- Explain why the term greenhouse effect is used to describe the theory of global
warming.
Does the greenhouse effect affect life on Earth? If yes, explain how?
What are the possible effects of a buildup of greenhouse gases in our atmosphere?

Answers

Answer 1
The greenhouse effect is a process that occurs when gases in Earth's atmosphere trap the Sun's heat. This process makes Earth much warmer than it would be without an atmosphere. It is one of the things that makes Earth a comfortable place to live.


Related Questions

Zeros between nonzero digits are significant

Answers

Answer:

Explanation:

If a zero is found between significant digits, it is significant

B) All nonzero digits are significant.

. Which one is NOT an INDICATOR that a chemical has occurred
A) Gas is produced
B) Precipitate is produced
C) Change in energy
D) Change in mass

Answers

Ima guess D) change in mass

Which could be the missing reason in Step 3?

alternate interior angles are congruent
alternate exterior angles are congruent
vertical angles are congruent
corresponding angles are congruent

Answers

Answer:

a) alternate interior angles are congruent

Explanation:

on edgen

The noble gases are the elements found in group__of the periodic table.

Answers

Answer:

easeaseaseas

Explanation:

Noble gases are found in group 18.

Enter the balanced net ionic equation for the potentially unbalanced equation NH4Cl(aq)+NaOH(aq)→H2O(l)+NH3(g)+NaCl(aq).

Answers

Answer:

NH₄⁺ (aq) + OH⁻ (aq) → H₂O (l) + NH₃ (g)

General Formulas and Concepts:

Chemistry - Solutions

Solubility RulesReaction PredictionCompound states

Explanation:

Step 1: RxN

NH₄Cl (aq) + NaOH (aq) → H₂O (l) + NH₃ (g) + NaCl (aq)

Step 2: Balance RxN

NH₄Cl (aq) + NaOH (aq) → H₂O (l) + NH₃ (g) + NaCl (aq)

1 N on each side5 H on each side1 Cl on each side1 Na on each side1 O on each sideAlready balanced

Step 3: Ionic Equations

Total Ionic Equation

Break up aqueous solutions.

NH₄⁺ (aq) + Cl⁻ (aq) + Na⁺ (aq) + OH⁻ (aq) → H₂O (l) + NH₃ (g) + Na⁺ (aq) + Cl⁻ (aq)

Net Ionic Equation

Cancel out spectator ions.

NH₄⁺ (aq) + OH⁻ (aq) → H₂O (l) + NH₃ (g)

How many electrons does chlorine need to gain in order to be like Argon ?


- 2 electrons

- 3 electrons

- 1 electron

Answers

Chlorine is in group 7 and thus requires 1 more valence electron in order to form a full valence shell as Argon (group 8 or also known as group 0). Therefore, the answer is 1 electron

V
A student dissolves 11.S g of sodium hydroxide (NaOH) in 250. g of water in a well-insulated open cup. He then observes the temperature of the water rise
from 20.0 °C to 31.3 °C over the course of 6.7 minutes.
Use this data, and any information you need from the ALEKS Data resource, to answer the questions below about this reaction:
NaOH(s) -. Na (ag) + OH (ag)
You can make any reasonable assumptions about the physical properties of the solution. Be sure answers you calculate using measured data are rounded to 3
significant digits.
Note for advanced students: it's possible the student did not do the experiment carefully, and the values you calculate may not be the same as the known and
published values for this reaction.
is this reaction exothermic, endothermic, or neither?
Oexothermic
O endothermic
O neither
0.°
If you said the reaction was exothermic or endothermic, calculate the amount of
heat that was released or absorbed by the reaction in this case.
Calculate the reaction enthalpy AH.
nen per mole of NaOH.
kJ

VA student dissolves 11.S g of sodium hydroxide (NaOH) in 250. g of water in a well-insulated open cup.

Answers

According to the question the reaction enthalpy is thus 10610 J / 0.278 moles = 38.3 kJ/mol.

What is enthalpy?

Enthalpy is a thermodynamic property of a system that measures the total energy content of a system. It is a state function that is expressed in terms of internal energy, pressure, and volume of a system. Enthalpy represents the amount of energy that is associated with a chemical reaction or physical change.

The reaction is exothermic, meaning that heat is released during the reaction. The amount of heat released can be calculated with the equation q = mcΔT, where q is the heat released, m is the mass of the solution, c is the specific heat capacity of the solution, and ΔT is the change in temperature of the solution. Using the given data, the amount of heat released by the reaction can be calculated as q = (250 g)(4.184 J/g-K)(11.1 K) = 10610 J. The enthalpy change for the reaction can then be calculated by dividing the heat released by the number of moles of NaOH, which is 11.1 g / 40.00 g/mol = 0.278 moles. The reaction enthalpy is thus 10610 J / 0.278 moles = 38.3 kJ/mol.

To learn more about enthalpy

https://brainly.com/question/14047927

#SPJ1

please answer holy its been an hour

please answer holy its been an hour

Answers

Reverse the sign of the second equation, change the sign of the enthalpy and add. Option B

What is the enthalpy?

The enthalpy could be obtained by the use of the Hess law of constant heat summation. As such, we have a number steps and it is possible for use to obtain the enthalpy of the final reaction as shown by a series of manipulations.

By inspection, we can see that, if we desire to obtain the enthalpy of the final reaction as shown, then we have to reverse the sign of the second equation, change the sign of the enthalpy and add. Option B

Learn more about enthalpy:https://brainly.com/question/13996238

#SPJ1

A 3.69 g
sample of a compound consisting of carbon, hydrogen, oxygen, nitrogen, and sulfur was combusted in excess oxygen. This produced 2.08 g
CO2
and 1.28 g
H2O
. A second sample of this compound with a mass of 4.65 g
produced 4.77 g
SO3
. A third sample of this compound with a mass of 8.62 g
produced 3.48 g
HNO3
. Determine the empirical formula of the compound. Enter the correct subscripts on the given chemical formula.

Answers

The empirical formula of the compound is C₂H₁₆S₂N₃O.

What is the empirical formula of the compound?

The moles of each element is as follows::

For CO₂:

Carbon (C) has a molar mass of 12.01 g/mol.

Oxygen (O) has a molar mass of 16.00 g/mol.

Moles of C in CO₂ = 2.08 g / 12.01 g/mol = 0.173 moles

Moles of O in CO₂ = 2.08 g / 16.00 g/mol = 0.130 moles

For H₂O:

Hydrogen (H) has a molar mass of 1.01 g/mol.

Oxygen (O) has a molar mass of 16.00 g/mol.

Moles of H in H₂O = 1.28 g / 1.01 g/mol = 1.27 moles

Moles of O in H₂O = 1.28 g / 16.00 g/mol = 0.080 moles

For SO₃:

Sulfur (S) has a molar mass of 32.06 g/mol.

Oxygen (O) has a molar mass of 16.00 g/mol.

Moles of S in SO₃ = 4.77 g / 32.06 g/mol = 0.149 moles

Moles of O in SO₃ = 4.77 g / 16.00 g/mol = 0.298 moles

For HNO₃:

Hydrogen (H) has a molar mass of 1.01 g/mol.

Nitrogen (N) has a molar mass of 14.01 g/mol.

Oxygen (O) has a molar mass of 16.00 g/mol.

Moles of H in HNO₃ = 3.48 g / 1.01 g/mol = 3.45 moles

Moles of N in HNO₃ = 3.48 g / 14.01 g/mol = 0.248 moles

Moles of O in HNO₃ = 3.48 g / 16.00 g/mol = 0.217 moles

The simplest whole-number ratio of the elements will be:

Carbon: 0.173 moles / 0.080 moles ≈ 2.16

Hydrogen: 1.27 moles / 0.080 moles ≈ 15.88

Sulfur: 0.149 moles / 0.080 moles ≈ 1.86

Nitrogen: 0.248 moles / 0.080 moles ≈ 3.10

Oxygen: 0.080 moles / 0.080 moles = 1

Therefore, the empirical formula is C₂H₁₆S₂N₃O.

Learn more about empirical formulas at: https://brainly.com/question/1603500

#SPJ1

PLS HELP= BRAINLIEST AND POINTS
Question 11 pts
What is the term for the "invisible force" that holds you to Earth's surface?
Group of answer choices

gravity

mass

attraction

matter

Flag question: Question 2
Question 21 pts
Once an object is in motion, what type of energy is being used?
Group of answer choices

kinetic energy

gravity

potential energy

Flag question: Question 3
Question 31 pts
The Moon's mass is lower than that of Earth, thus its gravity is ____ Earth’s gravity.
Group of answer choices

less than

more than

the same as

Flag question: Question 4
Question 41 pts
When you roll a ball across a rug, what slows it to a stop?
Group of answer choices

Friction resists the ball’s forward motion.

The rug doesn’t have enough momentum to keep the ball rolling.

The rug doesn’t have enough force to keep the ball rolling.

The ball isn’t moving fast enough.

Flag question: Question 5
Question 51 pts
A championship swimmer swims 20 meters in 10 seconds. What is his speed?
Group of answer choices

20 m/s

2.0 m/s

0.5 m/s

200 m/s

Flag question: Question 6
Question 61 pts
Without an unbalanced force, an object will ____.
Group of answer choices

change its direction

maintain its velocity

stop moving altogether

change its speed

Flag question: Question 7
Question 71 pts
Which of the following indicates how fast something is moving?
Group of answer choices

speed

gravity

force

inertia

Flag question: Question 8
Question 81 pts
Which of Newton's laws is also known as the law of inertia?
Group of answer choices

Newton's third law

Newton's first law

Newton's second law

Flag question: Question 9
Question 91 pts
Which object would need the greatest force to overcome its inertia?
Group of answer choices

a sports car

a bicycle

a dump truck

a tennis ball

Flag question: Question 10
Question 101 pts
Which of the following is described by the change in an object’s position?
Group of answer choices

force

position

motion

Answers

Explanation:

gravity

kinetic energy

less than

friction resists the ball's movement

2.0 m/s

change its direction

speed

newton's first law

dump truck

position

Answer:

Q1 - Gravity

Q2 - Kinetic Energy

Q3 - Less than

Q4 - Friction resists the ball's forward motion

Q5 - 2 m/a

Q6 - Change its speed

Q7 - Speed

Q8 - Second law

Q9 - a dump truck

Q10 - motion

I am not sure about some answers but I answered all questions.

Convert grams of fe2o3 to grams of fe. select the correct units and conversion factors for each step in the following unit roadmap.
Fe2O3 (s) + 3 CO(g) → 2Fe(s) + 3 CO2(g)

Answers

To convert grams of Fe₂O₃ to grams of Fe, we can use the balanced chemical equation for the reaction between Fe₂O₃ and CO.

The balanced equation for the reaction between Fe₂O₃ and CO is: Fe₂O₃(s) + 3 CO(g) → 2Fe(s) + 3 CO₂(g)

From this equation, we can see that 1 mole of Fe₂O₃ reacts with 3 moles of CO to produce 2 moles of Fe and 3 moles of CO₂. This means that the ratio of Fe to Fe₂O₃ is 2:1.

The conversion factor between grams of Fe₂O₃and grams of Fe is:

1 mole Fe₂O₃= 159.69 g Fe₂O₃

1 mole Fe = 55.845 g Fe

Steps:

Start with the given mass of Fe₂O₃in grams

Convert grams to moles of Fe₂O₃using the molar mass of Fe₂O₃ (159.69 g/mol)

Use the stoichiometry ratio of 2:1 to find the number of moles of Fe produced from the number of moles of Fe₂O₃

Convert the number of moles of Fe to grams using the molar mass of Fe (55.845 g/mol)

In conclusion, in order to convert grams of Fe₂O₃to grams of Fe, we used the balanced chemical equation to identify the molar ratio between the reactants and products.

Then, we used the molar mass of Fe₂O₃ and Fe to convert between moles and grams. It is important to be aware of the stoichiometry of the reaction in order to calculate the correct number of moles of Fe produced.

Learn more about conversion factors at

https://brainly.com/question/28366871

The complete question is:

Convert grams of Fe₂O₃ to grams of Fe. Mention the correct units and conversion factors for each step.

Fe₂O₃(s) + 3 CO(g) → 2Fe(s) + 3 CO₂(g)

#SPJ4

what is the mass of exactly 500 sulfur atoms

Answers

Answer:

2.6622592x10^-20 grams

Explanation:

Mass of single atom of 500 sulfur is 20 grams.

what are the roles of sulfur ?

Sulfur is the most vital minerals which is enormously available in the human body, it holds a significant role in the  processes like making proteins, gene expression regulation, building, and repairing DNA, it also support other metabolism.

Sulfur is the major element in the environment, is a key element of many fresh produces, body also uses sulfur for different bodily functions like building and repairing DNA,

It protect the cells against damage which is essential for the addition of number of sulfur-rich foods into the diet for optimal health and well-being.

Learn more about sulfur, here:

https://brainly.com/question/20710123

#SPJ6

4-A major textile dye manufacturer developed a new yellow dye. The dye has a percent composition of 75.95% X, 17.72% N, and 6.33% H by mass with a molar mass of about 240 g/mol. Determine the molecular formula of the dye.

Answers

Answer:

C₁₅N₃H₅

Explanation:

Let's assume we have 240 g of the dye (1 mol), in that case we'd have:

240 g * 75.95/100 =  182.28 g of C240 g * 17.72/100 =  42.53 g of N240 g * 6.33/100 =  15.19 g of H

Now we convert the masses of each element into moles, using their respective molar masses:

182.28 g C ÷ 12 g/mol = 15.19 mol C ≅ 1542.53 g N ÷ 14 g/mol = 3.04 mol N ≅ 3 15.19 g C ÷ 1 g/mol = 15.19 mol H ≅ 15

Thus the molecular formula is C₁₅N₃H₅.

2) What is the pH when the concentration of [H*] is 4.22 x 108
3) What is the pH when the pOH is 7
4) What is the concentration of [OH¹¹] when the pH is 4.3
5) What does it mean to be diprotic?
6) What does amphoteric mean?
7) WHat can you use to measure pH?
8) WHat does a buffer solution do?
9) What does titration do?
10) What is the difference between a strong acid and a weak acid?

Answers

2. The pH is 4.22 × 10⁸. 3. pH is 7, 4. pOH is 9.7, 5. diprotic is explained below, 6. Amphoteric is explained below, 7. pH meter, 8. A buffer solution is explained below, 9. Titration is explained below, 10. Difference between strong and weak acids is explained below.

2. pH = -log[H⁺]

pH = -log(4.22 x 10⁻⁸)

pH ≈ 7.375

3. pH + pOH = 14

pH + 7 = 14

pH = 14 - 7

pH = 7

4. pH + pOH = 14

pOH = 14 - pH

pOH = 14 - 4.3

pOH ≈ 9.7

Now,

[H⁺] × [OH⁻] = 1.0 x 10⁻¹⁴

[OH⁻] = 1.0 x 10⁻¹⁴ / [H⁺]

[OH⁻] = 1.0 x 10¹⁴ / 10^(-pOH)

[OH⁻] = 1.0 x 10⁻¹⁴ / 10^(-9.7)

[OH⁻] ≈ 1.99 x 10⁻⁶ M

5. Being diprotic means that a molecule or ion can donate or release two protons (H⁺ ions) in an acid-base reaction.

6. Amphoteric refers to a substance that can act as both an acid and a base.

7. The pH can be measured using a pH meter or a pH indicator.

8. A buffer solution is a solution that can resist changes in pH when small amounts of acid or base are added to it.

9. Titration is a laboratory technique used to determine the concentration of a solution by reacting it with a solution of known concentration (titrant) of another substance.

10. A strong acid is an acid that completely ionizes in water, releasing all of its hydrogen ions. A weak acid is an acid that does not completely dissociate into ions when dissolved in water.

Learn more about pH, here:

https://brainly.com/question/2288405

#SPJ1


What is the ratio of the volume of oxygen gas to the
volume of water vapor in the following reaction?

Answers

Answer:

The ratio of volumes in the given case illustrates the Gay Lussac's Law of Gaseous Volumes.

- The law was given by the french chemist Gay Lussac in the year 1806.

- He stated that when gases are combined or are produced in a chemical reaction, they do so in a simple ratio by volume.

- It is given that 2 volumes of hydrogen combine with 1 volume of oxygen producing 2 volumes of water.

- This is in accordance with this law.

Explanation:

is distilled water a pure substance or mixture​

Answers

Answer:

pure substance,...................

Describe the development of the modern periodic table. Include contributions made by Lavoisier, Newlands, Mendeleev, and Moseley.

Answers

Answer:  Lavoisier organized a list of the known elements of his day as four categories. Newlands was the first to organize the elements and show that properties repeated in a periodic way. Mendeleev and Meyer proposed periodic tables showing a relationship between atomic mass and elemental properties. Moseley organized the elements by atomic number instead of atomic mass.

Explanation:

Select reason(s) why 1-hydroxy-2-methyl-5-isopropylbenzene is an incorrect systematic name for carvacrol.

a. If named with benzene as the parent, the methyl group needs to have the first locant in order to minimize the number of the third locant.
b. The substituents are not listed alphabetically.
c. If named with benzene as the parent, the hydroxyl group needs to have the first locant in order to minimize the number of the third locant.
d. The substituents are not listed in order of increasing mass.

Answers

The reason why 1-hydroxy-2-methyl-5-isopropylbenzene is not the correct systematic name for carvacrol is because the substituents are not listed alphabetically.

IUPAC nomenclature provides the correct and acceptable system of naming organic compounds which are internationally acceptable among scientists.

According to the rules of IUPAC nomenclature, compounds are named in alphabetical order. The names of the locants are ordered in such a way that they have the lowest number. Following IUPAC nomenclature, the correct name of the compound ought to be, 1-hydroxy-5-isopropyl-2-methylbenzene.

Learn more: https://brainly.com/question/11587934

If 2.0 g of hydrogen gas combines with an excess of chlorine gas to form 72.9 g of hydrogen chloride, what mass of chlorine is used in the reaction?

Answers

Explanation:

Eqn of Reaction

H2 + Cl2 == 2HCl

Mass of HCl=72.9g

Mass of H2 = 2.0g.

Moles of HCl = Mass/Molar Mass

n = 72.9/36.5

n=1.997 moles of HCl was produced.

Now from the balanced eqn of reaction...

2moles of HCl is produced when 1moles of Cl2 reacts.

So

1.997moles of HCl would produce.....

1.997 x 1/2 moles of Cl2

0.999moles of Cl2 is gotten.

n(Cl₂) = mass/Mm

Mass = Mm x n

n=0.999moles

Molar Mass(Mm)= 35.5 x 2= 71g/mol ( You multiply by 2 cuz Chlorine is a diatomic gas).

Mass = 0.999 x 71

Mass = 70.929g of Chlorine.

An easier and swifter way to look at this is

From the Law of Conservation Of Mass.

The Mass of reactants MUST equal those of products in a simple chemical reaction since Matter is neither created nor destroyed in this scenario.

So The product Was 72.9g of HCl

Therefore

The Sum of both reactants Must equal this value.

We're already given the value of H₂ =2g

Therefore...

Chlorine should be undoubtedly 70.9g.

Hope this helps.

Have a great a day Amigo✅

What is the concentration (molarity) of a solution of NaCl if 350. mL of a 2.5 M NaCl solution is diluted to a total volume of 5.0 mL? (NEED HELP ASAP)

Answers

The concentration (molarity) of the final NaCl solution is 175 M.

To find the concentration (molarity) of the final NaCl solution, we can use the equation:

M1V1 = M2V2

Where M1 is the initial concentration, V1 is the initial volume, M2 is the final concentration, and V2 is the final volume.

In this case, we have an initial NaCl solution with a concentration of 2.5 M and a volume of 350 mL (0.350 L). We are diluting this solution to a total volume of 5.0 mL (0.005 L).

Plugging these values into the equation, we have:

(2.5 M) * (0.350 L) = M2 * (0.005 L)

Simplifying the equation:

0.875 = 0.005 * M2

Dividing both sides by 0.005:

M2 = 0.875 / 0.005

M2 = 175M

For such more questions on molarity

https://brainly.com/question/30704561

#SPJ8

Stephan’s mother cuts a twig from a rose bush and plants it in the soil. After a few days, Stephan observes a new plant growing. Which characteristic does the growth of the new plant depict?

Answers

The growth of the new plant depicts the asexual reproduction characteristic. The characteristic that describes the growth of the new plant in Stephan's mother cutting a twig from a rose bush and planting it in the soil is asexual reproduction.

Asexual reproduction is the mode of reproduction by which organisms generate offspring that are identical to the parent's without the fusion of gametes. Asexual reproduction is a type of reproduction in which the offspring is produced from a single parent.

The offspring created are clones of the parent plant, meaning they are identical to the parent.The new plant in Stephan’s mother cutting a twig from a rose bush and planting it in the soil depicts the process of asexual reproduction, which is the ability of a plant to reproduce without seeds. In asexual reproduction, plants can reproduce vegetatively by cloning themselves using their roots, bulbs, or stems.

Know more about    characteristic  here:

https://brainly.com/question/28790299

#SPJ8

What is the mass of 6.02 x 1024 molecules of the compound HCl?

Answers

Answer:

First, we need to determine the molar mass of HCl.

The molar mass of HCl = the mass of hydrogen (1.008 g/mol) + the mass of chlorine (35.45 g/mol) = 36.45 g/mol.

Next, we can use Avogadro's number (6.02 x 10^23 molecules/mol) to convert the number of molecules to moles:

6.02 x 10^24 molecules / 6.02 x 10^23 molecules/mol = 10 moles

Finally, we can use the molar mass to convert moles to grams:

10 moles x 36.45 g/mol = 364.5 grams

Therefore, the mass of 6.02 x 10^24 molecules of HCl is 364.5 grams.

6.02* 10^24 means 1 molecule of any substance
:. It means 1 mole of Hcl
:. To find the mass of HcL
no of moles = mass/ molar mass
To get the molar mass of HCL {H=1 CL=35.5}
:. H+CL = 1+ 35.5 =36.5
So we have our molar mass and number of moles now
Then we input it in the eqn
1=x/36.5
X= 36.5g of HCl

Balance the following chemical equation using the ion-electron method. Cr₂O7+ H₂S → Cr³+S (in acidic solution)

Answers

3H₂S + 8H⁺ + Cr₂O₇⁻² → 3S + 2Cr⁺³ + 7H₂O this is the balanced chemical equation

What is Balanced Chemical Equation ?

The balanced chemical equation is the equation in which the number of atoms on the reactant side is equal to the number of atoms on the product side in an equation.

The given chemical equation is

Cr₂O7+ H₂S → Cr³+S

Now, assign the oxidation number to each atom in the given equation.

Cr+6O72+H+1S2Cr+3+S0

Now separate the half reaction and balance the elements other than H and O.

H₂S → S

Cr₂O₇⁻² → 2Cr⁺³

Now, add water to balance oxygen

H₂S → S

Cr₂O₇⁻² → 2Cr⁺³ + H₂O

Now balance hydrogen by adding H⁺

H₂S → S + 2H⁺

14H⁺ + Cr₂O₇⁻² → 2Cr⁺³ + 7H₂O

Now, balance the charge

H₂S → S + 2H⁺ + 2e⁻

6e⁻ + 14H⁺ + Cr₂O₇⁻² → 2Cr⁺³ + 7H₂O

Now, balance the atoms multiply by 3

3 [H₂S → S + 2H⁺ + 2e⁻]

3H₂S → 3S + 6H⁺ + 6e⁻

6e⁻ + 14H⁺ + Cr₂O₇⁻² → 2Cr⁺³ + 7H₂O

Now, add both the half reaction

3H₂S + 6e⁻ + 14H⁺ + Cr₂O₇⁻² → 3S + 6H⁺ + 6e⁻ + 2Cr⁺³ + 7H₂O

Now, simplify the equation

3H₂S + 8H⁺ + Cr₂O₇⁻² → 3S + 2Cr⁺³ + 7H₂O

Thus from the above conclusion we can say that 3H₂S + 8H⁺ + Cr₂O₇⁻² → 3S + 2Cr⁺³ + 7H₂O this is the balanced chemical equation.

Learn more about the Balanced chemical equation here: brainly.com/question/26694427

#SPJ9

What makes an element neutral?
1
Same amount of electrons as neutrons
2 same amount of neutrons and protons
3same amount of electrons and protons
4 same amount of electrons and neucleons

Answers

Answer:

same amount of electrons and protons

Explanation:

it has equal number of negative electric chargesand the positive electric charges.the total electric charge of an atom is therefore zero and the atom is said to be neutral

A current of 3.91 A is passed through a Pb(NO3)2 solution for 1.70 h . How much lead is plated out of the solution?

Answers

The mass (in grams) of lead that will plate out of the solution, given that 3.91 A is passed through the solution for 1.7 h is 25.66 g

How do I determine the mass of lead?

First, we shall determine the charge flowing through the solution. This is shown below:

Current (I) = 3.91 ATime (t) = 1.70 h = 1.7 × 60 × 60 = 6120 sCharge (Q) = ?

Q = It

Q = 3.91 × 6120

Q = 23929.2 C

Finally, we shall determine the mass of lead that will plate out of the solution. Details below:

Balanced equation

Pb²⁺ + 2e —> Pb

Molar mass of Pb = 207 g/mol Mass of Pb from the balanced equation = 1 × 207 = 207 gNumber of faraday = 21 faraday = 96500 C2 faraday = 2 × 96500 = 193000 C

From the balanced equation above,

193000 C plated 207 g of lead

Therefore,

23929.2 C will plate = (23929.2 × 207) / 193000 = 25.66 g of lead

Thus, the mass of lead that  will plate out is 25.66 g

Learn more about mass:

https://brainly.com/question/27136699

#SPJ1

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

How many moles of a gas can be contained in a 1600-cm° flask at 25°C and 75 kPa?

Answers

Volume=1600cm³=1.6dm³=1.6L

Temperature=25°C=273+25=298K

Pressure=75000Pa

Now

Apply ideal gas equation

PV=nRTn=PV/RTn=75000(1.6)/8.314(298)n=48.43mol

The number of moles needed is

n=48.43mol.

Calculations

Given the values of the volume and temperature, we would convert them to the required units.

Volume=1600cm³=1.6dm³=1.6L

Temperature=25°C=273+25=298K

Pressure=75000Pa

We would use the ideal gas equation

PV=nRT

n=PV/RT

n=75000(1.6)/8.314(298)

n=48.43mol

A doctor is trying to diagnose a patient with dry skin. Which of the following resources would be the most helpfu
ОООО
a magazine ad about soft skin
a growth chart
online articles about dry skin
medical books

Answers

Medical books would be the best because it is a valid resource

Substances that are physical combinations of two or more different types of matter are known as

Answers

Answer:

A mixture!

Explanation:

Mixtures are a substance made of combining two or more different kinds of matter :)

Hope this helped!

all the questions 1. What contribution did de Broglie make to the development of the modern model of the atom? (A)Observed the effect of bombarding thin gold foil (and other metal foils) with alpha radiation from radioactive substances. 60 m B. Discovery of the nucleus C. Discovered that atoms and molecules emit energy only in certain discrete quantities, or quanta. D. Discovered negatively charged particles by cathode ray tube experiment E. Described the wave properties of particles

Answers

De Broglie contributed to the development of the modern model of atoms by describing the wave properties of particles. Option E.

De Broglie's contribution to atomic theory

Louis de Broglie was a French physicist who made significant contributions to the development of quantum mechanics.

In his doctoral thesis, he proposed that particles, such as electrons, have both particle-like and wave-like properties. This idea became known as wave-particle duality and laid the foundation for the development of the modern model of the atom.

According to de Broglie's theory, particles can exhibit wave-like behavior and have a wavelength that is inversely proportional to their momentum.

This theory was later experimentally confirmed in a series of experiments that demonstrated the diffraction of electrons and other particles.

More on de Broglie can be found here: https://brainly.com/question/17295250

#SPJ1

Other Questions
Marvin solved the equation 4(x+5)=88 fill in the blanks One characteristic of the Amazon River basin is that _?_. A. it is a fully explored area B. it has thick jungle areas bordered by barren desert areasC. it has a year-round growing season D. the government has banned further development of the region since 1900, the percentage of americans over the age of 65 has while the percentage of americans under the age of 18 has . A cannonball is shot from the ground, reaching the height of 50 meters before landing on a target 500 meters away.Assuming the cannonball is fired from the origin and its trajectory can be modeled by a quadratic function, where is the maximum point of the trajectory?(500, 50)(250, 25)(250,50)(0, 50) TriangleArea = 30inHeight = 5inBase = write formula, show work label A bookshelf contains 6 German books, 4 Spanish books and 7 French books. Each book is different from one another. How many different arrangements can be done of these books if What are the coordinates of the point on the directed line segment from (-8,8) to(7, 7) that partitions the segment into a ratio of 1 to 4? CELL STRUCTURE CROSSWORD GRADE 7 BIOLOGY (c) Ada is x years old and Bill is y years old.Lastyear,Bill was 6 times as old as Ada.(1) Form an equation in x and y and show that it simplifies to y = 6x - 5. Are elements of racial stereotyping present in the movie Glory Organelles found in an osteocytes how society is orginate? Find x when y=11 in the equation 7=-2x+7 Problem: Power Output. In each case, find your average power in watts. Assume that riding a bike burns 100 Calories per mile. If you ride at a speed of 20 miles per hour, what is your average power output, in watts? Angles Look at picture Upon entering a patient,s room to perform phlebotomy what is the very first step? True or False? Face-saving is a principle of language. PLZ HELP ME IM desperate!!!!When writing a rebuttal, what is the exact phrasing we use? Need help asap this affects my grade This graph represents the relationship between the growth of a plant and the amount of time that has passed since the plant was planted.Based on the data in the graph, which statement is true?The plant grows 8 inches in 6 weeks.The plant grows 3 inches in 6 weeks.The plant grows 6 inches in 8 weeks.The plant grows 4 inches in 3 weeks. 56, 76, 12, 82, 53, 70, 53, 53Find the IQR (Inter-quartile range)