give five differences between physical and chemical change​

Answers

Answer 1
Remember when it’s chemical substances change dramatically

Related Questions

18.A helium balloon has a volume of 3.0 m^3at lift off where the air pressure is 1 atm and the temperature is 20°C. When airborne, the temperature decreases to −60°C and the volume expands to 120 m^3. What it the pressure at this alriftide?


Answers

The pressure when the helium balloon is airborne at a volume of 120 m³ and a temperature of -60°C is approximately 0.726 atm.

To solve this problem, we can use the ideal gas law, which states that:

PV = nRT

P is the pressure

V is the volume

n is the number of moles of gas

R is the ideal gas constant (8.314 J/(mol·K))

T is the temperature in Kelvin

First, let's convert the initial and final temperatures from Celsius to Kelvin:

Initial temperature (T1) = 20°C + 273.15 = 293.15 K

Final temperature (T2) = -60°C + 273.15 = 213.15 K

Next, we can set up two equations using the ideal gas law for the initial and final states:

P1 * V1 = n * R * T1

P2 * V2 = n * R * T2

Since the number of moles (n) and the gas constant (R) are constant, we can write:

P1 * V1 / T1 = P2 * V2 / T2

Now we can plug in the given values:

P1 * 3.0 m³ / 293.15 K = P2 * 120 m³ / 213.15 K

Simplifying the equation:

P1 / 293.15 = P2 / 213.15

Now we can solve for P2:

P2 = P1 * 213.15 / 293.15

Finally, we can substitute the initial pressure (P1) with the given value of 1 atm:

P2 = (1 atm) * 213.15 / 293.15

P2 ≈ 0.726 atm

To know more about pressure refer to-

https://brainly.com/question/30673967

#SPJ11

the water in a beaker has a volume of 50 millimeters, is this an extensive property?

Answers

No, the volume of water in a beaker is not an extensive property.

Extensive properties are those that depend on the amount or size of the substance being measured. In other words, they are properties that change with the quantity of the substance. Examples of extensive properties include mass, volume, and total energy.

In the given scenario, the volume of water in the beaker is 50 milliliters. This volume remains the same regardless of the quantity of water present. Whether it's 50 milliliters or 500 milliliters, the volume measurement does not change. Therefore, the volume of water in the beaker is an example of an intensive property.

Intensive properties are independent of the amount or size of the substance. They are characteristics that remain constant regardless of the quantity of the substance. Examples of intensive properties include temperature, density, and color.

It's important to note that the distinction between extensive and intensive properties depends on the specific property being considered. While volume is typically an extensive property for a bulk substance, in the case of a fixed volume of water in a beaker, it becomes an intensive property.

In summary, the volume of water in a beaker is not an extensive property but rather an intensive property because it does not change with the quantity of the substance.

For more such questions on  extensive property visit:

https://brainly.com/question/13055036

#SPJ8

The water level in a granulated cylinder raised up 6.2 ml after a 16.74 metal sample is lowered into the cylinder. What is the density of the sample? What metal is the sample most likely to be?

Answers

Answer:

The density of the mystery metal is 2.7g/cm^3.  It is likely aluminum, Al.

Explanation:

Density is defined as (mass/unit volume).  We know the volume of the metal sample by the fact it displaced 6.2 ml of water.  Since the mateal sample had a mass of 16.74 grams, we find the density by dividing the mass by the volume:

Density = (mass)/(volume) = (16.74g)/(6.2ml)

Density = 2.7 g/ml

Note that the ubntis for density can vary greatly. kg/cm^3 is a possible unit.

since 1 ml = 1 cm^3, we can also say the density of the metal sample is 2.7 g/cm^3.  [This is a more common unit for this type of measurement]

A reference book of densities can be search to find what metals have this density.  See the attached excerpt form one such table.

While not definitive, it can be seen that aluminum, Al, is a good candidate for the ID of this metal.  It has a density of 2.7 g/cm^3, although different forms may deviate slightly.  The metal is most likely aluninum.

The water level in a granulated cylinder raised up 6.2 ml after a 16.74 metal sample is lowered into

what are the spectator ions in the reaction between mg(oh)2 (aq) and hcl (aq)? group of answer choices mg2 and cl- h and oh- oh- only h and cl- mg2 and h

Answers

The spectator ions in the REACTION between Mg(OH)2(aq) and HCl(aq) are OH-.

Here is the balanced chemical equation for the reaction:

Mg(OH)2(aq) + 2HCl(aq) → MgCl2(aq) + 2H2O(l)

In this reaction, Mg(OH)2(aq) reacts with HCl(aq) to produce MgCl2(aq) and H2O(l). Mg2+ and Cl- are involved in the reaction, but they are not spectator ions because they are part of the products. OH-, on the other hand, does not participate in the reaction and is present on both sides of the equation, making it a spectator ion.

Thus, the spectator ions in the reaction between Mg(OH)2(aq) and HCl(aq) are OH-.

To know more about chemical visit :-

https://brainly.com/question/29886197

#SPJ11

. Now Sara comes along, and she is the exact same size as you. However, she is even stronger than you are! When she pulls you in the wagon, she pulls with a greater force than when you pull her. Now who is in the wagon when it has the greatest acceleration? Explain, using Newton's second law. Sara would win because she is stronger but we have the same force.

Answers

Answer:

See explanation

Explanation:

According to Newton's second law, the rate of change of momentum is proportional to the impressed force.

Mathematically;

Ft = mv - mu

Where;

F = Force

t = time

m= mass

v = final velocity

u = initial velocity

Since the mass is the same, the equation reduces to;

Ft = m(v-u)

So

F=  m(v-u)/t

but

(v-u)/t = acceleration (a)

F = ma

a = F/m

Since the mass is the same because Sarah is the same size as i am but she pulls with a greater force, it follows that i will be the one in the wagon when the wagon has the greatest acceleration because the force that Sarah applies when pulling me is greater than the force i will apply when pulling her.

What are the 4 common elements that form covalent bonds?

Answers

Answer:

The four (4) most important elements found in cells that form covalent bonds are carbon, hydrogen, oxygen and nitrogen.

Explanation:

In an ionic compound, the negative and positive ions are held together by __________.

In an ionic compound, the negative and positive ions are held together by __________.

Answers

Answer:

the third one

Explanation:

plant growth is chemical change or physical change




Answers

Answer:

its a chemical change.

hope it helps.

stay safe healthy and happy...

Answer: it is a chemical change because it involves chemical process

Explanation:

what is the character of the vapor after each condensation-vaporization cycle in a fractional distillation of a mixture?

Answers

Vapour character is the same as gas

at the atomic level what causes fudge topping to pour faster when it is heated

Answers

At the atomic level, the main factor that causes fudge topping to pour faster when heated is the increase in the average kinetic energy of its constituent particles.

When fudge topping is heated, the thermal energy is transferred to the molecules and atoms within the topping. As the temperature rises, the average kinetic energy of the particles increases. This increase in kinetic energy leads to greater molecular motion and faster molecular interactions within the fudge topping.

The increase in molecular motion and interactions results in a reduction in the viscosity of the fudge topping. Viscosity refers to the resistance of a substance to flow. As the temperature increases and the particles move more rapidly, the intermolecular forces holding the fudge topping together weaken, allowing it to flow more easily.

Learn more about the thermal energy: https://brainly.com/question/3022807

#SPJ11

which of the following options correctly express the relationship between the volume and temperature of a gas at constant pressure? select all that apply.

Answers

The options that correctly express the relationship between the volume and temperature of a gas at constant pressure are:

As the temperature of the gas increases, the volume will increase.The volume of the gas is directly proportional to the absolute temperature.

What is the relationship between volume and temperature of a gas?

According to Charles' law, when the pressure is held constant, the volume of a given amount of gas is precisely proportional to its kelvin-scale temperature.

Because the gas particles are compressed closer together as the pressure on a gas rises, the volume of the gas decreases. In contrast, as a gas's pressure falls, its volume rises as a result of the gas's ability to spread its particles farther apart. Since the volume of the gas has expanded, the atmospheric gas exerts more force on weather balloons as they ascend through the atmosphere to areas of lower pressure.

Learn more about pressure at:

https://brainly.com/question/25736513

#SPJ1

complete questions:

Which of the following options correctly express the relationship between the volume and temperature of a gas at constant pressure? Select all that apply.

As the temperature of the gas increases, the volume will increase.

The volume of the gas is directly proportional to the absolute temperature.

Which reaction will occur? 2NaBr I2 Right arrow. 2NaI Br2 2Fe Al2O3 Right arrow. 2Al Fe2O3 2AgNO3 Ni Right arrow. Ni(NO3)2 2Ag Pb Zn(C2H3O2)2 Right arrow. Zn Pb(C2H3O2)2.

Answers

The reaction that has been occurred will be 2Fe+Al2O32Al+Fe2O3.

The chemical reaction has been defined as the interaction of the reactant  molecules for the formation of the product. The changes have been taken place in the reactivity series and under specific conditions.

Reaction occur

The displacement reaction has been taken place based on the reactivity series. The more reactive element has been able to displace the less reactive element in the compound and form a new compound.

The following reactions have been analyzed as:

2NaBr+I22NaI+Br2

In the reaction, Br has been replaced by Iodine. The iodine has been less reactive than Br and thus will not form the compound.

Thus, this reaction will not occur.

2Fe+Al2O32Al+Fe2O3

In the reaction, Al has been replaced by Fe. The Fe is more reactive than Al. thus this reaction will occur.

2AgNO3+NiNi(NO3)2+2Ag

The nickel has been less reactive than Ag, and thus will not be able to form the product.

Thus, this reaction will not occur.

Pb+Zn(C2H3O2)2Zn+Pb(C2H3O2)2

The lead has been less reactive than Zn, and thus will not be able to form the product.

Thus, this reaction will not occur.

The reaction that has been occurred will be 2Fe+Al2O32Al+Fe2O3.

Learn more about reactivity series, here:

https://brainly.com/question/10443908

How does the kinetic energy of solids, liquids, and gases compare?
OA. Gases have no kinetic energy, solids have a little, and liquids have
the most.
O
B. Gases have the same kinetic energy as liquids, which is more than
solids.
O
C. Gases have the highest kinetic energy, followed by liquids, and
then solids.
O D. Gases have the lowest kinetic energy, followed by liquids, and then
solids.

How does the kinetic energy of solids, liquids, and gases compare?OA. Gases have no kinetic energy, solids

Answers

Answer:

Gases have the highest kinetic energy, followed by liquids, and then solids.

Explanation:

Question:

How does the kinetic energy of solids, liquid, and gases compare ?

Context:

Higher kinetic energy causes particles to vibrate or move around faster. Solids have the lowest kinetic energy so vibrate very little.

Liquids have more kinetic energy so particles slide past each other.

Gases have the most kinetic energy so fly around in the air.

Answer:

C

Explanation:

you can relate this with their temprature, more kinetic energy means more movement of molecules. This creates heat which then melts or vaporizes substances. So, as K.E increases a substance will change from solid to liquid and eventually gas.

Two different medical students made models to show their ideas about the molecules that should be in the functioning cells of a healthy body. Using what you have figured out from reading and investigating so far, evaluate the models by answering the questions following the models.

Are these models accurate? choose one)
Medical Student A’s model is accurate.
Medical Student B’s model is accurate.
Both models are accurate.
Neither model is accurate.

Answers

Answer:

A

Explanation:

it's a because model is like the same thing as walking on a Runway but it's like a model in the medical field

What is the general trend for electron affınity values going across a period? OThe values become more negative. OThe values become more positive. OThe values stay relatively constant.
O The values show no trend.​

Answers

Option:The values become more positive

Explanation:

election affinity increases along a period ,so as the affinity increases values also increase

Answer:

The Value Becomes more negative

Hope this helps! :D

Explanation:

What is the general trend for electron affnity values going across a period? OThe values become more

I need help trying to explain this.

"Explain the relationship between Worldwide Earthquake Distribution and Geologic Forces."

Answers

Worldwide earthquake distribution and geologic forces are closely related. Earthquakes are caused by geologic forces that build up energy within the earth's crust and release it suddenly in the form of seismic waves.

What is the relationship?

The earth's crust is made up of several plates that are in constant motion. When two plates move towards each other, one plate may be pushed beneath the other in a process known as subduction. This can cause the build-up of pressure and the formation of faults or fractures in the crust, which can lead to earthquakes.

The distribution of earthquakes worldwide is largely determined by the location of these tectonic plate boundaries. For example, most earthquakes occur along the Pacific Ring of Fire, which is an area around the Pacific Ocean where several tectonic plates meet. The Mid-Atlantic Ridge, which is the boundary between the North American and Eurasian plates, is another area where earthquakes are common.

Learn more about geologic force:https://brainly.com/question/4254238

#SPJ1

Please help me:(
Mr. Jacob is teaching his class about the various changes of Earth’s Surface over time. He wants his students to explain the evidence that supports the claim that fossils can show proof of the changing of Earth’s surface. Which of the following statements best explains how students can use fossils as evidence?

Question 4 options:

Plant fossils can be used as evidence of Earth’s surface changing because similar fossils found in various locations supports that Earth was once a supercontinent.


Plant fossils can be used as evidence of Earth’s surface changing because different fossils found in one specific location on earth supports that earth was once a supercontinent.


Animal fossils can be used as evidence of Earth’s surface changing because different fossils found in various locations supports that Earth was once a supercontinent.


Animal fossils can be used as evidence of Earth’s surface changing because similar fossils found in one specific location of earth supports that Earth was once a supercontinent.

Answers

Answer:

A

Explanation:

for a gas phase chemical reaction, which of the following will affect the equilibrium constant for a given experiment? select one or more: A. changing the concentration of the reactants B. changing the temperature C. adding a catalyst to increase the rate of the reaction D. changing the volume of the system E. adding an inert gas to the system current question status

Answers

The factors that can affect the equilibrium constant for a given experiment are A (changing the concentration of the reactants), B (changing the temperature), and D (changing the volume of the system).

For a gas phase chemical reaction, the equilibrium constant is determined by the ratio of the concentrations (or partial pressures) of the products to the concentrations (or partial pressures) of the reactants at equilibrium. Based on this understanding, the factors that can affect the equilibrium constant for a given experiment are:

A. Changing the concentration of the reactants: Altering the concentration of the reactants will affect the equilibrium constant since it is dependent on the ratio of concentrations. Increasing the concentration of reactants will shift the equilibrium towards the product side (to restore the equilibrium), and vice versa.

B. Changing the temperature: Temperature has a significant impact on the equilibrium constant. Changing the temperature will shift the equilibrium in a direction that either favors the forward reaction (increasing temperature for an endothermic reaction) or the reverse reaction (decreasing temperature for an exothermic reaction).

C. Adding a catalyst to increase the rate of the reaction: A catalyst affects the rate of a reaction but does not alter the position of the equilibrium or the equilibrium constant. Therefore, adding a catalyst will not directly affect the equilibrium constant for the given experiment.

D. Changing the volume of the system: Altering the volume of the system affects the equilibrium constant if the reaction involves a different number of moles of gas on the reactant and product sides. According to Le Chatelier's principle, increasing the volume will shift the equilibrium in the direction that minimizes the total number of moles of gas, and vice versa.

E. Adding an inert gas to the system: Adding an inert gas, which does not participate in the chemical reaction, will not affect the equilibrium constant. It only increases the total pressure without affecting the partial pressures of the reactants and products.

Learn more about chemical reaction https://brainly.com/question/22817140

#SPJ11

True or false? Greenhouse gases affect the temperature of the earth by blocking sunlight from reaching the earth.

Answers

The given statement ," Greenhouse gases affect the temperature of the earth by blocking sunlight from reaching the earth" is true.

Generally the greenhouse effect is defined as a process that occurs when gases in Earth's atmosphere usually trap the Sun's heat. The process of greenhouse gases makes Earth much warmer than it would be without an atmosphere. Basically greenhouse effect is one of the things that makes our Earth a comfortable place to live.

Generally greenhouse gases are also known as GHGs are gases in the earth's atmosphere that trap heat. Basically, during the day time, the sun shines through the atmosphere, warming the earth's surface. During the night time the earth's surface cools, releasing heat back into the air.

Hence, the given statement is true.

Learn more about greenhouse effect from the link given below.

https://brainly.com/question/29000016

#SPJ4

Can someone help me with bill nye: science of music

Answers

Music is both an art and science which employs the various properties of sound waves to produce melodious sounds.

What is music?

Music is a process of combining sounds such that they produce a meaningful pattern and melody pleasant to the ears.

Music is both an art and a science.

Music is an art as it is a firm of expression of ideas and thoughts.

Music is a science as applies the knowledge of sound waves to produce melodious sounds. Different musical instruments have been produced using scientific knowledge.

Therefore, Music is both an art an science which employs the various properties of sound waves to produce melodious sounds.

Learn more about science of music at: https://brainly.com/question/11264894

#SPJ1

which of the following bonds has the lowest potential energy? a) C-C b) C-H c) N-N d) O-H e) H-H

Answers

In general, C-C and C-H bonds are stronger than N-N, O-H, and H-H bonds. Therefore, the bond with the lowest potential energy among the given options is a) C-C bond.

When it comes to potential energy, the strength of a bond is directly related to its bond energy. Bond energy is the amount of energy required to break a bond. Generally, the stronger the bond, the higher the bond energy and the lower the potential energy.

Now let's compare the given bonds:

a) C-C: This is a covalent bond between two carbon atoms.
b) C-H: This is also a covalent bond, but between a carbon atom and a hydrogen atom.
c) N-N: This is a covalent bond between two nitrogen atoms.
d) O-H: This is a covalent bond between an oxygen atom and a hydrogen atom.
e) H-H: This is a covalent bond between two hydrogen atoms.

Out of these options, the bond with the lowest potential energy would be the strongest bond, which means it would have the highest bond energy.

In general, C-C and C-H bonds are stronger than N-N, O-H, and H-H bonds. Therefore, the bond with the lowest potential energy among the given options is a) C-C bond.

To know more about bond visit:

https://brainly.com/question/33648670

#SPJ11

N2-3H2 → 2NH3
How many moles of hydrogen, H2, are needed
to react with 2.0 moles of nitrogen, N2?

Answers

Answer:

6 mols H2 are needed

Explanation:

N2 = 28.01g/mol

H2 = 2.02g/mol

2molN21 * 3molH21molN2 = 6 mol H2

you have a square with a Perimeter of 16 in,, what is the Area of the square after scaling it by 5?​
inches

Answers

Answer:

f the figure is a square with a perimeter of 16 inches, then each side of the square is 4 inchest in length. Area is found by multiplying the length x the width. For a square, the length and width are the same. A = 16 sq

Explanation:

What forces typically hold ions together?
O A. Intermolecular forces
OB. Ionic attractions
OC. Metallic bonds
O D. Covalent bonds

Answers

Answer: Ionic attractions

Explanation:

Ionic bonding is a type of chemical bond that involves the electrostatic attraction between oppositely charged ions.

What is the mass number of 19/9F?
Your answer:
A. 9
B. 10
C. 19
D. 28

Answers

the mass number of fluorine (F) is 19

C. 19

this circle represents a sample of a radioactive substance whose half life is 50 seconds. what would you predict it to look like after 150 seconds?

Answers

Radioactive decay is the process by which unstable atoms lose energy and emit radiation. The half life of a radioactive substance is the time it takes for half of its atoms to decay. In this circle, each dot represents an atom of the substance. After 50 seconds, half of the dots will disappear, meaning that half of the atoms have decayed. After another 50 seconds, half of the remaining dots will disappear, meaning that another quarter of the original atoms have decayed. After 150 seconds, only one eighth of the original atoms will remain. Therefore, you would predict that the circle would look like this after 150 seconds

About Radioactive Decay

Radioactive decay is the ability of an unstable atomic nucleus to become stable through emission of radiation. This ability involves the process of splitting unstable atomic nuclei resulting in energy loss by emitting radiation, such as alpha particles, beta particles with neutrinos and gamma rays.

Learn More About Radioactive decay at https://brainly.com/question/9932896

#SPJ11

A rock brought back from the moon contained 1/8 of a radioactive substance that was present when the rock was formed. If the half-life of this substance is 1.5 billion years, how old is the moon rock?

Answers

The age of the moon rock is roughly 11.8 billion years.

The age of the moon rock can be estimated using the half-life of the radioactive substance. The half-life of a radioactive substance is the amount of time it takes for half of the original amount of the substance to decay. In this case, the half-life is 1.5 billion years.

To determine the age of the moon rock, we can use the concept of exponential decay. Exponential decay is a mathematical term that describes the rate at which a substance decays over time. Since the rock contains 1/8 of the original amount of the radioactive substance, we can use this information to estimate the age of the rock.

Assuming that the original amount of the radioactive substance has decayed exponentially over time, we can determine the age of the rock using the following equation:

Age=(Halflifeln(18))ln(2)

Plugging in the given information, we get:

Age=(1.5 billion years  ln(18))ln(2)

Solving for Age, we get:

Age = 11.8 billion years

Therefore, the moon rock is estimated to be 11.8 billion years old.

learn more about radioactive Refer:brainly.com/question/14986315

#SPJ1

what is the ratio between the energy and oxygen based on the equation

Answers

The ratio between the energy and oxygen is 21.36 kJ/g of oxygen.

According to the given balanced equation:C_{2}H_{5}OH + 2O_{2} → 2CO_{2} + 3H_{2}O + 1367 kJ. The balanced equation tells us that one molecule of C_{2}H_{5}OH reacts with two molecules of O2 to form two molecules of CO2, three molecules of H_{2}O, and 1367 kJ of energy. Therefore, to determine the ratio between energy and oxygen, we need to first find the energy released per mole of O2 reacted. To do this, we need to use the energy released by the combustion of 1 mole of C_{2}H_{5}OH, which is given as 1367 kJ. So, 1 mole of C_{2}H_{5}OH releases 1367 kJ of energy. To balance the equation, 2 moles of O2 are required for every mole of C_{2}H_{5}OH reacted. So, 2 moles of O2 is equivalent to 1367 kJ of energy. Therefore, the energy released per mole of O2 is 1367/2 = 683.5 kJ/mol. Oxygen has a molar mass of 32 g/mol and therefore the mass of one mole of oxygen is 32 g/mol. Using the molar mass of oxygen and the energy released per mole of O2, we can calculate the energy released per gram of oxygen as follows: Energy released per gram of O2 = Energy released per mole of O2 / Molar mass of O2= 683.5 / 32 = 21.36 kJ/g. Therefore, the ratio between the energy and oxygen is 21.36 kJ/g of oxygen.

learn more about combustion Refer: https://brainly.com/question/14987280

#SPJ11

complete question: C_{2}H_{5}OH + 2O_{2} → 2CO_{2} + 3H_{2}O + 1367 kJ

What is the ratio between the energy and oxygen based on the equation?

-[?] kJ

[?]mol O2

when an acid such as hcl reacts with a metal, such as zinc (shown here) the gas produced is

Answers

When an acid such as hydrochloric acid (HCl) reacts with a metal like zinc (Zn), the gas produced is hydrogen gas (H₂).

When hydrochloric acid (HCl) reacts with zinc (Zn), something interesting happens. The acid gives away its hydrogen atoms (H⁺) to the zinc. At the same time, the zinc gives away some of its electrons. As a result, hydrogen gas (H₂) is produced. The gas forms little bubbles that you might see during the reaction. The remaining zinc combines with the chlorine atoms (Cl⁻) from the acid to form zinc chloride (ZnCl₂). So, to sum it up, when acid (like HCl) and metal (like zinc) react, they create hydrogen gas and a compound called zinc chloride. The hydrogen gas bubbles out, and the zinc chloride dissolves in the remaining acid.

A single displacement reaction, also known as a metal-acid reaction, occurs when hydrochloric acid (HCl) and zinc (Zn) are in contact. This reaction results in the creation of zinc chloride (ZnCl₂) and hydrogen gas (H₂) as the zinc metal displaces the hydrogen in the hydrochloric acid. While the acid's hydrogen ions lose electrons and undergo oxidation, the zinc atoms acquire electrons and undergo reduction. It is a redox (reduction-oxidation) reaction because it includes both oxidation and reduction reactions.

To learn more about gas, refer to:

https://brainly.com/question/6140407

#SPJ4

Is krypton a stable element

Answers

Answer:it is a stable element

Explanation:because it has six stable isotopes

Other Questions
In order to produce batteries for electric cars there is a need to open a larger number of lithium and cobalt strip mines. Many of these strip mines would be in the West of the country, andwould wipe-up habitats of endangered plants and animals living there.Use the decision tree to help you arrive to vou conclusion.What would be the third question that you would need to ask? Every project that is identified is selected to be completed. true false Cash distributions made by government to individuals when no good or service is received in exchange are known as __________.A. poverty paymentsB. taxesC. transfer payments which layer of the skin most protects the deeper tissues of the body and acts as a heat insulator? Which expression is equivalent to 150x - 60x ? A 15x(10x + 4) B15x(10x - 4) C 15(10x - 4) D 15(10x + 4) Why is daisy crying over shirts? is she really crying over shirts? or could she be "sad" about something else? is gatsby trying too hard here? what does he think tossing these shirts will prove? what could the shirts represent, and how do they fit into gatsby's dream? Once you display the list of events for a control, you can wire an existing event handler to any event by : using our previous student database assignments and the examples provided in class and on blackboard, youll add a student class. rather than work with just the variables, youll create a student object. youll assign the data to that student object and write the data out to a database file (a csv file that will act as our database Need help please!!!!! A cone has a radius of 3.8 m and a slant height of 8.8 m. Which would decrease the cone's surface area less, halving the radius or halving the slant height? Factor 15x3 5x2 + 6x 2 by grouping. What is the resulting expression? (5x2 + 2)(3x 1) (5x2 2)(3x + 1) (15x2 + 2)(x 1) (15x2 2)(x + 1) a) Explain the techniques used to analyze and assess thetraining needs for an organization. Which of the following is true about the differences between the "Plum Pudding" model and Rutherford's model? There are two possible answers. A. Both models describe food. B. The plum pudding model had no deflection of particles because it lacked a nucleus C. Rutherford's model showed deflection of particles because the nucleus has positive and neutral particles. D. The plum pudding model and Rutherford's model are the same 15.0 moles of gas are in a 8.00 l tank at 23.8 c . calculate the difference in pressure between methane and an ideal gas under these conditions. the van der waals constants for methane are a=2.300l2atm/mol2 and b=0.0430 l/mol . what the meaning of Formatting marks? In a condition called presbyopia, the eyes' lenses lose much of their elasticity and maintain a flat shape. Explain how this condition affects a person's vision. What is the range of the function f(x) = -2(6x) + 3? (-00,-2] (-0,3) [-2.co (3.c) o Name the process that occurs as the wavefronts pass from deep to shallow water The leg from the waiting area to the airplane's takeoff ( its hard to explain sorry) Which of the following are global risk factors for violence against women?Living in a rural areaLiving in povertyLiving in an area where women have little political powerAll of these are correct.