Give the charge of the stable ion formed by each of the following. Include the sign (+ or -) and magnitude (numerical value) of the charge in every case. (Note: Give only the charge, not the formula of the ion.)
1. A group 2A metal
2. A group 3A metal
Answers
The charges on the ions are;
1. A group 2A metal - 2+
2. A group 3A metal - 3+
What is a charge?A charge could be positive or negative. We know that a positive charge is formed when there is an excess of protons compared to electrons in a specie. On the other hands, a negative ion is one in which there are more electrons than protons.
Now we know that metals mostly form positive ions. The magnitude of the charge on the ions depends on the group in the periodic table to which the metal belongs.
The charges on the ions are;
1. A group 2A metal - 2+
2. A group 3A metal - 3+
Learn more about metal ions:https://brainly.com/question/269828
#SPJ1
Related Questions
Ex: A tablet weighing 0.940 g was dissolved in dilute sulphuric acid made up to 250 cm³ with water. 25.0 cm³ of this solution was titrated with 0.00160 moldm⁻³ K₂Cr₂O₇ requiring 32.5 cm³ of the K₂Cr₂O₇.
Calculate the percentage by mass of Fe²⁺ in the tablet?
Answers
The percentage by mass of Fe²⁺ in the tablet is 3.4%
The question is asking to calculate the percentage by mass of Fe²⁺ in the tablet. To solve this question, use the following formula:
mass of Fe²⁺ = (volume of titrant x molarity of titrant x valency of titrant) ÷ (volume of solution x 1000)
We are given the following information:
Tablet weight = 0.940 gVolume of solution = 250 cm³Volume of titrant = 32.5 cm³Molarity of titrant = 0.00160 moldm⁻³Valency of titrant = 6+Using the formula above, we can calculate the mass of Fe²⁺ as follows:
mass of Fe²⁺ = (32.5 cm³ x 0.00160 moldm⁻³ x 6+) ÷ (250 cm³ x 1000)
mass of Fe²⁺ = 0.0320 g
To calculate the percentage by mass of Fe²⁺ in the tablet, divide the mass of Fe²⁺ (0.0320 g) by the tablet weight (0.940 g) and multiply by 100:
Percentage by mass of Fe²⁺ = (0.0320 g ÷ 0.940 g) x 100
Percentage by mass of Fe²⁺ = 3.4%
Therefore, the percentage by mass of Fe²⁺ in the tablet is 3.4%.
To know more about percentage by mass click on below link:
https://brainly.com/question/16885872#
#SPJ11
What is the product of the reaction of 1-propanol with phenyl isocyanate, C6H5N=C=O?
Answers
The balanced equation for this reaction is:
CH3CH2CH2OH + C6H5N=C=O → CH3CH2CH2OC(=O)N(C6H5)CH3 + H2O
The reaction of 1-propanol (CH3CH2CH2OH) with phenyl isocyanate (C6H5N=C=O) leads to the formation of a urethane compound. The reaction's balanced equation is as follows:CH3CH2CH2OH + C6H5N=C=O → CH3CH2CH2OC(=O)N(C6H5)CH3 + H2O
In this process, the condensation reaction between the isocyanate group (-N=C=O) of phenyl isocyanate and the hydroxyl group (-OH) of 1-propanol results in the creation of a urethane molecule. A propanol group is connected to a phenyl group through an oxygen atom to produce CH3CH2CH2OC(=O)N(C6H5)CH3, the reaction's end product. The reaction also results in the production of water (H2O).Learn more about the condensation reaction:
brainly.com/question/6256866
#SPJ11
Which ions produce similar colors in the flame tests?
Answers
Answer:
Two ions that produced similar colors in the flame test were Ca+2 and Sr+2. 3.
Explanation:
The colors are produced when an electron jumps to a higher level and then jump back down.
Ba2+ and Cu2+ and Sr2+ and Li+ were the pair with the similar color. Sr and Li displayed red colors, while Ba and Cu had mild greenish yellowish hues.
Why do some ions in the flame test generate colors that are similar?
The precise sizes of the potential energy jumps differ from metal to metal. As a result, the flame color of each metal will differ due to its unique spectral line pattern. The movement of the electrons in the metal ions contained in the compounds results in the hues of the flame.
The energy released by each electron when it returns to its initial condition determines the hue of the light that is produced.
To learn more about ions in the flame refer to:
https://brainly.com/question/28715571
#SPJ2
Help meeeeee
A 280.0 sample of neon gas exerts a pressure of 660.0 mm Hg at 26.0°C. Assuming that the pressure remains constant, at what temperature in would the volume change to 440.0 ml?
Answers
Answer:
469.9K
Explanation:
Using Charles's law equation:
V1/T1 = V2/T2
Where;
V1 = initial volume (ml)
V2 = final volume (ml)
T1 = initial temperature (K)
T2 = final temperature (K)
Based on the information provided:
V1 = 280.0ml
V2 = 440.0 ml
T1 = 26.0°C = 26 + 273 = 299K
T2 = ?
Using V1/T1 = V2/T2
280/299 = 440/T2
0.936 = 440/T2
T2 = 440 ÷ 0.936
T2 = 469.9K
how does the total mass of each object increases the amount of force that is needed to get them moving at 5 m/s increase by about 200N demonstrate newtons 2nd law
Answers
Answer:
The answer is below
Explanation:
Newton's second law of motion states that the force applied to an object is directly proportional to the rate of change of momentum with respect to time, going in the same direction as the force.
Let F = force, m = mass of object, v = velocity of object, mv = momentum.
F = d/dt(mv) = m(dv / dt) = ma; a = acceleration.
Let us assume that the object starts from rest to 5 m/s within 1 seconds, hence:
F = m(dv / dt)
200 N = m[(5 m/s - 0 m/s) / (1 s)]
200 = 5m
m = 40 kg
A/An _______ indicates the ratio of atoms in a molecule.
Answers
Answer:
A molecular formula indicates the ratio of atoms in a molecule.
Explanation:
A molecular formula or chemical formula is a representation or indication of the number of atoms in a particular compound or molecule have in a specific specific proportion.
These are represented by the symbols of elements, numbers of atoms present and sometime other symbols. For example in water molecule there is one atom of oxygen and two hydrogen atoms.
Thus, the correct answer is : molecular formula
A sample contain 33.42g of metal pellets are poured on to a graduated cylinder initially containing 12.7ml of water, causing the water level to rise to 21.6ml. Calculate the density of the metal
Answers
Answer:
3. 76 g/ml^3
Explanation:
We are given the mass of the metal pellets which is 33.4 grams. To calculate the density of the metal, we need to divide the mass by the volume. The volume of the metal is not directly given so we need to find it ourselves. The water was initially 12.7 ml and then it rose to 21.6 ml after placing the metal pellets. This indicate that the volume of the metal pellets is 8.9 ml.
\(21.6 - 12.7 = 8.9\)
We can now use the density formula.
\(p = \frac{m}{v} \)
\(p = \frac{33.42}{8.9} \)
\(p = 3.76\)
The density of the metal is equal to 3.76 g/ml.
What is the density?The density of an object can be defined as the mass per unit volume. The average density is equal to the total mass of the object divided by the total volume of the object.
The mathematical formula for the density of the material is expressed as follows:
Density = Mass/Volume
The S.I. unit of the density is Kg/m³ and is an intrinsic property as it is independent of the size. If the size increases, the mass increases as well but the density of the material remains constant.
Given the mass of the metal, m = 33.42 g
Volume of the metal = Volume of water level with metal - volume of water
V = 21.6 -12.7 = 8.9 ml
The density of metal = 33.42/8.9 = 3.76 g/ml
Therefore, the density of the metal is 3.76 g/ml
Learn more about density, here:
brainly.com/question/15164682
#SPJ2
Which salt is produced when hydrobromic acid (HBr) is neutralized by sodium hydroxide
(NaOH)?
A) NaBr
B) BrOH
C) NaH
D) HNa
Answers
Answer:
NaOH
Explanation:
the balance equation is HBr +NaOH----> NaBr+ H2O. The salt formed is NaBr, sodium,Bromide
Why is soap mixed with water?
A. The soap becomes chemically active when mixed with water.
B. The soap turns the water molecules into a nonpolar solvent.
C. It covalently bonds to the water so it can be washed away.
D. Its polar end mixes with the water so it can be washed away.
Answers
The polar end of soap can be bonded with the polar end of water. Hence it can be mixed with water and can be washed away. Hence, option D is correct.
What is the action of soap in water?Soap is acting as a surfactant in water and oily surface of dirt. A lengthy chain of fatty acids is saltified with sodium or potassium to form a soap molecule. Soap is made up of two components: an ionic component and a long carbon chain.
The characteristics of the two molecules that make up soap are highly dissimilar. These two pieces are referred to as soap's hydrophobic tail dissolves in oils and is naturally water-repellent. It has an ionic makeup.
The second part hydrophilic head, or water-loving portion of the soap molecule, dissolves in water. It is composed of a very long hydrocarbon chain. Therefore, the hydrophilic head of soap molecule easily binds with water and can be washed away.
Find more on action of soaps:
https://brainly.com/question/27660538
#SPJ1
A sample of 0.53 of carbon dioxide was obtained by heating 1.31 grams of calcium carbonate. What is the percent yield for this reaction?
Answers
Step 1
The reaction:
CaCO3 + heat => CaO + CO2 (completed and balanced)
-----------------------
Step 2
Information provided:
Actual yield = 0.53
What is the inheritance of lactose intolerance?
Answers
Inheritance. Infant lactose intolerance is passed down in the autosomal recessive form, meaning that both copies of LCT gene present in every cell are mutated.
Is lactose intolerance heritable?In families, lactose intolerance is common (hereditary). In these circumstances, the body of the individual may produce less lactase over time. Teenage or adult years may be when symptoms first appear. After an accident, a sickness, or an infection, the small intestine may occasionally stop producing lactase.
What is Whether it is autosomal dominant or recessive, lactose intolerance?A recessive condition, lactose intolerance. A recessive condition can only manifest if both of the gene's copies, or alleles, are identical. People who are lactose intolerant and have cytosine (C) residues on both alleles near to the lactase locus do not make lactase as adults.
To know more about lactose intolerance visit:
https://brainly.com/question/13061505
#SPJ4
A population of a wild animal is a frequent target for hunters. Hunters tend to hunt the larger animals with big horns. How might this affect the populations in the wild?
A.
Animals with average horns will increase in number.
B.
Smaller animals with a trait for short horns will become endangered.
C.
Traits for larger animals with big horns will be selected.
D.
Traits for smaller animals with short horns will be selected.
Answers
Traits for larger animals with big horns will be selected.
For the reaction
CO(g) + 3H2(g)----->CH4(g) + H2O(g)
H°rxn = -206.1 kJ and S°rxn = -214.7 J/K
The standard free energy change for the reaction of 1.78 moles of CO(g) at 308 K, 1 atm would be kJ.
This reaction is (reactant,product) favored under standard conditions at 308 K.
Assume that H°rxn and S°rxn are independent of temperature.
Answers
The standard free energy change for the reaction of 1.78 moles of CO(g) at 308 K, 1 atm would be -36.9 kJ. This reaction is product-favored under standard conditions at 308 K.
To calculate the standard free energy change (ΔG°) for the reaction, we can use the equation:
ΔG° = ΔH° - TΔS°
Given that ΔH°rxn = -206.1 kJ and ΔS°rxn = -214.7 J/K, we need to convert the values to kJ and adjust the sign for ΔS°:
ΔH°rxn = -206.1 kJ
ΔS°rxn = -214.7 J/K = -0.2147 kJ/K
Now we can substitute these values into the equation:
ΔG° = -206.1 kJ - (308 K)(-0.2147 kJ/K)
= -206.1 kJ + 66.1736 kJ
= -139.9264 kJ
Since the question asks for the standard free energy change for 1.78 moles of CO(g), we need to calculate the moles of CO(g) in the reaction:
1 mole of CO(g) reacts to form 1 mole of CH₄(g)
1.78 moles of CO(g) will react to form 1.78 moles of CH₄(g)
Therefore, the standard free energy change for the reaction of 1.78 moles of CO(g) at 308 K, 1 atm is -139.9264 kJ.
Based on the negative value of ΔG°, the reaction is product-favored under standard conditions at 308 K.
To know more about standard free energy refer here:
https://brainly.com/question/32191515#
#SPJ11
MARKING BRAINLIEST!!!
image is attached
Answers
Answer:
2, s
Explanation:
The there will be two orbitals in the s subshell because the first orbital can only contain two electrons and there will be need of a second one
How many milliliters of a 9.0 h 2so 4 solution are needed to make 0.45 l of a 3.5 m solution?
Answers
To have 175ml is needed of a 9.0M \(H_{2} SO_{4}\) solution are needed to make 0.45 L of a 3.5 M (Morality).
How to calculate the molarity to make the solution?The Morality unit (M) is \($ \frac{\text { moles of solute }}{\text { liters of solution }}=\mathrm{mol} / \mathrm{L} $\)
The volume of a solution grows when it is diluted, while the solute concentration stays constant.
The following is the formula for dilution of a solution:
\(\mathrm{M}_1 \mathrm{~V}_1=\mathrm{M}_2 \mathrm{~V}_2\)
here \(\mathrm{M}_1 , \mathrm{M}_2\) represents morality and \(\mathrm{~V}_1 , \mathrm{~V}_2\) represents volume of solution in litres (L).
We are given the values: \(&\mathrm{M}_1=9.0 \mathrm{M}=9.0 \mathrm{~mol} / \mathrm{L} \\&\mathrm{M}_2=3.5 \mathrm{M}=3.5 \mathrm{~mol} / \mathrm{L} \\&\mathrm{V}_2=0.45 \mathrm{~L}\)
Now to calculate the volume of the solution i.e. \(\mathrm{V}_1=\frac{\mathrm{M}_2 \mathrm{~V}_2}{\mathrm{M}_1}\)
\($\mathrm{V}_1=\frac{3.5 \mathrm{M} \times 0.45 \mathrm{~L}}{9.0 \mathrm{M}}=0.175 \mathrm{~L}$\)
In milliliters \($\mathrm{V}_1=0.175\mathrm{~L} \times \frac{1000 \mathrm{mL}}{1 \mathrm{L}}=175 \mathrm{~mL}$\)
To know more about morality of a solution, click here:
https://brainly.com/question/9558971
#SPJ4
What is the oxidation number of sulfur in na2s2o3 ?.
Answers
Answer:
Therefore, the oxidation state of sulphur atoms in Na2S2O3 is −2 and +6.
What should scientists do when they see that the data collection or analysis
from their experiment has limitations?
O A. Ignore the limitations when they draw conclusions.
O B. Repeat the experiment to see if it still has limitations.
C. Decide not to report any of the experimental results.
O D. Describe the limitations in detail in their final report.
Answers
Answer:
D. Describe the limitations in detail in their final report.
Explanation:
Answer:
D. Describe the limitations in detail in their final report.
don't just look at this and don't answer it ._.
yeah i be seeing you guys view the answer and don't do nothing at all, not even comment IoI...
Answers
what is the name of the organic product formed in the reaction between hexan-3-ol and phosphorus tribromide? please use iupac substitutive nomenclature.
Answers
The full IUPAC name for the organic product formed in the reaction between hexan-3-ol and phosphorus tribromide is 3-bromohexane.
The reaction between hexan-3-ol and phosphorus tribromide produces the organic compound 3-bromohexane. Here is the IUPAC substitutive nomenclature for 3-bromohexane:
Prefix: bromo-
Root: hexane
Suffix: -e (indicating a saturated hydrocarbon with no functional groups)
Position of substituent: 3- (indicating that the bromine atom is attached to the third carbon atom in the hexane chain)
Therefore, the full IUPAC name for the organic product formed in the reaction between hexan-3-ol and phosphorus tribromide is 3-bromohexane.
To know more about Iupac substitutive nomenclature:
https://brainly.com/question/30586533
#SPJ11
Pb(No3) + K2S—>
Double replacement reactions
Answers
The double replacement reaction between lead(II) nitrate (Pb(NO3)2) and potassium sulfide (K2S) can be represented by the following balanced chemical equation: Pb(NO3)2 + K2S → PbS + 2KNO3
In this reaction, the lead(II) cations (Pb2+) from lead(II) nitrate swap places with the sulfide anions (S2-) from potassium sulfide, forming lead(II) sulfide (PbS) and potassium nitrate (KNO3).
Lead(II) sulfide (PbS) is a yellow solid, while potassium nitrate (KNO3) is a white crystalline solid. The reaction is a precipitation reaction because the formation of the insoluble lead(II) sulfide results in a solid precipitate being formed.
This double replacement reaction is driven by the exchange of ions between the reactants. The cations and anions swap partners to form new compounds. Double replacement reactions often occur when two ionic compounds are mixed in an aqueous solution.
It is important to note that double replacement reactions are only possible if there is a driving force to form an insoluble product or a gas. In this case, the formation of the insoluble lead(II) sulfide allows the reaction to proceed.
For such more questions on precipitation
https://brainly.com/question/16564963
#SPJ8
2.
Aluminium reacts with iron(III) oxide as shown.
iron(III) oxide + aluminium → iron + aluminium oxide
Which statement about this reaction is correct?
A
Aluminium is oxidised.
B
Aluminium oxide is reduced.
C Iron(III) oxide is oxidised.
D
Iron is oxidised.
Answers
Answer:
A is the answer..............
.............
Why are heat and alcohol used to disinfect medical equipment? 02 Why is milk given to someone who accidentally ingests a heavy metal ion such as silver or mercury?
Answers
The use of heat and alcohol to disinfect medical equipment is because both heat and alcohol are effective at killing microorganisms and bacteria.
Heat can be used to sterilize equipment by exposing it to high temperatures for a certain period of time, while alcohol, specifically ethanol and isopropyl alcohol, can be used to disinfect surfaces by denaturing the proteins and dissolving the lipid membranes of microorganisms.
Milk is not given to someone who accidentally ingests a heavy metal ion such as silver or mercury. Ingestion of heavy metal ions like silver or mercury can cause serious health problems and requires prompt medical attention. Milk is not an effective treatment for heavy metal poisoning, and chelating agents or other specific treatments are used for removing heavy metals from the body.
Learn more about chelating agents here:
https://brainly.com/question/1217155
#SPJ4
Given the density of 1.2 g/mL and a volume 7.8 mL. What is the mass? Round to the nearest 0.1.
Answers
Answer:
here is my answerrrrrrr
Determine the kmno4 concentration from the mass of na2c2o4 and volume of kmno4 solution used by the stockroom in standardization.
Answers
It's important to note that the specific values and units for the mass of Na2C2O4 and the volume of KMnO4 solution used are not provided in the question.
To determine the KMnO4 concentration from the mass of Na2C2O4 and the volume of KMnO4 solution used in standardization, we need to perform a titration calculation using the stoichiometry of the balanced chemical equation.
Here's a step-by-step breakdown of the process:
Step 1:
Write the balanced chemical equation:
2 KMnO4 + 5 Na2C2O4 + 8 H2SO4 → 2 MnSO4 + 10 CO2 + K2SO4 + 8 H2O
Step 2:
Determine the molar ratio between KMnO4 and Na2C2O4:
From the balanced chemical equation, we can see that 2 moles of KMnO4 react with 5 moles of Na2C2O4.
Step 3:
Calculate the number of moles of Na2C2O4:
Using the given mass of Na2C2O4, you can convert it to moles using its molar mass (molecular weight).
Step 4:
Convert moles of Na2C2O4 to moles of KMnO4:
Since we know the stoichiometric ratio between Na2C2O4 and KMnO4, we can calculate the moles of KMnO4.
Step 5:
Calculate the volume of KMnO4 solution used:
Using the balanced equation, determine the moles of KMnO4 reacted with the given moles of Na2C2O4. From the volume of KMnO4 solution used in the titration, you can calculate the concentration of KMnO4.
Step 6:
Convert the concentration to the desired unit:
The concentration of KMnO4 can be expressed in different units, such as molarity (moles per liter), percent concentration, or other units as required.
The calculations and the final result would require specific numerical values to be performed accurately.
Learn more about volume in the link:
https://brainly.com/question/14197390
#SPJ11
draw a table to compare the advantages and disadvantages of three feels _ ethanol,hydrogen, and diesel
please answer
Answers
Answer:
Lower fuel efficiency than Conventional Diesel
Pros of Biodiesel Cons of Biodiesel
Renewable May damage fuel filters and pipes
Incredibly Safe Can Effect Food Supply
Ready to Use Little bit Expensive
Extends engine lifespan Lower fuel Efficiency than DieselHydrogen Fuel Cell Advantages and Disadvantages in Material...
Hydrogen Fuel Cell Technology.
Advantage: High Energy Density Improves Productivity.
Disadvantage: The Use of Fossil Fuels in Hydrogen Production.
Disadvantage: Hydrogen Storage and Transportation.
Disadvantage: Fuel Cell Efficiency.Ethanol Fuel is Cost-effective Compared to Other Biofuels. ...
Ecologically Effective. ...
Helps Reduce Global warming. ...
Easily Accessible. ...
Minimizes Dependence on Fossil Fuels. ...
Contributes to Creation of Employment to the Country. ...
Opens up Untapped Agricultural Sector. ...
Ethanol Fuel is a Source of Hydrogen.draw a table to compare the advantages and disadvantages of three feels _ ethanol,hydrogen hope it's right
Ca(OH)2 is an Arrhenius ______________ and increases the concentration of __________ when added to water
Answers
1Propanol is combusted to provide heat The reaction and the enthalpy for the reaction are shown below Below is a list of sentences that describe a chemical reacsion Choose all of the sentences that apply to the above reaction Check all that apply. sharing gs ols View Available Hintls) This chemical reaction transfers heat tomte surroundings to the system This process is endothermic The enthalpy for 2GHrOA(1) + 9Oj (g) ? 60,(g) + 8H20(1) is 4 D42 kJ This process is exothermic The enthalpy for 2C4 H OH)+90()+6C02(8)+SH20(1) is 4.042 kJ This chemical reaction tansters heat from the system to the suroundings The enthalpy for 20,H,OH()+90 (s) -+6C02(s)+ 8H 0(1)s 2.021 k The enthalpy for 2C H:OH()+90()+ 6C0,(g)+8H,0(1) is 2.021
Answers
The combustion reaction of propanol, represented as 2C₄H₁₀(1) + 13O₂(g) → 8CO₂(g) + 10H₂O(1), involves the transfer of heat from the surroundings to the system. This exothermic process releases energy, as indicated by the negative enthalpy value of -442 kJ.
The combustion of propanol results in the formation of carbon dioxide (CO₂) and water (H₂O), while consuming oxygen (O₂) in the process.
This reaction is commonly used to provide heat in various applications, such as heating systems and fuel combustion.
By understanding the thermodynamics of this reaction, it becomes evident that it releases a substantial amount of energy in the form of heat, making it a valuable source of warmth and power.
Read more about Chemical reaction.
https://brainly.com/question/29762834
#SPJ11
given the fact that stomach acid (hcl) is neutralized by an antacid like mg(oh)2, what are the products of the reaction?
Answers
Water and Magnesium chloride is formed when (hcl) is neutralized by an antacid like mg(oh)2.
2 HCl (aq) + Mg (oh) 2 (aq) → Mg Cl2 (aq) 2H2O (l)
A chemical reaction is a method wherein one or more materials, also called reactants, are transformed into at least one or more special substances, called merchandise. Materials are both chemical elements or compounds.
A few synthesis reactions can result in more than one product. Photosynthesis is one of the maximum important chemical reactions on earth. It allows plants and a few microbes to transform water and carbon dioxide gas into storable sugar and oxygen.
Chemical compounds are made from atoms of different elements, joined collectively through chemical bonds. A chemical synthesis normally involves the breaking of existing bonds and the formation of recent ones.
Learn more about Chemical reactions here:- https://brainly.com/question/11231920
#SPJ4
Which region on the map has the highest risk of future landslides? a- Region 1 b-Region 2 c- Region 3 d- there is no way to make comparisons about the risk of future landslides? The subject is science (8th grade)
Answers
Answer:
Explanation:
Which region on the map has the lowest risk of future landslides?
answered Convert 55 grams of oxygen to moles
Answers
Answer:
3.44mole
Explanation:
Given parameters:
Mass of oxygen = 55g
Unknown:
Number of moles = ?
Solution:
To solve this problem, we use the expression below:
Number of moles = \(\frac{mass}{molar mass}\)
Molar mass of oxygen = 16g/mol
Number of moles = \(\frac{55}{16}\) = 3.44mole