g Identify the true statements regarding α-1,6 linkages in glycogen. At least four glucose residues separate α‑1,6 linkages. The number of sites for enzyme action on a glycogen molecule is increased through α‑1,6 linkages. New α‑1,6 linkages can only form if the branch has a free reducing end. The reaction that forms α-1,6 linkages is catalyzed by a branching enzyme. Exactly four residues extend from these linkages.

Answers

Answer 1

Answer:

At least four glucose residues separate α‑1,6 linkages.

The number of sites for enzyme action on a glycogen molecule is increased through α‑1,6 linkages.

The reaction that forms α-1,6 linkages is catalyzed by a branching enzyme.

Explanation:

Glycogen is a polymer of glucose and is the primary carbohydrate storage form in animals. The polymer is composed of glucose units linked in alpha(1-4) straight chains and alpha(1-6) branches which occur on average every 8-12 straight chain glucose residues. It has a reducing and non-reducing end. The end of the molecule containing a free carbon number one on glucose is called a reducing end. The other ends are all called non-reducing ends.

During the breakdown of glycogen, glucose units are removed one at a time from the non-reducing end until a point about four glucose residues away from a branch which will require a debranching enzyme to act for further breakdown to occur. Since many such branches occur in a glycogen molecule, it makes it possible for breakdown of glycogen to occur at many points speedily.

Glycogen branching enzyme is required to make alpha (1-6) glycosidic bonds. It transfers 6 to 7 glucose units from the non-reducing end of a straight chain glycogen molecule to an interior position of the same or another glycogen molecule forming alpha (1-6) bonds.


Related Questions

2C2H6: How many atoms for each element are in the formula? C= H=

Answers

Answer:

C=4 H=12

Explanation:

the 2 in front of the equation tells how many atoms there are the C2 and H6 tells you how much is in each atom, multiply to get the total

A student states that a graduated cylinder contains 150 mL of water the statement is

Answers

Answer:

Explanation:

An Observation

Chemists can identify the composition of some unknown salts by conducting a flame test. When potassium salts are heated in a flame, a purple color is observed.
This is due to the movement of electrons between energy levels. What is the electron configuration of a potassium atom at ground state?
answer choices
1s2; 2s2; 2p6; 3s2; 3p6; 4d1
1s2; 2s2; 2p6; 3s2;3p6; 3d1
1s2; 2s2; 2d6; 3s2; 3d6; 4s1
1s2; 2s2; 2p6; 3s2; 3p6; 4s1

Answers

The electron configuration of a potassium atom at ground state is 1s²2s²2p⁶3s²3p⁶4s¹. Therefore, option D is correct.

What is an electronic configuration?

The electron configuration of an element can be explained as electrons being occupied in different energy levels of an atom of a specific element. In the electron configuration, the electrons are usually written as a superscript of atomic subshells. For example, the electron configuration of Helium can be represented as 1s²2s².

The sequence of completely filled subshells similar to neighboring the electronic configuration of a noble gas is represented by square brackets. The principal quantum number (n) will be used to denote the maximum number of electrons in an electron shell.

The total number of electrons occupied in the given electronic configuration  1s²2s²2p⁶3s²3p⁶4s¹  is 19. The atomic number of potassium is 19 therefore it is the configuration of potassium.

Learn more about electronic configuration, here:

brainly.com/question/5624100

#SPJ4

18. at the stoichiometric point for a titration between hydrochloric acid and ammonia, the ph is expected to be: a. > 7 b. < 7 c. = 7 d. cannot be determined

Answers

At the stoichiometric point for a titration between hydrochloric acid (HCl) and ammonia (NH₃), the pH is expected to be greater than 7. The correct option is (a) > 7.

In the given titration, hydrochloric acid (HCl) is a strong acid, and ammonia (NH₃) is a weak base. At the beginning of the titration, the hydrochloric acid is in excess, and the solution is acidic, resulting in a pH less than 7. As the titration proceeds and ammonia is gradually added, it reacts with the hydrochloric acid to form ammonium chloride (NH₄Cl).

At the stoichiometric point, the moles of hydrochloric acid and ammonia are in the ratio dictated by the balanced chemical equation. This point signifies that all the hydrochloric acid has reacted with the ammonia, and no excess of either is present in the solution. The resulting solution consists mainly of the ammonium chloride salt.

Ammonium chloride is the salt of a weak base (ammonia) and a strong acid (hydrochloric acid). When dissolved in water, it undergoes hydrolysis, releasing H+ ions, which makes the solution acidic. Therefore, at the stoichiometric point of this specific titration, the pH is expected to be greater than 7, indicating an acidic solution.

It's important to note that this is a generalization and can vary depending on the specific titration and the concentrations of the reactants involved. However, in the given context of a titration between hydrochloric acid and ammonia, the pH at the stoichiometric point is expected to be greater than 7.

The correct option is a.

To know more about pH, refer to the link below:

https://brainly.com/question/28059616#

#SPJ11

Balancing equations help please !!!

Balancing equations help please !!!

Answers

6=CO2(g)
6=H2O(I)
1=C6H12O6(s)
6=O2(g)

you find 13406190 pennies. how many dollars did you actcually find? if each penny weighs 4 grams, how much does all of it weigh in ponds

Answers

Answer:

134,061.9 dollars and 118,222.45 lbs.

Explanation: you're welcome :)

how can splashes from the magnetic stirring of the titration be avoided?

Answers

By using an appropriate stirring bar, adjusting the speed of the stirrer, and using a larger container or filling the container to a lower level, splashes from magnetic stirring during titration can be minimized, ensuring accurate results and a safe laboratory environment.

As per the question given,  

Splashes from magnetic stirring during titration can be a common issue in the laboratory that can lead to inaccurate results or even harm to the person performing the experiment. Fortunately, there are several ways to minimize splashes and ensure a safe and accurate experiment.

One of the most effective ways to prevent splashes is to use a stirring bar that is appropriate for the size and shape of the container. A bar that is too large or too small can cause excessive turbulence, leading to splashing. It is also important to ensure that the stirring bar is placed in the center of the container to avoid hitting the sides and causing splashes.

Another way to prevent splashes is to adjust the speed of the magnetic stirrer. A slower speed will reduce the amount of turbulence in the solution, while a higher speed can increase splashing. It is important to find the right balance between the speed of the stirrer and the rate of the titration to avoid excessive splashing.

Additionally, using a larger container than necessary can help prevent splashing. A larger container provides more space for the solution to move, reducing turbulence and splashing. If a larger container is not available, filling the container to a lower level can also help reduce splashing.

For such more questions on Magnetic stirring

https://brainly.com/question/519230

#SPJ4

Aqueous solutions of soluble ionic substances and acids conduct an electric current because in a solution both compounds produce _____, which are free to move.

Answers

Aqueous solutions of soluble ionic substances and acids conduct an electric current because in a solution both compounds produce ions, which are free to move.


When soluble ionic substances and acids dissolve in water, they dissociate into their constituent ions, which are then free to move and conduct an electric current. This is because the flow of electric current requires the presence of charged particles that can move freely through a medium. In the case of aqueous solutions of soluble ionic substances and acids, these charged particles are the ions produced upon dissociation in water. Therefore, the solution can conduct electricity due to the presence of free ions in the solution.


These ions are free to move in the solution, allowing for the conduction of an electric current. This movement of ions in the solution is what enables the transfer of electric charge and thus, the conductivity of the solution.

To know more about ions, visit

https://brainly.com/question/1310794

#SPJ11

What affects wind speed?

Answers

Answer:

At the Earth's surface, wind blows horizontally from high pressure to low pressure areas. The speed is determined by the rate of air pressure change, or gradient, between the two pressure areas. The greater the pressure difference, the faster the winds.

- sciencing

The Four Forces That Influence Wind Speed & Wind Direction

Explanation:

a gas has a mass of 3175 g and takes up enough space to fill a room that is 2.00 m x 2.00 m x 5.00 m determined what the gas is in g/mL

Answers

To determine the gas in g/mL, we need to calculate the volume of the gas first. We can use the formula for the volume of a rectangular room to find the volume of the room:

Volume = length x width x height = 2.00 m x 2.00 m x 5.00 m = 20.00 m³

Next, we need to convert the mass of the gas from grams to kilograms, since density is usually expressed in units of kg/m³. We can do this by dividing the mass by 1000:

Mass = 3175 g ÷ 1000 = 3.175 kg

Finally, we can calculate the density of the gas using the formula:

Density = Mass ÷ Volume

Density = 3.175 kg ÷ 20.00 m³ = 0.1588 kg/m

To convert the density from kg/m³ to g/mL, we need to multiply by 1000 and then divide by 1000:

Density = 0.1588 kg/m³x 1000 g/kg ÷ 1000 mL/L = 0.1588 g/mL

Therefore, the gas has a density of 0.1588 g/mL. Without additional information, we cannot determine the identity of the gas.

To know more about density, visit :

https://brainly.com/question/29775886

#SPJ1

The property of a mineral splitting evenly along a flat surface is.

Answers

Answer:

The answer should be Cleavage

Determine the amount of Boron that is required to make a 10 kg p-type
silicon with majority carrier concentration of 5x018 /cm3. Density of Boron
is 2.46 g/cm3, an atomic mass unit of boron is 10 grams/mol. Distribution
coefficient of born in solid vs. melt in silicon is kd = 0.3.

Answers

Given the mass of silicon (Ms) as 10 kg, the atomic mass unit of boron (Mboron) as 10 g/mol, the density of boron (ρboron) as 2.46 g/cm³, and the majority carrier concentration of silicon (Np) as 5 × 10¹⁸/cm³, we are tasked with finding the boron concentration in silicon (Nb).

To calculate Nb, we can utilize the formula: Nb = (ρboron/Mboron) × (kd/Ms) × Np.

By substituting the given values into the equation, we obtain:

Nb = (2.46 g/cm³ ÷ 10 g/mol) × (0.3 ÷ 10 kg) × 5 × 10¹⁸/cm³.

Simplifying the expression, we find:

Nb = 3.69 × 10¹³/cm³.

Hence, the boron concentration required to produce a 10 kg p-type silicon with a majority carrier concentration of 5 × 10¹⁸/cm³ is 3.69 × 10¹³/cm³.

Read more about atomic mass unit,

https://brainly.com/question/8085884

#SPJ11

What are your thoughts abt love and relationships?

Answers

In my opinion most of the relationships are a lie,cheat,painful.

A tank contains 200 gallons of water in which 300 grams of salt is dissolved. A brine solution containing 0.4 kilograms of salt per gallon of water is pumped into the tank at the rate of 5 gallons per minute, and the well-stirred mixture is pumped out at the same rate. Let LaTeX: A\left(t\right)A(t)[Math Processing Error] represent the amount of salt (measured in kilograms) in the tank at time LaTeX: t[Math Processing Error].

Answers

Answer:

Therefore, after long period of time 80kg of salt will remain in tank

Explanation:

given amount of salt at time t is A(t)

initial amount of salt =300 gm =0.3kg

=>A(0)=0.3

rate of salt inflow =5*0.4= 2 kg/min

rate of salt out flow =5*A/(200)=A/40

rate of change of salt at time t , dA/dt= rate of salt inflow- ratew of salt outflow

dA/dt=2(A/40)dA=2dt(A/40)dtdA+(A/40)dt=2dt

integrating factor

=e(1/40)dt

integrating factor =e(1/40)t

multiply on both sides by  =e(1/40)t

dAe(1/40)t+(A/40)e(1/40)tdt=2e(1/40)tt(Ae(1/40)t)=2e(1/40)tt

integrate on both sides

Double exponent: use braces to clarify

b)

after long period of time means t - > ∞

tlimtAtlimt(80)(79/e(1/40)t=80(0)=80

Therefore, after long period of time 80kg of salt will remain in tank

A pure form of matter is isolated and tested. no physical procedures can produce simpler forms of matter but heating the sample produces a liquid and a gas. the sample of matter must be a(n)?

Answers

The sample of matter that has been isolated and tested, and can only be broken down into a liquid and a gas by heating it, must be a compound.

A synthetic compound is a substance made out of numerous indistinguishable particles containing molecules from more than one compound component kept intact by substance bonds. A particle comprising of iotas of only one component is subsequently not a compound.

A pure form of matter that cannot be further broken down into simpler forms by physical procedures is called an element. A compound is a substance that is composed of two or more different elements chemically combined. In this scenario, heating the sample of matter resulted in two different forms: a liquid and a gas.

This suggests that the sample was composed of two or more substances that were chemically combined. Therefore, the sample of matter is a compound.

Know more about compound:

https://brainly.com/question/14117795

#SPJ11

when two atoms of the same element chemically combine to form a bond with each other, the resulting molecule is called a compound. true or false

Answers

Answer:

Explanation: false

Nonpolar covalent bonds form between two atoms of the same element, or between atoms of different elements that share electrons more or less equally.

Answer and Explanation:

When two atoms form a chemical bond, they either share electrons or transfer them to make a new compound. Electrons are the negatively charged particles that orbit the nucleus of an atom in various energy levels.

25.0cm3 of s saturated potassium hydroxide is neutralized by 35.0cm3 of hydrogen chloride acid of concentration 0.75 mol/dm3. Calculate the concentration of potassium hydroxide solution. Please help, will give brainliest, unhelpful answers will get reported.​

Answers

Answer:

Concentration of the original KOH solution: approximately 1.05moldm3.

Explanation:

Notice that the concentration of the HCl solution is in the unit moldm3. However, the unit of the two volumes is cm3. Convert the unit of the two volumes to dm3 to match the unit of concentration.

V(NaOH)=25.0cm3=25.0cm3×1dm31000cm30.0250dm3.

V(HCl)=35.0cm3=35.0cm3×1dm31000cm30.0350dm3.

Calculate the number of moles of HCl molecules in that 0.0350dm3 of 0.75moldm3 HCl solution:

n(HCl)=c(HCl)V(HCl)=0.00350dm3×0.75moldm30.02625mol.

HCl is a monoprotic acid. In other words, each HCl would release up to one proton H+.

On the other hand, KOH is a monoprotic base. Each KOH formula unit would react with up to one H+.

Hence, HCl molecules and KOH formula units would react at a one-to-one ratio.

HCl(aq)+NaOH(aq)NaCl(aq)+H2O(l).

Therefore, that 0.02625mol of HCl molecules would neutralize exactly the same number of NaOH formula units. That is: n(NaOH)=0.02625mol.

Calculate the concentration of a NaOH solution where V(NaOH)=0.0250dm3 and n(NaOH)=0.02625mol:

c(NaOH)=n(NaOH)V(NaOH)=0.02625mol0.0250dm31.05moldm3.

how many atoms is in a molecule of omega 3 fatty acid

Answers

Answer:

There are 18 carbon atoms in a molecule of omega 3 fatty acid

Explanation:

This answer to this is 18

When the temperature of a 3. 0-l sample of a gas is dropped from 200°c to 100°c, what will be the final volume of the gas sample?.

Answers

P1V1T1=P2V2T2 Add 273 to convert degrees Celsius to Kelvin:

∴200×25/298=250×V2/273, ∴V2=200×25×273/298×250, ∴V2=18.32L

Where is the volume equation?

The basic formula for volume is length, breadth, and height, as opposed to length, width, and height for the area of a rectangular shape. The calculation is unaffected by how you refer to the various dimensions; for instance, you can use "depth" instead of "height."

What is chemistry using volume units?

Volume, which is measured in cubic units, is the 3-dimensional space occupied by matter or encircled by a surface. The cubic meter (m3), a derived unit, is the SI unit of volume.

to know more about volume and temperature here:

brainly.com/question/12050285

#SPJ4

hi please help, what is the correct formula for zinc nitrate?
A. ZnNO3
B. Zn, 2, N, 3
C. Zn(NO3)2

Answers

Answer:

The answer is (c) Zn(No3)2

Explanation:

Because we know the cation of zinc is+2 and whereas nitrate is anion, -1.

Length of a year. 31,560,000.0 seconds = 3.156 X 10^7 seconds
How do I convert into scientific notation

Answers

Answer: 3.156 * 10^7

Explanation: I do not really understand your question. You answered it yourself!

Scientific notation shortens large numbers. The number right after the decimal point can only be between 1 and 9, which you did correctly. When converting to scientific notation, the exponent of ten is based on how many places you moved the decimal and the direction you moved it (left, positive; right, negative). In this case, the exponent of ten is a positive seven.

You did everything correctly :) Good job!

an atom of vanadium (z = 23) in its ground state has _____ valence electrons.

Answers

An atom of vanadium (Z = 23) in its ground state has 5 valence electrons.

Valence electrons are the electrons in the outermost energy level of an atom. In the case of vanadium, it has an electron configuration of [Ar] 4s^2 3d^3. The outermost energy level is the 4s orbital, which contains 2 electrons, and the 3d orbital, which contains 3 electrons. The total number of electrons in the outermost energy level, therefore, is 5, making them the valence electrons. Valence electrons play a crucial role in determining the chemical properties and reactivity of an element. They are involved in bonding with other atoms and determining the element's ability to form compounds.

To learn more about electrons click here: brainly.com/question/12001116 #SPJ11

Jackson enjoys looking up at the night sky and writing about the variety of objects he see , on one special occasion he wrote in his journey that he saw a streak of light going across part of the sky . Which answer best describes what Jackson saw ?


a - Meteorite: A cold mixture of dust and ice that develops a long tail as it nears the sun

b - Meteor: A cold mixture of dust and ice that develops a long tail as it nears the sun

c - Meteorite: A streak of light made when an object burns up as it enters earth’s atmosphere

d - Meteor: A streak of light made when an object burns up as it enters earth’s atmosphere

Answers

Answer:

d - Meteor: A streak of light made when an object burns up as it enters earth’s atmosphere

Explanation:

The best description of what Jackson saw is a meteor which is a streak of light made when an object burns up as it enters earth's atmosphere.

A meteor is made up of rocky and sometime iron mass. They are believed to have formed since the early formation of the earth.

These objects moves with very high velocity in the solar system. When they enter the earth's atmosphere, they are burnt up and they leave a streak of light in the atmosphere. This is what is seen as a shooting star

What is the frequency of a red laser that has a wavelength of 676 mn

Answers

The frequency of a red laser that has a wavelength of 676 nm would be 4.43 x \(10^{14\) hertz.

Frequency of waves

The frequency and wavelength of a wave are related by the following equation:

λf = c

Where λ is the wavelength of the wave in meters, f is the frequency in Hertz, and c is the speed of light in a vacuum.

in this case, λ = 676 nm = 6.76 x \(10^{-7\) m

c = 299,792,458 m/s

Making f the subject of the formula:

f = c/λ

  = 299,792,458/6.76 x \(10^{-7\)

  = 4.43 x \(10^{14\) hertz

In other words, the frequency of a red laser that has a wavelength of 676 nm would be 4.43 x \(10^{14\) hertz.

More on waves can be found here: https://brainly.com/question/29334933

#SPJ1

What's the fifth planet from the sun?

Answers

Answer:

jupiter

Explanation:

mercury, venus, earth, mars, jupiter, saturn, uranus, neptune,

the answer is Jupiter

. what is the frequency in hz (s–1) of light with a wavelength of 6.40 × 10–7 m?

Answers

The frequency of light with a wavelength of 6.40 × 10⁻⁷ m is 4.69 × 10¹⁴ Hz for given wavelength .

Option C is correct .

We are instructed to calculate the frequency and given the wavelength. The number of oscillations per second, or frequency, is typically inversely proportional to wavelength.

The formula for finding the frequency of light with a given wavelength is given by :

                                         c = λν

where

c = speed of light = 3.00 × 10⁸ m/s

λ = wavelength of light = 6.40 × 10⁻⁷m

ν = frequency of light = ?

Substituting the given values into the formula, we have:

                             c = λν

3.00 × 10⁸ = (6.40 × 10⁻⁷)ν

Dividing both sides by 6.40 × 10⁻⁷  :

ν = (3.00 × 10⁸)/(6.40 × 10⁻⁷)

ν = 4.69 × 10¹⁴ Hz

Therefore, the frequency of light with a wavelength of 6.40 × 10⁻⁷ m is 4.69 × 10¹⁴ Hz (option C).

Incomplete question :

what is the frequency in hz (s–1) of light with a wavelength of 6.40 × 10–7 m?

A. 1.87 x 10−6 Hz

B. 2.13 x 10−4 Hz

C. 4.69 x 103 Hz

D. 1.92 x 1013 Hz

Learn more about wavelength :

brainly.com/question/28995449

#SPJ11

If 2.22g of NaCl was recovered after the reaction of 0.050L of hydrochloric acid and 0.033L of sodium hydroxide. What was the molarity of the base used in this experiment?

Answers

The molarity of the base used in the experiment, which was determined based on the recovered NaCl and the volumes of hydrochloric acid and sodium hydroxide, was approximately 1.15 M.

To determine the molarity of the base used in the experiment, we need to use the stoichiometry of the balanced chemical equation and the given data.

The balanced chemical equation for the reaction between hydrochloric acid (HCl) and sodium hydroxide (NaOH) is:

HCl + NaOH → NaCl + H2O

First, we need to find the number of moles of NaCl produced. We can do this by using the given mass of NaCl (2.22 g) and its molar mass (58.44 g/mol):

moles of NaCl = mass of NaCl / molar mass of NaCl

moles of NaCl = 2.22 g / 58.44 g/mol

moles of NaCl = 0.038 moles

Next, we can use the stoichiometry of the balanced equation to determine the number of moles of NaOH that reacted. Since the mole ratio between NaCl and NaOH is 1:1, the number of moles of NaOH is also 0.038 moles.

Now, we can calculate the molarity of the base (sodium hydroxide) using the given volume of sodium hydroxide solution (0.033 L):

Molarity of NaOH = moles of NaOH / volume of NaOH solution

Molarity of NaOH = 0.038 moles / 0.033 L

Molarity of NaOH ≈ 1.15 M

Therefore, the molarity of the base used in the experiment is approximately 1.15 M.

For more such question on experiment. visit :

https://brainly.com/question/20639065

#SPJ8

Steel has a density of 7.8 g/cm3. What is the volume of a 78-gram piece of steel?

Answers

Answer:

10 cm³

Explanation:

The volume of a substance when given the density and mass can be found by using the formula

volume=massdensity

From the question we have

volume=787.8

We have the final answer as

10 cm³

Hope this helps you

Can someone help me on this

Can someone help me on this

Answers

155,500



I did this to the best of my ability. I have a hard time comprehending things sometimes so I’m so so so sorry if it’s wrong

What is the concentration of lithium ions in 0.350 M Li₃PO₄?

Answer ASAP DUE TODAY

Answers

 we will measure the amount of lithium ion, Li+, present in 0.4 M Li2HPO4. This is attainable as follows: 1 mole of Li2HPO4 resulted in 2 moles of product in the equation for balance above.

What is the purpose of lithium?

Although its activities are unknown, trace levels of lithium are found in biological systems. Lithium salts have shown potential for the treatment for mental illnesses including bipolar disorder as an antidepressant and mood stabilizer. The lithium family, named for its main element, is another name for the alkali metals.

A lithium battery is what?

The most effective of them allows migration of a lithium cation, Li +, between the anode and the cathode, such as LiCoO 2, using a conducting polymer without a solvent. Cell phones, laptops, and other electronics frequently use smaller rechargeable lithium batteries.

To know more about lithium visit:

https://brainly.com/question/1439744

#SPJ1

Other Questions
please help me with this i will give brainlieist to anyone who does itLevi needs to write 263,000,700,000 in scientific notation.What is the sign of the exponent?The exponent will be negative because the number Levi needs to write in scientific notation is less than one. The exponent will be negative because the number Levi needs to write in scientific notation is greater than one. The exponent will be positive because the number Levi needs to write in scientific notation is greater than one. The exponent will be positive because the number Levi needs to write in scientific notation is less than one. layunin ng habitat for humanity Write an equation in slope-intercept form for a lineperpendicular toy=3x+3 and passing through the point (9,-1)y = As governor, Adelbert Ames pushed forvoting rights for African Americans.O acceptance of the Mississippi Plan.O amnesty for ex-Confederate officers.O returning power to the Democratic Party. The amount of workers working on a task varies inversely as the amount of time it takes to finish the task. If 10 people can finish a task in 2 weeks, how many days will it take for 15 people to complete the same task?. Answer these questions where are romeo and juliet when they meet for the second time? 1ANALYZE The events of the memoir are not in chronological order.Useyour notes to identify the order of events and complete the timeline.What is the effect of the way the author structures this text? albert's son, aiden, really likes playing with his toy car. his father will sometimes try to take the car away and hide it and when he does this, aiden immediately tries to look for the car. piaget would say Calculate the present value of an asset worth $2,000 four years from now if the interest rate is 6 percent. Multiple Choice $2,480 $2,524.95 $1,520 Only the negative vote can be reconsidered for discharging a committee. True or false ? Determine the NPW, AW, FW and IRR of the following engineering project. Initial Cost ($300,000) The Study Period 15 years Salvage (Market) Value of the project 12% of the initial cost Operating Costs in the first year ($7,500) . Cost Increase 5% per year Benefits in the first year $30,000 Benefit Increase 13% per year MARR 9% per year Is the Project acceptable? WHY? What part of a plant makes food? When the outer envelope of a red giant escapes, the remaining carbon core is called a? which of the following statements regarding standardization is true?i. all products made to a given specification will be interchangeable.ii. a range of standard specifications can be established so that the range covers the majority of uses for the item.iii. standardization results in a larger variety of parts. group of answer choices a. i and ii are true b. ii and iii are true c. i and iii are true d. i, ii and iii are true e. none of the above is true some students study grammer on the Internet change this sentence into passive When determining a country's level of development in terms of infrastructure, the factors to consider are? What is the de broglie wavelength in meters of a mosquito weighing 1.65 mg and flying at 1.40 m/s ? Does anyone know the You.Tuber, Luke Eich? let me know if you do :) have a good day!!!!! An A-frame picnic shelter at Lewis and Clark Historic Park in Iowa is shown. 40 degrees for one angle and 70 degrees for the other. What is the value of x?