Excess HCl is added to 234 g of Na2S solution as shown by the equation below:
Na2S(aq) + 2HCl(aq) →2NaCl(aq) + H2S(g)
How many liters of H2S gas are produced at standard temperature and pressure (STP)? The molar mass of Na2S is 78 g.

Answer: The inner core

Explanation:

‍♀️

The layer of the earth which  is the most dense is the inner core as it is present in depth of earth.

Earth is the third planet from the Sun and the only place known in the universe where life has originated and found habitability. While large volumes of water can be found throughout the Solar System, only Earth sustains liquid surface water. Approximately 70.8% of Earth's surface is made up of the ocean, dwarfing Earth's polar ice, lakes, and rivers.

The remaining 29.2% of Earth's surface is land, consisting of continents and islands. Earth's surface layer is formed of several slowly moving tectonic plates, which interact to produce mountain ranges, volcanoes, and earthquakes. Earth's liquid outer core generates the magnetic field that shapes the magnetosphere of Earth, deflecting destructive solar winds.

The atmosphere of Earth consists mostly of nitrogen and oxygen. Greenhouse gases in the atmosphere like carbon dioxide (CO2) trap a part of the energy from the Sun close to the surface.

Learn more about earth,here:

https://brainly.com/question/12041467

#SPJ5

Answer:

The total mass =    159.129      

Explanation:

Comment

The easiest way to do this is to set up a small table. The table contains 6 entrys: Three are meant to  find the mass of the liquid and one states the mass of the beaker and 1 gives the answer. The table is given under this statement.

Solution

Mass of beaker                                  13.739

Volume =  132.9

density = 1.094 g/mL

Mass liquid = density * Volume

Mass = 1.094 g /mL *132.9 =            145.39

Total Mass =                                      159.129                        

The correct valence for ions of the following elements are:

Ca: 2+

Cl: 1-

O: 2-

Al: 3+

K: 1+

What is valence?

To know more about valence, click the link given below:

https://brainly.com/question/866518

#SPJ1

The new temperature of the gas can be calculated using the ideal gas law: PV = nRT. Rearranging the equation to solve for temperature, we get: T = (PV)/(nR). With a volume of 400 ml, a pressure of 1 atm, and a constant R of 0.08206 L·atm/K·mol, the new temperature of the gas is 59.95°C.

Answer:

88.42°C

Explanation:

The temperature change of a gas can be calculated using Gay-Lussac's law, which states that the pressure-volume ratio of a gas is directly proportional to its temperature. The equation is:

P1/V1 = P2/V2 = (nRT)/V = constant

where P1 and V1 are the initial pressure and volume, P2 and V2 are the final pressure and volume, n is the number of moles, R is the gas constant, and T is the temperature in Kelvin.

Given the initial volume and temperature, we can rearrange the equation to solve for the final temperature:

T2 = (P1V1)/(nR) * (V2/P1)

Since the pressure is constant, we can simplify the equation to:

T2 = T1 * (V2/V1)

We can convert the temperature to Kelvin:

T1(K) = 45 + 273.15 = 318.15 K

T2(K) = T1 * (400/350) = 318.15 * (400/350) = 361.57 K

Finally, we can convert back to Celsius:

T2(°C) = 361.57 - 273.15 = 88.42 °C

The new temperature is 88.42°C.


ALLEN

Answer:

65.0 K

Explanation:

To find the temperature, you need to use the Ideal Gas Law:

PV = nRT

In this equation,

-----> P = pressure (pKa)

-----> V = volume (L)

-----> n = moles

-----> R = Ideal Gas Constant (8.31 L*kPa/mol*K)

-----> T = temperature (K)

You can plug the given values into the equation and simplify to find the temperature.

P = 202.65 pKa                          R = 8.31 L*kPa/mol*K

V = 2.0 L                                     T = ? K

n = 0.75 moles

PV = nRT

(202.65 pKa)(2.0 L) = (0.75 moles)(8.31 L*kPa/mol*K)T

405.3 = (6.2325)T

65.0 K = T

The correct options are: changes in shape or size, color changes, formation of precipitates or gases, and whether changes are easily reversible.

According to the lab guide, the following changes below will be looked for in order to test the hypothesis: changes in shape or sizecolor changesformation of precipitates or gaseswhether changes are easily reversibleThese changes are the characteristics that will be observed in order to test the hypothesis in the lab. Furthermore, temperature changes and changes of state (gas, liquid, or solid) may also occur and can be observed while testing the hypothesis.

For more question precipitates

https://brainly.com/question/13859041

#SPJ8

Answer:

A,B,E,F

Explanation:

Answer:

The answer is D

Explanation:

The hornwort is telling what that exact plant does and the kangaroo paw is telling what they do physically to hold onto water

The first adaptation is to the life cycle, and the second is to the physical traits thus, the kangaroo paw describes what they physically do to hold onto water, and the hornwort describes what that particular plant performs. So, the correct option is D.

A species or organism gradually grows more accustomed to its surroundings through the process of adaptation. The behavioral or physical characteristics of an animal that improve its ability to thrive in its ecosystem are referred to as adaptation. Animals can adapt by changing how they look to hide from predators (camouflage). To survive in their habitats, different species have evolved various adaptations.

In the above given example, the life cycle is the first adaptation, and the physical characteristics are the second. Therefore, the hornwort defines what that particular plant does, and the kangaroo paw represents what they physically do to hold onto water.

Therefore, the correct option is D.

Learn more about Adaptation, here:

https://brainly.com/question/28881538

#SPJ3

Answer: Submarine

Explanation:

Depends on the size and weight of the sailboat and submarine but the submarine will have more momentum because it is heavier.

Types of luminous flames:

1. Yellow Luminous Flame

2. Smoky Luminous Flame

3. Orange Luminous Flame

4. Blue Luminous Flame

Luminous flames are characterized by their visible glow, which is caused by the incomplete combustion of fuel. The presence of soot particles in the flame causes the emission of light. There are different types of luminous flames, which can be classified based on their fuel composition and burning conditions. Here are some common types of luminous flames:

1. Yellow Luminous Flame: This is the most common type of luminous flame, often seen in open fires, candles, and gas stoves. It appears yellow due to the presence of soot particles in the flame. Yellow flames indicate incomplete combustion of hydrocarbon fuels, such as methane, propane, or natural gas. The high carbon content in these fuels leads to the formation of soot, which emits visible light.

2. Smoky Luminous Flame: This type of flame is characterized by a significant amount of black smoke and soot production. It is commonly observed in poorly adjusted or malfunctioning burners or engines. The excessive presence of unburned fuel in the flame results in incomplete combustion and the emission of dark smoke particles.

3. Orange Luminous Flame: An orange flame indicates a higher combustion temperature compared to a yellow flame. It is often seen in more efficient burners or when burning fuels with a higher carbon content, such as oil or diesel. The higher temperature helps in burning more of the carbon particles, reducing the amount of soot and making the flame appear less yellow.

4. Blue Luminous Flame: A blue flame is typically associated with complete combustion. It indicates efficient burning of fuel, resulting in minimal soot formation. Blue flames are commonly observed in gas burners or Bunsen burners. The blue color is a result of the combustion of gases, such as methane, in the presence of sufficient oxygen.

It's important to note that the luminosity of a flame can vary depending on factors such as fuel-air mixture, combustion temperature, and the presence of impurities. Achieving complete combustion and minimizing the production of soot is desirable for efficient and cleaner burning processes.

for more questions on luminous

https://brainly.com/question/27163038

#SPJ8

1. Oxygen is a reactant needed for all combustion reactions.

2. The products of the complete combustion reaction of a hydrocarbon (compound containing carbon and hydrogen) are carbon dioxide and water.

3. Complete combustion takes place if the quantity of oxygen is sufficient.

4. Incomplete combustion takes place if the quantity of oxygen is insufficient.

5. Combustion is a exothermic change.

6. In a combustion reaction, oxygen is the oxidizer and the substance which burns is the fuel.

7. The lower the kindling temperature, the easier is the combustion.

8. If a substance burns at room temperature in the absence of a flame the combustion is said to be spontaneous.

9. Combustion reactions are accompanied by heat and light effect.

10. Combustion reactions don't take place at the same rate.

1)Oxygen is a reactant needed for all combustion reactions. Combustion reactions are chemical reactions that involve the rapid combination of a fuel (usually a hydrocarbon) with oxygen gas. Oxygen acts as the oxidizing agent, providing the necessary component for the reaction to occur. Without oxygen, combustion cannot take place.

2)The products of the complete combustion reaction of a hydrocarbon are carbon dioxide and water. In the presence of sufficient oxygen, hydrocarbons undergo complete combustion, resulting in the production of carbon dioxide (\(CO_2\)) and water (\(H_2O\)). This reaction releases a significant amount of energy in the form of heat and light.

3)Complete combustion takes place if the quantity of oxygen is sufficient. Complete combustion occurs when there is an adequate supply of oxygen available for the reaction. In this case, the fuel (hydrocarbon) reacts completely with oxygen, resulting in the formation of carbon dioxide and water as the only products

4)Incomplete combustion takes place if the quantity of oxygen is limited. In situations where there is insufficient oxygen available, incomplete combustion occurs. This leads to the formation of products such as carbon monoxide (CO) and carbon (soot) in addition to carbon dioxide and water. Incomplete combustion is less efficient and can release harmful pollutants into the environment.

5)Combustion is a chemical change. Combustion is classified as a chemical change because it involves the breaking and forming of chemical bonds between atoms and molecules. The reactants (fuel and oxygen) undergo a chemical reaction to produce new substances (products) with different properties, such as carbon dioxide and water. Heat and light are also typically released during combustion.

6)In a combustion reaction, oxygen is the oxidizer, and the substance that burns is the fuel or combustible material. Oxygen acts as the oxidizing agent, meaning it accepts electrons from the fuel, leading to the oxidation (burning) of the fuel. The fuel provides the carbon and hydrogen atoms that combine with oxygen to form carbon dioxide and water.

7)The lower the kindling temperature, the easier the combustion. The kindling temperature is the minimum temperature at which a substance can ignite and sustain combustion. If the kindling temperature is lower, it means that less heat is required to initiate the combustion process. Substances with lower kindling temperatures are more prone to catching fire and sustaining combustion.

8)If a substance burns at room temperature in the absence of a flame, the combustion is said to be spontaneous. Spontaneous combustion refers to the ignition and burning of a substance without the need for an external ignition source, such as a flame. It occurs when certain materials, under specific conditions, undergo self-heating and eventually reach their ignition temperature, leading to combustion.

9)Combustion reactions are accompanied by heat and light effects. Combustion reactions are highly exothermic, meaning they release a significant amount of heat energy. This energy is released in the form of heat and light, resulting in flames or glowing embers during combustion.

10)Combustion reactions don't take place at the same rate for all substances. The rate of combustion can vary depending on factors such as the nature of the fuel, the availability of oxygen, temperature, and pressure. Different substances have different combustion rates due to variations in their chemical properties and reactivity.

Know more about   carbon dioxide  here:

https://brainly.com/question/30355437

#SPJ8

Answer and Explanation:

Heat required to raise the temperature of the unit mass of a given substance by a given amount (usually one degree).

Answer:

the heat required to raise the temperature of the unit mass of a given substance by a given amount (usually one degree)

Hope it helps!!

The model would be complete when there two pairs of white dots and one pair of black dots

The chemical process of electrolysis breaks down water molecules into their component parts, hydrogen  and oxygen , using an electric current. Two simultaneous reactions take place at distinct electrodes, referred to as the anode and cathode, which are submerged in an electrolyte solution, to produce this process.

A crucial step in the process of creating hydrogen gas, a clean and renewable energy source, is the electrolysis of water.

Learn more about electrolysis:https://brainly.com/question/12054569

#SPJ1

The pH at equivalence point is 12.46

At equivalence point, number of moles of acid, n equals number of moles of base, n'

So, n = n'

CV = C'V' where

Making C' subject of the formula, we have

C' = CV/V'

Substituting the values of the variables into the equation, we have

C' = CV/V'

C' = 0.0470 M × 16.0 mL/26.0 mL

C' = 0.752 MmL/26.0 mL

C' = 0.0289 M

We know that the ion-product of water Kw is

Kw = [H⁺][OH⁻] =  where

Making [H⁺] subject of the formula, we have

[H⁺} = Kw/[OH⁻]

[H⁺] = 1.01 × 10⁻¹⁴/0.0289

[H⁺] = 34.95 × 10⁻¹⁴

[H⁺] = 3.495 × 10⁻¹³

Since pH = -㏒[H⁺]

pH = -㏒[3.495 × 10⁻¹³]

pH = -㏒[3.495] + (-㏒10⁻¹³)

pH = -㏒[3.495] + [-13(-㏒10)]

pH = 13 - 0.5434

pH = 12.4566

pH ≅ 12.46

So, the pH at equivalence point is 12.46

Learn more about pH at equivalence point here:

https://brainly.com/question/25487920

Answer:

98.08 g/mol

Explanation:

Hope this helps.

The reaction requires a stoichiometric ratio of \(2:4\) for carbon monoxide to hydrogen gas, resulting in the formation of methane and oxygen gas as products.

The balanced chemical equation for the reaction between gaseous carbon monoxide  \((CO)\) and hydrogen gas \((H_2)\) to form gaseous methane \((CH_4)\) and oxygen gas  \((O_2)\)  is:

\(2CO(g) + 4H2(g) \rightarrow CH4(g) + O2(g)\)

In this equation, \(2\)  moles of carbon monoxide react with  \(4\) moles of hydrogen gas to produce 1 mole of methane and  \(1\) mole of oxygen gas.

Therefore, The reaction requires a stoichiometric ratio of \(2:4\) for carbon monoxide to hydrogen gas, resulting in the formation of methane and oxygen gas as products.

Learn more about equation here:

https://brainly.com/question/30087623

#SPJ1

Answer:

ang hirap na nag tanung

The total pressure in the flask after 1.00 hour will be 0.85 atm.

The given process is a second-order reaction, and its rate law is given by:

rate = k[CH₃CHO]²

where k is the rate constant and [CH₃CHO] is the concentration of acetaldehyde.

The half-life of the reaction is given as 410 seconds, which can be used to determine the rate constant as follows:

t1/2 = 1 ÷ k[CH₃CHO]²

410 s = 1 ÷ k[CH₃CHO]²

k = 1 ÷ (410 s [CH₃CHO]²)

Assuming that the reaction proceeds to completion, i.e., all the acetaldehyde is converted to methane and carbon monoxide, we can use the ideal gas law to determine the total pressure:

PV = nRT

where P is the total pressure, V is the volume of the flask (500 mL = 0.5 L), n is the number of moles of gas, R is the gas constant (0.08206 L atm/mol K), and T is the temperature (518 °C = 791 K).

Let [CH₃CHO]₀ be the initial concentration of acetaldehyde, then:

[CH₃CHO]₀ = P₀ ÷ RT

[CH₃CHO] = [CH₃CHO]₀ exp(-kt)

n(CH₃CHO) = [CH₃CHO]₀ V

n(CH4) = n(CO) = n(CH₃CHO)

Therefore, the total pressure at equilibrium is given by:

P = n(RT ÷ V) = [CH₃CHO]₀ (RT ÷ V) exp(-kt) + 2 [CH₃CHO]₀ (RT ÷ V)

P = P₀ exp(-kt) + 2P0

where P0 is the initial pressure of acetaldehyde (364 mmHg = 0.48 atm)

k = 1 ÷ (410 s [CH3CHO]³) = 0.000039 M⁻¹ s⁻¹

[CH₃CHO]₀ = P₀ ÷ RT = 0.48 atm ÷ (0.08206 L atm/mol K × 791 K) = 0.00706 M

P = P0 exp(-kt) + 2P0

P = 0.48 atm exp (-0.000039 M⁻¹ s⁻¹ × 3600 s) + 2 × 0.48 atm

P = 0.85 atm

To learn more about pressure follow the link:

https://brainly.com/question/19975849

#SPJ1

Answer:

From the Online Catalog to the Shelf

Libraries in the United States generally use either the Library of Congress Classification System (LC) or the Dewey Decimal Classification System to organize their books. Most academic libraries use LC, and most public libraries and K-12 school libraries use Dewey.

Explanation:

Answer:

From the Online Catalog to the Shelf

Libraries in the United States generally use either the Library of Congress Classification System (LC) or the Dewey Decimal Classification System to organize their books. Most academic libraries use LC, and most public libraries and K-12 school libraries use Dewey.

According to specific heat capacity, 37800 J s of energy is absorbed when 100 g of water is heated from 10°C to 100°C, 18900 J of energy is required to freeze 50 g of water at 0°C and 37800  J  of energy is required to vaporize 10 g of water at 100°C.

Specific heat capacity is defined as the amount of energy required to raise the temperature of one gram of substance by one degree Celsius. It has units of calories or joules per gram per degree Celsius.

It varies with temperature and is different for each state of matter. Water in the liquid form has the highest specific heat capacity among all common substances .Specific heat capacity of a substance is infinite as it undergoes phase transition ,it is highest for gases and can rise if the gas is allowed to expand.

It is given by the formula ,

Q=mcΔT,substitution in each case gives Q= 100×4.2×90=37800 J, Q= 50×4.2×90=18900 J,Q= 4.2×90×10= 3780 J

Learn more about specific heat capacity,here:

https://brainly.com/question/16952828

#SPJ1

Answer:

1 is true 2 is flase and 3 is true

Explanation:

Answer:1 is true 2 is false and 3 is true

Explanation:

Consider the following mechanism.

The overall balanced chemical equation : 2O₃  ---->   3O₂

The intermediates within the mechanism : O

The order with respect to each reactant :  2

The rate law for the overall reaction : R = k[O₃]²/[O]

The equations are :

O₃  ---->   O₂  +  O   fast

O₃  +   O  --->  2O₃   slow

a) The overall reaction is given as :

2O₃  ---->   3O₂

b) The intermediates within the mechanism is O.

c)  The order with respect to each reactant is 2

d) slow step rate : k[O][O₃]

at equilibrium, kc = [O][O₂] / [O₃]

The rate law = R = k[O₃]²/[O]

Thus, Consider the following mechanism.

The overall balanced chemical equation : 2O₃  ---->   3O₂

The intermediates within the mechanism : O

The order with respect to each reactant :  2

The rate law expression for the reaction : R = k[O₃]²/[O]

To learn more about rate law here

https://brainly.com/question/21256997

#SPJ1

Answer and Explanation:

Inspiration for new types of synthetic materials come from natural materials where a derivative is needed to be used in situations where properties of a natural material are adjusted. Inspirations for new types of synthetic materials can also come from current synthetic materials that create toxins, and new ones are created with the same properties but with less harmful downsides.

Answer:Chemistry is important for meeting our needs of food,clothing,shelter,health,energy,and clan air,water,and soil.

Answer: Sexual reproduction produces offspring by the fusion of gametes, resulting in offspring genetically different from the parent or parents.

Explanation: Asexual reproduction produces new individuals without the fusion of gametes, genetically identical to the parent plants and each other, except when mutations occur. Hope this helped! :)

Answer:

To find the pressure at which the solubility of the gas would be 0.2 g/L, we can use the concept of Henry's Law. Henry's Law states that the solubility of a gas in a liquid is directly proportional to the pressure of the gas above the liquid.

The equation for Henry's Law is:

S = k * P

Where:

S is the solubility of the gas in the liquid (in g/L)

k is the Henry's Law constant (which depends on the specific gas and liquid)

P is the partial pressure of the gas above the liquid (in atm)

We can set up a proportion to find the unknown pressure (P2) when the solubility (S2) is 0.2 g/L:

S1 / P1 = S2 / P2

Substituting the given values:

0.028 g/L / 3.5 atm = 0.2 g/L / P2

Now we can solve for P2:

P2 = (0.2 g/L * 3.5 atm) / 0.028 g/L

P2 = 24.5 atm

Therefore, at a pressure of 24.5 atm, the solubility of the gas would be 0.2 g/L.

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Answer:

Commercially, 2-methylpentenal is synthesized by the aldol condensation of propanal in the presence of liquid base like KOH or NaOH in stoichiometric amount,,. Under optimum reaction conditions, 99% conversion of propanal is achieved with 86% selectivity of 2-methylpentenal using liquid base.

Explanation:

hope this helps

Answer:

HMM, what the person above said.

The balanced chemical equation of combustion of methanol is  2 CH₃OH  + 3 O₂\(\rightarrow\) 2 CO₂ + 4 H₂O

Chemical equation is a symbolic representation of a chemical reaction which is written in the form of symbols and chemical formulas.The reactants are present on the left hand side while the products are present on the right hand side.

A plus sign is present between reactants and products if they are more than one in any case and an arrow is present pointing towards the product side which indicates the direction of the reaction .There are coefficients present next to the chemical symbols and formulas .

The first chemical equation was put forth by Jean Beguin in 1615.By making use of chemical equations the direction of reaction ,state of reactants and products can be stated. In the chemical equations even the temperature to be maintained and catalyst can be mentioned.

Learn more about chemical equation,here:

https://brainly.com/question/28294176

#SPJ1