For the proportion, find the unknown number n. 9.6/16 = n/3.2​

Answers

Answer 1

Answer:

n = 1.92

Step-by-step explanation:

Multiply both sides of the equation by 3.2

3.223.2=3.29.616

Simplify both sides of the equation.

n = 1.92

good luck, i hope this helps :)


Related Questions

On a 9 question multiple-choice test, where each question has 5 answers, what would be the probability of getting at least one question wrong?

Answers

Answer:

P(at least one wrong) = 1- P(all correct) =1-.25^6=1-1/4096=4095/4096. This assumes that the answers are picked at random. This kind of question is always the complement of an extreme binomial outcome.

Given ΔMNO, find the measure of ∠MNO.
Triangle MNO with segment LM forming a straight angle with segment MO and segment OP forming a straight angle with segment MO, the measure of angle NOP is 104 degrees, and segment MN and NO are marked congruent.
28 degrees
38 degrees
52 degrees
76 degrees
I know the answer is 28 degrees , I just am not sure how to work out this problem .

Answers

Answer:10907

Step-by-step explanation 10907

Answer:

The answer is 28

Step-by-step explanation:

Hope this helps,

have a great day

I need expert answers for this

I need expert answers for this

Answers

The last expression finally simplifies to cot β + tan α using quotient identity in trigonometric identities.

How to prove Trigonometric Identities?

We want to verify the trigonometric  identity;

cos (α - β)/(cos α sin β) = cot β + tan α

Now, according to trigonometric identities in mathematics, we know that;

cos (α - β) = (cos α cos β) + (sin α sin β)

Thus, plugging that back into our left hand side of the main question gives;

[(cos α cos β) + (sin α sin β)]/(cos α sin β)

Rewriting this expression by separating the denominator gives;

[(cos α cos β)/(cos α sin β)] + [(sin α sin β)]/(cos α sin β)

Using quotient identities, this can be simplified to;

cot β + tan α

Read more about Trigonometric Identities at; https://brainly.com/question/7331447

#SPJ1

A report from 2019 claims that the average salary of a retail worker is $15 per hour. You collect data from a random sample of 30 retail workers in Atlanta and calculate the average salary for workers from your sample to be $16.00 with a standard deviation of $2.80. Conduct a hypothesis test to determine if the true average hourly wage of a retail worker is different than the claim of $15.

Answers

Answer:

Hypothesis test conclusion , average salary  ≠ 15

Step-by-step explanation:

Null Hypothesis [H0] : Average Salary = 15  

Alternate Hypothesis [H1] : Average Salary ≠ 15

t = (x bar - μ) ÷ (s / √[n])

Sample Mean [x bar] = 16 , Population Mean [μ] = 15 , Standard Deviation [s] = 2.80 , [Sample number] n = 30

t = (16 - 15) / (2.80 / 5.47)

t = 1 / 0.5

t = 2

As calculated value ie 2 > tabulated critical value ie 1.96 , at significance level 0.05. So, we reject the Null Hypothesis.

Hence, as per Alternate Hypothesis, average salary  ≠ 15

Anyone got any Idea in this maths question. My answer was 63.

Anyone got any Idea in this maths question. My answer was 63.

Answers

Answer:

a: 2

b:93

Step-by-step explanation:

x=3  

y-5

a)

4x-2y    given

4(3)-2(5)  substitution

12-10        multiply

2               subtract

b)

2x^2+3y^2       given

2(3^2)+3(5^2)  substitution

2(9)+3(25)       solve exponent

18+75               multiply

93

Answer:

A would be 2 assuming x=3 and y=5

B would be 36 + 225 . So I believe the answer is 261

Step-by-step explanation:

I hope you ace your test

The volume of a cuboid is 540cm³. The length is 6cm and the width is 150mm. Work out the height of the cuboid in cm. ​

Answers

Step-by-step explanation:

To work out the height of the cuboid, we need to use the formula:

Volume = Length x Width x Height

We have been given the volume and the length, so we can substitute those values into the formula:

540 = 6 x Width x Height

Now we need to convert the width from millimeters to centimeters, so we divide it by 10:

150mm ÷ 10 = 15cm

Substituting this value into the formula:

540 = 6 x 15 x Height

Simplifying:

540 = 90 x Height

Dividing both sides by 90:

6 = Height

Therefore, the height of the cuboid is 6cm.

Find the length of the cable in the diagram below.

Find the length of the cable in the diagram below.

Answers

Answer:

13.4

Step-by-step explanation:

it is A square +b square =c square which is just 12×12=144 + 6×6=36 and then add them together which is 180, then just square root 180 can do it for every type of question like that and always remember the longest side is c, and the other two it doesn't matter which is A or B.

Y-x=2x-2/3y linear or non linear

Answers

─── ∙ ~εïз~ ∙ ───
The following is linear.
_________________

The degree of the equation is one. Then the equation y = (9/5)x is a linear equation.

What is the solution to the equation?

The distribution of weights to the variables involved that establishes the equilibrium in the calculation is referred to as a result.

A relationship between two or more parameters that, when shown on a graph, produces a linear model. The degree of the variable will be one.

The equation is given below.

y - x = 2x - (2/3)y

Simplify the equation for y, then we have

y + (2/3)y = 2x + x

(5/3)y = 3x

y = (9/5)x

The degree of the equation is one. Then the equation y = (9/5)x is a linear equation.

More about the solution of the equation link is given below.

https://brainly.com/question/545403

#SPJ2

Express 900 as a product of its prime factors in index form. Write the prime factors in ascending factors.

Answers

Answer:

900 = 2 * 2 * 3 * 3 * 5 * 5 = 2^2 * 3^2 * 5^2

Step-by-step explanation:

900/2 = 450

450/2 = 225

225/3 = 75

75/3 = 25

25/5 = 5

5/5 = 1

900 = 2 * 2 * 3 * 3 * 5 * 5 = 2^2 * 3^2 * 5^2

Fill in the blanks to complete the steps of this word problem: Moby can use his jetpack to travel 240 miles in 4 hours. How far can he travel in 10 hours?

If d represents the distance Moby travels, one way to write a proportion for this situation is
?
/4=d/
?
. Using cross multiplication gives us a new equation:
4/d
=4d. The final step is to divide by
?
, which tells us that Moby can travel
?
600miles in 10 hours.

Answers

Answer:

ummmm

Step-by-step explanation:

4271

7645

9822

0378

if n = 5 what does (4n - 2)(7-n) equal?

Answers

Given

(4n2)(7n)

To evaluate this expression for n=5, the first step is to replace it with the given value for n.

(452)(75)

Then you have to solve the operations inside both parentheses:

(202)(2)(18)(2)

Once solved the operation inside the parentheses terms, you can multiply the results

182=36

This means that (4n-2)(7-n) equals 36 when n=5

find the ratio for cos

find the ratio for cos

Answers

The value of cos E in the triangle is √2/2

What is trigonometric ratio?

Trigonometric Ratios are defined as the values of all the trigonometric functions based on the value of the ratio of sides in a right-angled triangle. Trigonometric ratio is only applied in right triangles.

Some of the trigonometric functions are ;

sinθ = opp/hyp

cosθ = adj/hyp

tanθ = opp/adj

In the triangle taking reference from angle E, 5 is the opposite and 5 is the adjascent and 5√2 is the hypotenuse.

Therefore;

cos E = 5/5√2

cos E = 1/√2

rationalizing the value;

cos E = √2/2

learn more about trigonometric ratio from

https://brainly.com/question/24349828

#SPJ1

which value represents solutions to cos(π/4-x) = √2/2sinx, where x [0, 2π)​

Answers

The solution of the trigonometric equation  are, x=π2,3π2

Trigonometric equation:

Given equation are,

           cos(π4x)=22sinx

We know that,  cos(AB)=cosAcosB+sinAsinB

         cos(π4x)=22sinxcosπ4cosx+sinπ4sinx=22sinx22cosx+22sinx=22sinx22cosx=0cosx=0x=π2,3π2

Hence, The solution of the trigonometric equation  are, x=π2,3π2

Learn more about the trigonometric equation here :

https://brainly.com/question/14421002

At the office supply store, a ream of paper costs $5.89 and a cartridge of ink costs $38.40. Delilah needs to buy 8 reams of paper and 6 cartridges of ink for her office. She needs to know how much money to bring, so estimate the cost of these supplies.

Answers

Answer:

Step-by-step explanation:

Delilah needs to buy 8 reams of paper which cost $5.89 each, $5.89 x 8 = $47.12

Delilah needs to buy 6 cartridges of ink which cost $38.40 each, $38.40 x 6 = $230.4

We then add $230.4 and $47.12

$230.4 + $47.12 = $277.52.

Delilah needs to bring $277.52 to cover the cost of her supplies.

How much does the distance increase for each hour since Dan crossed the bridge ?

Answers

Can I see a picture of the question?

what decimal is equivalent to 41 over 100 (pls keep it simple i am only in 5th grade )

Answers

Answer: 0.41

Step-by-step explanation:
To find the decimal point of a fraction, divide the numerator (the top half of the fraction) by the denominator (the bottom half of the fraction).

41 over 100 as a decimal point would be 41 divided by 100

Which produces the equivalent decimal, 0.41

P.S this is also how you find the percent of a number. To get the percent, move the decimal point 2 digits over (0.41 to 41.) and then add the percentage sign to the end of the number (41%)

0.41 = 41%

so 41 over 100 is 0.41, and 41 is also 41% of 100 (per cent means per 100)

Best of luck in 5th grade :)

There are 100 candies in a candy dish. It took 3 bags of candy to fill the dish. How many candies
were there in each bag? (3 points)
PLEASE HELP. ILL MARK YOU BRAINIEST!

Answers

Answer:

33 candies in each bag but there's 1 bag with 34 candies

Answer:

33 and 34 in 1

Step-by-step explanation:

Falling objects can be modeled with quadratic functions. One student was thinking about this
and wondered what might happen in a few different situations.
They wondered if they could get on top of a 126 foot tall building and throw a tennis ball
straight up in the air as hard as they could, how long would it take for the ball to hit the ground.
Based on their knowledge of gravity and how fast they can throw a ball, they created the
following equation, which relates time, t, in seconds to height, h(t), in feet.

h(t) = -14t² + 56t+126
a. Find the vertex of the equation and explain what it means in this context.

b. Find the x-intercepts and y-intercept and explain what they mean in this context.

This student also wonders how long it will take the ball to reach the 6th floor, which
they measured to be 72 feet from the ground. Find the time it will take for the ball to reach 72 feet.

Answers

a. The x-coordinate of the vertex (2) represents the time it takes for the ball to reach its maximum height, and the y-coordinate (182) represents the maximum height itself.

b. The tennis ball is initially at a height of 126 feet above the ground.

How to calculate the value

a. The x-coordinate of the vertex is 2. To find the y-coordinate, we substitute this value back into the equation:

h(2) = -14(2)² + 56(2) + 126

h(2) = -14(4) + 112 + 126

h(2) = -56 + 112 + 126

h(2) = 182

Therefore, the vertex of the equation is (2, 182). In this context, the vertex represents the highest point reached by the tennis ball during its trajectory. The x-coordinate of the vertex (2) represents the time it takes for the ball to reach its maximum height, and the y-coordinate (182) represents the maximum height itself.

b. In order to find the y-intercept, we set t equal to zero and evaluate h(t):

h(0) = -14(0)² + 56(0) + 126

h(0) = 126

The y-intercept is 126. In this context, the y-intercept represents the initial height of the ball when it is thrown. Therefore, the tennis ball is initially at a height of 126 feet above the ground.

Learn more about equations

https://brainly.com/question/2972832

#SPJ1

Consider the function, f(x)=2x-1

Consider the function, f(x)=2x-1

Answers

Answer:

1, -1 , -3 ,3

Step-by-step explanation:

function is a relationship between inputs where each input is related to exactly one output.

The values of f(x) for x = 1, 0, -1, 2 are 1, -1, -3,  and 3.

x        f(x)

1         1

0        -1

-1       -3

2        3

What is a function?

function is a relationship between inputs where each input is related to exactly one output.

Example:

f(x) = 2x + 1

f(1) = 2 + 1 = 3

f(2) = 2 x 2 + 1 = 4 + 1 = 5

The outputs of the functions are 3 and 5

The inputs of the function are 1 and 2.

We have,

f(x) = 2x - 1

For x = 1

f(1) = 2 - 1 = 1

For x = 0

f(0) = 0 - 1 = -1

For x = -1

f(-1) = -2 - 1 = -3

For x = 2

f(2) = 4 - 1 = 3

Thus,

The values of f(x) for x = 1, 0, -1, 2 are 1, -1, -3,  and 3.

Learn more about functions here:

https://brainly.com/question/28533782

#SPJ5

Graph the line. pllzzzzzzzz

Graph the line. pllzzzzzzzz

Answers

Answer:

Step-by-step explanation:

X: -2, -1, 0, 1, 2,...

Y: -2, -1, 0, 1, 2,...

(y=x)

Graph the line. pllzzzzzzzz

HELP ME raaaaaaaa NOWWWWWWWWWW

HELP ME raaaaaaaa NOWWWWWWWWWW

Answers

Answer:

C: EAF Is the correct answer

I think the answer is c

Given that sin(θ)=−2√13/13, and θ is in quadrant III, what is cos(θ)? Give your answer as an exact fraction with a radical, if necessary.

Answers

Answer:

Given that sin(θ) = -2√13/13 and θ is in quadrant III, we know that sin(θ) is negative and cos(θ) is also negative. We can use the Pythagorean identity to solve for cos(θ):

cos²(θ) + sin²(θ) = 1

cos²(θ) = 1 - sin²(θ)

cos(θ) = ±√(1 - sin²(θ))

Since cos(θ) is negative in quadrant III, we take the negative square root:

cos(θ) = -√(1 - sin²(θ))

Substituting sin(θ) = -2√13/13, we get:

cos(θ) = -√(1 - (-2√13/13)²) = -√(1 - 4/13) = -√9/13 = -3√13/13

Therefore, cos(θ) = -3√13/13.

A researcher wishes to study how the average weight Y (in kilograms) of children changes during the first year of life. He plots these averages versus the age X (in months) and decides to fit a least-squares regression line to the data with X as the explanatory variable and Y as the response variable. He computes the following quantities. r = correlation between X and Y = 0.9 J = mean of the values of X = 6.5 M = mean of the values of Y = 6.6 sJ = standard deviation of the values of X = 3.6 sM = standard deviation of the values of Y = 1.2 Find the slope of the least-squares line.
Explain it step by step

Answers

The slope of the least-squares line is 0.3

How to find the slope of the least-squares line?

Given:

r = correlation between X and Y = 0.9

J = mean of the values of X = 6.5

M = mean of the values of Y = 6.6

sJ = standard deviation of the values of X = 3.6

sM = standard deviation of the values of Y = 1.2

To find the slope of the least-squares line in this case, you can use the following formula:

Slope = r × (sM / sJ)

Substituting the given values for r, sJ, and sM:

Slope = 0.9 × (1.2 / 3.6) = 0.3

Thus, the slope of the least-squares line is 0.3. This tells you the rate at which the average weight of children changes as their age increases by one month

Learn more about slope of the least-squares line on:

brainly.com/question/23731608

#SPJ1

Multiply. Write your answer as a fraction in simplest form. 3/28 *8

Answers

Answer:

67=0,857142

Step-by-step explanation:

328×8

37×2

37×21=3×27×1

\green=67=0,857142

Answer:

....................

How many natural numbers are between 34 and 72? and, how many whole numbers between -2 and 25?

Answers

Answer:

There are 37 natural numbers between 34 and 72.

There are 25 whole numbers between -2 and 25.

Step-by-step explanation:

1. Natural numbers between 34 and 72

2. Whole numbers between -2 and 25

1.35,36,37,38,39,40,41,42,43,44,45,46,47,48,49,50,51,52,53,54,55,56,57,58,59,60,61,62,63,64,65,66,67,68,69,70,71.

2.0,1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24.

Which of the following points would fall on the line produced by the point-slope form equation y + 12 = 3(x - 4) when graphed​

Answers

Answer:

where r the points??

Step-by-step explanation:

give them atleast to find the ans.

Please answer this question

Please answer this question

Answers

Answer:

$40.00 is the answer

Step-by-step explanation:

also can you mark me as a brainlist if you get a chance

Answer: $40.00

Step-by-step explanation:

12 is 30% of 40

A triangle has sides with lengths of 14 yards 17 yards and 18 yard is it a right triangle yes or no

Answers

The given sides of the triangle are : 14 yards, 17 yards & 18 yards.

Condition of a right angle triangle :

1) The sum of square of Base and the perpendicular sides of traingle are always equal to the square of Hypotenuse.

Hypotenuse² = Perpendicular² + Base²

where, Hypotenuse, Base and perpendicular are express as :

2) The hypotenuse side of the right angle triangle is always the longest side.

In the given sides of triangle :

18 is the longest one, consider 18 as the Hypotenuse and remaing as the perpendicular and base

i.e.

Hypotenuse = 18, Base = 17 and perpendicular = 14

Substitute the value in the expression of the second condition :

Hypotenuse² = Perpendicular² + Base²

18² = 14² + 17²

324 = 196 + 289

324 = 485

LHS is not equal to RHS

Thus, expression doesnot hold

Hence the given sides of triangle is not a right angle triangle

Answer : The given sides of triangle is not a right angle triangle

A triangle has sides with lengths of 14 yards 17 yards and 18 yard is it a right triangle yes or no

Find the coordinates of the point P that lies along the directed line segment from A(-2,5) and B(2,-3) and partitions the segment in the ratio of 4 to 1.

A (1.6, -1.2)

B (1, 4.5)

C (1.2, -1.4 )

D (9, -2)

Part B

Find the coordinates of the point P that lies along the directed line segment from A(-3,-4) and B(5,0) and partitions the segment in the ratio of 2 to 3.
Group of answer choices

(-2.4, 0.2)

(0.2, -2.4)

(-0.2, 0.4)

(-0.4, 6)

Answers

Answer:

help

Step-by-step explanation:

What is the difference between the largest prime number less than 5o and the smallest comoosite number greater than 10

Answers

Answer:  35

A prime number is one where the only factors are one and itself. A composite number has other factors.

You'll have to look at the list of numbers from 1 to 50

In that list, 47 is the largest prime less than 50, and 12 is the smallest composite number greater than 10.

So 47-12 = 35

Other Questions
Using the normalization condition, show that the constant A has the value (mwo/hbarpie)0.25 for one dimensional simple harmonic oscillator in its ground state Plz Help !!!If the circumference of the earth is 24,900 miles, then what is the radius of the earth? What does that distance mean? Show your work. The norm of ______ is the well-accepted social standard dictating that we should treat other people as they treat us. A line passes through points (5,3) and (-5,-2). Another line passes through points (-6,4) and (2,-4). Find the coordinates (ordered pairs) of the intersection of the two lines. Step 1: Find the slope of each lineStep 2: Find the y-intercept of each lineStep 3: Write each line in slope-intercept form (y = mx + b)Step 4: Solve for the system. Find the point of intersection for the systemPlease help I will mark brainliest!!! Moving left 5 units would be shown as 'x+5'True False What meaning is revealed through the narrator's tone? Simplify:a) 3x + 5y - x + 2yb)3g + 5h + 4g - 2h a square table has am area of 15476cm^2 find the perimeter of the square Using the graph below, write the equation in point-slope form that uses the bolded point. May someone please help me out. Ive been stressing out. Alguin me puede ayudar A generator makes electricity from _____.chemical reactionskinetic energyheatfriction Passed by congress in 1833, the so-called _______________________ gave the president the power to use direct power to collect federal tariffs. What is the distance, in units, between the points (-3, 1) and (2, -1)? help pls Please help me ASAP!! T/F tanya believes the way her culture eats is much better than the portuguese way of preparing meals and dining. tanya is demonstrating What do aaron and bear nickname the portland street assisted living center(book restart by gorn korman) 4) Which is most likely the meaning of ameliorated? a) worsened b) improved c) continued d) renewed sort each condition into the appropriate bin depending on whether or not the lac operon would be transcribed. Mrs. Worthington purchased single slices of pizza for 24 students. The cost for 24 slices of pizza is $25.65. What is the cost for one slice of pizza? ______Complete the chart. SPANISH HELP!!Fill in the blank and decide whether the word needs to be imperfect or preterite. (Word options are in the parentheses)