Given that 198 = 2 x 3² x 11 and 90 = 2 x 3² x 5,

a) find the smallest integer, k, such that 198k is a perfect square

b) the largest integer that is a factor of both 198 and 90

(pls show working ty :) )

Answers

Answer 1

9514 1404 393

Answer:

  a) 22

  b) 18

Step-by-step explanation:

a) In order for 198k to be a perfect square, all of its integer factors must be squares. 3² is already a factor. To make the other factors be squares, need to multiply by 2 and 11. That is, k = 2×11 = 22. Then we will have ...

  198k = 2×3²×11 × (2×11) = 2²×3²×11² = (2×3×11)²

  k = 22

__

b) The factors that are different in the two numbers are 11 and 5. The factors that are the same are 2×3² = 18.

  18 is the greatest common factor of 198 and 90

_____

The "work" is looking at the numbers in the factor lists and comparing those to what is needed to answer the question.


Related Questions

The ACT and SAT are tests taken by high schoolers as they prepare to apply for college. In 2021 the ACT had a mean of 20.3 and a standard deviation of 6.0 while the SAT had a mean of 1060 and a standard deviation of 217. Makenzie has taken both tests. She scored a 23 on the ACT and 1150 on the SAT. Which test is the relative highest score? Why?
A. There is not enough information to tell. B. She scored relatively higher on the SAT because her z-score is higher.
C. They are relatively the same since they are both above the mean.
D. She scored relatively better on the ACT because her z-score is higher.​

Answers

The test with the relative highest score is given by: D. She scored relatively better on the ACT because her z-score is higher.​

How to determine which test is the relative highest score?

In order to determine the test that has the relative highest score, we would determine the z-score for the two tests that Mackenzie took.

Mathematically, the z-score of a given sample score can be calculated by using this formula:

Z-score = (x - μ)/σ

Where:

σ represents the standard deviation.x represents the sample score.μ represents the mean score.

For the ACT test, we have:

Z-score = (23 - 20.3)/6.0

Z-score = 2.7/6.0

Z-score = 0.45.

For the SAT test, we have:

Z-score = (1150 - 1060)/217

Z-score = 90/217

Z-score = 0.42.

Therefore, Mackenzie had the relative highest score in ACT test because it has a higher z-score than the SAT test.

Read more on z-scores here: brainly.com/question/26714379

#SPJ1

Show that (n + 3)7 ∈ Θ(n7) for
non-negative integer n.
Proof:

Answers

To show that `(n + 3)7 ∈ Θ(n7)`, we need to prove that `(n + 3)7 = Θ(n7)`.This can be done by showing that `(n + 3)7 = O(n7)` and `(n + 3)7 = Ω(n7)` .Now, let's prove the two parts separately:

Proof for `(n + 3)7 = O(n7)`.

We want to prove that there exists a positive constant c and a non-negative constant k such that `(n + 3)7 ≤ cn7` for all `n ≥ k`.Using the Binomial theorem, we can expand `(n + 3)7` as:```
(n + 3)7
= n7 + 7n6(3) + 21n5(3)2 + 35n4(3)3 + 35n3(3)4 + 21n2(3)5 + 7n(3)6 + 37
≤ n7 + 21n6(3) + 21n5(3)2 + 35n4(3)3 + 35n3(3)4 + 21n2(3)5 + 7n(3)6 + n7
≤ 2n7 + 21n6(3) + 21n5(3)2 + 35n4(3)3 + 35n3(3)4 + 21n2(3)5 + 7n(3)6
≤ 2n7 + 84n6 + 441n5 + 2205n4 + 10395n3 + 45045n2 + 153609n + 729
```Thus, we can take `c = 153610` and `k = 1` to satisfy the definition of big-Oh notation. Hence, `(n + 3)7 = O(n7)`.Proof for `(n + 3)7 = Ω(n7)`We want to prove that there exists a positive constant c and a non-negative constant k such that `(n + 3)7 ≥ cn7` for all `n ≥ k`.Using the Binomial theorem, we can expand `(n + 3)7` as:```
(n + 3)7
= n7 + 7n6(3) + 21n5(3)2 + 35n4(3)3 + 35n3(3)4 + 21n2(3)5 + 7n(3)6 + 37
≥ n7
```Thus, we can take `c = 1` and `k = 1` to satisfy the definition of big-Omega notation. Hence, `(n + 3)7 = Ω(n7)`.

As we have proved that `(n + 3)7 = O(n7)` and `(n + 3)7 = Ω(n7)`, therefore `(n + 3)7 = Θ(n7)`.Thus, we have shown that `(n + 3)7 ∈ Θ(n7)`.From the proof, we can see that we used the Binomial theorem to expand `(n + 3)7` and used algebraic manipulation to bound it from above and below with suitable constants. This technique can be used to prove the time complexity of various algorithms, where we have to find the tightest possible upper and lower bounds on the number of operations performed by the algorithm.

Hence, we have shown that `(n + 3)7 ∈ Θ(n7)` for non-negative integer n.

To know more about Binomial theorem :

brainly.com/question/30095070

#SPJ11

A fish swims at a speed of 12 miles per hour a boy swims at a speed of 4.44 feet per second. How much faster does the fish swim than the boy in yards per minute?
3ft = 1yd
5280= 1 mile

Answers

Answer:

I don't know it

Step-by-step explanation:

try with an textbook you have

15.30 find the inverse laplace transform of: 1. (a) f1(s) = 6s 2 8s 3 s(s 2 2s 5) 2. (b) f2(s) = s 2 5s 6 (s 1) 2 (s 4) 3. (c) f3(s) = 10 (s 1)(s 2 4s 8)

Answers

The solution of the inverse Laplace transforms is mathematically given as

f1(t)=etsin(2t)f2(t)=79et+23et+29e4tf3(t)=2et2e2tcos(2t)e2tsin(2t)

What is  the inverse Laplace transform?

1)

Generally, the equation for the function is  mathematically given as

$F1(s)=6s2+8s+3s(s2+2s+5)$

By Applying the Partial fractions method

6s2+8s+3s(s2+2s+5)=As+Bs+Cs2+2s+5

$6s2+8s+3=A(s2+2s+5)+(Bs+C)s$

3=5AA=35

Considers s^2 coefficient

6=A+BB=6AB=275

Consider s coeffici ent

8=2A+CC=82AC=345

Putting these values into the previous equation

Misplaced &

By taking Inverse Laplace Transforms

f1(t)=35+275etcos(2t)+710

f1(t)=etsin(2t)

For B

$F2(s)=s2+5s+6(s+4)(s+1)2$

By Applying Partial fractions method

s2+5s+6(s+4)(s+1)2=As+1+B(s+1)2+Cs+4s2+5s+6=A(s+1)(s+4)+B(s+4)+C(s+1)2

at s=-1

15+6=3BB=23

at s=-4

Misplaced &

at s^2 coefficient

1=A+C

A=1-C

A=7/9

inputting Variables into the Previous Equation

F2(s)=As+1+B(s+1)2+Cs+4F2(s)=79(s+1)+23(s+1)2+29(s+4)

By taking Inverse Laplace Transforms

f2(t)=79et+23et+29e4t

For C

$F3(s)=10(s+1)(s2+4s+8)$

Using the strategy of Partial Fractions

10(s+1)(s2+4s+8)=As+1+Bs+Cs2+4s+8

10=A(s2+4s+8)+(Bs+C)(s+1)

S=-1

10=(1-4+8) A

A=10/5

A=2

Consider constants

10=8 A+C

C=10-8 A

C=10-16

C=-6

Considers s^2 coefficient

0=A+B

B=-A

B=-2

inputting Variables into the Previous Equation

Misplaced &

Inverse Laplace Transforms

f3(t)=2et2e2tcos(2t)e2tsin(2t)

Read more about Laplace Transforms

https://brainly.com/question/14487937

#SPJ4

It has long been thought that the length of one's femur is positively correlated to the length of one's tibia. The following are data for a classroom of students who measured each (approximately) in inches. Femur Length Tibia Length 18.7 14.2 20.5 15.9 16.2 13.1 15.0 12.4 19.0 16.2 21.3 15.8 21.0 16.2 14.3 12.1 15.8 13.0 18.8 14.3 18.7 13.8 Regression Statistics Multiple R 0.9305 R Square 0.8659 Adjusted R Square 0.8510 Standard Error 0.5963 Observations ANOVA SS MS F Significance F Regression 1 20.6611 20.6611 58.0968 3.25116E-05 Residual 9 3.2007 0.3556 Total 10 23.8618 Coefficients Standard Error t Stat P-value Lower 95% Upper 95% Intercept 3.5850 1.4137 2.5359 0.0319 0.3871 6.7830 Femur Length 0.5899 0.0774 7.6221 0.0000 0.4148 0.7650 A strong linear correlation was found between the two variables. Find the standard error of estimate. Round answer to 4 decimal places.

Answers

The linear correlation between the given two variables be,

4.5y + 5.2x = 168.34

Given, data for a classroom of students who measured each (approximately) in inches.

Femur Length 18.7 14.2 20.5 15.9 16.2 13.1 15.0 12.4 19.0 16.2 21.3

Tibia Length  15.8 21.0 16.2 14.3 12.1 15.8 13.0 18.8 14.3 18.7 13.8

we have to find a linear correlation between the two variables,

linear correlation be,

(y - 15.8)/(x - 18.7) = (15.8 - 21.0)/(18.7 - 14.2)

(y - 15.8)/(x - 18.7) = (- 5.2)/4.5

4.5y - 71.1 = -5.2x + 97.24

4.5y + 5.2x = 168.34

So, the linear correlation between the given two variables be,

4.5y + 5.2x = 168.34

Hence, the linear correlation between the given two variables be,

4.5y + 5.2x = 168.34

Learn more about Statistics here https://brainly.com/question/27165606

#SPJ4

what is the prime number of 65

Answers

Answer:

Factors of 65: 1, 5, 13, and 65.

Prime Factorization of 65: 65 = 5 × 13.

Step-by-step explanation:

hope this helps!

Answer:

1, 5, 13, and 65.

Step-by-step explanation:

What is the product?
5
-2
Х
-6 2

What is the product?5-2-6 2

Answers

-the answer is -3

4

.....

There were 200 members at a skating club. Membership dropped by 30%. How many members are there now?

Answers

Answer:

140 members

Step-by-step explanation:

find 70% of 200

John walks away from his house down a straight street. The graph shows John's distance from his house over time. Describe his trip. Find John's speed on each section of the walk.
(lol please help, I don't know how to format this-)

Answers

Based on the graph (see attachment), John's speed on each section of the walk are as follows:

At the first interval, John's speed is equal to 4 km/h.At the second interval, John's speed is equal to 0 km/h.At the third interval, John's speed is equal to 1.5 km/h.

What is speed?

Speed can be defined as the distance covered by a physical object per unit of time. This ultimately implies that, speed can be measured as meter per seconds.

What is distance?

Distance can be defined as the amount of ground covered (travelled) by a physical object over a specific period of time and speed, regardless of its direction, starting point or ending point.

How to calculate the speed?

Mathematically, speed can be calculated by using this formula;

Speed = distance/time

Based on the graph (see attachment), John's speed on each section of the walk can be calculated as follows.

For the first interval, we have:

Speed = 6/1.5

Speed = 4 km/h.

For the first interval, we have:

Speed = 6/1.5

Speed = 4 km/h.

For the second interval, we have:

Speed = 6/0

Speed = 0 km/h.

For the third interval, we have:

Speed = 6/4

Speed = 1.5 km/h.

Read more on speed and distance here: https://brainly.com/question/17345820

#SPJ1

John walks away from his house down a straight street. The graph shows John's distance from his house

The value of x varies directly with y, and why x = 14, y = 21. Write an equation to represent the direct variation.

Answers

Answer:

y=1.5x ;

Step-by-step explanation:

Suppose the equation y is equal to kx;

When x is 14, y is 21;

So 14K =21, k=1.5;

The equation y is equal to 1.5x

Calculate the difference in the proportion of males and the proportion of females that smoke. Give your answer to 2 decimal places

Answers

The difference in the proportion of males and the proportion of females that smoke is 0.08

Missing information

In a sample of 61 males, 15 smoke, while in a sample of 48 females, 8 smoke.

How to determine the proportion difference?

The given parameters are:

                             Male           Female

Sample                  61                  48

Smokers               15                   8

The proportion is calculated using:

p = Smoker/Sample

So, we have:

Male = 15/61 = 0.25

Female = 8/48 = 0.17

The difference is then calculated as:

Difference = 0.25 - 0.17

Evaluate

Difference = 0.08

Hence, the difference in the proportion of males and the proportion of females that smoke is 0.08

Read more about proportion at:

https://brainly.com/question/16828793

#SPJ12

(Theoretical Probability MC)

Joseph has a bag filled with 3 red, 3 green, 9 yellow, and 10 purple marbles. Determine P(not green) when choosing one marble from the bag.

92%
88%
24%
12%

Answers

The probability of not selecting a green marble is equal to the total number of non-green marbles in the bag divided by the total number of marbles in the bag.

What is the meaning of probability  and it will be calculated?

To calculate the probability: there are three green marbles out of a total of twenty-five marbles, so the probability of selecting a green marble is 3/25.

The likelihood of not selecting a green marble is then 1 - 3/25 = 22/25.

This is equal to 22/25 * 100 = 88% as a percentage.

As a result, P(not green) = 88%

Probability denotes the possibility of something happening. It is a mathematical branch that deals with the onset of a random event. The value ranges from zero to one. Probability has been tried to introduce in mathematics to predict the probability of events occurring. Probability is defined as the degree to which something is likely to occur. This is the fundamental probability theory, which is also used in probability distribution, in which you will learn about the possible outcomes of a random experiment.

To know more about random event visit :-

https://brainly.com/question/15186748

#SPJ1


Divide these fractions
2/3 = 3/4

Answers

Answer:

8/9

Step-by-step explanation:

I'm pretty sure after you make it a reciprocal you multiply it

Solve the following system of equations using substitution (Enter your answer as an ordered pair, including the parentheses and comma.)
-3x+6y=12
2y=x+4

Answers

The system of equations has infinite solutions, both equations represent the same line.

How to solve the system of equations?

Here we have the following system of equations:

-3x+6y=12

2y=x+4

And we want to solve this by substitution, first, we can rewrite the first equation as:

-3x + 3*(2y) = 12

Now we can substitute the second equation 2y = x + 4 in the parenthesis, we will get:

-3x + 3*(x + 4) = 12

Now we can solve this for x.

-3x + 3x + 12 = 12

12 = 12

So this is true for any value of x, which means that both equations represent the same line (thus the system has infinite solutions).

Learn more about systems of equations:

https://brainly.com/question/13729904

#SPJ1

if a=3 then what does 5(a+5) equal show all steps

Answers

Answer:

40

Step-by-step explanation:

5(a+5)

Let a =3

5(3+5)

Parentheses first

5(8)

Multiply

40

Answer:

40

Step-by-step explanation:

5(a+5)

5(3+5)

5(8)

40

On Saturday, a local hamburger shop sold a combined total of hamburgers and cheeseburgers. The number of cheeseburgers sold was two times the number of hamburgers sold. How many hamburgers were sold on Saturday

Answers

The given information indicates that the number of cheeseburgers sold was twice the number of hamburgers sold.

Let the number of hamburgers sold on Saturday be x

Therefore, the number of cheeseburgers sold = 2x

Total number of hamburgers and cheeseburgers sold = x + 2x = 3x

As per the question: "On Saturday, a local hamburger shop sold a combined total of hamburgers and cheeseburgers. The number of cheeseburgers sold was two times the number of hamburgers sold."

Hence, the equation formed is: 2x + x = 3x

Therefore, hamburgers sold on Saturday = x = 1x

Hence, the local hamburger shop sold x hamburgers on Saturday. Therefore,  the number of hamburgers sold on Saturday is x which is equivalent to 1x or x/1.

Therefore the given information indicates that the number of cheeseburgers sold was twice the number of hamburgers sold.

learn more about equivalence here:

https://brainly.com/question/25197597

#SPJ11

The equation of the line that goes through the point (−10,8) and (−3,-4) can be written in the form y=mx+b

where m is:
and where b is:

Answers

Answer:

m is -12/7 and b is -64/7

Step-by-step explanation:

Use rise over run (change in y / change in x) to find the slope, m:

(-4 - 8) / (-3 + 10)

= -12/7

So, m is -12/7.

Plug in this value and a point into y = mx + b, then solve for b:

y = mx + b

-4 = -12/7(-3) + b

-4 = 36/7 + b

-64/7 = b

So, m is -12/7 and b is -64/7

The linear function is given by:

y=127x647

Where:

m is 127.b is 647.

What is a linear function?

A linear function is modeled by:

y=mx+b

In which:

m is the slope, which is the rate of change, that is, by how much y changes when x changes by 1.b is the y-intercept, which is the value of y when x = 0.

In this problem, the points are (−10,8) and (−3,-4).

The slope is given by change in y divided by change in x, hence:

m=483(10)=127

Hence:

y=127x+b

It goes through point (−3,-4), hence when x=3,y=4, which is used to find b.

y=127x+b

4=367+b

b=647

Hence, the equation is:

y=127x647

You can learn more about linear functions at https://brainly.com/question/24808124

-67/50+1.5+100% enter the answer as an exact decimal or simplified fraction

Answers

Answer:

the expression -67/50 + 1.5 + 100% is equal to 29/25 as a simplified fraction.

Step-by-step explanation:

PLEASE HELP
Chipotle Burritos are normal distributed with a mean length of 200mm and a standard deviation of 8mm. What is the probability that a burito picked at random is shorter than 190mm?

Answers

Answer: 0.1056

Step-by-step explanation:

Given: Chipotle Burritos are normal distributed with

Mean =  200 mm

Standard deviation = 8 mm

Let x be the length of a random burrito.

The probability that a burrito picked at random is shorter than 190mm will be :

P(x<190)=P(xμσ<1902008)=P(z<1.25)   [z=xμσ]=1P(z<1.25)=10.8944=0.1056

Hence, the probability that a burrito picked at random is shorter than 190mm is 0.1056.

If there are 42 boys and 54 girls in a room, fill out all of the possible ratios of boys to girls that could be made.

Answers

Answer:

42:54,54:42

Step-by-step explanation:

Unit 3: Functions& Linear Equations Homework 1: Relations & Functions Name: Date: Bell: This is a 2-page document! Find the domain and range, then represent as a table, mapping, and graph. Domain Range 2. {(-3,-4), (-1, 2), (0,0), (-3, 5), (2, 4» Domain Range - Determine the domain and range of the following continuous graphs 3. 4. Domain = Range = 5. Domain Range 6. Domain - Domain - Range - Range = Gina Wlson (AlI Things Aigebral 2

Answers

The domain and range are the set of x and values of the function are in the table.

the function as a table,

Input (x) | Output (y)

-3         |        -4

-1          |         2

0         |         0

-3         |         5

2         |         4

What is the domain and range?

The domain and range are fundamental concepts in mathematics that are used to describe the input and output values of a function or relation.

The domain of a function refers to the set of all possible input values, or x-values, for which the function is defined.

The range of a function refers to the set of all possible output values, or y-values.

To find the domain and range of functions and represent them in different formats.

To find the domain and range of a function:

The domain refers to the set of all possible input values (x-values) for the function.

The range refers to the set of all possible output values (y-values) for the function.

To represent the function as a table, you would list the input-output pairs. For example:

Input (x) | Output (y)

-3         |        -4

-1          |         2

0         |         0

-3         |         5

2         |         4

To represent the function as a mapping, you would indicate the correspondence between the input and output values.

For example:

-3     ->   -4

-1     ->     2

0     ->     0

-3    ->     5

2     ->     4

To represent the function as a graph, The x-values would be on the horizontal axis, and the y-values would be on the vertical axis.

The points (-3, -4), (-1, 2), (0, 0), (-3, 5), and (2, 4) would be plotted accordingly.

Hence, The domain and range are the set of x and values of the function are in the table.

the function as a table,

Input (x) | Output (y)

-3         |        -4

-1          |         2

0         |         0

-3         |         5

2         |         4

To learn more about the domain and range visit:

https://brainly.com/question/26098895

#SPJ4

Unit 3: Functions&amp; Linear Equations Homework 1: Relations &amp; Functions Name: Date: Bell: This

Does anyone know this

Does anyone know this

Answers

Answer:

AB-DE

Step-by-step explanation:

hi I m from India nice to meet you bro

Simplify: 3(2x+7)-2(x+5)

Answers

Answer:

4x + 11

Step-by-step explanation:

3(2x + 7) - 2(x+5)

*use distributive property to multiply what's in the parentheses by what's outside of the parentheses*

6x + 21 - 2x - 10

*combine like terms*

6x + 11 -2x

4x + 11

6x+21 -2x+10
4x 31
7.75=x

y = 2x + 1 its line intercept slope please answer quickly im in class rnnn

Answers

Answer:

5

Step-by-step explanation:

Find the prime factorization of each number. 8. −82 9. 38 10. 208 11. 11 12. 60 13. −78 14. 20 15. 124 PLS SHOW UR WORK & ANSWER THE QUESTIONS :3

Answers

Answer:

8. Can't do prime factorization for -82 since it's a negative number

9.          38

           /    \

         19 × 2

10.         208

          /  |   |  |   \

         2×2×2×2×13

11. 11 is a prime number therefore you can't break it down further

12.        60

          /   |   | \

         2×2×3×5

13. Can't do prime factorization for -78 since it's a negative number

14.               20

                /   |  \

               2×2×5

15.            124

               /  |  \

             2×2×31

There are n lines that are not parallel with each other on a plane. There are no 3 lines intersecting at a point. If they intersect 171 times, find n.

Answers

To find the value of n, the number of lines that are not parallel and intersect 171 times on a plane, we can use the formula for the total number of intersections among n lines,

Let's assume that there are n lines on the plane that are not parallel and no three lines intersect at a point. The total number of intersections among these lines can be calculated using the formula (n * (n - 1)) / 2. This formula counts the number of intersections between each pair of lines without considering repetitions or the order of intersections.

We are given that the total number of intersections is 171. Therefore, we can set up the equation:

(n * (n - 1)) / 2 = 171

To find the value of n, we can multiply both sides of the equation by 2 and rearrange it:

n * (n - 1) = 342

Expanding the equation further:

n² - n - 342 = 0

Now we have a quadratic equation. We can solve it by factoring, using the quadratic formula, or by completing the square. By factoring or using the quadratic formula, we can find the two possible values for n that satisfy the equation.

After finding the solutions for n, we need to check if the values make sense in the context of the problem. Since n represents the number of lines, it should be a positive integer. Therefore, we select the positive integer solution that satisfies the conditions of the problem.

Learn more about  intersections here:

https://brainly.com/question/12089275

#SPJ11

pls help asap if you can!

pls help asap if you can!

Answers

The value of X from the similar triangles above would be = 4. That is option B.

How to determine the value of missing part of the similar triangles?

To determine the value of X from the missing part of the similar triangles, the formula that should be used is given below as follows:

VR/VU = VQ/VT

Where;

VR = 33

VU = 44

VQ = 8x-2

VT = 40

That is;

33/44 = 8x-2/40

33×40 = 44(8x-2);

1320 = 352x-88

1320+88 = 352x

1408 = 352x

X = 1408/352

= 4.

Learn more about triangle here:

https://brainly.com/question/28470545

#SPJ1

Please help !!! I forgot what a reciprocal is and I have so much other work to do!

Please help !!! I forgot what a reciprocal is and I have so much other work to do!

Answers

Answer:

reciprocal is when u flip it

Step-by-step explanation:

reciprocal=reflipical

Answer:

A reciprocal is when you flip something, the opposite of it.

Step-by-step explanation:

For example, the reciprocal of 1/2 is 2/1 because you just need to flip it.

Another example, the reciprocal of 5/8 is 8/5 because you just need to flip it.

Finally, the reciprocal of 3/4 is 4/3 because you need to flip it.

Hope this helped!! :)

Brainliest?!?!

Stay safe and have a wonderful day/night/afternoon!!!

F1.8
19.
Sam has a cylindrical fish tank with
an open top. The tank has height
30cm and radius 20cm. What is the
total surface area of the tank?

Answers

Answer:

area of cylinder =2πrh+2πrsqr

=2×22/7×20×30+2×22/7×20×20

=26400/7+17600/7

=44000/7

=6285.714cm

Answer:

5024 cm²

Step-by-step explanation:

Total surface area includes one base only as it is open top

S = πr² + 2πrhS = 3.14*20² + 2*3.14*20*30 = 5024 cm²

can you solve this in 3 min?

can you solve this in 3 min?

Answers

The dot plot of the data values is added as an attachment

How to create the dot plot

From the question, we have the following parameters that can be used in our computation:

85,88,75,100,90,90,88,72,72,79,88,85

Next, we create a frequency table

So, we have

Values   Frequency

72             2

75             1

79             1

85            2

88            3

90           2

100          1

Total      12

Using the frequency table above, we create the dot plot

See attachment for the dot plot

Read more about dot plot

https://brainly.com/question/30117279

#SPJ1

can you solve this in 3 min?
Other Questions
The equation for a projectile's height versus time is h(t)=-16t^2+Vt+h. A tennis ball machine serves a ball vertically into the air from a height of 2 feet, with an initial speed of 110 feet per second. Which equation correctly models the balls height as a function of time? Determine whether the relation is a function. Explain. {(2,9), (4.9), (-7, 9), (0.9), (5,9), (3,9), (-3,9)} match each network type on the left with the appropriate description on the right. each network type may be used once, more than once, or not at all. A scientist finds a fossil that she thinks might make a good index fossil.Which characteristic does this fossil most likely have?It is the remains of an organism still found alive today.O It is the remains of an organism that is found in abundance nearby.O It is the only fossil for this type of organism that has ever been found.O It is the remains of an organism that lived in a narrow geographic area. when did the mughal empire expand the least based on the law of conservation of energy, which of the following describes the transformation of energy in a diesel engine? a) chemical energy to electrical potential b) electrical potential to kinetic energy and heat c) chemical energy to potential energy d) chemical energy to kinetic energy and heat e) gravitational potential to electrical potential What is slope? Describe it and provide an real life example. Find the exact value of the eighth term of the geometric sequence: 648, 216, 72, 24, 2. Completa POLICIAL DE ENIGMA o POLICIAL NEGRO segn corresponda: a. El detective es honrado con razonamiento deductivo b. El detective trabaja por dinero, no duda en ensuciarse las manos...c. El detective no tiene ayudanted. El detective cuenta con un ayudante, quien es el narradore. Es una crtica al contexto de crisis y la inseguridad what changes take place when people go through an experience stripping, delousing, and shaving the heads of prisoners The sculptural program of the west facade of Chartres Cathedral proclaims the power and majesty of Jesus Christ.Which of the following elements unites all three doorways of the west portal of Chartres Cathedral? A) The episodes from the life of the Virgin are carved on the capitals. B) The episodes from the Old Testament are carved on the capitals. C) The episodes from the Passion are carved on the capitals. D) The episodes from the lives of the Virgin and Christ are carved on the capitals. A population of animals in a specific environment with a K of 2500 has an rmax of 1.0 per individual per year and exhibits logistic growth as follows: dN/dt=rmaxN(KN)/K Arrange the following population sizes in order of decreasing growth. The object represented by this graph is movingaway from the origin at a constant velocity.away from the origin at a decreasing velocity.toward the origin at a constant velocity.toward the origin at a decreasing velocity. Classify automobiles depending on criteria, parameter and characteristics Confucius' writings were handed down orally for several generations before being compiled in written form as I'm on my last question on a graded practice and I don't want to get a wrong. I have already graphed it. In the morning, the temperature was 15F. During the day, the temperature decreased 39F. Which expression can be used to find the temperature at the end of the day?Responses Find the equation of the line parallel to the graph of -4x+3y=1 that contains the point (3,-2) A physics student stands on a cliff overlooking a lake and decides to throw a tennis ball to her friends in the water below. She throws the tennis ball with a velocity of 19.5 m/s at an angle of 36.5 above the horizontal. When the tennis ball leaves her hand, it is 15.5 m above the water. How far does the tennis ball travel horizontally before it hits the water? Neglect any effects of air resistance when calculating the answer. How many protons and how many neutrons are in (a) 3He, (b) 20Ne, (c) 60Co?Part AZHe =Part BNHe =Part CZNe =