Evidence II
How did the suspects make the silver coins look gold?

A)Concentration of NH4+ = 0.041 * 0.0100 M = 0.00041 M

B)Concentration of molecular NH3 = 0.0100 M - 0.00041 M = 0.00959 M

C)Ka = (0.00041 M)(0.00041 M) / 0.00959 M = 1.76 x 10^-5

D)[OH-] after NH4Cl addition = 0.00041 M - 0.0090 M = -0.00859 M (negative value indicates that OH- is completely consumed)

To calculate the values requested, we can use the given information and the concept of ionization of aqueous ammonia. The ionization reaction is as follows:

NH3 + H2O ⇌ NH4+ + OH-

(a) To determine the concentration of NH4+ and OH- ions:

Given that the ammonia solution is 4.1% ionized, this means that 4.1% of the initial concentration of NH3 has ionized.

Concentration of NH4+ = 0.041 * 0.0100 M = 0.00041 M

Concentration of OH- = 0.00041 M

(b) To find the concentration of molecular ammonia:

Concentration of molecular NH3 = initial concentration - concentration of NH4+

Concentration of molecular NH3 = 0.0100 M - 0.00041 M = 0.00959 M

(c) To calculate the ionization constant (Ka) of aqueous ammonia:

Ka = [NH4+][OH-] / [NH3]

Ka = (0.00041 M)(0.00041 M) / 0.00959 M = 1.76 x 10^-5

(d) When 0.0090 mol of NH4Cl is added to 1 L of the solution, it reacts with OH- to form NH3 and H2O. The NH4Cl dissociates fully, providing 0.0090 mol of NH4+ and Cl- ions.

Since NH4+ reacts with OH-, the concentration of OH- will decrease by 0.0090 M.

[OH-] after NH4Cl addition = 0.00041 M - 0.0090 M = -0.00859 M (negative value indicates that OH- is completely consumed)

Please note that the negative value for [OH-] is not physically meaningful in this context, as the actual concentration cannot be negative. It suggests that all OH- ions have been consumed in the reaction, and the solution is now acidic.

For more question on Concentration

https://brainly.com/question/28564792

#SPJ8

Answer:

could you explain your question more

Explanation:

water, food, and air.

Additionally:

Shelter and clothes

Answer:

If you left a block of dry ice in a bow of room temperature all day, it would evaporate.dry ice undergo sublimation,it will go from solid to gas instead of going through the normal process

solid-liquid- gas

Answer:

Chemical to electrical to mechanical

Explanation:

The energy conversion going on in a battery - powered toy car is from chemical to electrical and then to mechanical energy.

According to the law of conservation of energy, energy is neither created nor destroyed but transformed from one form to another.

The hydrogen-rich fuel cell offers advantages in terms of efficiency, environmental impact, operating time, refueling speed, weight, size, and lifespan when compared to conventional electrochemical cells like the lead-acid battery.

The hydrogen-rich fuel cell offers several advantages over conventional electrochemical cells like the lead-acid battery. Here are some of the key advantages:

1. Higher Efficiency: Hydrogen fuel cells have higher energy conversion efficiencies compared to lead-acid batteries. Fuel cells can convert chemical energy directly into electrical energy with minimal loss, while lead-acid batteries have inherent energy losses due to factors such as internal resistance and heat dissipation.

2. Clean and Environmentally Friendly: Hydrogen fuel cells produce electricity through the reaction of hydrogen and oxygen, with water being the only byproduct. They do not produce harmful emissions or contribute to air pollution, making them a cleaner and more sustainable power source compared to lead-acid batteries, which require the use of chemicals like sulfuric acid.

3. Longer Operating Time: Fuel cells have longer operating times compared to lead-acid batteries. Lead-acid batteries have a limited capacity and need to be recharged frequently, while fuel cells can continuously generate electricity as long as there is a supply of hydrogen.

4. Faster Refueling: Refueling a fuel cell is faster compared to recharging a lead-acid battery. Fuel cells can be refueled by replenishing the hydrogen supply, which can be done relatively quickly. In contrast, lead-acid batteries require a longer time to recharge, typically hours, depending on the battery's capacity and charging rate.

5. Lighter Weight and Compact Size: Hydrogen fuel cells have a higher energy density compared to lead-acid batteries, meaning they can store more energy in a smaller and lighter package. This makes fuel cells more suitable for applications where weight and space are critical, such as in portable devices or electric vehicles.

6. Longer Lifespan: Fuel cells generally have a longer lifespan compared to lead-acid batteries. Lead-acid batteries can experience degradation over time due to factors like sulfation, which can reduce their overall capacity and lifespan. Fuel cells, on the other hand, can provide consistent performance over an extended period with proper maintenance.

These advantages make fuel cells a promising technology for various applications, including transportation, stationary power generation, and portable electronics.

for more questions on fuel cell

https://brainly.com/question/14122421

#SPJ8

If during a spectroscopy experiment a student notes a wavelength peak measurement at 280 nm, then the region of the electromagnetic spectrum observed is the UV region.

The electromagnetic spectrum refers to all types of wavelengths that radiation can emit as light, which involves both visible light and also ultraviolet (UV) radiation.

In conclusion, if during a spectroscopy experiment a student notes a wavelength peak measurement at 280 nm, the region of the electromagnetic spectrum observed is the UV region.

Learn more about the electromagnetic spectrum here:

https://brainly.com/question/23423065

#SPJ1

Answer:

I hope this helps you

.......................................

Hello, this is Bing. I can help you with your question. Based on the information I found on the web, **H2** can be broken down into its two atoms of hydrogen (H) by supplying enough energy to overcome the bond that holds them together⁴. This process is called **dissociation** and requires an energy equal to or greater than the **dissociation energy** of H2, which is about 436 kJ/mol⁴.

One way to break down H2 is by using **electricity** to split water (H2O) into hydrogen (H2) and oxygen (O2) through a process called **electrolysis**¹. In this process, water is decomposed into its elements by passing an electric current through it. The electric current is provided by a battery or another source of electricity and the water needs to have an **electrolyte**, such as salt or acid, added to it to make it conductive¹. Two electrodes, usually made of metal or other conductive material, are inserted into the water and connected to the battery. The electrode connected to the positive terminal of the battery is called the **anode** and the one connected to the negative terminal is called the **cathode**¹. When the electric current flows through the water, hydrogen gas bubbles form at the cathode and oxygen gas bubbles form at the anode¹. The overall chemical reaction for electrolysis of water is:

2 H2O → 2 H2 + O2

Another way to break down H2 is by using **heat** to cause a reaction between hydrogen and oxygen that produces water and releases a large amount of energy. This reaction is called **combustion** or **oxidation** and can be ignited by a spark or a flame³. The reaction is very fast and explosive and can be dangerous if not controlled. The overall chemical reaction for combustion of hydrogen is:

2 H2 + O2 → 2 H2O

I hope this helps you understand how H2 can be broken down and what methods are used to do so.

The student's method for preparing pure crystals of copper sulfate contains errors and does not produce the desired outcome.

Use copper oxide instead of calcium carbonate: The student should add copper oxide (CuO) to the hydrochloric acid instead of calcium carbonate. Copper oxide reacts with hydrochloric acid to form copper chloride, which can then be converted to copper sulfate through a subsequent reaction with sulfuric acid.

Add sulfuric acid to the copper chloride solution: After the copper chloride solution is formed, the student should add sulfuric acid to it. This reaction between copper chloride and sulfuric acid will yield copper sulfate and hydrochloric acid. The student should ensure that the correct stoichiometric ratio is maintained to maximize the yield of copper sulfate crystals.

Crystal formation: The student should allow the solution to cool slowly after the reaction with sulfuric acid. This promotes the formation of larger, well-defined copper sulfate crystals.

Filtration and drying: Once the crystals have formed, the student should filter the solution to separate the solid crystals from the remaining liquid. The filtered crystals should then be thoroughly dried to remove any remaining water, resulting in pure copper sulfate crystals.

By following these improvements, the student can obtain pure crystals of copper sulfate.

For more such questions on copper sulfate visit:

https://brainly.com/question/17439051

#SPJ8

Answer:

Animal? Bacteria? Plant? Fungi? What do these figures represent?

2

None of the above! These organisms may be single-celled like bacteria, and they may look like a fungus. They also may hunt for food like an animal or photosynthesize like a plant. And, yet, they do not fit into any of these groups. These organisms are protists!

What are Protists?

3

Protists are eukaryotes, which means their cells have a nucleus and other membrane-bound organelles. Most protists are single-celled. Other than these features, they have very little in common. You can think about protists as all eukaryotic organisms that are neither animals, nor plants, nor fungi.

4

Although Ernst Haeckel set up the Kingdom Protista in 1866, this kingdom was not accepted by the scientific world until the 1960s. These unique organisms can be so different from each other that sometimes Protista is called the “junk drawer" kingdom. Just like a junk drawer, which contains items that don't fit into any other category, this kingdom contains the eukaryotes that cannot be put into any other kingdom. Therefore, protists can seem very different from one another.

Explanation:

Hope it helps, some how.

Answer:

CH2O

Explanation:

According to the valence shell electron pair repulsion theory, electron pairs tend to position themselves as far apart in space as possible to minimize repulsion.

The shape of a molecule depends on the number of electron pairs present on the valence shell of the central atom in the molecule- both lone pairs and bond pairs.

CH2O has three electron domains. the possession of three electron domains and no lone pairs of electrons on the central atom corresponds to a trigonal planar geometry.

Answer:

Less than 7

Explanation:

during the titration of strong acid and weak base, the weak base is usually kept in the flask and strong acid is kept in the burette. So when we add strong acid slowly drop by drop, slowly the pH level of solution starts to decrease and at equivalence point the acid overpowers the base as a strong acid was taken over a weak base.

Taking into account definition of limiting reagent,  when 20.0 g NH₃ and 50.0 g O₂ are allowed to react, NH₃ will be the limiting reagent.

In first place, the balanced reaction is:

4 NH₃ + 5 O₂ → 4 NO + 6 H₂O

By reaction stoichiometry (that is, the relationship between the amount of reagents and products in a chemical reaction), the following amounts of moles of each compound participate in the reaction:

The molar mass of the compounds is:

By reaction stoichiometry, the following mass quantities of each compound participate in the reaction:

The limiting reactant is the one that is consumed first and sets a limit on the quantity of product(s) that can be produced

To determine the limiting reagent, it is possible to use a simple rule of three as follows: if by stoichiometry 160 grams of O₂ reacts with 68 grams of NH₃, 50 grams of O₂ reacts with how much mass of NH₃?

mass of NH₃= (50 grams of O₂× 68 grams of NH₃)÷ 160 grams of O₂

mass of NH₃= 21.25 grams

But 21.25 grams of NH₃ are not available, 20 grams are available. Since you have less mass than you need to react with 50 grams of O₂, NH₃ will be the limiting reagent.

Learn more about limiting reagent:

https://brainly.com/question/26905271

#SPJ1

Answer:

\(224 \times 13313\frac{.131?}{?244} \)

If you accidentally add salt instead of sugar to a recipe, you can use vinegar to counteract the salty taste.

If you have added salt instead of sugar to a recipe, then you can try to remove the salt by adding a substance that will counteract its flavor. One such substance is vinegar, which is an acid and can help to neutralize the salty taste. Here are the steps to remove salt from a dish:

1. Remove as much of the salty liquid or sauce as possible.

2. Dilute the remaining sauce or liquid by adding more of the ingredients in the recipe, except for the salt

3. Taste the dish and add more sugar if needed.

4. If the dish is still too salty, add a little bit of vinegar.

5. Keep tasting the dish and adjusting the sugar and vinegar until it is no longer too salty.6. If the dish becomes too sweet, add more of the other ingredients to balance it out.

Know more about   salt   here:

https://brainly.com/question/20835655

#SPJ8

The concentration of free Hg²⁺ ions in the solution is extremely low, which is much less than the solubility product of Hg(OH)2, Ksp= 3.0×10⁻²⁶. Therefore, Hg(OH)₂ will not precipitate from the solution.

A solution is a homogeneous mixture of two or more substances. In a solution, the solute is uniformly dispersed in the solvent. The solute can be a solid, liquid, or gas, while the solvent is usually a liquid, such as water.

Solutions can be classified as dilute or concentrated, depending on the amount of solute present in the solution. A dilute solution has a low concentration of solute, while a concentrated solution has a high concentration of solute.

To determine whether Hg(OH)₂ will precipitate from the solution, we need to calculate the concentration of free Hg²⁺ ions in the presence of EDTA⁻⁴. We can use the formation constant (Kf) of HgEDTA⁻² to calculate the concentration of HgEDTA⁻² complex ion:

Hg²⁺ + EDTA⁻⁴ → HgEDTA⁻², Kf = 6.3×10²¹

The equilibrium constant expression for this reaction is:

Kf = [Hg]/([Hg²⁺][EDTA⁻⁴])

We can rearrange this equation to solve for the concentration of free Hg²⁺ ions:

[Hg²⁺] = [HgEDTA⁻²]/(Kf[EDTA⁻⁴])

We are given that the concentration of Hg(NO3)2 is 0.025 M, which means the concentration of  Hg²⁺ ions is also 0.025 M. We can assume that all the  Hg²⁺ ions are complexed with EDTA⁻⁴, so the concentration of HgEDTA⁻² complex ion is also 0.025 M.

Therefore,

[ Hg²⁺] = [HgEDTA⁻²]/(Kf[EDTA⁻⁴])

[ Hg²⁺] = (0.025 M)/(6.3×10²¹ × 0.10 M)

[ Hg²⁺] = 3.97 × 10⁻²⁷ M

The concentration of free Hg²⁺ ions in the solution is extremely low, which is much less than the solubility product of Hg(OH)2, Ksp= 3.0×10⁻²⁶. Therefore, Hg(OH)2 will not precipitate from the solution.

To know more about ions visit:

https://brainly.com/question/30133364

#SPJ1

Answer:

Explanation:

The mass of a substance when given the density and volume can be found by using the formula

From the question

density = 2.7 g/mL

volume = 11 mL

The mass is

mass = 2.7 × 11

We have the final answer as

Hope this helps you

Answer:

Options : A, B and C are correct procedure for quality control in a fertilizer plant

Explanation:

The options that constitute the sampling plan are :

A) A 50 g sample is removed from every 100th bag of fertilizer produced, resulting in ten 50 g samples

B) Samples 1, 3, 5, 7, and 9 are thoroughly mixed and a 50 g sample of the mixture is removed

C) Samples2,4,6,8 and 10 and the 50 g sample from the mixture are taken to the analytical laboratory.

A quality control procedure is used to ensure that a certain product is produced following set standards or meets the required quality desired by the customer . and options A, B and C ensures that.

Answer:

b) empty space

Explanation:

A mechanical cannot travel through empty space. So option (b) is correct.

A mechanical wave is a wave which needs a material medium for its propagation. For example sound, water waves etc . The medium required by the wave can be a solid, liquid or a gas. Empty space doesn't have any medium, so a mechanical wave cannot travel through empty space.

3.68*10-5 m/s  is the average rate of the reaction during this time period.

What is rate of reaction?

A rate of reaction is the speed at which a chemical reaction takes place. It is usually expressed as the change in the concentration of a reactant or product per unit time. The rate of a reaction is determined by many factors, including the physical state of the reactants, the temperature, the concentration of the reactants, the presence of a catalyst, and the surface area of the reactants that are in contact with each other.

2NO(g)+O2(g) -> 2NO_2(g)

Rate = -1/2 d[No]/dt

Average Rate = -1/2[0.0225-0.0700/650-5]

           = 3.68*10^-5 m/s

Therefore, 3.68*10-5 m/s  is the average rate of the reaction during this time period.

To learn more about rate of reaction from the link

https://brainly.com/question/13329913

#SPJ1

Explanation:

To find the value of n in the formula P4On, we need to use the given relative molecular mass of the oxide and the atomic masses of phosphorus (P) and oxygen (O).

The molecular mass of P4On can be calculated as:

molecular mass of P4On = (molecular mass of P4) + (molecular mass of On)

= (4 × atomic mass of P) + (n × atomic mass of O)

We are given that the relative molecular mass of the oxide is 284. Therefore:

molecular mass of P4On = 284

Substituting the atomic masses of P and O, we get:

(4 × 31) + (n × 16) = 284

Simplifying the equation, we get:

124 + 16n = 284

Subtracting 124 from both sides, we get:

16n = 160

Dividing both sides by 16, we get:

n = 10

Therefore, the value of n in the formula P4On is 10. Hence, the formula of the oxide is P4O10.

Strong bonds between the atoms are shown by the high melting and boiling temperatures of metals.

The coordination number for each atom is either eight or twelve, and metallic solids contain metal atoms arranged in face-centered or body-centered patterns. The difficulty is that the bonding is too strong for London Dispersion forces, in addition to the fact that there are insufficient electrons to form covalent bonds. The problem is solved by the fact that the nuclei of the metals float in a sea of electrons. Metals transmit electricity because the electrons are mobile and delocalized.

To know more about metals click on the link below:

https://brainly.com/question/4701542

#SPJ4

Answer:

oxidation

Explanation:

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Answer: O a layer of grass clippings, a layer of fruit scraps, some soil, and some water

Explanation:

The compost pile is made up of decomposing organic materials that are obtained from dead and decaying vegetable or plant matter, animal materials like dung, dead skins and others. The decomposition is done by the soil microbes that recycle the matter into nutrients that are absorbed by the plants. All the components of the compost pile are degradable and completely converted into organic matter. The grass clipping and fruit scraps mixed with soil and water can be easily decomposed by the soil microbes easily.

The appropriate layering process for a compost pile would be: a layer of grass clippings, a layer of fruit scraps, some soil, and some water and the correct option is option 4.

This layering process ensures a balanced mix of nitrogen-rich "green" materials (such as grass clippings) and carbon-rich "brown" materials (such as fruit scraps).

The addition of soil introduces microorganisms necessary for decomposition, and water provides moisture for the composting process.

The layering of different materials promotes proper airflow and creates an optimal environment for the decomposition of organic matter, resulting in the formation of nutrient-rich compost.

Thus, the ideal selection is option 4.

Learn more about Layering, here:

https://brainly.com/question/30005642

#SPJ6

Answer:

Explanation:

Baking soda decomposes to produce sodium carbonate .

2NaHCO₃  = Na₂CO₃ + CO₂ + H₂O.

2 x 84 g          106 + 10 x 18  g

Molecular mass of Na₂CO₃ .10H₂O = 286

168 g baking soda  produces 286  g sodium carbonate

1.555g baking soda will produce 286 x 1.555 / 168

= 2.647 g

Percentage yield = actual yield / theoretical yield x 100

= ( .991 /2.647 ) x 100

= 37.43 %.

Answer:

Xenon is element 54. in a perfect atom it would have 54 neutrons

Answer:

refer to explanation in order V

Explanation:

Atomic number: 54

Protons: 54

Electrons: 54

Neutrons: 77

Mass Number: 131.293 U

6 (1/2): At the upper left is the atomic number, or number of protons. In the middle is the letter symbol for the element (e.g., H). Below is the relative atomic mass, as calculated for the isotopes found naturally on Earth. At the very bottom is the name of the element (e.g., hydrogen).

6 (2/2): On the periodic table, the mass number is usually located below the element symbol.

I hope this helped!