Find the volume of a square based pyramid with a base length of 8 m and a height of 14 m.

Answers

Answer 1

\(V = \frac{1}{3} \times base \: area \: \times height \\ \)

\(V = \frac{1}{3} \times {8}^{2} \times 14 \\ \)

\(V = \frac{1}{3} \times 64 \times 14 \\ \)

\(V = \frac{896}{3} \: \: \: {m}^{3} \\ \)


Related Questions

1/8 (p + 24) = 9 step by step

Answers

Answer:

48

Step-by-step explanation:

Start by dividing both sides of the equation by 1/8.

9 divided by 1/8 is equivalent to 9 times 8, so we are left with

(p+24)= 72

Now subtract 24 from both sides to get p by itself.

72-24= 48

P= 48

Step-by-step explanation: In order to factor an integer, which is 8, we'll need to repeatedly divide it by ascending sequence of primes. (2, 3, 5). The number of times that each prime divides the original integer becomes Its exoponent.

In the example 1/8 (p + 24) = 9, Prime number 2 to the 3rd power equals 8.

\(\frac{1}{2^3} (p +24)=9\)

We now need to perform a multiplication. We can use this rule: \(\frac{A}{B} C=\frac{AC}{B}\)

In the example, the factors are in the new numerator are: 1, (p + 24), notice that all non-fraction factors are placed in the numerator. The factors in the denominator are: \(2^3\)

\(\frac{p + 24}{2^3} =9\)

Therefore, our answer is: 48.

p = 48.

Monique had $34 to spend on art supplies. After buying a sketchbook for $13.50, she purchased 4 charcoal pencils each for the same price. She had $11.30 left in change. How much is each charcoal pencil?

Answers

She had a total of $34 to spend on art supplies.

She purchased a sketchbook for $13.5 and 4 charcoal pencils each one for the same x price.

She had $11.30 left in change.

With the situation above, we can create the following equations:

Let x be the price of each charcoal pencil

\(\begin{gathered} 13.5+4x+11.30=34 \\ 4x+24.8=34 \\ 4x=34-24.8 \\ x=\frac{9.2}{4} \\ x=2.3 \end{gathered}\)

Each charoal pencil costs $2.3.

The phone company Splint has a monthly cellular plan where a customer pays a flat monthly fee and then a certain amount of money per minute used on the phone. If a customer uses 380 minutes, the monthly cost will be $173. If the customer uses 570 minutes, the monthly cost will be $249.

A) Find an equation in the form
y
=
m
x
+
b
,
where
x
is the number of monthly minutes used and
y
is the total monthly cost of the Splint plan.

Answer:
y
=




B) Use your equation to find the total monthly cost if 942 minutes are used.

Answer: If 942 minutes are used, the total cost will be
dollars.

Answers

The solution of the given problem of equation comes out to be total cost for 942 minutes is $1044.

What is an equation?

The similar symbol (=) is used in arithmetic equations to signify equality between two statements. It is shown that it is possible to compare various numerical factors by applying mathematical algorithms, which have served as expressions of reality. For instance, the equal sign divides the number 12 or even the solution y + 6 = 12 into two separate variables many characters are on either side of this symbol can be calculated. Conflicting meanings for symbols are quite prevalent.

Part A:

Given:

customer uses 380 minutes, the monthly cost will be $173.customer uses 570 minutes, the monthly cost will be $249.

To find an equation,

Where x is number of monthly minutes.

and y is total monthly of splint plan.

So, equation is:

\(\rightarrow \text{y} =\text{mx} +\text{b}\)

For the first case:

\(\rightarrow\bold{173 = 380x + b}\)

Second case:

\(\rightarrow\bold{249= 570x + b}\)

Solve for x:

\(\rightarrow{173 - 380\text{x}=249- 570\text{x}\)

\(\rightarrow{-207=-321\)

\(\rightarrow \text{x} =\dfrac{321}{207}\)

\(\rightarrow \text{x} =\dfrac{107}{69}\)

\(\rightarrow \text{x} \thickapprox1.55\)

For value of b

\(\rightarrow 173 = 380(1.55) + \text{b}\)

\(\rightarrow 173 - 589 = \text{b}\)

\(\rightarrow -416 = \text{b}\)

Part B:

\(\rightarrow \text{y} = 942(1.55) - 416\)

\(\rightarrow \text{y} = 1460.1 - 416\)

\(\rightarrow \text{y} \thickapprox1044\)

Therefore, the solution of the given problem of equation comes out to be total cost for 942 minutes is $1044.

To know more about the equation, visit:

https://brainly.com/question/29657983

How do you write in decimals eight and three tenths

Answers

Answer:

8.3

Step-by-step explanation:

Find the diameter of a circle whose circumference is 62.8 feet. Use 3.14 for pie.
a. 18
b. 22
c. 20
d. 21

Answers

The diameter of the circle whose circumference is 62.8 feet is 20 ft, thus the correct option is C.

How to find the diameter of the circle?

Remember that for a circle of diameter D, the circumference is given by the formula:

C = pi*D

Where pi = 3.14

Here we know that the circumference is 62.8 feet, then we can rewrite:

62.8 feet = 3.14*D

Now we can solve that equation for D, then we will get:

D = 62.8ft/3.14 = 20ft

The diameter is 20 ft, thus, the correct option is C.

Learn more about circles by reading:

https://brainly.com/question/1559324

#SPJ1

Gabrielle swam for 142 minutes during her first week of vacation. In her two weeks of vacation, she swam for a total of 347 minutes. How many more minutes did she swim for in the second week than in the first week?
Gabrielle swam for ????
more minutes in the second week than in the first week.

Answers

Answer:

she swam 63 minutes more than in the first

Step-by-step explanation:

first week only = 142 minutes

total week = 347

second week only = 347 - 142 = 205 minutes

205 - 142 = 63 minutes

Need answers please help

Need answers please help

Answers

Answer

Yes, zero is contained in the interval

Choose the graph of y=|x|-2 by translating the parent function

Answers

The graph of function y = |x| - 2 by translating the parent function is shown in image.

We have to given that;

Function is,

⇒ y = |x| - 2

Now, We can formulate;

Since, Function is,

⇒ y = |x| - 2

It is translation of parent function y = |x| by 2 units down.

Thus, The graph of function y = |x| - 2 by translating the parent function is shown in image.

Learn more about the transformation visit:

https://brainly.com/question/30097107

#SPJ1

Choose the graph of y=|x|-2 by translating the parent function

X-intercept is -2, y-intercept is -4Find the equation of a line with the x and y intercepts.

Answers

Equation of a line in slope-intercept form

\(y=mx+b\)

where m is the slope and the point (0, b) is the y-intercept.

The slope of the line that passes through the points (x₁, y₁) and (x₂, y₂) is calculated as follows:

\(m=\frac{y_2-y_1}{x_2-x_1}\)

Given that the x-intercept of this line is -2, then the line passes through (-2, 0), and given that the y-intercept is -4. then the line passes through (0, -4), then its slope is:

\(m=\frac{-4-0}{0-(-2)}=\frac{-4}{2}=-2\)

Substituting with m = -2 and b = -4 into the general equation, we get:

\(\begin{gathered} y=(-2)x+(-4) \\ y=-2x-4 \end{gathered}\)

Distribute and simplify these radicals.
√12 (-1+√5)
-4√3
-2√3+2√15
4√3
6√3

Answers

The simplified expression of √12 (-1+√5) is -2√3 + 2√15

How to simplify the radical expression?

The radical expression is given as:

√12 (-1+√5)

Express √12 as 2√3

So, we have:

√12 (-1+√5) = 2√3(-1+√5)

Evaluate the product

√12 (-1+√5) = (-2√3+2√15)


Remove the bracket

√12 (-1+√5) = -2√3 + 2√15

Hence, the simplified expression of √12 (-1+√5) is -2√3 + 2√15

Read more about radical expressions at:

https://brainly.com/question/8952483

#SPJ1

Here is a sphere with a radius of 4 feet. What is the Volume of the sphere? Express your answer in terms of π (exact answer).Work must be shown.
v=4/3*π*r^3
=4/3*π*4^3
=

Answers

Answer:

256

Step-by-step explanation:

V= 4/3×pi×r³V=4/3×3×4³=4⁴=256

what multiplies to -65 and adds to -8

Answers

Answer: The two numbers that multiply to -65 and add to -8 are -13 and 5.

Steps: Here are the steps to find two numbers that multiply to -65 and add to -8:

Write down the equation x * y = -65 where x and y are the two numbers you’re looking for.

Write down the equation x + y = -8.

Solve for one of the variables in one of the equations. For example, solving for x in the second equation gives us x = -8 - y.

Substitute this expression for x into the first equation: (-8 - y) * y = -65.

Solve this quadratic equation for y: -y^2 - 8y + 65 = 0.

Use the quadratic formula to find the values of y: y = (-(-8) +/- sqrt((-8)^2 - 4 * (-1) * 65)) / (2 * (-1)).

This gives us two possible values for y: -13 and 5.

Substitute these values back into one of the original equations to find the corresponding values of x. For example, when y = -13, we have x = -8 - (-13) = 5. When y = 5, we have x = -8 - 5 = -13.

So, the two numbers that multiply to -65 and add to -8 are -13 and 5.

HELP WILL GIVE BRAINLIEST AND DON’T TAKE THE POINTS IF YOU DON’T KNOW IT

HELP WILL GIVE BRAINLIEST AND DONT TAKE THE POINTS IF YOU DONT KNOW IT

Answers

87. 5 miles.

Since 1 inch=35 miles and there are 2.5 inches...
35 times 2 = 70
35/2= 17.5
70+17.5= 87.5

Hope this helps ☺️

Use De Morgan’s Law to find the indicated set

Use De Morgans Law to find the indicated set

Answers

Answer:

C' U (A U B')

Step-by-step explanation:

Using  DeMorgan's laws

(C ∪ A' ∩ B)' = C' U (A' ∩ B)'

(A' ∩ B)' = (A')' U B' = A U B'

So (C ∪ A' ∩ B)' = C' U (A U B')

A tourist information Center is between a Bus Station and a train Station when mapped on a grid, the Tourist Information center is located at (4,6) and the Bus Station is located at (-4,-10). The Train Station is located at point

Answers

Let's draw the grid with given points:

This drawing is approximate

You can use right triangles to solve it

A tourist information Center is between a Bus Station and a train Station when mapped on a grid, the

5.82-1.76 rounded to the nearest whole number

Answers

Answer:

4.06 = 4

Step-by-step explanation:

I WILL GIVE BRAINLIEST PLS PLS PLS HELP ITS DUE TOMORROW PLS DO ALL FOR BRAINLIEST

I WILL GIVE BRAINLIEST PLS PLS PLS HELP ITS DUE TOMORROW PLS DO ALL FOR BRAINLIEST

Answers

Answer: Sorry but I don't know which one to do and can you move it too the left a little bit so I may see the whole sentence?

Step-by-step explanation:

I am lost please help thank you all

I am lost please help thank you all

Answers

Answer:

Step-by-step explanation:

At least 9 means more than 9 and includes 9

x ≥ 9     and    [9,  +∞)

At most 9 means numbers less than 9

x≤9       and  (-∞, 9]

more than 9 means bigger than 9 but not including 9

x > 9     and    (9,  +∞)

fewer than 9 means less than 9 but not including 9

x<9       and  (-∞, 9)

strictly between 7 and 9   means between 7 and 9 but not including

7<x<9      and    (7,9)       (This is the only one I'm unsure of.  Strictly, not sure if it includes or doesn't include, usually it just says include or doesn't include)

between 7 and 7 inclusive.   means it's just =7  There's no boundaries

x=7

no more than 7 means less than 7 and includes 7

x ≤ 7   and   (-∞, 7]

John drove from here to San Antonio which is 180 miles away in 3 hours. Which rate is equivalent to
the rate at which John drove to San Antonio?

Answers

The rate that is equivalent to the rate at which John drove to San Antonio is 60 miles per hour

Which rate is equivalent to the rate at which John drove to San Antonio?

From the question, we have the following parameters that can be used in our computation:

John drove from here to San Antonio which is 180 miles away in 3 hours.

This means that

Distance = 180 miles

Time = 3 hours

Using the above as a guide, we have the following:

Speed = Distance/Time

Substitute the known values in the above equation, so, we have the following representation

Speed = 180/3

Evaluate

Speed = 60

Hence. the rate that is equivalent to the rate at which John drove to San Antonio is 60 miles per hour

Read more about speed at

https://brainly.com/question/24571540

#SPJ1

Use the following diagram for questions 21-24 in which G is the centroid of AABC, FC=35, AG=42, BF=57, and
DG=14.
Find AC
Find BG
Find GC
Find AE

Use the following diagram for questions 21-24 in which G is the centroid of AABC, FC=35, AG=42, BF=57,

Answers

G is the centroid of triangle ABC, AC = 85.5, BG = 38, GC = 23.33 (rounded to two decimal places), AE = 11.67 (rounded to two decimal places).

Describe Triangle?

A triangle is a closed, two-dimensional shape that consists of three straight sides and three angles. It is one of the basic shapes in geometry and is often used in various mathematical and scientific contexts.

The three sides of a triangle are usually named using lowercase letters a, b, and c, and the three angles are named using uppercase letters A, B, and C, with the opposite angles and sides having the same letter. The sum of the angles in a triangle is always 180 degrees, and this property is known as the Angle Sum Theorem.

Triangles can be classified based on their side lengths and angles. Based on the side lengths, triangles can be classified as:

Scalene triangle: A triangle in which all three sides have different lengths.

Isosceles triangle: A triangle in which two sides have the same length, and the third side has a different length.

Equilateral triangle: A triangle in which all three sides have the same length.

We can start by using the fact that G is the centroid of triangle ABC, which means that the medians from each vertex intersect at G. Therefore, we know that:

FC = 2/3 * EA (since FC is a median and EA is the corresponding segment of the opposite side)

AG = 2/3 * DC (since AG is a median and DC is the corresponding segment of the opposite side)

BF = 2/3 * AC (since BF is a median and AC is the corresponding segment of the opposite side)

We can use these relationships to find the lengths of AC, BG, GC, and AE:

AC = 3/2 * BF = 3/2 * 57 = 85.5

BG = 2/3 * AG = 2/3 * 2/3 * AC = 4/9 * 85.5 = 38

GC = 2/3 * FC = 2/3 * 35 = 23.33 (rounded to two decimal places)

AE = EA/2 = 2/3 * FC/2 = 1/3 * 35 = 11.67 (rounded to two decimal places)

Therefore, the answers are:

AC = 85.5

BG = 38

GC = 23.33 (rounded to two decimal places)

AE = 11.67 (rounded to two decimal places)

To know more about median visit:

https://brainly.com/question/2272632

#SPJ1

4 3/8 + 5 1/2= in fractions

Answers

Answer:

9 7/8

Step-by-step explanation:

1. 4 3/8 can be converted into the improper fraction 35/8, and 5 1/2 can be converted into 11/2.

2. Now that we have 35/8 + 11/2, we have to find a common denominator. Since 2 goes into 8 four times, we can turn 11/2 into 44/8 by multiplying the numerator and denominator (the top and the bottom numbers) by 4.

3. Now we have 35/8 + 44/8. At this point, the all we have to do is add the numerators (the top numbers). 35+44=79, so our answer is 79/8, which we can simplify to 9 7/8.

The graph shows a proportional relationship between the number of cans of tennis balls and the total number of tennis balls.
What does the point (2, 6) represent in this situation?

Tennis Balls graph showing number of tennis balls on the y axis and number of cans on the x axis. A line begins at the origin and passes through the points 1 comma 3 and 2 comma 6.

Answers

Answer:

There are 6 tennis balls in 2 cans.

Answer: c and e

Step-by-step explanation:

because im smart like that

Which describes the graph of y = −(x − 3)2 − 8?

A.Opens up with a vertex at (−3, −8)
B.Opens up with a vertex at (3, −8)
C.Opens down with a vertex at (−3, −8)
D.Opens down with a vertex at (3, −8)

Answers

D

Opens down with a vertex at (3, −8)

Will mark the brainliest

Will mark the brainliest

Answers

Answer:

4! click 4!

Step-by-step explanation:

A sign in a bakery gives these options:

12 cupcakes for $29
24 cupcakes for $56
50 cupcakes for $129
a. Find each unit price to the nearest cent.

Answers

The sοlutiοn οf the given prοblem οf unitary methοd cοmes οut tο be 12 cupcakes, 24 cupcakes, and 50 cupcakes will cοst rοughly $2.42, $2.33, and $2.58 per cupcake, respectively.

Define unitary methοd.

Tο cοmplete the assignment, use the tried-and-true straightfοrward methοdοlοgy, the real variables, and any pertinent details frοm the preliminary and specialized questiοns. In respοnse, custοmers might be given anοther οppοrtunity tο range sample the prοducts. In the absence οf such changes, majοr advances in οur knοwledge οf prοgrammes will be lοst.

Here,

We must divide the tοtal cοst by the quantity οf cupcakes in οrder tο determine the unit cοst οf each οptiοn:

Twelve cupcakes:

Unit cοst is calculated as Tοtal Cοst / Cupcakes.

=>  Unit cοst: $29 fοr 12 cupcakes.

=>  $2.42 is the unit cοst per cupcake.

Tο make 24 cupcakes:

Unit cοst is calculated as Tοtal Cοst / Cupcakes.

=> 24 cupcakes equals $56 fοr the unit.

=>  $2.33 is the unit cοst per cupcake.

50 cupcakes =

Unit cοst is calculated as Tοtal Cοst / Cupcakes.

=>  $129 fοr a unit οf 50 cupcakes.

=>  Unit cοst: $2.58 fοr each cupcake

As a result, 12 cupcakes, 24 cupcakes, and 50 cupcakes will cοst rοughly $2.42, $2.33, and $2.58 per cupcake, respectively.

To know more about unitary method  visit:

brainly.com/question/28276953

#SPJ1  

which of the following are perfect cubes 1)3375 2)8000 3)6859​

Answers

Answer:

all are perfect cubes

Step-by-step explanation:

you can just cube root the numbers and bom if it aint decimal its a perfect cube

Use the original price and the markup to find the retail price.

Original price: $40; Markup: 12.5%

Answers

41 dollarsStep-by-step explanation:

In the picture below, which lines are lines of symmetry for the figure?
A. 1 and 3
B. only 3
C. 2
D. 1, 2, and 3

In the picture below, which lines are lines of symmetry for the figure?A. 1 and 3B. only 3C. 2D. 1, 2,

Answers

A line of symmetry would separate a shape to make multiple shapes that are exactly the same.

The answer is C.2

Three ways to solve systems of equations ?

Answers

substitution, elimination, and graphing.
i know one is graphing:)

Can you please help with 44For the following exercise, sketch a graph of the hyperbola, labeling vertices and foci

Can you please help with 44For the following exercise, sketch a graph of the hyperbola, labeling vertices

Answers

We have the following equation of a hyperbola:

\(4x^2+16x-4y^2+16y+16=0\)

Let's divide all the equations by 4, just to simplify it

\(x^2+4x-y^2+4y+4=0\)

Just to make it easier, let's put the term if "x" isolated

\(x^2+4x=y^2-4y-4\)

Now we can complete squares on both sides, just remember that

\(\begin{gathered} (a+b)^2=a^2+2ab+b^2 \\ \\ (a-b)^2=a^2-2ab+b^2 \end{gathered}\)

Now let's complete it!

\(\begin{gathered} x^2+4x=y^2-4y-4\text{ complete adding 4 on both sides} \\ \\ x^2+4x+4=y^2-4y-4+4 \\ \\ (x+2)^2=y^2-4y \\ \end{gathered}\)

We already completed one side, now let's complete the side with y^2, see that we will add 4 again, then

\(\begin{gathered} (x+2)^2=y^2-4y \\ \\ (x+2)^2+4=y^2-4y+4 \\ \\ (x+2)^2+4=(y-2)^2 \end{gathered}\)

And now we can write it using the standard equation!

\(\begin{gathered} (y-2)^2-(x+2)^2=4 \\ \\ (y-2)^2-(x+2)^2=4 \\ \\ \frac{(y-2)^2}{4}-\frac{(x+2)^2}{4}=1 \end{gathered}\)

And now we can graph it like all other hyperbolas, the vertices will be:

\((-2,4)\text{ and }(-2,0)\)

And the foci

\(\begin{gathered} c^2=a^2+b^2 \\ \\ c^2=2^2+2^2 \\ \\ c^2=2\cdot2^2 \\ \\ c^{}=2\, \sqrt[]{2} \end{gathered}\)

Then the foci are

\((-2,2+2\, \sqrt[]{2})\text{ and }(-2,2-2\, \sqrt[]{2})\)

Now we can plot the hyperbola!

Can you please help with 44For the following exercise, sketch a graph of the hyperbola, labeling vertices
Other Questions
The individual assets invested by a partner in a partnership determine that partner's share of net income or loss for the year. revert back to that partner if the partnership liquidates. are jointly owned by all partners. determine the scope of authority of that partner. Conflict diamonds are sometimes called blood diamonds because __________. A. diamonds are more valuable than blood in parts of Africa B. money is often used to buy drugs and other health care supplies C. many people have been killed by rebel groups while mining diamonds D. the rarest diamond, and the most valuable, is a deep red color Please select the best answer from the choices provided A B C D a dark purple eggplant is mated with a white eggplant. the progeny are all white. this mode of inheritance of dark purple color is called group of answer choices complete recessiveness. complete dominance. incomplete dominance. a dominance series. codominance. simplify1.2+2(0.9x4)(9.1x+5.8) Which suggestion by the nurse meant to promote good dental health in the 15-month-old is inappropriate? A rather unbalanced goat jumps off a the air. Evan is dressed in his parachuting outfit, 2.0-m high. How much gravitational potential cliff. The goat has a mass of 50kg and the which brings his mass to a total of 90.0 kg. The energy does the girl gain? cliff is 450 m high. What is the kinetic aircraft takes the group to a height of 5000.00 m m= 36 kg before the jump. How much GPE does Evan gain Given: h: 2.0m Asked 5P6 energy of the goat just before it hits the ground? Which of the following are true? Check all that apply. a. Changing a firm's culture is usually a fast and easy process. b. Changing from a traditional organization to a team-based organization is an example of an organization culture change. c. All firms have cultural values consistent with high performance. d. The most important organizational mechanism affecting the socialization of workers is the behavior they see experienced employees exhibit Yu-Xi draws a triangle with two angles measuring 79 degrees and 23 degrees. What is the measure, in degrees, of the third angle? Jesus was conducting an experiment in science class. He took a flask and measured 50ml of vinegar into it. He then measured 10g of baking soda into a balloon and attachedthe balloon to the flask, covering the mouth of the flask completely. Next, he puts the flask with the balloon attached on a triple beam balance and finds the total pre-reactionmass of his experiment. Finally, leaving the flask/balloon set up on the balance, he lifts the balloon and mixes the chemicals. How should the total mass be affected by thechemical reaction? This is science How much fire resistance do model building codes typically require for the structural fram of a high rise building When the ignition is first turned on a click noise is heard from under the hood of a vehicle equipped with ETC. Technician A says that this is the normal operation of the ETC self-test. Technician B says that the ETC motor should not move unless the engine is running. Which technician is correct Where does Katniss live within District 12? Devise a test to demonstrate the validity of the following formulas. What values of A and B should be used to test these function thoroughly? (a). Sin (A+B) = Sin(A)cos(B)+cos(A)sin(B) (b). Sin (2A) = 2sin(A)cos(A) (c). Sin2 (A) = (1-cos (2A)). a client is receiving gentamicin to treat meningitis. the health care provider has ordered a peak serum level be drawn in association with the 07:00 dose, which will finish infusing at 07:30. when should the peak serum level be drawn? Some people view the rapid population growth in less-developed nations as the primary causeof environmental problems. Others see the high rate of resource use per person in more-developed countries asthe problem. Which factor do you think is more significant? Why? Why did civilization begin in ancient Egypt? A quality control inspector is inspecting newly produced items for faults. The inspector searches an item for faults in a series of independent fixations, each of a fixed duration. Given that a flaw is actually present, let p denote the probability that the flaw is detected during any one fixation (this model is discussed in "Human Performance in SamplingRequired:a. Assuming that an item has a flaw, what is the probability that it is detected by the end of the second fixation (once a flaw has been detected, the sequence of fixations terminates)?b. Give an expression for the probability that a flaw will be detected by the end of the nth fixation.c. If when a flaw has not been detected in three fixations, the item is passed, what is the probability that a flawed item will pass inspection?d. Suppose 10% of all items contain a flaw [P (randomly chosen item is flawed) = .1]. With the assumption of part (c), what is the probability that a randomly chosen item will pass inspection (it will automatically pass if it is not flawed, but could also pass if it s flawed)?e. Given that an item has passed inspection (no flaws in three fixations), what is the probability that it is actually flawed? Calculate for p = .5. Craig Corporation has just paid dividends of $2.25 per share, which the company projects will grow at a constant rate of 5% percent forever. If Craig Corporations shareholders require a 10 percent rate of return, what is the price of its common stock.A. $47.25B. $36.50C. $42.00D. $45.75 the one-year libor rate is 3% and the forward rate for the one- to two-year period is 3.2%. the three-year swap rate for a swap with annual payments is 3.2%. what is the libor forward rate for the 2 to 3 year period if ois zero rates for one, two, and three year maturities are 2.5%, 2.7%, and 2.9%, respectively. what is the value of a three-year swap where 4% is received and libor is paid on a principal of $100 million. all rates are annually compounded. which exposure technique sytem uses the rule to double of halve milliampere seconds (mAs) for every 5 centimeters of tissue