factor the exprresion 27+12

Answers

Answer 1
27+12 is 39. We can factor out a 3 and get,

3(13)

Related Questions

Use the given conditions to write an equation for the line in the indicated form.
Passing through (2, 2) and perpendicular to the line whose equation is y = 4x + 7;
point-slope form
A)y=-4x-10
B)y-2=-1/4(x-2)
C)y-2=1/4(x+2)
D)y-2=1/4(x-2)

Answers

Answer:

B) y - 2 = (-1/4)(x - 2)

Step-by-step explanation:

Start with the equation of the given line: y = 4x + 7.

Determine the slope of the given line, which is 4.

Since the perpendicular line has a negative reciprocal slope, the perpendicular line's slope is -1/4.

Use the point-slope form of a linear equation: y - y₁ = m(x - x₁), where (x₁, y₁) is the given point and m is the slope.

Substitute the values x₁ = 2 and y₁ = 2 into the point-slope equation: y - 2 = (-1/4)(x - 2).

Simplify by distributing -1/4 to (x - 2): y - 2 = (-1/4)x + 1/2.

Add 2 to both sides to isolate y: y = (-1/4)x + 1/2 + 2.

Simplify further: y = (-1/4)x + 5/2.

The equation in point-slope form for the line passing through (2, 2) and perpendicular to y = 4x + 7 is y - 2 = (-1/4)(x - 2), which matches option B.

Xavier saved money to purchase a bike that originally cost $250, not including tax. The store discounted the bike by 20%. What is the discounted price he will pay for the bike, not including tax?

Question 1 options:

$50.00


$300.00


$270.00


$200.00


HELP I WILL GIVE BRAINLIEST

Answers

D. $200


This is how I do it-
250 x .20 = 50
(The .20 is the same as 20%)

My answer is 50, which is 20% of 250. So 250-50=

$200.00 :)

Juan randomly surveys students in the seventh grade to learn about their favorite type of music. Of 30 respondents, 8 liked to listen to rap mus Part A Based on Juan's data, how many of the 150 students in seventh grade like to listen to rap music?​

Answers

Answer: 40

Step-by-step explanation:

150 / 30 = 5

8 x 5 = 40

40 of 150 students is equivalent to 8 of 30 students.

which inequality statement below is true?
7.745966… > √59
7.745966… < √59

Answers

The inequality statement 7.745966… < √59 is true.

The symbol √59 represents the square root of 59, which is approximately 7.681146. The value 7.745966… is a decimal representation of the square root of 59 that has been rounded to three decimal places. Because 7.681146 is less than 7.745966, the inequality statement 7.745966… < √59 is true.

What values of b satisfy 3(2b + 3)² = 36?

Answers

Answer:

The values of b that satisfy the equation are:

b = (2√3 - 3) / 2

b = (-2√3 - 3) / 2

In other words, b can take the values (2√3 - 3) / 2 or (-2√3 - 3) / 2.

Step-by-step explanation:

To find the values of b that satisfy the equation 3(2b + 3)² = 36, we can solve for b by following these steps:

1. Divide both sides of the equation by 3:

  (2b + 3)² = 12

2. Take the square root of both sides:

  √[(2b + 3)²] = √12

  Simplifying further:

  2b + 3 = ±√12

3. Subtract 3 from both sides:

  2b = ±√12 - 3

4. Divide both sides by 2:

  b = (±√12 - 3) / 2

  Simplifying further:

  b = (±√4 * √3 - 3) / 2

  b = (±2√3 - 3) / 2

Therefore, the values of b that satisfy the equation are:

b = (2√3 - 3) / 2

b = (-2√3 - 3) / 2

In other words, b can take the values (2√3 - 3) / 2 or (-2√3 - 3) / 2.

At the candy store you can buy 20 ounces of Jolly Ranchers for $1. You could also buy 30 ounces of Skittles
for $1.50. Which cost more per ounce? Explain.

Answers

Cost of Jolly Ranchers per ounce

1÷20=0.05$

Cost of Skittles per ounce

1.5÷30=0.05$

Same prices

Scores on a University exam are normally distributed with a mean of 68 and a standard deviation of 9. Using the 68-95-99.7 rule, what percentage of students score above 77?

Answers

Answer:

0.1585, or 15.85%

Step-by-step explanation:

On a standard bell curve, the area from 77 to 100 falls within the 95.45 to 99.73 range.

99.73 - 68.27 = 31.46

31.46 / 2 =15.73

99.7 - 68 = 31.7

31.7 / 2 = 15.85


1) A student has a Math placement of Math 111, Math 100 and Math 102+. What course should the student first start with according to their placement results to then continue to get to Math 103E?

Answers

The placement results provided, the student should start with Math 100.

The placement results indicate that the student has placements for Math 111, Math 100, and Math 102+. Math 111 typically corresponds to a higher-level course than Math 100, and Math 102+ implies a placement beyond Math 102.

To progress towards Math 103E, it is essential to follow the recommended course sequence. Usually, Math courses are designed to build upon previously learned concepts and skills. Starting with Math 100 would provide the foundational knowledge necessary to succeed in subsequent courses.

Therefore, the student should first start with Math 100, and upon successful completion, they can proceed to Math 103E. It is important for the student to consult with their academic advisor or the mathematics department at their institution for specific course placement and sequencing information to ensure they are following the appropriate path.

for such more question on placement

https://brainly.com/question/16927451

#SPJ8

Help with the slop for each one thanks

Help with the slop for each one thanks

Answers

Answer:

13. zero slope

14. 1/2

15. undefined slope

16.-3/2 slope


Select the correct answer.

Which sentence correctly describes a data set that follows a normal distribution with a standard deviation of 4 and a mean of 14?

68% of the data points lie between 10 and 14.
68% of the data points lie between 8 and 12.
68% of the data points lie between 10 and 18.
68% of the data points lie between 10 and 16.

Answers

Answer:

68% of the data points lie between 10 and 18.

Step-by-step explanation:

one standard deviation to left of mean = 14 - 4 =10

one standard deviation to right of mean = 14 + 4 = 18

68% of data is in this region.

so the answer is 68% of the data points lie between 10 and 18.

i need help please help me

here is the picture

i need help please help me here is the picture

Answers

Therefore, the answers for the given composite functions are:

f(g(7)) = 814

g(f(4)) = 151

f(g(8)) = 898

f(f(2)) = -4

What is function?

A function from a set X to a set Y allocates precisely one element of Y to each element of X. The set X is known as the function's domain, while the set Y is known as the function's codomain. Originally, functions were the idealization of how a variable quantity depended on another quantity.

Here,

To evaluate function compositions, we substitute the inner function into the outer function and simplify.

(a) To evaluate f(g(7)), we first find g(7):

g(7) = 7(7)^2 + 9(7) + 3 = 343 + 63 + 3 = 409

Now we can substitute g(7) into f(x):

f(g(7)) = f(409) = 2(409) - 4 = 814

(b) To evaluate g(f(4)), we first find f(4):

f(4) = 2(4) - 4 = 4

Now we can substitute f(4) into g(x):

g(f(4)) = g(4) = 7(4)^2 + 9(4) + 3 = 112 + 36 + 3 = 151

(c) To evaluate f(g(8)), we first find g(8):

g(8) = 7(8)^2 + 9(8) + 3 = 7(64) + 72 + 3 = 451

Now we can substitute g(8) into f(x):

f(g(8)) = f(451) = 2(451) - 4 = 898

(d) To evaluate f(f(2)), we first find f(2):

f(2) = 2(2) - 4 = 0

Now we can substitute f(2) into f(x):

f(f(2)) = f(0) = 2(0) - 4 = -4

To know more about function,

https://brainly.com/question/29633660

#SPJ1

can someone help me with this (will give brainliest)
please view the attached image

can someone help me with this (will give brainliest)please view the attached image

Answers

Answer:

rate: 4                             rate: -2

starting: 3                       starting: 30

y= -4x + 3                        y= -2x + 30

rate: 2                            rate: 6

starting: -4                     starting: 6

y= 2x -4                          y= 6x + 6

Step-by-step explanation:

m=riserun=y2y1x2x1

^equation to find slope

To also find b, the starting value,  you need to take any point given and substitute it back into the equation with the slope.

However, these problems give you the y-int already [it is the point like (0,y)]

7-3/1-0 = 4/1

rate: 4

starting: 3

y= 4x + 3

28-30/1-0= -2/1

rate: -2

starting: 30

y= -2x + 30

-2 - (-4)/1-0 = 2/1

rate: 2

starting: -4

y= 2x -4

6-0/1-0 = 6/1

rate: 6

starting: 6

y= 6x + 6

Solve
The equation
X=-3x +20

Answers

X=-3x+20
Add 3x to both sides to move the -3x over
4x=20
Then do 20 divided by 4
X=5

A person leaves home and walks 4 miles west, then 5 miles southwest.

How far from home is she?

miles

In what direction must she walk to head directly home?

degrees North of East

A person leaves home and walks 4 miles west, then 5 miles southwest.How far from home is she? milesIn

Answers

The person is approximately 8.43 miles from home, and they need to walk in the direction of approximately 26.6 degrees east of north to head directly home.

To determine the distance from home, we can use the concept of vector addition. The person walks 4 miles west, which can be represented as a vector (-4, 0) in a coordinate plane. Then, they walk 5 miles southwest, which can be represented as a vector (-3.54, -3.54) since southwest is a combination of west and south. Adding these two vectors together gives us (-7.54, -3.54).

To find the magnitude or distance from home, we use the Pythagorean theorem. The distance is given by sqrt((-7.54)^2 + (-3.54)^2) = 8.43 miles (approximately).

To determine the direction to head directly home, we need to find the angle between the vector (-7.54, -3.54) and the positive x-axis. We can use trigonometry to find this angle. The tangent of the angle is given by the ratio of the y-coordinate to the x-coordinate, which is -3.54 / -7.54. Taking the inverse tangent of this value gives us approximately 26.6 degrees.

For more such questions on direction

https://brainly.com/question/30016405

#SPJ8

Find the value of 33.​

Answers

The anwser would be 33 because 33=33 as an absolute value

The absolute value of a number is how far away the number is from zero. The absolute value is ALWAYS positive.

What is the absolute value of -33?

The negative version of the number is also | 33 |

If m∠J = 44°, what is m∠I?

Answers

Answer:

6666

Step-by-step explanation:

24,783 is invested, part at 15% and the rest 9%. If the interest earned from the amount invested at 15% exceeds the interest earned from the amount invested at 9% by $894.09, how much is invested at each rate?

Answers

If 24,783 is invested, part at 15% and the rest 9%. If the interest earned from the amount invested at 15% exceeds the interest earned from the amount invested at 9% by $894.09: 51,960 is invested at 15%, and 22,823 is invested at 9%.

How to find the amount invested?

Let's x represent the amount invested at 15%

Let the  amount invested at 9% = 24,783 - x.

Interest earned at 15% is 0.15 * x

Interest earned at 9% is 0.09 * (24,783 - x)

We can set up the equation: 0.15x = 0.09 * 24,783 - 0.09x + 894.09

Solving for x:

0.06x = 24,783 * 0.09 + 894.09

0.06x = 2223.47 + 894.09

0.06x = 3117.56

x = 51,960

So,

(24,783 - x)

24,783 - 51,960

= 22,823

Therefore 51,960 is invested at 15%, and 22,823 is invested at 9%.

Learn more about amount invested here:https://brainly.com/question/25300925

#SPJ1

Trigonometry, Need Help please!!

Trigonometry, Need Help please!!

Answers

The value of cos(2α + β) using trigonometric identities is; -1.0155

How to solve trigonometric Identities?

We are given;

α = sin⁻¹(4/5)

β = tan⁻¹(12/5)

Thus;

sin α = 4/5

tan β = 12/5

From trigonometric ratios, we can say that;

cos α = 3/5

sin β = 12/13

cos β = 5/13

We know from trigonometric identities that  cos (a + b) = cos a cos b - sin a sin b.

Thus;

cos(2α + β) = cos 2α cos β - sin 2α sin β

Thus;

cos(2α + β) = 2(3/5) * (5/13)) - ((2 * 4/5 * 12/13))

= 0.4615 - 1.477

= -1.0155

Read more about Trigonometric Identities at: https://brainly.com/question/7331447

#SPJ1

$500 is invested in an account earning 7% interest compounded quarterly. Find the value
after 8 years.

Answers

The amount of the investment after 8 years will be, $4,357.64

Given, $500 is invested in an account earning 7% interest compounded quarterly.

We have to find the value of the invested amount after 8 years,

as, Amount = P(1 + r/100)^t

where, P is the amount of money invested, r is the rate of interest and t is the amount of time

Amount = 500(1 + 7/100)^(8×4)

Amount = 500(1.07)^32

Amount = 500×8.715

Amount = 4,357.635

So, the amount of the investment after 8 years will be, $4,357.64

Hence, the amount of the investment after 8 years will be, $4,357.64

Learn more about Compound Interest here https://brainly.com/question/24274034

#SPJ9

which of the following shows the slope and y-intercept on graph?​

which of the following shows the slope and y-intercept on graph?

Answers

Answer:

ans is slope =-2; y-intercept = -6

The sector of a circle has an area of 104pi/9
square inches and a central angle with measure 65 degree
. What is the radius of the circle, in inches?

Answers

Answer:

Given:

Area of the sector (A) = 104π/9 square inches

Central angle (θ) = 65 degrees

The formula for the area of a sector of a circle is:

A = (θ/360) * π * r^2

We can rearrange this formula to solve for the radius (r):

r^2 = (A * 360) / (θ * π)

Plugging in the given values:

r^2 = (104π/9 * 360) / (65 * π)

r^2 = (104 * 40) / 9

r^2 = 4160 / 9

r^2 ≈ 462.22

Taking the square root of both sides:

r ≈ √462.22

r ≈ 21.49

Therefore, the radius of the circle is approximately 21.49 inches.

Answer: 8 inches

Step-by-step explanation:

One day a store sold 36 sweatshirts. White ones cost​ $10.95 and yellow ones cost $11.50. In​ all, ​$404.65 worth of sweatshirts were sold. How many of each color were​ sold?
The store sold ____ white sweatshirts

Answers

Answer:

17 white sweatshirts were sold and 19 yellow sweatshirts were sold.

Step-by-step explanation:

Let w represent the number of white sweatshirts sold and y represent the number of yellow sweatshirts sold.

We can write a system of equations to represent the situation.

Since the store sold a total of 36 sweatshirts, the sum of the white and yellow sweatshirts must total 36. So:

y+w=36

And since each white sweatshirt cost $10.95 and each yellow sweatshirt cost $11.50 and the total profit was $404.65:

10.95w+11.5y=404.65

Solve the system. I'll use substitution this time (though elimination will work just as perfect). From the first equation, subtract w from both sides:

y=36w

Substitute this into the second:

10.95w+11.5(36w)=404.65

Distribute:

10.95w+41411.5w=404.65

Simplify:

0.55w=9.35

Divide both sides by -0.55:

w=17

So, 17 white sweatshirts were sold.

Using the modified equation, substitute:

y=36(17)=19

Therefore, 17 white sweatshirts were sold and 19 yellow sweatshirts were sold.

EspanolAvicenna, a major insurance company, offers five-year life insurance policies to 65-year-olds. If the holder of one of these policiesdies before the age of 70, the company must pay out $27,400 to the beneficiary of the policy. Executives at Avicenna areconsidering offering these policies for $765 each. Suppose that for each holder of a policy there is a 3% chance that they will diebefore the age of 70 and a 97% chance they will live to the age of 70.00If the executives at Avicenna know that they will sell many of these policies, should they expectto make or lose money from offering them? How much?To answer, take into account the price of the policy and the expected value of the amount paldout to the beneficiary.Avicenna can expect to make money from offering these policies.In the long run, they should expect to make dollars on each policy sold.Avicenna can expect to lose money from offering these policies,

EspanolAvicenna, a major insurance company, offers five-year life insurance policies to 65-year-olds.

Answers

Answer:

Avicenna can expect to lose money from offering these policies. In the long run, they should expect to lose 57 dollars on each policy sold.

Explanation:

If a person lives to the age of 70, they will earn $765. So, there is a 97% chance to earn $765. On the other hand, if a person dies before age of 70, they will lose $26635 because

$27,400 - $765 = 26,635

Then, there is a 3% chance to lose $26635.

Now, we can find the expected value, multiplyion each option by its probability, so:

E = $765(0.97) - (26635)(0.03)

E = $742.05 - $799.05

E = - $57

Since the sign is negative they can expect to lose money, so the answer is:

Avicenna can expect to lose money from offering these policies. In the long run, they should expect to lose 57 dollars on each policy sold.

The distance around a triangle is 36 centimeters. If two sides are equal and the length of the third side is 14 centimeters, what is the length of each of the other two sides?

Answers

Length of unknown side = x

36 = 14 + 2x

Subtract 13 from both sides

22 = 2x

Divide by 2 on both sides to isolate for x

11 = x

11 cm

Pablo solved the polynomial equations given in the table. Determine whether each polynomial is correct. Select Correct or Incorrect for each equation.

Equation

(b²+7b-9)+(4b-6b²) = -8b² + 14b-9

(4a+6)-(3a²-9a+1)=-3a²+ 13a +5

(12c-8c²)+(5c²- 10c) = -3c²+2c

Answers

The first equation is incorrect.

The second equation is correct.

The third equation is correct.

Let's go through each equation and determine whether it is correct or incorrect:

(b²+7b-9)+(4b-6b²) = -8b² + 14b-9

To determine if this equation is correct, we need to simplify both sides and check if they are equal.

On the left side:

(b²+7b-9)+(4b-6b²) = b² - 6b² + 7b + 4b - 9 = -5b² + 11b - 9

On the right side:

-8b² + 14b - 9

Comparing both sides, we can see that -5b² + 11b - 9 is not equal to -8b² + 14b - 9. Therefore, the equation is incorrect.

(4a+6)-(3a²-9a+1)=-3a²+ 13a +5

Again, we need to simplify both sides of the equation and check if they are equal.

On the left side:

(4a+6)-(3a²-9a+1) = 4a + 6 - 3a² + 9a - 1 = -3a² + 13a + 5

On the right side:

-3a² + 13a + 5

Comparing both sides, we can see that -3a² + 13a + 5 is equal to -3a² + 13a + 5. Therefore, the equation is correct.

(12c-8c²)+(5c²- 10c) = -3c²+2c

Again, let's simplify both sides and compare them.

On the left side:

(12c-8c²)+(5c²- 10c) = 12c - 8c² + 5c² - 10c = -3c² + 2c

On the right side:

-3c² + 2c

Comparing both sides, we can see that -3c² + 2c is equal to -3c² + 2c. Therefore, the equation is correct.

For more such questions on equation visit:

https://brainly.com/question/17145398

#SPJ8

Is the circumcenter equidistant from the vertices of a triangle?

Answers

The answer is , Yes, the circumcenter is equidistant from the vertices of a triangle .

In the question ,

we have to check whether the circumcenter is equidistant from the vertices of the triangle or not .

we know that the Circumcenter of the circle is the point where , all the perpendicular bisectors of all the sides meet .

the circumcenter is also the center of circumcircle which is the circle that goes through the vertices of the triangle .  

So , the distance from the circumcenter and vertices is called the radius of circle that is always equidistant from center .

Therefore , Yes , circumcenter equidistant from the vertices of a triangle .

Learn more about Circumcenter here

https://brainly.com/question/2520846

#SPJ4

suppose g(x)=f(x-3)-4. which statement best compares the graph of g(x) with the graph of f(x)

suppose g(x)=f(x-3)-4. which statement best compares the graph of g(x) with the graph of f(x)

Answers

Answer:

D.) The graph of g(x) is shifted 3 units right and 4 units down

Step-by-step explanation:

When a number is added directly to an "x" variable, the graph of the function shifts to the left. When this number is negative, the graph shifts to the right. Therefore, if a -3 is directly modifying the "x" variable, the graph shifts 3 units to the right.

When a number is added to the overall function, the graph of the function shifts up. When this number is negative, the graph shifts down. Therefore, if a -4 is being added to the overall function, the graph shifts down 4 units.

Answer:

A. The graph of g(x) is shifted 3 units left and 4 units up.

Step-by-step explanation:

Which expression is equivalent to

Which expression is equivalent to
Which expression is equivalent to
Which expression is equivalent to
Which expression is equivalent to
Which expression is equivalent to

Answers

Answer:

The second expression

Step-by-step explanation:

n=320n(n+1)=n=320(n2+n)=n=320n2+n=320n

You can split up sums.

What is formed when the number of electrons is changed?

Question 2 options:

isotope


radioisotope


a new element


ion

Answers

Answer:

A New Element

An ion is formed. Change of electrons = ionizing the element!

Angles A,D and G are congruent, and angles c, f and j are congruent. What is the mesure of angle E?​

Angles A,D and G are congruent, and angles c, f and j are congruent. What is the mesure of angle E?

Answers

Answer:

60

Step-by-step explanation:

Since the angles A, D, and G are congruent then sum of given angles is eaqual to 180 degrees

x + 20 + 2x + x  = 180 add like terms

4x + 20 = 180 subtract 20 from both sides

4x = 160 divide both sides by 4

x = 40

Angles B, E, and H are congruent so E is also  = x + 20 and x = 40 so angle E = 60

Other Questions
A particle is moving with the given data. Find the position of the particle.a(t) = 2t + 9, s(0) = 8, v(0) = 4 Which are characteristics of an entrepreneur?select all that apply.a. indifferenceb. inflexibilityc. visiond. risk-takinge. competitiveness Solve the inequality -3/4x + 6 > -3. Read the excerpt below and answer the question. The child is not dead not at Langa nor at Nyanga not at Orlando nor at Sharpeville What is the significance of the underlined details in the excerpt from the poem? They name important South African cities. They name important figures in the South African government. They name people who were involved in the anti-apartheid movement. They name townships where black South Africans protested. Enter the current interest for each payment in the range D8:D79. Ensure that the function returns a positive number and use mixed references where necessary. Enter the current principal for each payment in the range E8:E79. Ensure that the function returns a positive number and use mixed references where necessary. n=.1515 You need to multiply n by a power of 10 to help you find the fraction. Decide on the power of 10 to multiply by, and tell how you identified that number. 100 Points! Geometry question. Photo attached. Please show as much work as possible. Thank you! Question 1 of 10What variable represents thermal energy in the equation Q=MAT?O A. The variable eO B. The variable QO c. The variableO D. The variablem Which type of balance sheet analysis sets total assets at 100%?a. Horizontal analysisb. Ratio analysisc. Vertical analysisd. Base year analysis How long does it take a dvd to spin up, from rest, to 675 rpm with an angular acceleration of 32.0 rad/s2?a. 221 s b. 1245 sc. 2125 sd. 0.0352s Why doe alt water appear to be a ingle ubtance even though it contain more than one ubtance? Repone The component in alt water cannot be eparated from each other. The component in alt water cannot be eparated from each other. The particle in alt water are pread throughout. The particle in alt water are pread throughout. Salt water i a olution and a pure ubtance. Salt water i a olution and a pure ubtance. Each component in alt water retain it original phyical propertie Parkinson's disease is caused by ___________________dopamine levels and its etiology is _________________. high, unknown low, unknown low, history of uncontrolled DM high, history of uncontrolled diabetes g To a stationary observer, a man jogs east at 6 m/s and a woman jogs west at 2 m/s. from the man's frame of reference, what is the woman's velocity?Answer: 8m/s west I think WRITE A STORYWrite a story using these words:butterfly, balloon, rainbow, sky What does the H stand for in the HELP process?HandyHealthfulHurryHungry PLEASE HELP I WILL MARK BRAINLIEST FOR THE CORRECT ANSWER !!! A staff's shadow is 8 feet and a tree's shadow is 16 feet. If the staff is 9 feet tall, how tall is the tree? Remember to use the correct unit of measure. List the sample space of a fair, 9-sided number cube rolled while playing a board game. S = {1, 2, 3, 4, 5, 6, 7, 8, 9} S = {1, 2, 3 ,4, 5, 6, 7, 8, 9, 10, 11, 12} S = {9} S = {1,9} sylvie needs $110 for a concert ticket. she already has $ 16 and she can earn the rest by working 10 hours at her job. if h represents her hourly earnings. select all the equations that can be solved to find sylvies hourly earnings An expression is shown below.3m + 9Which expression is equivalent to the given expression?A 12mB 3(m + 3)C 27m D 3(m + 9)