SPJ8

There is a 2 percent defect rate at a specific point in a production process. If an inspector is placed at this point, all the defects can be detected and eliminated. The inspector would cost $10 per hour and could inspect units in the process at the current production rate of 48 per hour.
If no inspector is hired and defects are allowed to pass this point, there is a cost of $11 per defective unit to correct the defects later on.
Assume that the line will operate at the same rate (i.e., the current production rate) regardless of whether the inspector is hired or not.
a. If an inspector is hired, what will be the inspection cost per unit? (Round your answer to 3 decimal places.)
Inspection cost per unit _____________$
b. If an inspector is not hired, what will be the defective cost per unit? (Round your answer to 3 decimal places.)
Defective cost per unit _____________$
c. Should an inspector be hired based on costs alone?

Answers

Answer:

A)  $0.208 per unit

B) $0.220 per unit

C) An inspector should be hired

Explanation:

percentage of defect rate = 2% = 0.02

cost of inspector = $10 per hour

production rate = 48 per hour

cost of not hiring an inspector = $11

A) Determine the inspection cost per unit if an inspector is hired

= cost of inspector / production rate

= 10 / 48 = $0.208 per unit

B) Determine the defective cost per unit if an Inspector is not hired

= cost of not hiring an inspector * percentage of defect rate

= 11 * 0.02

= $0.220 per unit

C)   Inspection cost < defective cost   i.e. $0.208 < $0.220  hence an inspector should be hired

- If x moles of electrons are transferred when 4.8 g of oxygen reacts with 4.8 g of
magnesium, what is the value of x?

Answers

Answer:

sdfffffffff

Explanation:

dfffffgsdsdsdsdsdsdsdsdsdsdsdsdsdsdsd

The meaning of the word symptom:​

Answers

The word "symptom" refers to a specific manifestation or indication of a condition, disease, or disorder that is experienced or observed by an individual.

Symptoms are subjective or objective changes in the body's normal functioning that may be recognized as abnormal, uncomfortable, or problematic. Symptoms can manifest in various ways depending on the nature of the underlying condition. They can be physical, such as pain, rash, cough, fever, or fatigue, indicating an illness or injury affecting the body. Symptoms can also be psychological, such as anxiety, depression, or confusion, reflecting disturbances in mental health.

Symptoms serve as important clues for medical professionals to identify and diagnose diseases or disorders. They provide valuable information about the nature, severity, and progression of an illness, helping healthcare providers formulate appropriate treatment plans. Additionally, symptoms may also be important for individuals to self-assess their own health status and seek appropriate medical attention.

It is essential to note that symptoms alone may not provide a definitive diagnosis, as they can overlap across different conditions. Further evaluation, including medical tests and examinations, is often necessary to confirm a diagnosis and determine the appropriate course of action.

for more such questions on symptom

https://brainly.com/question/21078887

#SPJ8

1. Write the IUPAC names for the following 1.1 1.2 N 1.3 O NO2 x Y ·0 OH 5​

Answers

1. The IUPAC name of N is nitrogen.

2. Nitrogen dioxide

3.The IUPAC name of O is oxygen

4.The IUPAC name of OH is hydroxyl.

The IUPAC name of ·0 is a radical. It is commonly found in organic chemistry and plays an important role in many reactions.

IUPAC names for the given compounds are:1.1. N: Nitrogen

The IUPAC name of N is nitrogen.

It is a non-metal and belongs to group 15 in the periodic table. It has an electronic configuration of 1s2 2s2 2p3.1.2. NO2: Nitrogen dioxide

Explanation: NO2 is a chemical compound that is formed by the combination of nitrogen and oxygen. It is a reddish-brown gas that has a pungent odor.

The IUPAC name of NO2 is nitrogen dioxide.1.3. O: Oxygen

Explanation: The IUPAC name of O is oxygen.

It is a non-metal and belongs to group 16 in the periodic table. It has an electronic configuration of 1s2 2s2 2p4.

X: UnknownExplanation: No IUPAC name can be given to an unknown compound as the structure and composition are not known.

Y: Hydroxyl Explanation: The IUPAC name of OH is hydroxyl.

It is a functional group that is composed of an oxygen atom and a hydrogen atom (-OH). It is commonly found in alcohols and phenols. ·0: RadicalExplanation: A radical is a molecule or an ion that contains an unpaired electron.

for more question on electronic configuration

https://brainly.com/question/26084288

#SPJ8

Note: The complete question is given below

Provide the IUPAC names for the following compounds:

CH3CH2CH(CH3)CH2CH2CH2CH3

C6H5CH(CH3)2

H2NCH2CH2CH2CH2CH2NH2

CH3CH2CH2CH2CH2OH

CH3CH2CH2CHOHCH3

-Convert 6.02 x 1020 formula units of MgCl₂ to mol of MgCl₂:​

Answers

6.02 x \(10^{20\) formula units of MgCl₂ is equal to 0.1 moles of MgCl₂.

To convert formula units of MgCl₂ to moles of MgCl₂, we need to use Avogadro's number, which relates the number of formula units to the number of moles.

Avogadro's number (NA) is approximately 6.022 x 10^23 formula units per mole.

Given that we have 6.02 x 10^20 formula units of MgCl₂, we can set up a conversion factor to convert to moles:

(6.02 x 10^20 formula units MgCl₂) * (1 mol MgCl₂ / (6.022 x 10^23 formula units MgCl₂))

The formula units of MgCl₂ cancel out, and we are left with moles of MgCl₂:

(6.02 x 10^20) * (1 mol / 6.022 x 10^23) = 0.1 mol

Therefore, 6.02 x 10^20 formula units of MgCl₂ is equal to 0.1 moles of MgCl₂.

It's important to note that this conversion assumes that each formula unit of MgCl₂ represents one mole of MgCl₂. This is based on the stoichiometry of the compound, where there is one mole of MgCl₂ for every one formula unit.

Additionally, this conversion is valid for any substance, not just MgCl₂, as long as you know the value of Avogadro's number and the number of formula units or particles you have.

For more such questions on MgCl₂ visit:

https://brainly.com/question/26311875

#SPJ8


Two chemical substances A and B can be touched easily by hands kept on seperate tube but when both the substances are mined in a test tube it cannot be touched due to hotness. What can be reason. behind this?​

Answers

Answer:

The reason for this is likely an exothermic reaction, where the combination of substances A and B results in a release of heat energy.

Explanation:

An exothermic reaction is a chemical reaction that releases heat energy. This heat can cause an increase in temperature, sometimes to a point where it becomes uncomfortable or even dangerous to touch the mixture. The exact reason why the mixture becomes hot depends on the chemical nature of substances A and B and the reaction they undergo when mixed. Some possible causes could include an increase in the rate of molecular motion as the reaction progresses, or the breaking and formation of chemical bonds, which releases energy in the form of heat. Additionally, the reaction could be releasing gases that are expanding and generating heat as a result. To determine the exact cause, a detailed analysis of the chemical composition and reaction kinetics of the mixture would be required.

What would be the bond type for BH2?

Answers

The bonds present in BH₂⁻ ion are single covalent bonds.

What is dihydridoborate?

BH₂⁻ has the chemical formula for dihydridoborate(-1) which is also called Boranide. BH₂⁻ consists of one boron atom and two hydrogen atoms.  BH₂⁻ can be defined as a boron hydride.

In  BH₂⁻ lewis structure, there are two atoms present i.e. boron atom and a hydrogen atom. The boron atom has 3 valence electrons and the hydrogen atom has one valence electron in their outer shell orbitals.

All the B and H atoms in the structure are arranged not in a symmetrical manner and lone electron pairs there is repulsion between atoms and creating a 120° bond angle and having a bent shape.

BH₂⁻ ion contains B and H atoms, which are connected with each other by single covalent bonds.

Learn more about Boron hydride, here:

https://brainly.com/question/11512924

#SPJ1

how many bond can boron make without hybridization

Answers

Without hybridization, boron can form 4 bonds

What is hybridization?

Hybridisation is phenomenon of combining two atomic orbitals to give a new degenerate hybrid orbital which have same energy levels. Hybridization increases the stability of bond formation than unhybridized orbitals. We can predict the shape of molecules by its hybridization.

With hybridization , boron can form 3 bonds.

Hence, without hybridization, Boron donates the lone pair of electrons to form the fourth bond. In addition to that Boron is a second period element hence, which makes it small in size and d-orbitals are unavailable as well. Hence, Boron can only form 4 bonds with hybridization.

learn more about hybridization from

https://brainly.com/question/22765530

#SPJ1

Please help me do this

Please help me do this

Answers

The total mass of the balloon and its content is 1521.17 g, the number of moles of CO₂ in the balloon is 34.15 mol, and the number of CO₂ molecules in the balloon is 2.06 x 10²⁵ molecules.

a) The molar mass of CO₂ is 44.01 g/mol. To find the total mass of the balloon and its content, we need to add the mass of the balloon (20g) to the mass of the CO₂ inside the balloon.

Mass of CO₂ = number of moles of CO₂ x molar mass of CO₂

Since the balloon is at STP (standard temperature and pressure), we can use the molar volume of a gas at STP (22.4 L/mol) to find the number of moles of CO₂ in the balloon:

Volume of CO₂ = Volume of balloon = 765 L (at STP)

Number of moles of CO₂ = volume of CO₂ / molar volume of a gas at STP

                                          = 765 L / 22.4 L/mol

                                          = 34.15 mol

Mass of CO₂ = 34.15 mol x 44.01 g/mol

                       = 1501.17 g

Total mass of balloon and its content = 20 g + 1501.17 g

                                                               = 1521.17 g

b) Number of moles of CO₂ in the balloon is 34.15 mol

c) To find the number of CO₂ molecules in the balloon, we need to use Avogadro's number (6.02 x 10²³ molecules/mol).

Number of CO₂ molecules = number of moles of CO₂ x Avogadro's number

                                           = 34.15 mol x 6.02 x 10²³ molecules/mol

                                           = 2.06 x 10²⁵ molecules

To know more about the Mass, here

https://brainly.com/question/22104139

#SPJ1

radium-223 decays with a half-life of 11.4 days, how long will it take for a 0.240-mol sample of radiuim to decay to 1.88 x 10-3 mol

Answers

The time taken for 0.240 mole sample of radiuim to decay to 1.88×10¯³ mole is 79.8 days

We'll begin by calculating the number of half-lives that has elapsed.

Original amount (N₀) = 0.240 mole

Amount remaining (N) = 1.88×10¯³ mole

Number of half-lives (n) =?

N = 1/2ⁿ × N₀

1.88×10¯³ = 1/2ⁿ × 0.240

Cross multiply

1.88×10¯³ × 2ⁿ = 0.240

Divide both side by 1.88×10¯³

2ⁿ = 0.240 / 1.88×10¯³

2ⁿ = 128

2ⁿ = 2⁷

n = 7

Thus, 7 half-lives has elapsed

Finally, we shall determine the time.

Number of half-lives (n) = 7

Half-life (t½) = 11.4 days

Time (t) =?

t = n × t½

t = 7 × 11.4

t = 79.8 days

Therefore, the time taken for 0.240 mole sample of radiuim to decay to 1.88×10¯³ mole is 79.8 days

Learn more: https://brainly.com/question/13266270

What would the final freezing point of water be if 3 mol of
sugar were added to 1 kg of water (Kx = 1.86°C/(mol/kg)
for water and i = 1 for sugar)?
A. -1.86°C
B. -5.58°C
C. -0.62°C
Ο Ο
D. +5.58°C
SUBMIT

Answers

Answer:

B. -5.58°C.

Explanation:

Hello!

In this case, since the freezing point depression is computed as follows:

ΔTf=imKf

Whereas i=1 as the van't Hoff's factor of sugar (nonionizing solute), m=3mol/1kg=3mol/kg as the molality and Kf=1.86 °C/(mol/kg) as the freezing point depression constant for water. In such a way, we plug in to obtain:

ΔTf=13molkg1.86Cmol/kgΔTf=5.58C

Now, since the freezing point of pure water is 0°C, we infer that freezing point of such solution is:

B. -5.58°C.

Best regards!

Ocean water contains 3.3 % NaCl by mass.
How much salt can be obtained from 234g of seawater?

Answers

Answer:

Ans: 8.9 NaCl

Explanation:

Ocean water contains 3.5 nacl by mass how much salt can be obtained from 254 g of seawater

Question: Ocean water contains 3.5% NaCl by mass. How much salt can be obtained from 254g of seawater?

11. The pH values of some solutions are given below pH 14.0 1.0 L 8.0 N 6.5 n P 7.0 Solution M Z (a) Identify the solution with the lowest concentration of hydrogen ion. Give reason for your (1mk) answer​

Answers

Answer: 14.0

Explanation: 14.0 is a base. The more basic, the less hydrogen ion concentration.

Explain how electronegativity changes as one moves across the third period of the periodic table? 

Answers

Electronegative will increase

A sample of gas at 2815 torr is cooled from 150.0 C to 100.0 C. Assuming the volume is constant what is the pressure in atm of the gas at 100.0 C

Answers

A sample of gas at 2815 torr is cooled from 150.0 C to 100.0 C. Assuming the volume is constant, 2482.2torr is the pressure in atm of the gas at 100.0 C.

The force delivered perpendicularly to an object's surface per unit area across how that force is dispersed is known as pressure (symbol: p / P). The pressure in relation to the surrounding air pressure is known as gauge pressure, also spelt gauge pressure.

Pressure is expressed using a variety of units. Some of these are calculated by dividing a unit of force by a unit of area; for instance, the metric system's unit of pressure, a pascal (Pa), is equal to one newton / square metre (N/m2).

P₁/T₁=P₂/T₂

2815 ×373/423=2482.2torr

To know more about pressure, here:

https://brainly.com/question/12971272

#SPJ1

What is the reaction of Dimethylamamine + acetic acid

Answers

DMA is prepared commercially by the reaction of dimethylamine with acetic anhydride or acetic acid. Dehydration of the salt of dimethylamine and acetic acid also furnishes this compound: CH3CO2H·HN(CH3)2 → H2O + CH3CON(CH3) Dimethylacetamide can also be produced by the reaction of dimethylamine with methyl acetate.

The research department found that adding more oxygen to the mixture was the solution the problem

Answers

The research department found that adding more oxygen to the mixture was the solution to  the problem according to solubility concept.

What is solubility?

Solubility is defined as the ability of a substance which is basically solute to form a solution with another substance. There is an extent to which a substance is soluble in a particular solvent. This is generally measured as the concentration of a solute present in a saturated solution.

The solubility mainly depends on the composition of solute and solvent ,its pH and presence of other dissolved substance. It is also dependent on temperature and pressure which is maintained.Concept of solubility is not valid for chemical reactions which are irreversible. The dependency of solubility on various factors is due to interactions between the particles, molecule or ions.

Learn more about solubility,here:

https://brainly.com/question/22185953

#SPJ9

If 238 J of heat is absorbed by a sample of metal with a mass of 40.7 g, and it raises the temperature from 20.0°C to
32.4°C, what is the specific heat capacity of the metal? (show your work)

Answers

Explanation:

here is the answer to your question babe

If 238 J of heat is absorbed by a sample of metal with a mass of 40.7 g, and it raises the temperature

The specific heat capacity of the metal is 0.471 J/g°C .

How do we calculate specific heat?

Specific heat of the metal will be calculated by using the below equation:

Q = mcΔT

Or c = Q/mΔT, where

m = mass = 40.7gQ = absorbed heat = 238JΔT = change in temperature = 32.4 - 20 = 12.4°C

On putting all these values, we get

c = 238 / (40.7)(12.4) = 0.471 J/g°C

Hence value of specific heat capacity of metal is 0.471 J/g°C.

To know more about specific heat, visit the below link:
https://brainly.com/question/22947190

#SPJ2

g Which of the following is TRUE for a system that is in dynamic equilibrium? Which of the following is TRUE for a system that is in dynamic equilibrium? The concentration of products is equal to the concentration of the reactants. The forward reaction goes to 100% completion. Both the forward and reverse reactions come to a halt. The reaction rate of the forward reaction approaches zero. none of the above

Answers

Answer:

none of the above

Explanation:

A system is said to have attained dynamic equilibrium when the forward and reverse reactions proceed at the same rate. That is;

Rate of forward reaction = Rate of reverse reaction

The implication of this is that the concentrations of reactants and products remain constant when dynamic equilibrium is attained in a system. This does not mean that the reactant and product concentrations become equal; it rather means that their concentrations do not significantly change once dynamic equilibrium has been attained.

What volume of CO2(g), measured at STP is produced if 15.2 grams of CaCO(s) is heated?

Answers

Answer:

Volume = 3.4 L

Explanation:

In order to calculate the volume of CO₂ produced when 15.2 g of CaCO₃ is heated, we need to first write out the balanced equation of the thermal decomposition of CaCO₃:

CaCO₃ (s) + [Heat] ⇒ CaO (s) + CO₂ (g)

Now, let's calculate the number of moles in 15.2 g CaCO₃:

mole no. = massmolar mass

                 = 15.240.1+12+(16×3)

                 = 0.1518 moles

From the balanced equation above, we can see that the stoichiometric molar ratios of CaCO₃ and CO₂ are equal. Therefore, the number of moles of CO₂ produced is also 0.1518 moles.

Hence, from the formula for the number of moles of a gas, we can calculate the volume of  CO₂:

mole no. = Volume in L22.4

0.1518=Volume22.4

⇒ Volume = 0.1518 × 22.4

                 = 3.4 L

Therefore, if 15.2 g of CaCO₃ is heated, 3.4 L of CO₂ is produced at STP.

Need help with this chemistry lab ASAP!

Need help with this chemistry lab ASAP!

Answers

the answer is baking soda. in order to figure out which substance will neutralize the acid you can complete a simple experiment, by combining different mixtures of these items
vinegar and lime juice
lime juice and baking soda
vinegar and baking soda
when combining the vinegar and lime juice, nothing will happen as they are both acidic with a similar ph (between 2-3)
however when you combine either one of these liquids with baking soda, you will find that first you will experience foaming and the creation of lots of bubbles, however once it stops the liquid you are left with is essentially water and will have a relatively neutral ph as baking soda is a base (ph of 9) so once mixed with an acid it neutralizes to a ph of about 7 which is considered neutral.

Baking soda can be used to cure acidity as it a base and has a pH value of around 8-9.

What is a base?

According to the Arrhenius concept, base is defined as a substance which yields hydroxyl ions on dissociation.These ions react with the hydrogen ions of acids to produce salt in an acid-base reaction.

Bases have a pH higher than seven as they yield hydroxyl ions on dissociation.They are soapy in touch and have a bitter taste.According to the Lowry-Bronsted concept, base is defined as a substance which accepts protons .Base react violently with acids to produce salts .Aqueous solutions of bases can be used to conduct electricity .They can also be used as indicators in acid-base titrations.

They are used in the manufacture of soaps,paper, bleaching powder.Calcium hydroxide ,a base is used to clean sulfur dioxide gas while magnesium hydroxide can be used as an antacid to cure acidity.

Learn more about base,here:

https://brainly.com/question/12445440

#SPJ7

What is the heat of a reaction, in joules, with a total reaction mixture volume of 61.2 mL if the reaction causes a temperature change of 4.6 oC in a calorimeter

Answers

Answer:

1178J is the heat of the reaction

Explanation:

Assume that the reaction mixture has a density of 1.00 g/mL and a specific heat of 4.184 J/g-oC. The calorimeter has a heat capacity of 10.0 J/oC

The heat of a reaction follows the equation:

Q = m*S*ΔT

Where Q is the heat of the reaction,

m is the mass:

61.2mL * (1.00g/mL) = 61.2g

S is specific heat = 4.184J/g°C

ΔT = 4.6°C

Replacing:

Q = 61.2g*4.184J/g°C*4.6°C

Q = 1178J is the heat of the reaction


Engineers must consider how removing or adding thermal energy changes the energy in materials on the molecular level. Describe how the different
weather conditions would affect the concrete in the roads and what the construction teams might need to consider when choosing materials for each
road.

Engineers must consider how removing or adding thermal energy changes the energy in materials on the

Answers

The thermal energy will affect the temperature of road and increase the temperature which causes cracks on the roads after some times. Thus the construction team must use temperature resistant material.  

What is thermal energy?

Thermal energy is defined as internal energy present in a thermodynamically balanced system as a result of its temperature.

It can also be defined as the energy derived from matter's temperature.

There are three types of thermal energy transfer.

ConductionRadiationConvection

Thus, the  thermal energy will affect the temperature of road and increase the temperature which causes cracks on the roads after some times. Thus the construction team must use temperature resistant material.  

To learn more about thermal energy, refer to the link below:

https://brainly.com/question/11278589

#SPJ1