Find the amount A=? if $12,000 is invested with the APR rate of 5% compounded monthly for 8 years. Round the answer in two places.

Answers

Answer 1

When $12,000 is invested with a 5% APR compounded monthly for 8 years, the sum is $17,792.05 when rounded to two decimal places.

What is percent?

A percent is a unit of measurement that represents a fraction of 100. It is commonly used to express proportions, ratios, or rates of change. In mathematical terms, a percent is a dimensionless number that represents a ratio of a quantity to 100. For example, if you score 80 out of 100 on a test, you could say that you scored 80 percent on the test. This means that you got 80 out of 100 possible points, or that you answered 80 out of 100 questions correctly. Percentages can also be expressed as decimals or as fractions. For example, 25 percent can be expressed as 0.25 (as a decimal) or 1/4 (as a fraction). To convert a percentage to a decimal, divide it by 100. To convert a decimal to a percentage, multiply it by 100. To convert a fraction to a percentage, divide the numerator by the denominator and then multiply by 100. Percentages are widely used in many areas of mathematics, including finance, statistics, and economics. They provide a convenient way of expressing and comparing proportions, ratios, or rates of change, and they are often used to calculate percent changes, percent differences, or percent increases and decreases.

Here,

The amount A after 8 years can be calculated using the formula for compound interest:

A = P * (1 + r/n)ⁿˣ

where:

P is the principal amount ($12,000)

r is the annual interest rate (5%)

n is the number of times the interest is compounded per year (12 for monthly)

t is the number of years (8)

So, we have:

r = 5/100 = 0.05

n = 12

t = 8

A = $12,000 * (1 + 0.05/12)¹²*⁸

A = $12,000 * (1.004167)⁹⁶

A = $12,000 * 1.482404

A = $17,792.05

Rounding to two decimal places, the amount is $17,792.05 when $12,000 is invested with the APR rate of 5% compounded monthly for 8 years.

To know more about percent,

https://brainly.com/question/29172752

#SPJ1


Related Questions

A taxi cab driver charges a flat fee of $0.50 for every ride. In
addition, he charges $0.15 per mile. If Jose pays $5.00 for his
taxi ride, how many miles did he travel? Write and solve an
equation.

Answers

Answer:

12 miles

Step-by-step explanation:

A 16 foot ladder is leaning against a wall. If the top of the ladder slides down the wall at a rate of 3 feet per second, how fast is the bottom of the ladder moving along the ground when the bottom of the ladder is 4 feet from the wall

Answers

The bottom of the ladder moving at 11.625 ft/s along the ground.

How fast is the bottom of the ladder moving along the ground?

We have:

L = length of the ladder = 16 ft

Vy = rate at which top of ladder slides down = -3 ft/s

Vx = rate at which bottom of ladder slides

y = distance of the top of ladder from the ground

x = distance of bottom of ladder from wall = 4 ft

Using Pythagorean theorem

L² = x² + y²

16² = 4² + y²

y = 15.5 ft

Also using Pythagorean theorem

L² = x² + y²

Taking derivative both side relative to t

0 = 2x(dx/dt) + 2y(dy/dt)

0 = x·Vx + y·Vy

0 = 4Vx + 15.5(-3)

0 = 4Vx - 46.5

4Vx = 46.5

Vx = 46.5/4

Vx = 11.625 ft/s

Learn more about Pythagorean theorem on:

https://brainly.com/question/29229820

#SPJ1

You just completed a similarity transformation to show that ∆ABC is similar to ∆DEF. Let's see how the corresponding angles relate between these two similar triangles. Measure the angles of ∆ABC and ∆DEF and record their values.​

You just completed a similarity transformation to show that ABC is similar to DEF. Let's see how the

Answers

Answer: Edmentum answer!!

Step-by-step explanation:

You just completed a similarity transformation to show that ABC is similar to DEF. Let's see how the

Answer:

Enjoy

Step-by-step explanation:

Angle Measure Angle Measure

∠A 26.57 ∠D 26.57  

∠B 135  ∠E 135  

∠C 18.43  ∠F 18.43

Find the value of x. Please help. I am confused

Find the value of x. Please help. I am confused

Answers

Answer:

x=30

Step-by-step explanation:

Exterior Angle Theorem = the exterior angle of a triangle is equal to the sum of the two opposite interior angle

Thus, 2x+6+36=4x-18

2x+42=4x-18 add 18 to both side

2x+60=4x minus 2x

60=2x

x=30

I'LL GIVE BRAINLIEST TO WHOEVER ANSWERS THE QUESTION CORRECTLY!!!!

I'LL GIVE BRAINLIEST TO WHOEVER ANSWERS THE QUESTION CORRECTLY!!!!

Answers

Answer:

the first one

Step-by-step explanation:

Answer:

I am pretty sure the answer is B.

Step-by-step explanation:

Find the distance between the two points rounding to the nearest tenth (if necessary). (-1,8) and (8,5)​

Answers

Your answer to is 9.5

In science class, the average score on a lab report is 78 points, with all students scoring within 2.2 points of the average. If x represents a student's score, write an equation that represents the minimum and maximum scores.

a. |x + 2.2| = 78
b. |x − 2.2| = 78
c. |x + 78| = 2.2
d. |x − 78| = 2.2

Answers

The equation that represents the minimum and maximum scores is |x − 78| = 2.2

What is an equation?

An equation is an expression that shows the relationship between two or more numbers and variables.

Independent variables represent function inputs that do not depend on other values, while dependent variables represent function outputs that depends on other values.

Let x represents a student's score. Since the average score on a lab report is 78 points, Hence:

|x − 78| = 2.2

The equation that represents the minimum and maximum scores is |x − 78| = 2.2

Find out more on equation at: https://brainly.com/question/2972832

#SPJ1

Discuss the type of this operational problem and identify the
decision variables and objective function. Discuss the type of this
operational problem and identify the decision variables and
objective Product 1 would require a metal sheet of 0.250 {~m}^{2} , a glass sheet of 0.120 {~m}^{2} and 3 units of electrical components. Product 2 would require a metal sheet of 0.1

Answers

The given operational problem relates to production or manufacturing, with decision variables representing the quantities of the two products to be produced and an objective function representing the specific goal to be achieved (such as maximizing profit or minimizing costs).

Based on the information provided, it appears that the given scenario relates to a production or manufacturing problem. The problem involves the production of two different products, Product 1 and Product 2, and requires specific quantities of different resources or components.

Decision Variables:

The decision variables in this operational problem could include the quantities or amounts of each product to be produced. For example, let's denote the quantity of Product 1 as x and the quantity of Product 2 as y.

Objective Function:

The objective function represents the goal or objective of the problem. In this case, the objective could be to maximize or minimize a certain aspect, such as profit, production efficiency, or resource utilization. The specific objective function would depend on the specific goal of the problem. For example, if the objective is to maximize profit, the objective function could be expressed as a linear combination of the quantities produced and the associated costs and revenues.

Since the specific objective function is not provided in the question, it is not possible to determine it accurately. However, it could involve maximizing profit, minimizing production costs, or maximizing resource utilization efficiency, among other possibilities.

In summary, the given operational problem relates to production or manufacturing, with decision variables representing the quantities of the two products to be produced and an objective function representing the specific goal to be achieved (such as maximizing profit or minimizing costs).

Learn more about variable  from

https://brainly.com/question/28248724

#SPJ11

A piggy bank contains 2 pennies, 15 nickels, 3 dimes, and 2 quarters. Suppose a coin is selected at random. What is the chance that the coin is worth less than 20 cents?



HELPPP

Answers

Therefore, the chance of selecting a coin worth less than 20 cents is 17/22, which can also be expressed as a decimal or percentage as approximately 0.7727 or 77.27%.

To calculate the chance that a randomly selected coin from the piggy bank is worth less than 20 cents, we need to determine the total number of coins worth less than 20 cents and divide it by the total number of coins in the piggy bank.

The coins worth less than 20 cents are the 2 pennies and 15 nickels. The total number of coins worth less than 20 cents is 2 + 15 = 17.

The total number of coins in the piggy bank is 2 pennies + 15 nickels + 3 dimes + 2 quarters = 22 coins.

For such more question on decimal

https://brainly.com/question/28393353

#SPJ8

Can a child who is 4 feet tall walk under one of the arches without having to bend over?

Answers

Answer:

4 feet tall =121.92 cm

Whether they can walk under an arch without having to bend over depends on the height of the arch

but I think most of arches can because child are not that tall

A post office has 2 clerks. Alice enters the post office while 2 other customers, Bob and Claire, are being served by the 2 clerks. She is next in line. Assume that the time a clerk spends serving a customer has the Expo (lambda) distribution. a) What is the probability that Alice is the last of the 3 customers to be done being served? b) What is the expected total time that Alice needs to spend at the post office?

Answers

a) The probability that Alice is the last of the 3 customers to be done being served depends on the specific values of the exponential parameter (lambda) and the service times for Bob and Claire.

b) The expected total time that Alice needs to spend at the post office depends on the exponential parameter (lambda) and the expected service times for Bob and Claire.

a) To find the probability that Alice is the last of the 3 customers to be done being served, we need to consider the possible arrangements of Bob, Claire, and Alice being served.

There are two clerks, so there are two possible arrangements:

1. Bob is served by Clerk 1 and Claire is served by Clerk 2.

2. Claire is served by Clerk 1 and Bob is served by Clerk 2.

In both cases, Alice will be the last to be served.

Since the time spent by each clerk serving a customer follows the exponential distribution, the probability of each arrangement can be calculated as the product of the exponential probabilities for the corresponding service times.

Let's assume the exponential parameter (lambda) is the same for both clerks.

The probability that Alice is the last to be done being served is given by:

Probability = P(Arrangement 1) + P(Arrangement 2)

          = (lambda × exp(-lambda × time for Bob)) × (lambda × exp(-lambda × time for Claire)) +

            (lambda × exp(-lambda × time for Claire)) × (lambda × exp(-lambda × time for Bob))

b) To calculate the expected total time that Alice needs to spend at the post office, we need to consider the total time spent by Bob, Claire, and Alice.

Assuming the exponential distribution for service times, the expected total time is the sum of the expected times for each customer.

Expected Total Time = Expected Time for Bob + Expected Time for Claire + Expected Time for Alice

The expected time for each customer can be calculated as the reciprocal of the exponential parameter (1/lambda).

Fill in the values for lambda and any specific times for Bob and Claire to get more precise calculations.

Read more about Probability here: https://brainly.com/question/30034780

#SPJ11

The owner of a hotdog stand wants to make the price of her hotdogs reasonable but also maximize her profits. In the equation below,
x
represents the extreme values for the possible prices of a hotdog.


200
x
2
+2,800
x

4,800
=
0
To solve for
x
, the owner first factors –200 out of the trinomial expression and then factors the result. Which of these is one of those factors?

The owner of a hotdog stand wants to make the price of her hotdogs reasonable but also maximize her profits.

Answers

One of the factors of the quadratic polynomial -200x² + 2,800x - 4,800 = 0 is x - 2.

Given information:

The owner of a hotdog stand wants to make the price of her hotdogs reasonable but also maximize her profits.

First, we can simplify the equation by factoring out -200:

-200x² + 2,800x - 4,800 = 0

Next, we can simplify further by dividing each term by -200:

x² - 14x + 24 = 0

To factor this trinomial expression, we need to find two numbers that multiply to 24 and add to -14. These numbers are -2 and -12:

(x - 2)(x - 12) = 0

Therefore, the factor is x - 2, which corresponds to option A.

To learn more about the quadratic equation;

https://brainly.com/question/17177510

#SPJ1


What’s is the right answer choice to the picture.

Whats is the right answer choice to the picture.

Answers

Q has coordinates

(2,-4)

P is 6units left

P(2-6,-4)=(-4,-4)

R is 7units up

R(2,-4+7)R(2,3)

Option B

Answer:

B)  P (-4, 4) and R (2, 3)

Step-by-step explanation:

Q = (2, -4)

If ΔPQR is a right triangle, then

Missing point 1 will be on the x = 2 lineMissing point 2 will be on the y = -4 line

If PQ is 6 units, then

P = (2-6, -4) = (-4, -4) or

P = (2, -4+6) = (2, 2)

If QR is 7 units, then

R = (2-7, -4) = (-5, -4) or

R = (2, -4+7) = (2, 3)

Therefore, P (-4, 4) and R (2, 3)

Whats is the right answer choice to the picture.

Carl Heinrich ha latera filing cabinets that need to be placed along one wall of a storage closet. The filing cabinets are each 1 1/2 feet wide and the wall is 6 feet long. Decide how many cabinets can be placed along the wall

Answers

We'd be able to fit 4 cabinets total if there is no space in between them.

What is division ?

Compared to multiplication, division is the opposite. When you divide 12 into three equal groups, you get four in each group if three groups of four add up to 12, which they do when you multiply.The primary objective of division is to count the number of equal groups that are created or the number of individuals in each group after a fair distribution.

Given that: Carl heinrich has lateral filing cabinets that need to be placed along 1 wall of a storage closet.  that the filing cabinets are each 1 and a half feet wide, and the wall is 6 feet long

We know that we have a total of 18 feet that we want to break up so to speak amongst 1 and a half foot, so 1.5 foot wide cabinets.

So we will take 6 and divide that by 1.5 and we get a value of exactly 4 point. So double checking that when we have 4 times 1.5,we get a value of exactly 6 point, so you'd be able to fit 6 or part me we'd be able to fit 4 cabinets total if there is no space in between them.

To learn more about division visit:

brainly.com/question/1575906

#SPJ4

Given \sin A=\frac{5}{\sqrt{89}}sinA=
89


5

and that angle AA is in Quadrant I, find the exact value of \cos AcosA in simplest radical form using a rational denominator.

Answers

Answer:

First don't forget the [ tex ] [ /tex ] in order to execute the latex code.

Step-by-step explanation:

sinA=589sinA=89

cosAcosA = cos

The exact value of cosine of angle A for the considered case using a rational denominator in simplest radical form is 8√(89)/89

What are the six trigonometric ratios?

Trigonometric ratios for a right angled triangle are from the perspective of a particular non-right angle.

In a right angled triangle, two such angles are there which are not right angled(not of 90 degrees).

The slant side is called hypotenuse.

From the considered angle, the side opposite to it is called perpendicular, and the remaining side will be called base.

From that angle (suppose its measure is θ),

sin(θ)=Length of perpendicularLength of Hypotenusecos(θ)=Length of Base Length of Hypotenusetan(θ)=Length of perpendicularLength of basecot(θ)=Length of baseLength of perpendicularsec(θ)=Length of HypotenuseLength of basecsc(θ)=Length of HypotenuseLength of perpendicular

What is Pythagoras Theorem?

If ABC is a triangle with AC as the hypotenuse and angle B with 90 degrees then we have:

|AC|2=|AB|2+|BC|2

where |AB| = length of line segment AB. (AB and BC are rest of the two sides of that triangle ABC, AC being the hypotenuse).

Given that:

sinA=589

So, from this, we are given the ratio of perpendicular and hypotenuse from the perspective of angle A.

There must be existing a right triangle with same measure of angle A such that:

Perpendicular's length = P = 5 units

and Hypotenuse' length = H = 89 units.

Using Pythagoras theorem, we get:

Base' length = B as:

P2+B2=H2B=H2P2B=(89)252B=8925=64=8

(took positive root as B is representing length, a non-negative quantity).

Thus, Base is of 8 units length.

Thus, we get:

cos(θ)=Length of Base Length of Hypotenusecos(A)=BH=889

Rationalizing, we get:

cos(A)=889=889×8989cos(A)=88989

Thus, the exact value of cosine of angle A for the considered case using a rational denominator in simplest radical form is 88989

Learn more about Pythagoras theorem here:

https://brainly.com/question/12105522

The simple interest on a sum of money invested at 3% per annum for 2 years was $39.75.
Calculate the sum of money invested

Answers

Answer:

$37.50

Step-by-step explanation:

P+Prt=39.75P+P(2)(0.03)=39.751.06P=39.75P=$37.50

Identify the sampling technique used to obtain the following sample. the first 35 students leaving the library are asked how much money they spent on textbooks for the semester. Choose the correct sampling technique below. A. Systematic sampling B. Convenience sampling C. Cluster sampling D. Stratified sampling E. Random sampling

Answers

The sampling technique used to obtain the described sample is A. Systematic sampling.

In systematic sampling, the elements of the population are ordered in some way, and then a starting point is randomly selected. From that point, every nth element is selected to be part of the sample.

In the given scenario, the first 35 students leaving the library were selected. This suggests that the students were ordered in some manner, and a systematic approach was used to select every nth student. Therefore, the sampling technique used is systematic sampling.

To know more about sampling technique,

https://brainly.com/question/29076444

#SPJ11

What is the domain of the function in the graph?

A. 4≤y≤6
B. 20≤y≤70
C. 4≤x≤6
D. 20≤x≤70

What is the domain of the function in the graph?A. 4y6B. 20y70C. 4x6D. 20x70

Answers

Answer:

C. 4≤x≤6

Step-by-step explanation:

First things first, let’s learn the difference between domain and range. Domain is the spread of the x values and range is the spread of the y values. This means that in this question, you can rule out options A and B because those could potentially show range. Now we are left with options C and D. When we look at the first x coordinate, we see that it’s a 4. The last x coordinate is a 6. This means that the domain is greater than or equal to 4, but less than or equal to 6. You can also represent it as 4≤x≤6.


Hope that helps! Have a fantastic day!

Light sample A has a frequency of 4.30×1015 Hz and light sample B has a frequency of 8.70×1018 Hz. What is the wavelength of light sample A in meters? Light sample A has a frequency of 4.30×1015 Hz and light sample B has a frequency of 8.70×1018 Hz. What is the wavelength of light sample B in meters? Light sample A has a frequency of 4.30 ×1015 Hz and light sample B has a frequency of 8.70×1018 Hz. Based on frequency, which set gives the most correct description of the types of light for samples A and B respectively? Light sample A has a frequency of 4.30 ×1015 Hz and light sample B has a frequency of 8.70×1018 Hz. Based on frequency, which set gives the most correct description of the types of light for samples A and B respectively?

Answers

1) The wavelength of A is equal to 6.98 × 108meters

2) The wavelength of B is equal to 3.45 × 1011 meters

Since we know that the wavelength = speed of light / frequency

The speed of light is 3.00 × 108 meters per second.

For light sample A with a frequency of 4.30 × 10^15 Hz can be calculated as;

wavelength of A = (3.00 ×  108  m/s) / (4.30 × 10^15 Hz)

wavelength of A = 6.98 ×  108 meters

For light sample B with a frequency of 8.70 × 1018 Hz can be calculated as;

wavelength of B = (3.00 ×  108 m/s) / (8.70 ×1018 Hz)

wavelength of B = 3.45 ×  1011  meters

Learn more about wavelength:

brainly.com/question/31143857

#SPJ4


What is the expected standard deviation of stock A's returns
based on the information presented in the table? Outcome
Probability of outcome Stock A return in outcome :
Good 16% 65.00%
Medium 51% 17.0

Answers

The expected standard deviation of stock A's returns, based on the information presented in the table, is approximately 23.57%.

To calculate the expected standard deviation of stock A's returns, we first need to calculate the variance. The variance is the average of the squared deviations from the expected return, weighted by the probabilities of each outcome.

Given the information provided:

Outcome Probability Stock A Return

Good 16% 65.00%

Medium 51% 17.00%

Let's calculate the expected return first:

Expected Return = (Probability of Good × Stock A Return in Good) + (Probability of Medium × Stock A Return in Medium)

= (0.16 × 65.00%) + (0.51 × 17.00%)

= 10.40% + 8.67%

= 19.07%

Next, we calculate the squared deviations from the expected return for each outcome:

Deviation from Expected Return in Good = Stock A Return in Good - Expected Return

= 65.00% - 19.07%

= 45.93%

Deviation from Expected Return in Medium = Stock A Return in Medium - Expected Return

= 17.00% - 19.07%

= -2.07%

Now, we calculate the variance:

Variance = (Probability of Good × Squared Deviation in Good) + (Probability of Medium × Squared Deviation in Medium)

= (0.16 × (45.93%^2)) + (0.51 × (-2.07%^2))

= (0.16 × 0.2110) + (0.51 × 0.0428)

= 0.0338 + 0.0218

= 0.0556

Finally, we calculate the standard deviation, which is the square root of the variance:

Standard Deviation = √Variance

= √0.0556

= 0.2357 or approximately 23.57%

Therefore, the expected standard deviation of stock A's returns, based on the information presented in the table, is approximately 23.57%.

To learn more about standard deviation,

https://brainly.com/question/24298037

#SPJ4

13. A submarine was cruising at a depth of
153 m. It then rose at 4.5 m/min for 15 min.
a) What was the submarine's depth at the
end of this rise?
b) If the submarine continues to rise at the
same rate, how much longer will it take
to reach the surface?

Answers

At the end of the rise it is at 85.5m

It will take about 38 minutes to reach the surface

BRAINLIST if right please help

BRAINLIST if right please help

Answers

Answer:

The third one

Step-by-step explanation:

The answer would be number three .

For the following reaction, 19.4grams of iron are allowed to react with 9.41 grams of oxygen gas . iron (s)+ oxygen (g)⟶ iron(II) oxide (s) What is the maximum amount of iron(II) oxide that can be formed? __grams. What is the FORMULA for the limiting reagent?__. What amount of the excess reagent remains after the reaction is complete? ___grams.

Answers

The maximum amount of iron(II) oxide that can be formed is 19.37 grams.
The formula of the limiting reagent, since iron is the limiting reagent, the formula is Fe.
The amount of the excess reagent remaining after the reaction is complete is 6.62 grams.

To determine the maximum amount of iron(II) oxide that can be formed, we need to identify the limiting reagent. The limiting reagent is the reactant that is completely consumed and determines the maximum amount of product that can be formed.

To find the limiting reagent, we compare the moles of iron and oxygen gas using their respective molar masses. The molar mass of iron is 55.85 g/mol, and the molar mass of oxygen gas is 32 g/mol.

First, let's find the number of moles of iron:


Number of moles of iron = mass of iron / molar mass of iron
Number of moles of iron = 19.4 g / 55.85 g/mol = 0.347 mol

Next, let's find the number of moles of oxygen gas:


Number of moles of oxygen gas = mass of oxygen gas / molar mass of oxygen gas
Number of moles of oxygen gas = 9.41 g / 32 g/mol = 0.294 mol

Now, we need to compare the mole ratios of iron and oxygen gas from the balanced chemical equation:
4 moles of iron react with 1 mole of oxygen gas to form 2 moles of iron(II) oxide.

Using the mole ratios, we can determine the theoretical amount of iron(II) oxide that can be formed from each reactant:
Theoretical moles of iron(II) oxide from iron = 0.347 mol * (2 mol FeO / 4 mol Fe) = 0.1735 mol
Theoretical moles of iron(II) oxide from oxygen gas = 0.294 mol * (2 mol FeO / 1 mol O2) = 0.588 mol

Since the theoretical moles of iron(II) oxide from iron (0.1735 mol) are less than the theoretical moles of iron(II) oxide from oxygen gas (0.588 mol), iron is the limiting reagent.


To find the maximum amount of iron(II) oxide that can be formed, we use the limiting reagent:


Maximum moles of iron(II) oxide = theoretical moles of iron(II) oxide from iron = 0.1735 mol


Now, we need to convert moles of iron(II) oxide to grams using its molar mass:
Molar mass of iron(II) oxide = 111.71 g/mol


Maximum mass of iron(II) oxide = maximum moles of iron(II) oxide * molar mass of iron(II) oxide


Maximum mass of iron(II) oxide = 0.1735 mol * 111.71 g/mol = 19.37 grams

Therefore, the maximum amount of iron(II) oxide that can be formed is 19.37 grams.

As for the formula of the limiting reagent, since iron is the limiting reagent, the formula is Fe.

Finally, to determine the amount of the excess reagent remaining after the reaction, we need to calculate the moles of oxygen gas that reacted:


Moles of oxygen gas that reacted = theoretical moles of oxygen gas - moles of oxygen gas used


Moles of oxygen gas that reacted = 0.294 mol - (0.347 mol * (1 mol O2 / 4 mol Fe)) = 0.294 mol - 0.0868 mol = 0.2072 mol

To find the mass of the excess reagent remaining, we multiply the moles by the molar mass of oxygen gas:


Mass of excess reagent remaining = moles of excess reagent remaining * molar mass of oxygen gas
Mass of excess reagent remaining = 0.2072 mol * 32 g/mol = 6.62 grams

Therefore, the amount of the excess reagent remaining after the reaction is complete is 6.62 grams.

Learn more about limiting reagent from the given link

https://brainly.com/question/23661051

#SPJ11

Tarea: investigar y demostrar la potenciación a 0, porque un numero elevado a 0 es igual a 1.

Answers

So the power of 0 of any number is 1 because any number to the zero power is just the product of no numbers at all, which is the multiplicative identity, 1.

When we multiply a number by itself n times, we are actually raising it to the nth power of that number.

For instance, 2² = 2*2 = 4

2³ = 2*2*2 = 8

3³ = 3*3*3 = 27 and so on.

Therefore, when we multiply a number by itself zero times, we are actually not multiplying anything at all.

This is known as raising a number to the zero-th power.

Since we aren't adding anything, we should anticipate receiving zero.

However, zero is also a very unique number.

It is known as the additive identity because it is the only number that can be added to any other number without changing it.

Simply said, for any number x, x + 0 = x, making 0 the only such number.

Therefore, if adding no numbers at all results in the additive identity, it makes obvious that multiplying no numbers at all should result in the multiplicative identity.

Multiplicative identity is the only number, after all, that can be multiplied by another number without that other number altering.

In other words, the multiplicative identity is 1, since 1*x = x for every other number x.

Thus, the rationale behind any number.

To know more about power of number here

https://brainly.com/question/22075377

#SPJ4

Kevin has a rectangular
swimming pools that is 12
feet by 16 feet. He wants
to put a rope diagonally
across the pool. How long
does the rope need to
be?

Answers

Answer:

20 feet long

Step-by-step explanation:

To solve this you need to use the Pythagorean theorum, a2+b2=c2, where c is the length of rope needed and A and B are the side lengths. Think of it like a right triangle.

So, the equation is

122+162=c2

Which is then

144+256=c2

c2=400

And the possible values of c are 20 and -20.

From here we know the answer cannot be -20 because you cannot have a negatively long length of rope, so the answer must be 20 feet.

Answer:

20 feet

Step-by-step explanation:

Use Pythagoras's theorem.

\(A^{2}+B^{2} =C^{2} \12^{2} +16^{2}= C^{2} \400 = C^{2} \\sqrt{400}= \sqrt{C^{2}\\\)

20 = C

Hello I need help asap pleaseeee

Hello I need help asap pleaseeee

Answers

You have to do 165 times 38 because for each mile she drives she gets 38 pounds and theres 165 miles so that would mean that the company pays her 6,270p.

in a box there are three types of chocolates
there are 6 plain chocs
8 milk chocs
10 white chocs
ben takes at random a choc from the box
a) what is the probability that ben takes a plain choc ?

Answers

Answer:

25% , 6/24 , .25

Step-by-step explanation:

The total number of chocolates in the box are 24 and the number of plain chocolates is 6. 6/24 is .25 in decimal and 25% in percentage

Which, if any, of the following generalized formulas does not exist for interhalogen compounds? (X and Y represent different halogens.)
XY
XY2
XY3
XY5
All the above can represent stable interhalogen compounds.

Answers

All the above can represent stable interhalogen compounds. Interhalogen compounds are formed when different halogens combine with each other.

The general formula for interhalogen compounds is given by XYn, where X and Y represent different halogens, and n represents the number of Y atoms bonded to the X atom. The interhalogen compounds can have different stoichiometries, resulting in different values of n. Therefore, all the given formulas, XY, XY2, XY3, and XY5, can represent stable interhalogen compounds, depending on the specific combination of halogens and their bonding arrangements.

Hence, none of the given formulas does not exist for interhalogen compounds, as all of them can be valid representations of stable interhalogen compounds.

To learn more about    compounds click here: brainly.com/question/31217310

#SPJ11

5.86
What is the value
of the 8?

Answers

Answer:

0.8 or Tenths place. I hope this helped.

someone help and explain

someone help and explain

Answers

We can fill in the boxes to make each equation complete as follows:

1. x³x⁹ = x¹²

2. x⁷/x³ = x⁴

3. 1/x⁻⁵ = x⁵

4. (7b³c⁵)³ = 343b⁹c¹⁵

How to solve the exponents

To solve the exponents as provided above, the rules have to be factored in. One of the rules is that when multiplying exponents of the same base, we simply add their powers together. So, we have the powers of 3 and 9 for the first expression and they add up to 12.

1. x³x⁹ = x³ ⁺ ⁹ = x¹²

For the second expression, the rule of exponents says that when dividing, we will subtract the powers. This gives us x⁴ for the second expression.

2. x⁷/x³ = x⁷ ⁻ ³ = x⁴

Learn more about exponents here:

https://brainly.com/question/13669161

#SPJ1

Other Questions
Solve for y when x = 2. y = 4x +2 * I REALLY NEED HELP HHDJDICUHDHHEI HELP ME BRUH Brenda, a job applicant at Trade Winds Corp., discovers that the job she is applying for requires her to be a union member before being hired. She also learns that this arrangement is illegal under the National Labor Relations Act. In the context of the security provisions related to union membership, this Trade Winds Corp. has a(n) __________ arrangement. Prove by induction that 2 2^1 +3 2^2 + ... + (n + 1) 2^n = n2^n+1 for all n = = 1, 2, 3, .... 13+(x+8)= i am so lost three project teams are working on parts of a single project. the parts are highly dependent on each other. the leader of the team indicates that this might create conflicts when the outputs from the three teams are combined. the project manager needs to provide guidance to the team lead. what guidance should be offered? Breadth of a rectangle i 5cm le than length. If breadth of the rectangle i 13cm ,find the area What Allied victories halted Japan's advance? What is the most important element of freedom to the freedom to the freedmen who gathered for this meeting Plz help me well mark brainliest if you are correct!!... PLEASE DOUBLE CHECK. I AM REPOSTING THIS AFAIN. DO NOT COPYPASTE OLD ANSWER. THEY ARE ALL WRONGOn January 1, 2020, the dental partnership of Angela, Diaz, and Krause was formed when the partners contributed $48,000, $75,000, and $78,000, respectively. Over the next three years, the business rep Which of the following statements would most likely have been spoken by a supporter of Andrew Jackson?A- "The government is morally responsible for making sure the infrastructure is up to date."B- "The president should veto legislation that expands the federal government."C- "Sectional divides between Americans are our biggest concern."D- "Limiting the use of alcohol will greatly improve our society" 2.54 g of beryllium chloride are completely dissolved into 50.00 mL of water inside a beaker. (a) Draw a particulate representation of all species in the beaker after the solute has dissolved. Your diagram should include at least one beryllium ion, one chloride ion, and four water molecules. Make sure the atoms and ions are correctly sized and oriented relative to each other (b) What is the concentration of beryllium and chloride ions in the beaker? A solution of 0.850 Mlead nitrate is then titrated into the beaker, causing a precipitate of lead (II) chloride to form. (c) (d) Identify the net ionic reaction occurring in the beaker. What volume of lead nitrate must be added to the beaker to cause the maximum precipitate formation? (e) What is the theoretical yield of precipitate? Students performing this experiment suggested the following T (f) techniques to separate the precipitate from the water. Their teacher How many strands of DNA are copied in transcription?O 1O423 as governor of new york, franklin d. roosevelt group of answer choices tended to withdraw from the public. transformed the state's and the states' residents economic and political outlook forever. followed a conservative budget policy that made any deficit impossible. was one of the few governors to mobilize his state's limited resources to help the unemployed and poor. Use the fact that the gradient is perpendicular to the tangentline of the level curve to find the tangent line to x2+ 4xy + 9y2= 21 at thepoint (2, 1). Your answer may be in parametric form or implicit form. pls helpSimplify. (-2w^4v^3)^4 Write your answer without parentheses. The two kinds of cells are found in two major groups of organisms. Identify thegroups.2 Label the parts of the cells. Why was President George Washingtons proclamation of neutrality in 1793 important for U.S. foreign policy goals?It allowed the United States to secure colonies throughout Latin America.It kept the United States from becoming entangled in European wars.It allowed the United States to maintain troops throughout Europe.It secured an open trade policy between the United States and Asia. Write the equation of the line that has a slope of 3 and goes through (-2,5)in point-slope form. * 6.3 code practice edhisiveYou should see the following code in your programming environment:Import simplegui Def draw_handler(canvas): # your code goes hereFrame = simplegui.creat_frame(Testing , 600, 600)Frame.set_canvas_background(Black)Frame.set_draw_handler(draw_handler)Frame.start()Use the code above to write a program that, when run, draws 1000 points at random locations on a frame as it runs. For an added challenge, have the 1000 points be in different, random colors.