F is directly proportional to A. if F=72 when A=9 find F when A=7

Answers

Answer 1
56 is your answer.

Equation for direct proportion is y = kx where k is the constant of proportionality. For your letters, it’s f = ka

We know 72 =k9, so k = 8
Then they want you to solve
f = 8•7
f = 56

Related Questions

Solve:
3(4 - 2x) = -x +1
13
X =
5
O B. x = 11
O C. x= -1
x-5
D. X

Answers

Step-by-step explanation:

3(42x)=x+1126x=x+1121=6xx11=5x115=x215=x

The solution of the equation is x = 11/5

What is an Equation?

An equation is the statement of two expressions located on two sides connected with an equal to sign. The two sides of an equation is usually called as left hand side and right hand side.

The given equation is,

3 (4 - 2x) = -x + 1

We have to solve the equation.

Distributive property states that, for three numbers, a, b and c,

a(b + c) = ab + ac

So, 3 (4 - 2x) = (3 × 4) - (3 × 2x)

                     = 12 - 6x

Substituting,

3 (4 - 2x) = -x + 1

12 - 6x = -x + 1

-6x + x = 1 - 12

-5x = -11

x = 11/5

Hence the solution is x = 11/5.

To learn more about Equations, click :

https://brainly.com/question/30066982

#SPJ7

At the bank teller's window, arrivals and service times are randomly distributed (Poisson and exponential distributions, respectively). There is only one teller at the window. If the arrival rate is 8 customers per hour, and the service rate is 15 customers per hour, what is the utilization of the teller, as a percentage? (It is a single channel, single server, single phase, unlimited waiting space model). (calculate answer to two decimal places)

Answers

The utilization of the teller is approximately 53.33%.

To calculate the utilization of the teller, we need to compare the arrival rate and the service rate. The utilization represents the fraction of time the server (teller) is busy serving customers.

The arrival rate is given as 8 customers per hour, which means that, on average, 8 customers arrive at the teller's window in one hour. This follows a Poisson distribution.

The service rate is given as 15 customers per hour, indicating that, on average, the teller is able to serve 15 customers in one hour. The service times follow an exponential distribution.

Utilization is calculated as the ratio of the arrival rate to the service rate. In other words:

Utilization = Arrival rate / Service rate

Substituting the given values:

Utilization = 8 / 15 ≈ 0.5333

To express this as a percentage, we multiply the result by 100:

Utilization = 0.5333 * 100 ≈ 53.33%

Therefore, the utilization of the teller in this scenario is approximately 53.33%. This means that, on average, the teller is occupied serving customers about 53.33% of the time, and the remaining time is idle or available for serving new customers.

Learn more about utilization of the teller here:-

https://brainly.com/question/32957276

#SPJ11

please help me this is due today
show ur work

please help me this is due todayshow ur work

Answers

Answer:

3+(-5)-7+6=3-5-7+6=-3

You can check whether you have the correct direction of the inequality sign by substituting a number for p. Any value of p less than –8 should result in a true statement. Try p=−10.


Enter your responses in the boxes.


5p−8(p+1)>16

5 (−10)−8(−10+1)>16

−50−8(

) >16

−50+

>16

>16

Answers

sorry മോനെ എനിക്ക് അറിയില്ല

Let Xi, i=1,2,3 be independent random variables from N(i,i2) distributions. For each of the following, use the Xi's to construct a statistic with the indicated distribution.
(a) chi-squared distribution with v=3 degrees of freedom.
(b) t distribution with v=2 degrees of freedom.
(c) F distribution with v1=1 and v=2 degrees of freedom.

Answers

a) For chi-squared distribution with v=3 degrees of freedom, the statistic that can be constructed using Xi's is:

X2 = Σ i=1 3 (Xi − i)2 / 3.

X2 has chi-squared distribution with 3 degrees of freedom.

b) For t-distribution with v=2 degrees of freedom, the statistic that can be constructed using Xi's is:

T = (X1 − 1) / [(X2/2)0.5].

T has t-distribution with 2 degrees of freedom.

c) For F-distribution with v1=1 and v=2 degrees of freedom, the statistic that can be constructed using Xi's is:

F = [(X1 − 1)/1] / [(Σi=2 to 3 Xi2) / 2].

F has F-distribution with 1 and 2 degrees of freedom.

#SPJ11

Let us know more about distribution : https://brainly.com/question/32696998.

what is the answer to this question ????????????

what is the answer to this question ????????????

Answers

Answer:

umm

Step-by-step explanation:

Ecological approach to algal bloom control. Algal blooms can have negative effects on an ecosystem by dominating its phytoplankton communities. Gonyostomum semen is a nuisance alga infesting many parts of northern Europe. Could the overall biomass of G. semen be controlled by grazing zooplankton species? A research team examined the relationship between the net growth rate of G. semen and the number of Daphnia magna grazers introduced in test tubes. A net growth rate was computed by comparing the initial and final abundances of G. semen in the experiment, with a negative value indicating a decrease in abundance. Here are the findings: 13 1 2 3 4 5 6 Number of grazers Net growth rate -1.9 -2.5 -2.2 -3.9 -4.1 -4.3 a. Make a scatterplot of number of grazers and net growth rate. Do you think that D. magna is an effective grazer of the G. semen alga? b. Find the correlation 1. How does it support your interpretation?

Answers

a. D. magna is an effective grazer of the G. semen alga. b. a very strong negative correlation between the number of grazers and the net growth rate of G. semen.

a. The scatterplot of the data shows a clear negative correlation between the number of D. magna grazers and the net growth rate of G. semen. As the number of grazers increases, the net growth rate of G. semen decreases. This suggests that D. magna is an effective grazer of the G. semen alga.

b. The correlation coefficient between the number of grazers and the net growth rate is -0.996. This indicates a strong negative correlation between the two variables, which supports the interpretation that D. magna is an effective grazer of G. semen. The closer the correlation coefficient is to -1, the stronger the negative correlation between the two variables. In this case, the correlation coefficient is very close to -1, which indicates a very strong negative correlation between the number of grazers and the net growth rate of G. semen.

Learn more about correlation here

https://brainly.com/question/28196194

#SPJ11

what is the slope of the line that passes through the given points (2 12) and (6 11)

Answers

Am just trying though I don’t think it’s correct:(
Y= -1/4x+25/2

The slope of the line that passes through the given points (2 12) and (6 11) is  -1/4.

Two points are given: (2, 12), (6, 11).

A line's "steepness" is quantified by a quantity called the slope, which is typically represented by the letter m. It is the adjustment of y for a unit adjustment of x.

We are aware that the formula for the slope of a line using two points is

m= y2 - y1 /x2 - x1

In this instance, x1 = 2, Y1 = 12, X2 = 6, Y2 = 11.

m = 11 - 12 / 6 - 2

m = -1/4

The slope is therefore -1/4.

To know more about  the Slope of a line

brainly.com/question/29775018?referrer=searchResults

Solve for y by first substituting x. 3r + 2y = 1; r = 5

Answers

First write the expression.

3r+2y=1Here, r=5Now, 3×5+2y=115+2y=12y=14y=7

Calculate ∂z/∂x and ∂z/∂y at the points (3, 46, 2) and (3, 46, −2), where z is defined implicitly by the equation z4+z2x2−y−6=0.
(Give exact answers. Use symbolic notation and fractions where needed.)

Answers

Using partial derivatives the value of ∂z/∂x and ∂z/∂y at the points (3, 46, 2) and (3, 46, −2), where z is defined as the implicit equation z4 + z², x² − y − 6 = 0 is -1/5 and 1 respectively.

To calculate the partial derivatives ∂z/∂x and ∂z/∂y, we first need to differentiate the equation z4 + z², x² - y - 6 = 0 implicitly with respect to x and y, holding z constant.

Differentiating with respect to x, we get:

4z³ × ∂z/∂x + 2zx² + 2z²x × ∂z/∂x = 0

Simplifying, we get:

∂z/∂x = (-2zx²) / (4z³ + 2z²x)

Similarly, differentiating with respect to y, we get:

-1 + ∂z/∂y = 0

Simplifying, we get:

∂z/∂y = 1

Now, we can substitute the given points (3, 46, 2) and (3, 46, -2) into these formulas to get the partial derivatives at those points.

At (3, 46, 2):

z = (681)(1/4) = -3

∂z/∂x = (-2 × 3 × 3²) / (4 × (-3)³ + 2 × (-3)² × 3) = -18/54 = -1/3

∂z/∂y = 1

At (3, 46, -2):

z = (6+81)(1/4) = 3

∂z/∂x = (-2 × 3 × 3²) / (4 × 3³ + 2 × 3² × 3) = -18/90 = -1/5

∂z/∂y = 1

Therefore, at point (3, 46, 2), ∂z/∂x = -1/3 and ∂z/∂y = 1, and at point (3, 46, -2), ∂z/∂x = -1/5 and ∂z/∂y = 1.

Learn more about the implicit equation at

https://brainly.com/question/30482202

#SPJ4

An airline charges a flat fee of $25 for each checked bag under 40 lbs and $2 per pound for each pound over 40, up to a maximum of 100 lbs. which expression can be used to calculate the cost of checking a bag when the weight, w, is 40 < w < 100 ?

Answers

The expression to calculate the cost of checking a bag when the weight is between 40 and 100 pounds is Cost = $25 + ($2 * (w - 40)), where "w" represents the weight of the bag in pounds.

To calculate the cost of checking a bag when the weight is between 40 and 100 pounds, we can use the following expression:

Cost = $25 + ($2 * (w - 40))

In this expression, "w" represents the weight of the bag in pounds.

Let's break down the expression to understand how it calculates the cost:

- $25 represents the flat fee charged for each checked bag under 40 lbs.

- (w - 40) calculates the weight over 40 lbs. By subtracting 40 from the bag's weight, we obtain the additional weight in pounds that exceeds the 40-pound limit.

- $2 represents the cost per pound charged for each pound over 40 lbs. Multiplying the weight over 40 lbs by $2 gives us the additional cost for the extra pounds.

By adding the flat fee of $25 to the cost for the additional weight, we obtain the total cost of checking the bag when its weight falls within the range of 40 to 100 pounds.

It's important to note that the expression assumes the bag's weight is between 40 and 100 pounds. If the weight is less than or equal to 40 pounds, only the flat fee of $25 would be applicable. If the weight exceeds 100 pounds, the maximum weight limit would be considered, and the cost calculation would be different.

In summary, the expression to calculate the cost of checking a bag when the weight is between 40 and 100 pounds is Cost = $25 + ($2 * (w - 40)), where "w" represents the weight of the bag in pounds.

Learn more about weight here

https://brainly.com/question/2335828

#SPJ11

When alicia makes oat biscuits she uses syrup, butter and oats in the ratio 1:2:4.
She says she has plenty of syrup but only 250g of butter and 440g of oats in her kitchen cupboard.
Alicia makes as many oat biscuits as she can with these ingredients.
How much of each ingredient does she use?

Answers

Answer:

110 g of syrup, 220 g of butter and complete 440 g of oats.

Step-by-step explanation:

#hope it helps

When alicia makes oat biscuits she uses syrup, butter and oats in the ratio 1:2:4.She says she has plenty

Consider the following functions. (See attachment)
Find the area of the region.

Consider the following functions. (See attachment)Find the area of the region.

Answers

Answer:

Area:  12

General Formulas and Concepts:

Pre-Algebra

Order of Operations: BPEMDAS

Brackets Parenthesis Exponents Multiplication Division Addition Subtraction Left to Right

Algebra I

FunctionsFunction NotationGraphing FunctionsExponential Rule [Root Rewrite]:                                                                     xn=x1n

Calculus

Derivatives

Derivative Notation

Derivative of a constant is 0

Area - Integrals

Area under a curveArea between 2 curves

Integration Rule [Reverse Power Rule]:                                                                   xndx=xn+1n+1+C

Integration Rule [Fundamental Theorem of Calculus 1]:                                        abf(x)dx=F(b)F(a)

Integration Property [Addition/Subtraction]:                                                           [f(x)±g(x)]dx=f(x)dx±g(x)dx

U-Substitution

Area of a Region Formula:                                                                                       A=ab[f(x)g(x)]dx

Step-by-step explanation:

Step 1: Define

Identify functions

f(x)=x93

g(x)=x9

Step 2: Identify Info

Graph the functions - See Attachment

[1st Integral] Bounds: [8, 9], g(x) top function/f(x) bottom function

[2nd Integral] Bounds: [9, 10], f(x) top function/g(x) bottom function

Step 3: Find Area Pt. 1

Set up integrals [Area of a Region Formula]:                                                 A=89[(x9)x93]dx+910[x93(x9)]dxRewrite integrals [Integration Property - Addition/Subtraction]:                   A=89(x9)dx89x93dx+910x93dx910(x9)dxIntegrate [Integration Rule - Reverse Power Rule]:                                        \limits is allowed only on operatorsEvaluate [Integration Rule - FTC 1]:                                                                 A=1289x93dx+910x93dx12Subtract:                                                                                                            A=89x93dx+910x93dx1Rewrite [Exponential Rule - Root Rewrite]:                                                     A=89(x9)13dx+910(x9)13dx1

Step 4: Identify Variables

Identify variables for u-substitution.

u = x - 9

du = dx

Step 5: Find Area Pt. 2

[Integrals] U-Substitution:                                                                                 A=10u13du+01u13du1[Integrals] Integrate [Integration Rule - Reverse Power Rule]:                      \limits is allowed only on operatorsEvaluate [Integration Rule - FTC 1]:                                                                 A=(34)+341Simplify:                                                                                                              A=12

Topic: AP Calculus AB/BC (Calculus I/II)

Unit: Integrals - Area between 2 curves

Book: College Calculus 10e

Consider the following functions. (See attachment)Find the area of the region.

for a party you make a gelatin dessert in a rectangular pan and cut the dessert into equal-sizes pieces, as shown below. The desert consists of 5 layers of equal height. Each layer is a different flavor, as shown be,ow by a side view of the pan. Your guests eat 3/5 of the pieces of dessert. Part A. Write the amount of cherry gelatin that your guests eat as fraction of the total dessert. Part b. Write the amount of the cherry gelatin that your guests eat as a percent of the total dessert.

Answers

The amount of cherry gelatin that the guests eat as fraction of the total dessert is 3/25.

The amount of the cherry gelatin that the guests eat as a percent of the total dessert is 12%.

We have,

The desert consists of 5 layers of equal height.

As, the guest eat 3/5 of the pieces of dessert.

So, the amount of cherry gelatin that the guests eat as fraction of the total dessert

= 3/5 x 1/5

= 3/ 25

Now, In percentage

= 3/25 x 100

= 12%

Thus, the required fraction is 3/25.

Learn more about Fraction here:

https://brainly.com/question/10354322

#SPJ1

Find the mean of the picture below?

Find the mean of the picture below?

Answers

The believe mean is four

If a ball is thrown into the air with a velocity of 40 ft/s, its height in feet after t seconds is given by y=40t−16t2.a) Find the average velocity for the time period beginning when t=2 and lasting(i) 0.5 seconds(ii) 0.1 second(iii) 0.05 seconds(iv) 0.01 secondb) Find the instantaneous velocity when t=2.

Answers

The average velocities for the given time periods has been calculated and the instantaneous velocity when t = 2 is -24 ft/s.

To find the average velocity for the given time periods, we need to calculate the change in position divided by the change in time. The formula for average velocity is:

Average Velocity = (Δy) / (Δt)

For the time period of 0.5 seconds:

Substituting t = 2 and t = 2.5 into the equation y=40t16t2, we have:

y1=40(2)16(22)=8064=16ft

y2=40(2.5)16(2.52)=100100=0ft

Δy = y2 - y1 = 0 - 16 = -16 ft

Δt = 0.5 seconds

Average Velocity = (Δy) / (Δt) = (-16 ft) / (0.5 s) = -32 ft/s

For the time period of 0.1 seconds:

Substituting t = 2 and t = 2.1, we have:

y1=40(2)16(22)=8064=16fty2=40(2.1)16(2.12)=8472.24=11.76ft

Δy = y2 - y1 = 11.76 - 16 = -4.24 ft

Δt = 0.1 seconds

Average Velocity = (Δy) / (Δt) = (-4.24 ft) / (0.1 s) = -42.4 ft/s

For the time period of 0.05 seconds:

Substituting t = 2 and t = 2.05, we have:

y1=40(2)16(22)=8064=16fty2=40(2.05)16(2.052)=8168.56=12.44ft

Δy = y2 - y1 = 12.44 - 16 = -3.56 ft

Δt = 0.05 seconds

Average Velocity = (Δy) / (Δt) = (-3.56 ft) / (0.05 s) = -71.2 ft/s

For the time period of 0.01 seconds:

Substituting t = 2 and t = 2.01, we have:

y1=40(2)16(22)=8064=16fty2=40(2.01)16(2.012)=80.464.3216=16.0784ft

Δy = y2 - y1 = 16.0784 - 16 = 0.0784 ft

Δt = 0.01 seconds

Average Velocity = (Δy) / (Δt) = (0.0784 ft) / (0.01 s) = 7.84 ft/s

To find the instantaneous velocity when t = 2, we need to calculate the derivative of the position function y(t) with respect to t.

Taking the derivative of y=40t16t2 gives us the velocity function v(t):

$v(t)=ddt(40t16t2)=4032t$

Substituting t = 2 into v(t), we have:

v(2) = 40 - 32(2) = 40 - 64 = -24 ft/s

Therefore, the instantaneous velocity when t = 2 is -24 ft/s.

Learn more about average velocity here:

https://brainly.com/question/28512079

#SPJ11

Compare in days.
55 days to 5 weeks
The ratio is

Answers

Answer: no.of days in 5 weeks= 5× 7= 35

ratio of 5 days to 5 weeks= 5/35

=1/7

answer= 1:7

Step-by-step explanation: .

If A = 40° and B = 25°, calculate, correct to ONE decimal place, each of the following: cosec² B


1.1.2 tan(A - B) In the following, find, correct to One decimal place ​

Answers

The values are:

cosec² B ≈ 5.2

tan(A - B) ≈ 0.5

We have,

To calculate the values, we'll use the following trigonometric identities:

- Cosecant squared (cosec²) is the reciprocal of the sine squared (sin²): cosec² B = 1/sin² B

- Tangent (tan) difference formula: tan(A - B) = (tan A - tan B) / (1 + tan A * tan B)

Given:

A = 40°

B = 25°

To find cosec² B:

Find sin B using the sine function: sin B = sin(25°)

Calculate cosec² B using the reciprocal of the sine squared: cosec² B = 1/sin² B

To find tan(A - B):

Find tan A using the tangent function: tan A = tan(40°)

Find tan B using the tangent function: tan B = tan(25°)

Calculate tan(A - B) using the tangent difference formula: tan(A - B) = (tan A - tan B) / (1 + tan A * tan B)

Let's calculate the values now:

cosec² B:

sin B = sin(25°) = 0.4226 (rounded to four decimal places)

cosec² B = 1/sin² B = 1/0.4226² ≈ 5.2268 (rounded to one decimal place)

tan(A - B):

tan A = tan(40°) = 0.8391 (rounded to four decimal places)

tan B = tan(25°) = 0.4663 (rounded to four decimal places)

tan(A - B) = (tan A - tan B) / (1 + tan A x tan B)

= (0.8391 - 0.4663) / (1 + 0.8391 * 0.4663)

= 0.4662 (rounded to one decimal place)

Therefore,

The values are:

cosec² B ≈ 5.2

tan(A - B) ≈ 0.5

Learn more about trigonometric identities here:

https://brainly.com/question/14746686

#SPJ1

Find the value of c that makes the expression a perfect square trinomial. x^2+10x+c A. 20 B. 25 C. 50 D. 100

Answers

Answer:

The answer is B.

Step-by-step explanation:

In the options, 25 is perfect square of 5 and 100 is square of 10.

So when 5 + 5, you will get 10 which is the 2nd term of the expression.

Solve for x and y.?? having trouble

Solve for x and y.?? having trouble

Answers

Answer:

c

Step-by-step explanation:

took the test

Answer:

Option C is the correct answer

x=34y=173

Step-by-step explanation:

sin30\degree=17x12=17xx=17×2x=34tan30\degree=17y13=17yy=173

If the sale of jacket is 160 what is the original price before the 80 percent

Answers

The answer to your question is 2

Question 4: Optimization (25 points) Find the maximum and minimum of the following functions over the indicated interval: f(x)=−2x−1 over [−3,5]f(x)=x3−4x+10 over [−10,10]f(x)=xx2+1​ over [1,4]​ Question 1: Inverse Functions ( 25 points) Find the inverse function of the following functions: - y=7x+4​ - y=x−2x+1​ - y=ex+5 - y=x3+2 Question 2: Concave/Convex Functions (25 points) Are the following functions convex or concave? Why?: - f(x)=x2−2x+2 - f(x)=5x31​ - f(x)=3x3+2x+1 Question 3: Derivative of Functions ( 25 points) Differentiate the following functions with respect to x : - f(x)=6x5−2x15 - f(x)=x−23x−5​ - f(x)=x5x+1​ - f(x)=(x2+x+1)5ln(x+1)​

Answers

The maximum value is 5 and the minimum value is -11.The maximum value is approximately 13.84 and the minimum value is -1040. The maximum value is approximately 0.8 and the minimum value is -0.333.


1. For f(x) = -2x - 1 over [-3, 5]:
  - Take the derivative of f(x) with respect to x: f'(x) = -2.
  - Set f'(x) equal to zero and solve for x: -2 = 0. There are no solutions, so there are no critical points.
  - Since the interval is finite, we evaluate f(x) at the endpoints:
    - f(-3) = -2(-3) - 1 = 5.
    - f(5) = -2(5) - 1 = -11.
  - Therefore, the maximum value is 5 and the minimum value is -11.


2. For f(x) = x³ - 4x + 10 over [-10, 10]:
  - Take the derivative of f(x) with respect to x: f'(x) = 3x² - 4.
  - Set f'(x) equal to zero and solve for x: 3x² - 4 = 0.
    - x = 2/√3 or x = -2/√3.
  - Since the interval is finite, we evaluate f(x) at the endpoints and critical points:
    - f(-10) = -10³ - 4(-10) + 10 = -1040.
    - f(-2/√3) ≈ 8.16.
    - f(2/√3) ≈ 13.84.
    - f(10) = 10³ - 4(10) + 10 = 960.
  - Therefore, the maximum value is approximately 13.84 and the minimum value is -1040.


3. For f(x) = x/(x^2 + 1) over [1, 4]:
  - Take the derivative of f(x) with respect to x: f'(x) = (x² + 1 - 2x²) / (x² + 1)².
  - Set f'(x) equal to zero and solve for x: (x²+ 1 - 2x²) / (x² + 1)² = 0.
    - x² + 1 - 2x² = 0.
    - -x² + 1 = 0.
    - x² = 1.
    - x = ±1.
  - Since the interval is finite, we evaluate f(x) at the endpoints and critical points:
    - f(1) = 1 / (1² + 1) ≈ 0.333.
    - f(-1) = -1 / (1² + 1) ≈ -0.333.
    - f(4) = 4 / (4² + 1) ≈ 0.8.
  - Therefore, the maximum value is approximately 0.8 and the minimum value is -0.333.

Learn more about value from the following link:

https://brainly.com/question/11546044

#SPJ11

What would be the answer to the math equation e-mc2
(It is a subtraction sign) :)

Answers

emc2

Use the commutative property to reorder the terms

ec2m

in triangle ABC, AB = 6 cm, BC = 13cm and angle ACB = 23 degrees. Calculate angle BÁC, which is obtuse.

in triangle ABC, AB = 6 cm, BC = 13cm and angle ACB = 23 degrees. Calculate angle BC, which is obtuse.

Answers

Answer:

BAC=18013sin236

Step-by-step explanation:

sin(BAC)13=sin236sinBAC=13sin236BAC=18013sin236

Please help! Easy question, answer pls, 15 pts.

Please help! Easy question, answer pls, 15 pts.

Answers

Answer:

360 in

Step-by-step explanation:

To figure out how many inches the dressmaker has in 10, 3 ft rolls, we can multiply by the conversion ratio:

12 in1 ft  (103 ft)12 in1 ft  30 ft12 in1 ft  3012 in  360 in

So, the dressmaker has 360 in of ribbon.

Select the correct answer.
A pencil costs $0.25 more than an eraser. If the cost of eight pencils is $6.80, what is the cost of one eraser?
A.
$1.80
B.
$0.85
C.
$0.60
D.
$0.40
E.
$0.30

Answers

Answer:

C.$0.60

hope this help!!!!!!!!!!!!!!!!!!!!!!

Two ships leaving the same marina at the same timeare 3.2 miles apart after sailing 2.5 hours. If theycontinue at the same rate and direction, how farapart will they be 2 hours later?2.56 miles3.52 miles5.76 miles6.08 miles

Two ships leaving the same marina at the same timeare 3.2 miles apart after sailing 2.5 hours. If theycontinue

Answers

To answer this question, we need to take into account that the two ships continue sailing at the same rate and direction, and we can solve this using the unit rate concept, as follows:

3.22.5milesh=1.28milesh

If they continue sailing at this same rate, then, after two hours they will be:

1.28milesh2h=2.56miles

They will have 2.56 miles more distance between them.

Then, they will be separated by a distance of:

3.2miles+2.56miles=5.76miles

In summary, we have that the answer is 5.76 miles.

2. A line segment Shas endpoints (a, a) and (a, -a), for a + 0. Which of thefollowing transformations preserves the position of the line segment?F. Ry=a(S)H. Rx = o(S)G. Ry=x(S)J. Ry=0(S)

Answers

First the endpoints of this line segment are : (a, a) and (a, -a)

For a+0 the new endpoints will be :(a, a) and (a, -a) because only zero was added to each coordinate

The transformation that will retain these points will be;

Rx =0 (S) where you only add zero to the x,coordinate

solve the equation by completing the square. 4x2 − x = 0 x = (smaller value) x = (larger value)

Answers

To solve the given equation, we need to complete the square. First, we can factor out 4 from the equation to get 4(x^2 - 1/4x) = 0. To complete the square, we need to add (1/2)^2 = 1/16 to both sides of the equation. This gives us 4(x^2 - 1/4x + 1/16) = 1. We can simplify this to (2x - 1/2)^2 = 1/4.

Taking the square root of both sides gives us 2x - 1/2 = ± 1/2. Solving for x, we get x = 1/4 or x = 0. Therefore, the smaller value of x is 0 and the larger value of x is 1/4. Completing the square helps us find the values of x that satisfy the equation by manipulating it into a form that can be more easily solved.
To solve the equation 4x² - x = 0 by completing the square, follow these steps:

1. Divide the equation by the coefficient of x² (4): x² - (1/4)x = 0
2. Take half of the coefficient of x and square it: (1/8)² = 1/64
3. Add and subtract the value obtained in step 2: x² - (1/4)x + 1/64 = 1/64
4. Rewrite the left side as a perfect square: (x - 1/8)² = 1/64
5. Take the square root of both sides: x - 1/8 = ±√(1/64)
6. Solve for x to find the two values: x = 1/8 ±√(1/64)

The smaller value: x = 1/8 - √(1/64)
The larger value: x = 1/8 + √(1/64)

To learn more about Equation: brainly.com/question/29657983

#SPJ11

HELP ASAPPP PLSS ill mark

HELP ASAPPP PLSS ill mark

Answers

Answer: 88

Step-by-step explanation: since its a circle u times the diameter of the cloth by 3.14 which is 87.92 so you round it to 88

Other Questions
Which of the following represents the lowest speed in miles per hour? 4. Unemployment is a key measure of the health of the economy. The most frequent measure of unemployment is the unemployment rate, which is the number of unemployed people divided by the number of people in the labour force. Discuss about the ways to minimize unemployment in the economy of Maldives. (300-350 words) 5:y in the equation givenbelow is called:4 - 3y A ballet is a story told through __________. music and singing images and words music and dance music and speaking The oldest fossils and evidence of modern humans on earth are around 200,000 years old. Before that time lived the ancestors of modern humans and Neanderthals. If all of earths history was compressed into 12 hours, what time would you first see modern humans? Divide and simplify.48xy / 6xy Help me please!! This is timed and Im stuck what kind of topic is discussed in a persuasive text Relate the volume of the cube to the length of each side which of the following developments in the 1500s is best illustrated by the excerpt? european settlers faced resistance from native americans. european settlers faced resistance from native americans. europeans transported enslaved africans to the americas to produce sugar. europeans transported enslaved africans to the americas to produce sugar. europeans sought new sources of wealth in the americas. 1 / 3 1 2 / 3pzzzzzzzzzzzzzzz A number plus 1/2And a number minus .7 Polygon D has been dilated to create polygon D.Polygon D with top and bottom sides labeled 8 and left and right sides labeled 9.5. Polygon D prime with top and bottom sides labeled 6.4 and left and right sides labeled 7.6.Determine the scale factor used to create the image. Scale factor of 0.6 Scale factor of 0.8 Scale factor of 1.2 Scale factor of 1.6 n the last few section workbooks, we've reviewed python basics, used a little pandas, wrangled and cleaned data, and generated a number of basic visualizations. this week, we'll extend this a bit futher, incorporating all that we've learned so far. your goal is to, without much structure provided, utilize the data provided to answer the following questions: does congress have an age problem? (aka, is congress much older than the population they represent?) is this problem exclusive to one of the two major parties? think about what your hypotheses are before delving into this analysis! code has been provided in parts i and iii - your job is do figure out part ii! and, don't worry if you don't get to everything. the data you have to start with are available here: congress-terms.csv. they were used in this piece at fivethirtyeight. note, there is an entry for every member of congress who has served at any point during a particular congress between january 1947 and februrary 2014. one thing to keep in mind is the fact that elections have occurred since 2014 that are not included in this dataset. getting up-to-date data will be explored in part iii of this notebook. 1) For a boxplot, the following data is given:Smallest number = 40Q1 = 45Q2 = 47.52) Approximately 95% of data values are found in +- 1 standard deviations about the mean for a normal distribution, according to the Empirical Rule.Group of answer choicesTrueFalse Think about a product or service that was frustrating for you recently. Instead of complaining. Take Action. Write an e-mail message to a company complaining about a defective product or poor service. (i.E. Poor cell phone service, quality of food, customer service, defective product) Provide details about the problem or concern. Explain the experience you encountered, the impact it had on you, and retribution you would like the company to offer for your inconvenience. a proton moves through a magnetic field at 33.5% of the speed of light. at a location where the field has a magnitude of 0.00659 t and the proton's ve Determine the total number of kilograms from 15 cremora boxes the model of communication in which the sender and receiver play interchangeable roles, communicating simultaneously, is the: linear model interaction model transactional model shannon-weaver model which new deal had the biggest impact on the Great depression??? explain. thank youu!