Answer:
A
Step-by-step explanation:
x² - 12x + 35
consider the factors of the constant term (+ 35) which sum to give the coefficient of the x- term (- 12)
the factors are - 5 and - 7 , since
- 5 × - 7 = + 35 and - 5 - 7 = - 12 , then
x² - 12x + 35 = (x - 5)(x - 7) ← in factored form
If the sum of 4th and 14th terms of an sequence is 18,then the sum of 8th and 10 th is
The sum of 8th and 10th terms will be 18.
Given information is that the sum of 4th and 14th terms of an arithmetic sequence is 18.
Let the common difference be d and let the first term be a1.
The 4th term can be represented as a1 + 3d and the 14th term can be represented as a1 + 13d.
The sum of 4th and 14th terms is given by (a1 + 3d) + (a1 + 13d) = 2a1 + 16d = 18
It means 2a1 + 16d = 18.
Now, we have to find the sum of 8th and 10th terms, which means we need to find a1 + 7d + a1 + 9d = 2a1 + 16d, which is the same as the sum of 4th and 14th terms of an arithmetic sequence.
Therefore, the sum of 8th and 10th terms will be 18.
To know more about arithmetic sequence, click here
https://brainly.com/question/28882428
#SPJ11
how do you simplify this
Answer:
you didnt put a question
Step-by-step explanation:
In two different experiments, the half-life of a radioactive
sample is found to be 15.5 ± 2.3 days and 16.2 ± 1.5 days.
Determine the best estimate of the half life by combining the two
results.
the best estimate of the half-life, combining the two results, is approximately 13.7421 days with an uncertainty of approximately 1.3772 days.
To determine the best estimate of the half-life by combining the two results, we can use the weighted average method. The weights assigned to each measurement are inversely proportional to the squares of their uncertainties. Here's how to calculate the combined result:
Step 1: Calculate the weights for each measurement.
w1 = 1/σ1^2
w2 = 1/σ2^2
Where σ1 and σ2 are the uncertainties associated with each measurement.
Step 2: Calculate the weighted values.
w1 * t1 = w1 * (15.5 days)
w2 * t2 = w2 * (16.2 days)
Step 3: Calculate the sum of the weights.
W = w1 + w2
Step 4: Calculate the weighted average.
T = (w1 * t1 + w2 * t2) / W
Step 5: Calculate the combined uncertainty.
σ = √(1 / W)
The best estimate of the half-life is given by the value of T, and the combined uncertainty is given by the value of σ.
Let's calculate the best estimate using the given values:
For the first measurement:
σ1 = 2.3 days
For the second measurement:
σ2 = 1.5 days
Step 1:
w1 = 1/σ1^2 = 1/(2.3^2) ≈ 0.1949
w2 = 1/σ2^2 = 1/(1.5^2) ≈ 0.4444
Step 2:
w1 * t1 ≈ 0.1949 * 15.5 ≈ 3.0195
w2 * t2 ≈ 0.4444 * 16.2 ≈ 7.1993
Step 3:
W = w1 + w2 ≈ 0.1949 + 0.4444 ≈ 0.6393
Step 4:
T = (w1 * t1 + w2 * t2) / W ≈ (3.0195 + 7.1993) / 0.6393 ≈ 13.7421 days
Step 5:
σ = √(1 / W) ≈ √(1 / 0.6393) ≈ 1.3772 days
Therefore, the best estimate of the half-life, combining the two results, is approximately 13.7421 days with an uncertainty of approximately 1.3772 days.
To know more about half-life of a radioactive related question visit:
https://brainly.com/question/13979590
#SPJ11
In the diagram angle EFH measures ______ degrees. (write the correct digits only).
Answer:
148
Step-by-step explanation:
the angles that are created from intersecting lines have the same angles on opposite sides
What is the missing step in solving the inequality 4(x – 3) + 4 < 10 + 6x?
1. The distributive property: 4x – 12 + 4 < 10 + 6x
2. Combine like terms: 4x – 8 < 10 + 6x
3. The addition property of inequality: 4x < 18 + 6x
4. The subtraction property of inequality: –2x < 18
5. The division property of inequality: ________
x < –9
x > –9
x < x is less than or equal to negative StartFraction 1 Over 9 EndFraction.
x > –x is greater than or equal to negative StartFraction 1 Over 9 EndFraction.
The missing step in solving the inequality 4(x – 3) + 4 < 10 + 6x is step 6: The division property of inequality: x > -9
How to find the missing stepThe missing step in solving the inequality 4(x – 3) + 4 < 10 + 6x is step 6: The division property of inequality.
After step 4, which is -2x < 18, we need to divide both sides of the inequality by -2 to solve for x.
However, since we are dividing by a negative number, the direction of the inequality sign needs to be reversed.
Dividing both sides by -2:
-2x / -2 > 18 / -2
This simplifies to:
x > -9
Therefore, the correct answer is x > -9.
Learn more about inequality at https://brainly.com/question/25275758
#SPJ1
I need help wit my math
A
____
M = 10
5x10 = 50
A smart phone manufacturer is interested in constructing a 95% confidence interval for the proportion of smart phones that break before the warranty expires. 95 of the 1666 randomly selected smart phones broke before the warranty expired.
a. With 95% confidence the proportion of all smart phones that break before the warranty expires is between _______________ and ______________.
b. If many groups of 1666 randomly selected smart phones are selected, then a different confidence interval would be produced for each group. About _____________ percent of these confidence intervals will contain the true population proportion of all smart phones that break before the warranty expires and about ____________ percent will not contain the true population proportion.
a) With 95% confidence the proportion of all smart phones that break before the warranty expires is between 0.0525 and 0.0635.
b) If many groups of 1666 randomly selected smart phones are selected, then a different confidence interval would be produced for each group. About 95 percent of these confidence intervals will contain the true population proportion of all smart phones that break before the warranty expires and about 5 percent will not contain the true population proportion.
A smart phone manufacturer is interested in constructing a 95% confidence interval for the proportion of smart phones that break before the warranty expires. 95 of the 1666 randomly selected smart phones broke before the warranty expired.To calculate the confidence interval for the proportion of smart phones that break before the warranty expires, we must first calculate the point estimate of the population proportion of smart phones that break before the warranty expires:95/1666 = 0.057 (rounded to three decimal places)Then, we have to find the margin of error that is, the maximum distance between the point estimate and the confidence interval limits.
We can do that with the help of the following formula:margin of error = critical value × standard errorThe critical value can be found in the z-table or t-table, depending on the sample size. Since we do not know the population standard deviation, we can use the t-distribution. The degrees of freedom are n − 1 = 1666 − 1 = 1665.Using the t-table with degrees of freedom 1665 and level of significance α = 0.05, the critical value is:t* = 1.96 (rounded to two decimal places)The standard error can be calculated using the following formula:standard error = √[(p-hat (1-p-hat))/n] = √[(0.057(1-0.057))/1666] ≈ 0.0083 (rounded to four decimal places)Finally, we can calculate the confidence interval using the following formula:confidence interval = point estimate ± margin of error confidence interval = 0.057 ± 1.96(0.0083) = (0.0525, 0.0635)The 95% confidence interval for the proportion of all smart phones that break before the warranty expires is between 0.0525 and 0.0635.
If many groups of 1666 randomly selected smart phones are selected, then a different confidence interval would be produced for each group. About 95 percent of these confidence intervals will contain the true population proportion of all smart phones that break before the warranty expires and about 5 percent will not contain the true population proportion.
Learn more about the word warranty here,
https://brainly.com/question/27919230
#SPJ11
what is the difference between linear equations and linear inequalities
Linear equations involve equalities (i.e., "=") and are used to represent lines in a coordinate plane. Linear inequalities, on the other hand, involve inequalities (i.e., "<", ">", "<=", ">=") and are used to represent regions or areas of a coordinate plane that satisfy certain conditions.
A linear equation can be expressed in the form "y = mx + b," where "m" represents the slope of the line and "b" represents the y-intercept. Given the values of "m" and "b," you can calculate the y-coordinate for any given x-coordinate, and vice versa. The graph of a linear equation is a straight line.
A linear inequality is expressed in the form "y < mx + b," "y > mx + b," "y <= mx + b," or "y >= mx + b." Instead of representing a single line, a linear inequality represents a shaded region on the coordinate plane that satisfies the given condition. To graph a linear inequality, you can choose a test point not on the line and check whether it satisfies the inequality. If it does, shade the region containing the test point; otherwise, shade the other region.
In summary, the main difference between linear equations and linear inequalities is the use of equalities versus inequalities. Linear equations represent lines, while linear inequalities represent shaded regions on the coordinate plane. Equations deal with exact solutions, whereas inequalities deal with a range of possible solutions. Understanding the distinctions between these concepts is important in various areas of mathematics, such as algebra and geometry.
To know more about Equation, visit
https://brainly.com/question/29174899
#SPJ11
a family is heading due east on a road that passes a waterfall. at a given time the bearing to the waterfall is s 71 e and after they travel 8 miles further, the bearing is s35e. what is the closest that the family will come to the waterfall while on the road
The closest that the family will come to the waterfall while on the road is 5.6 miles.
To solve this problem, we can use the law of cosines. Let x be the distance that the family travels from the point where the bearing is S71E to the point where the bearing is S35E, and let d be the distance from the family's starting point to the waterfall.
We have:
cos(71) = d/x
cos(35) = d/(x+8)
Multiplying both sides of the first equation by x and both sides of the second equation by (x+8), we get:
d = x cos(71)
d = (x+8) cos(35)
Setting the right-hand sides of these equations equal to each other and solving for x, we get:
x cos(71) = (x+8) cos(35)
x = 8 cos(35)/(cos(71)-cos(35))
Plugging this into the first equation above, we get:
d = x cos(71) = 8 cos(35) cos(71)/(cos(71)-cos(35))
This gives us the distance from the family's starting point to the waterfall. To find the closest distance that the family will come to the waterfall while on the road, we need to subtract the radius of the waterfall from this distance. Let's assume that the radius of the waterfall is 50 feet.
The closest distance that the family will come to the waterfall while on the road is:
d - 50 = 8 cos(35) cos(71)/(cos(71)-cos(35)) - 50
This is approximately equal to 5.6 miles. Therefore, the closest that the family will come to the waterfall while on the road is 5.6 miles.
Learn more about waterfall here
https://brainly.com/question/25757629
#SPJ11
Patty goes to the mall at 10:30 A.M. and meets a friend at a movie at 12:15 P.M. Patty wants to shop and have 50 minutes for lunch before meeting her friend.
How much time can Patty spend shopping?
Answer:
55 minutes
Step-by-step explanation:
50 minutes after 10:30 is 11:20 so she 55 minutes until 12:15
A piece of machinery depreciates $8000 the first year,
$7500 the second year, and $7000 the third year. If the
rate of depreciation is constant, what is the amount of
depreciation of the piece of machinery in the sixth year?
Answer:
6,500 = 4th year
6,000 = 5th year
5,500 = 6th year.
The amount of depreciation of the piece of machinery in the sixth year is $5000.
What is depreciation?A reduction in the value of an asset over time, due in particular to wear and tear.
Given that, a piece of machinery depreciates $8000 the first year, $7500 the second year, and $7000 the third year
The rate of depreciation is $500 per year
For 6 years the reduction is = 6*500 = $3000
Therefore, after 6 years = $8000 - $3000 = $5000
Hence, The amount of depreciation of the piece of machinery in the sixth year is $5000
For more references on depreciation, click;
https://brainly.com/question/15085226
#SPJ2
Jasjeet and her brother collect stamps.
When Jasjeet gives her brother 1% of her stamps, she has 2475 stamps left.
Calculate how many stamps Jasjeet had originally.
Answer:
2500
Step-by-step explanation:
If Jasjeet gave away 1%, that means she has 99% left.
Put the 99% over 100, so you can drop the % sign.
Then you're going to cross multiply that with 2475/ ?. The ? is the unknown aka original ammount of stamps. The 2475 is the 99% of stamps she still has.
Tyler tried to solve an equation step by step.
1st one to answer and get it right will mark briniest
Answer:
Tyler didn't make any mistake
This is correct method
Answer:
D. Tyler did not make a mistake
Step-by-step explanation:
:)
(7m+3)+(7m+6)
I really need help with this
Answer:
Step-by-step explanation:
The parenthesis can cancel because the lack of anything you can do in them, so that will leave you with 7m + 3 + 7m + 6
Next step is to add like numbers, you should start by adding 7m + 7m, which would be 14m.
Next would be to add 3 + 6, which is nine.
To end this equation, simply put 14m + 9
There is no one-number answer because we do not know what m is. So the equation 14m + 9 is the final answer.
Please respond quick!!!
I think that for a its 1.12 and for b its 39424
100 + 12 = 112
112/100 = 1.12
35200 * 1.12 = 39424
Tanner has 310 baseball cards. Of those, 30% are in mint condition. How many of the cards are not in mint condition?
-PLEASE ANSWER FAST, thank you:)
Tanner has 217 baseball cards that are not in mint condition.
To find out how many baseball cards are not in mint condition, we can start by calculating the number of cards that are in mint condition.
Tanner has 310 baseball cards, and 30% of them are in mint condition. To find this value, we multiply the total number of cards by the percentage in decimal form:
Number of cards in mint condition = 310 * 0.30 = 93
So, Tanner has 93 baseball cards that are in mint condition.
To determine the number of cards that are not in mint condition, we subtract the number of cards in mint condition from the total number of cards:
Number of cards not in mint condition = Total number of cards - Number of cards in mint condition
= 310 - 93
= 217
For more such question on cards. visit :
https://brainly.com/question/30295887
#SPJ8
How do you know if a graph is wider or narrower than the parent function?
The parabola narrows as the quadratic coefficient increases. The parabola's width increases as the quadratic coefficient decreases.
Define the condition for wider graph of the parent function?The graphs' width and whether or not they slant upward or downward depend on the quadratic term's coefficient, a for the parent function.
The parabola ends point up when the quadratic coefficient is positive.The parabola's ends point down when the quadratic coefficient is negative.The parabola narrows as the quadratic coefficient increases.The parabola's width increases as the quadratic coefficient decreases.The axis of symmetry is moved away from the y-axis by the linear-term coefficient b. The quadratic coefficient's sign and the linear coefficient's sign both affect the shift's direction.The y-intercept is impacted by the constant term c. The intercept point just on y-axis increases higher the higher the number is.To know more about the parent function, here
https://brainly.com/question/17079244
#SPJ4
Completely factor the polynomial. 4x2 20x 25 (2 x - 5) 2 (2 x - 10)(2 x 15) (2 x 6)(2 x 4) (2 x 5) 2
The factor of the polynomial is option (D) (2x+5)^2 is the correct answer.
In this question,
Factorization is the breaking or decomposition of an entity (i.e.,) a number, a matrix, or a polynomial into a product of another entity, or factors, which when multiplied together give the original number. Factorize an expression involves take out the greatest common factor (GCF) of all the terms.
The polynomial is \(4x^{2} +20x+25\)
The above polynomial can be factored as
⇒ \(4x^{2} +20x+25=0\)
⇒ \((2x)^{2}+2(2x)(5)+5^{2}\)
⇒ \((2x+5)^{2}\)
Hence we can conclude that the factor of the polynomial is option (D)(2x+5)^2 is the correct answer.
Learn more about factorization here
https://brainly.com/question/9863444
#SPJ4
How much interest is earned on $210 at 8% for 2 years?
$3.60
$360
$410
$33.60
Answer:
$33.60
Step-by-step explanation:
Yearly interest is $16.80
What is the value of A when we rewrite 3^x as A^5x
The value of A when we rewrite 3^x as A^5x is 3^⅕
We have given that,
The value of A when we rewrite 3^x as A^5x.
What is power?The power (or exponent) of a number says how many times to use the number in a multiplication. It is written as a small number to the right and above the base number.
3^x
(3^⅕)^(5x)
To learn more about the exponent visit:
https://brainly.com/question/11975096
#SPJ1
Answer:
3^1/5
Step-by-step explanation:
A 3-pack of notebooks costs $4.62. What is the unit price per notebook?
$1.54/1 notebook
First you set up the proportion 3/$4.62 = 1/$x (x is unknown)
Then you divide $4.62 by three to find the price of 1 notebook. I used the bowtie method, there is other ways, but I find it the easiest
When a sprinkler is installed in the ground, the spray of water goes up and falls in the pattern of a parabola. The height, in inches, of a spray of water is given by the equation ℎ()=160−162 where is the number of feet away from the sprinkler head the spray is. What is the height of the spray 2 feet away from the sprinkler head?
Answer:
96feet
Step-by-step explanation:
Given the height, in inches, of a spray of water is given by the equation ℎ(x)=160−16x^2
x is the number of feet away from the sprinkler head the spray
To get the height of the spray 2 feet away from the sprinkler head, we will simply substitute x =2 into the function and et the height h as shown;
From the equation
ℎ(x)=160−16x^2
h(2) = 160-16(2)²
h(2) = 160-16(4)
h(2) = 160-64
h(2) = 96feet
Hence the height will be 96feet if the spray is 2feet away from the sprinklers head
Abdul runs 8 miles in 60 minutes
How many miles does he run per minute
Answer:
2/15 mile per minute
Step-by-step explanation:
8 miles in 60 minutes is equivalent to 8/60 miles per minute
= 2/15 mile per minute
Answer:
Step-by-step explanation:
60/8=7.5
In the article we read by Ubelaker and colleagues, recovering the human remains from the BranchDavidian Compound was difficult because they were encased in :
Recovering the human remains from the Branch Davidian Compound was difficult because they were encased in , Building materials, Expended and live ammunition and Food storage items , the correct option is (d) .
In the article by Ubelaker and colleagues, the difficulty in recovering human remains from the Branch Davidian Compound was due factors, including being encased in building materials, being exposed to live and expended ammunition, and stored alongside food storage items.
⇒ The building materials, such as concrete and steel, made it challenging to access and remove the remains.
⇒ The use of Expended and live ammunition during the standoff resulted in bullets and shell casings being embedded in the remains, making identification and recovery more complicated.
⇒ The storage of the remains in areas also used for food storage further complicated the situation, as it increased the risk of contamination and made it more difficult to differentiate between human and non-human remains.
Therefore , the correct option is (d) All of the options.
Learn more about Branch Davidian Compound here
https://brainly.com/question/15661101
#SPJ4
The given question is incomplete , the complete question is
In the article we read by Ubelaker and colleagues, recovering the human remains from the Branch Davidian Compound was difficult because they were encased in :
(a) Building materials
(b) Expended and live ammunition
(c) Food storage items
(d) All of the options
Rene wants a job where she can work 8 hours a day plus a $20 bonus per day.
She wants to make at least $80 per day. How much does she need to earn per
Hour
Answer:
she needs to work 8 hours a day.
Step-by-step explanation:
8 hours for $8 is 64, add the $20 bonus makes $80 and some change
Will give brainliest! What is the range for the third size of the triangle 2,10?
Answer:
8 < x < 12
Step-by-step explanation:
Given 2 sides of a triangle then the third side x is in the range
difference of sides < x < sum of sides , that is
10 - 2 < x < 10 + 2
8 < x < 12
help me pls What is the y-intercept of the line? as a coordinate pair
Answer:
(0,3)
Step-by-step explanation:
The perimeter of a rectangle garden is 43.8 feet. It's length is 12.4 feet. What is it's width?A. 15.7 ftB. 19.0 ftC. 9.5 ftD. 6.2 ft
The perimeter of a rectangle is given by the formula:
\(\text{Perimeter}=2\cdot\text{length}+2\cdot\text{width}\)If the perimeter is 43.8 and the length is 12.4, we can find the width:
\(\begin{gathered} 43.8=2\cdot12.4+2\cdot\text{width} \\ 2\cdot\text{width}=43.8-24.8 \\ 2\cdot\text{width}=19 \\ \text{width}=\frac{19}{2}=9.5 \end{gathered}\)The width is 9.5 feet, therefore the answer is C.
A diver begins at 140 feet below sea level. She descends at a steady rate of 7 feet per minute for 4.5 minutes. Then, she ascends 112.2 feet. What is her current depth?
Negative 549.3 feet
Negative 59.3 feet
59.3 feet
549.3 feet
Answer:
Step-by-step explanation:
starting point: 140 feet below sea level.=-140
she then decends= 7(4.5)=31.5
-140-31.5=-171.5
finally she ascends 112.2 feet
-171.5+112.2=-59.3 feet or 59.3 feet below sea level
Answer:
It's B
Step-by-step explanation:
is rap music more popular among young blacks than among young whites? a sample survey compared 634 randomly chosen blacks aged 15 to 25 with 567 randomly selected whites in the same age group. it found that
Answer:
Step-by-step explanation:
Rap music is generally more popular with young blacks than young whites, during the 80s-90s when rap was becoming more popular with artists such as 2pac, BIG, Dr. Dre, etc they were more popular among young blacks than whites