estimate the number of solar neutrinos that pass through your head every second from the pp i fusion process that goes on in the sun.

CaF₂ (s) ⇄Ca (aq) + 2F (aq)

KP = [Ca²⁺][F]²

Use the stoichiometry of the reaction to prepare an ICE table showing the initial concentration of the common ion.

CaF2 (s) ⇄ Ca (aq) + 2F (aq)

initial           0            0.010

change      +S              +S

equili          S             0.010+S

Kp = [Ca²⁺][F]²

= (S)(0.010+S)²

= S(0.010)²

S= KP/(0.010)²

= 4.0×10⁻¹¹/1x104

= 4×10⁻⁷ M

A saturated solution is a solution in which as many solutes as possible are dissolved. At a certain temperature, solutes can no longer dissolve in saturated solutions. A saturated solution can be made by dissolving more solutes until no more solutes are dissolved. If adding more solute does not dissolve it, the original solution is saturated. If the added solute dissolves, the original solution was unsaturated.

Learn more about A saturated solution here:- https://brainly.com/question/4529762

#SPJ4

Answer:

C.

Explanation:

Answer A is incorrect because a compound doesn't have to be made with only metals.

Answer B is incorrect because that is actually the definition of a pure element.

Answer C is correct because to make a compound, there has to be a chemical reaction where bonds are formed and an entirely new substance is created.

Answer D is incorrect because compounds cannot be separated by physical means.

Hope this helps :D

Answer:

See explanation below

Explanation:

The overall question is design a synthesis. The rest of the question is just for you to choose the correct procedure of the synthesis.

Now first of all, you need to know how this reaction goes. We have an alkyl halide that undergoes a whole process to become a tertiary alcohol. Now the first step would be doing a E2 reaction, to eliminate the bromine and turn the molecule into an alkene.

When the molecule is turned into an alkene, we will have a double bond available to do another reaction.

In this case we can use any method to do an alkene hydration. You can use a acid medium, or use mercury compounds among others. This will be through acid medium cause it's easier.

In the picture below, you have the mechanism of this reaction:

The use of phenol (carbolic acid) as a surgical wound disinfectant was first practiced by Joseph Lister.

Joseph Lister was a surgeon, scientist, pathologist, etc. He was famous for the discovery of the prevention of infection in wounds. He first used phenol as a disinfectant agent for wounds.

Phenol is an inorganic compound, it is white crystalline and solid. It was used by Joseph Lister as an agent for a disinfectant agent. He discovered the safer medical procedure.

Thus, Joseph Lister was the first to utilize phenol (carbolic acid) to sterilize surgical wounds.

To learn more about Joseph Lister, refer to the below link:

https://brainly.com/question/472334

#SPJ4

Answer:

Four is the maximum number of single covalent bonds that can be formed by carbon. Carbon has four electrons in the valence shell.

Explanation:

Answer:skin cream

Explanation:

the independent variable is the variable that is always changed or manipulated. in this case the skin cream is the independent variable.

To perform the procedure, slowly add the calculated amount of 0.2 F AgNO3 from a buret while maintaining constant stirring. Additionally, incorporate a 10% excess of AgNO3 as directed by the instructor.

In this procedure, the objective is to add a specific amount of 0.2 F AgNO3 solution with constant stirring. The use of a buret allows for precise control over the volume being added. By adding the solution slowly, the reaction can be monitored and controlled more effectively.

Furthermore, it is mentioned that a 10% excess of AgNO3 should be added. This means that an additional 10% of the calculated amount of AgNO3 should be incorporated. The purpose of this excess is to ensure that all the reactants are fully consumed, promoting a complete reaction and maximizing the desired outcome.

The instructor will provide the 0.2 M AgNO3 solution, which is a solution with a known concentration. This concentration allows for accurate calculations of the required volume to achieve the desired amount of AgNO3.

Learn more about excess of AgNO3

brainly.com/question/10052452

#SPJ11

41.4 mol air would be inside the container at the tension determined to a limited extent c.

41.4 mol air would be inside the container at the tension determined to a limited extent c in light of the fact that the strain of the air inside the container is 1 atm. Since the molar mass of air is 28.97 g/mol, the crate would contain 41.4 mol of air at this tension. The molar mass of air is the typical molar mass of the parts of air, which are nitrogen, oxygen, argon, carbon dioxide, and other following gases. In this manner, the number of moles of air inside the container at the tension determined to a limited extent c is equivalent to 41.4 mol.

Computation of tension of the air inside the container.

To ascertain the tension of the air inside the container, the ideal gas regulation condition is utilized which is:

where P is the strain, V is the volume of the container, n is the number of moles of air, R is the all-inclusive gas consistency, and T is the temperature of the crate.

In this manner, the tension of the air inside the container can be determined as follows:

where V and T are the volume and temperature of the container, individually.

To know more about the pressure of the air inside the box calculate here

brainly.com/question/30426546

#SPJ4

The pH of the solution can be defined as the negative logarithm of the concentration of hydrogen ions or H+. In the equation form it is, pH = -log[H+]. These are the important equations to formulate when it comes to equilibrium pH problems.

KCN is actually a  basic salt coming from the reaction of a weak acid, HCN, and a strong base, KOH.  We know that HCN is the weak acid, the SCB is CN-. The reaction would be written as:

CN- + H2O ⇔ HCN + OH-

The important data that is the equilibrium constant of acidity of the weak acid is : Ka for HCN is 6.2×10^-10. Then, let's do the ICE(Initial-Change-Equilibrium) analysis.

         CN-    +    H2O    ⇔    HCN +    OH-

I      0.2 m             ∞                   0             0

C      -x                 ∞                   +x        +x

-----------------------------------------------------------

E      0.2-x                               +x         +x

The value x actually denotes the number of moles that CN- reacted. There is no value for H2O because the solution is dilute which means that water is added to the solution such that H2O>>>CN-.

Since the value of OH- is also calculated to be x, then OH-=0.001788 m. Consequently,

pOH = -log(0.001788) = 2.75

Calculation is pH = 14 - pOH = 14 - 2.75

pH = 11.25

Learn more about pH:

brainly.com/question/2288405

#SPJ4

Answer: hope this helps!

Explanation:

Answer: Why don't we feel the air pressing on us all the time?

Explanation:

Because air is a fluid, the weight of the air is transmitted to the palm of your hand and to the back of your hand at the same time. These forces cancel so that your hand overall feels no net force

Answer:the gravity in the atmosphere is pulling all the air so we can survive

Explanation:

The pH of the resulting solution after the addition of 13.0 mL of 0.100 M HCl is 4.7. This indicates that the solution is acidic and that there is still some of the weak acid HA remaining in the solution.

The addition of the strong acid HCl will react with the weak base A- produced during the titration, forming the weak acid HA and neutralizing some of the OH- ions present. This will result in a lower pH than the pH at the equivalence point, and the difference between the two pH values can be used to calculate the dissociation constant (pKa) of the weak acid.

At the equivalence point, the pH is determined by the dissociation constant (Ka) of the weak acid. In this case, the pale-pink phenolphthalein endpoint indicates that the pH at the equivalence point is approximately 8.5-9.5.

Since the pH at the equivalence point is higher than the pH of 4.7 after the addition of HCl, the weak acid must be less dissociated at the latter pH.

This means that the pKa of the weak acid is higher than the pH of 4.7, because a higher pKa corresponds to a weaker acid and a lower degree of dissociation.

Therefore, we can conclude that the pKa of the unknown weak acid HA is greater than 4.7, based on the pH of the resulting solution after the addition of HCl.

For more question on weak acid

https://brainly.com/question/30465440

#SPJ11

The two main methods used to increase CO2 levels in beer after fermentation are natural carbonation and forced carbonation.

Natural carbonation involves adding a small amount of sugar to the beer before bottling or kegging. The residual yeast in the beer will consume the sugar, producing CO2 as a byproduct, which will dissolve into the beer, naturally carbonating it. This process can take anywhere from a few days to a few weeks, depending on the beer style and temperature.

Forced carbonation, on the other hand, involves using a CO2 tank to directly inject carbon dioxide into the beer. The beer is placed in a closed vessel and pressurized with CO2 until the desired level of carbonation is reached. This method is much quicker and more precise than natural carbonation, but it requires specialized equipment and can be more expensive.

Both methods have their advantages and disadvantages, and many breweries use a combination of both to achieve the desired level of carbonation for their beers. The level of carbonation can greatly affect the taste and mouthfeel of the beer, so it is an important consideration for brewers to get right.

For more such questions on fermentation, click on:

https://brainly.com/question/1411731

#SPJ11

Answer:

\( \huge{5.77 \times {10}^{ - 5} m}\)

Explanation:

The wavelength of a wave can be found by using the formula

\(\lambda = \frac{c}{f} \\\)

where

c is the speed of the wave

f is the frequency

From the question we have

\( \lambda = \frac{3 \times {10}^{8} }{5.2 \times {10}^{ 12} } \\ \\ \\ \\ \large{ = 5.77 \times {10}^{ - 5} m}\)

Hope this helps you

The molecule contains two chiral carbon atoms.

To determine the number of chiral carbon atoms in a molecule, we need to identify the carbon atoms that are bonded to four different substituents.

The structure of 2-chloro-4,5-dimethyl-3-hexone is:

    Cl

     |

CH3-C-CH2-C(CH3)2-CH(CH3)-CO

     |

    CH3

There are two carbon atoms that have four different substituents: the second carbon (C2) and the fifth carbon (C5). These two carbon atoms are chiral centers.

Therefore, the molecule contains two chiral carbon atoms.

To know more about substituents refer here

brainly.com/question/30779133#

#SPJ11

The atomic structure of a sodium atom:

The atomic number of the sodium atom is eleven. The electrons are placed in their respective orbits and sub-orbits with an electron configuration of 1s²2s²2p⁶3s¹.

The number of electrons and protons is also eleven and they are present in the nucleus of the atom. The sodium atom with an atomic number eleven is made up of a central nucleus which holds eleven positively charged protons, and eleven neutrons.

To maintain a neutral charge the proton count is always balanced with that of the electron count that is present in their respective energy level orbits outside the nucleus based on the energy possed by the electrons.

learn more about sodium atom at -

https://brainly.com/question/11694375

Answer:C12: 0.487 m

Explanation:

amount of time the two substances are in contact. area in contact between the two substances. specific heat of the material that makes up the substances. the density of the two substances in contact.

The characteristics determine how easily two substances change temperature is amount of time the two substances are in contact, area of contact between the two substances, specific heat of the material that makes up the substances and the density of the two substances in contact. Therefore, option B, C, D and E are correct.

When two substances that have different surface temperatures come in contact, conduction happens. The substance with the higher temperature always transfers energy to the one with the lower temperature.

When two objects with different temperatures come in contact with one another, energy moves from the hotter (higher temperature) object to the cooler (lower temperature) object until both objects reach the same temperature.

The latitude of the location has an impact on the air temperature there. The location's elevation. separation from the ocean.

Thus, option B, C, D and E are correct.

To learn more about the temperature, follow the link;

https://brainly.com/question/11464844

#SPJ6

The placement of a plastic coating (a, b, c, or d below) that could be used to prevent galvanic corrosion would depend on the type of plastic coating being used and the specifics of the joined copper and iron pieces that are exposed to salt water conditions.

Generally, a plastic coating should be applied to prevent any direct contact between the copper and iron pieces. Placement “a” and “b” could both be used, as they would create a barrier between the two pieces, while placement “c” and “d” would not be as effective because there would still be direct contact between the two pieces.

Learn more about galvanic corrosion:

https://brainly.com/question/20264260

#SPJ4

Among the given gases, the gas that shows the greatest deviation from ideal behavior at 25 degrees Celsius and 1 atm is likely to be H2 (hydrogen).

1. Size and shape of molecules: Hydrogen gas (H2) consists of diatomic molecules that are very small in size. The size of the hydrogen molecule is relatively larger compared to other gases such as CH4 (methane), SO2 (sulfur dioxide), and O2 (oxygen). The small size of hydrogen molecules leads to a higher probability of molecular interactions and deviations from ideal behavior.

2. Intermolecular forces: Hydrogen gas has relatively weak intermolecular forces compared to other gases. Although it exhibits London dispersion forces, these forces are not as strong as the dipole-dipole interactions in molecules like SO2 and CH4 or the formation of double bonds in O2. The weaker intermolecular forces in hydrogen contribute to larger deviations from ideal behavior.

Based on the size and shape of molecules as well as the strength of intermolecular forces, hydrogen gas (H2) is expected to show the greatest deviation from ideal behavior among the given gases at 25 degrees Celsius and 1 atm.

To know more about deviation visit:  

https://brainly.com/question/13208028

#SPJ11

Pure elements has Gibbs free energy equal to 0.

The Gibbs free energy is a concept in chemistry specially of thermodynamics. The maximum amount of work that can be accomplished at a constant temperature and pressure by a closed system can be calculated using the Gibbs free energy (also known as Gibbs energy; symbol: denoted as delta G). Additionally, it offers a prerequisite for any processes like chemical reactions that might take place in such circumstances.

When a system achieves equilibrium without being pushed by an input electrolytic voltage, the Gibbs energy is the thermodynamic potential that is reduced. At the equilibrium point, its derivative w.r.t. the system's reaction coordinate vanishes.

To know more about free energy, click here,

brainly.com/question/13765848

#SPJ4

It will take approximately 60 seconds for the concentration of phosphine to go from 0.400 M to 0.100 M.

For a first-order reaction, the rate of reaction is proportional to the concentration of the reactant. The integrated rate law for a first-order reaction is given by:

\(ln(\frac {[A]_t}{[A]_0}) = -kt,\)

where \([A]_t\) is the concentration of the reactant at time t, \([A]_0\) is the initial concentration of the reactant, k is the rate constant, and t is the time.

Given that the time required to go from 1.00 M to 0.250 M is 120 seconds, we can use this information to determine the rate constant (k). Rearranging the integrated rate law, we have:

ln(0.250/1.00) = -k(120 seconds).

Solving this equation for k, we find:

k ≈ -ln(0.250/1.00) / 120 seconds.

Now, to determine the time required for the concentration to go from 0.400 M to 0.100 M, we can rearrange the integrated rate law as follows:

\(ln(\frac {[A]_t}{[A]_0}) = -kt,\)

ln(0.100/0.400) = -kt.

Substituting the value of k we obtained earlier, we have

ln(0.100/0.400) = -(-ln(0.250/1.00) / 120 seconds)t.

Simplifying this equation, we find

\(t \approx -120 seconds \frac {ln(\frac {0.100}{0.400})}{ln(\frac {0.250}{1.00})}.\)

Evaluating this expression, we get

t ≈ 60 seconds.

Learn more about integrated rate law here:

https://brainly.com/question/29653027

#SPJ4

The correct option is B: Nitrogen forms three single covalent bonds.

In the given Lewis symbol ":N:::N:", each colon ":::" represents a shared pair of electrons, which indicates a covalent bond. The presence of three colons between the two nitrogen atoms suggests the formation of three covalent bonds.

Therefore, the correct statement is that nitrogen forms three single covalent bonds.

This is consistent with the electronic configuration of nitrogen, which has five valence electrons. Nitrogen requires three more electrons to achieve a stable octet configuration (eight valence electrons), and it achieves this by forming three covalent bonds with other atoms.

Hence, option b, stating that nitrogen forms three single covalent bonds, is the right answer based on the given Lewis symbol representation.

Learn more about Lewis symbol

brainly.com/question/31041158

#SPJ11

To determine the number of molecules of water of crystallization in the hydrated sodium carbonate and write its correct formula, we can use the given information and perform a calculation.

First, let's calculate the number of moles of nitric acid used in the titration:

Volume of nitric acid used = 28.75 cm³

Concentration of nitric acid = 1.6800 M

Number of moles of nitric acid = concentration × volume

= 1.6800 M × 0.02875 L

= 0.04824 moles

Since the reaction between nitric acid and hydrated sodium carbonate is 1:1, the moles of nitric acid used are equal to the moles of hydrated sodium carbonate.

Now, let's calculate the number of moles of hydrated sodium carbonate:

Mass of hydrated sodium carbonate used = 138.14 g

Molar mass of hydrated sodium carbonate = 105.99 g/mol (\(Na_2CO_3\))

Volume of solution prepared = 600.00 cm³ = 0.6 L

Number of moles of hydrated sodium carbonate = mass / molar mass

= 138.14 g / 105.99 g/mol

= 1.302 moles

Since the moles of nitric acid and hydrated sodium carbonate are equal, we can determine the number of water molecules of crystallization in the hydrated sodium carbonate.

The molar ratio between hydrated sodium carbonate and water can be found from the balanced chemical equation. Let's assume the formula of hydrated sodium carbonate is \(Na_2CO_3\) · x\(H_2O.\)

From the balanced equation:

1 mole of\(Na_2CO_3\) · x\(H_2O.\) reacts with x moles of water.

Therefore, in this case:

1.302 moles of \(Na_2CO_3\) · x\(H_2O.\) reacts with x moles of water.

Since the number of moles of water is equal to the number of moles of hydrated sodium carbonate, we can conclude that the correct formula for the hydrated sodium carbonate is \(Na_2CO_3\) ·\(1.302 H_2O.\)

So, the number of water molecules of crystallization in the hydrated sodium carbonate is 1.302.

Know more about crystallization    here:

https://brainly.com/question/30670227

#SPJ8

Answer:

A lunar eclipse can only happen during a full moon.

Hope I helped :)

Explanation:

The balanced half-reactions are given below:

A. Mo³⁺ (aq) + 3e⁻ → Mo(s)

B. H₂SO₃ (aq) +  H₂O → SO₄⁻ (aq) + 4 H⁺ + e⁻

C. NO₃⁻ (aq) + 4 H⁺ + 2e⁻ → NO (g) + 2 H₂O

D. O₂ (g) + 4H⁺ +  4 e⁻ → 2 H₂O (l)

Half-reactions refers to either of the two reactions in a redox reaction.

A redox reaction is a reaction in which oxidation and reduction occur simultaneously and to the same extent.

Oxidation reaction involves a loss of electrons while reduction reaction involves a gain of electrons.

The balanced half-reactions are given below:

A. Mo³⁺ (aq) → Mo(s) ( in acidic solution)

This is a reduction reaction:

Mo³⁺ (aq) + 3e⁻ → Mo(s)

B. H₂SO₃ (aq) → SO₄⁻ (aq) (acidic solution)

This is an oxidation reaction

H₂SO₃ (aq) +  H₂O → SO₄⁻ (aq) + 4 H⁺ + e⁻

C. NO₃⁻ (aq) → NO (g) (acidic solution)

This is a reduction reaction

NO₃⁻ (aq) + 4 H⁺ + 2e⁻ → NO (g) + 2 H₂O

D. O₂ (g) → H₂O (l) (acidic solution

This is a reduction reaction

O₂ (g) + 4H⁺ +  4 e⁻ → 2 H₂O (l)

Learn more about half-reactions at: https://brainly.com/question/24082438

#SPJ1

The benzoic acid Collect the top layer dry with Na2SO4 and evaporate the solvent.

Benzoic acid is sparingly soluble in water and forms a precipitate. The benzoic acid can then be separated by suction filtration through a Buchner funnel. Washing with sodium bicarbonate converts the benzoic acid to the more water-soluble form of sodium benzoate, which is extracted into the aqueous layer. Additionally, sodium bicarbonate neutralizes the catalytic acid in this reaction.

Benzoic acid containing the naphthalene impurity can be purified by crystallization in water. The reaction between benzoic acid and NaOH is an acid-base neutralization reaction. An acid reacts with a base to form salt and water. In aqueous solutions, NaOH increases the solubility of benzoic acid. Benzoic acid cannot move from one layer to another because ethanol is immiscible with water.

Learn more about Benzoic acid here:-https://brainly.com/question/28299797

#SPJ4

³⁸₁₈Ar nucleus completes the given equation, hence option D is correct.

The equation provided illustrates how an unstable chlorine isotope breaks down into a beta particle and an argon nucleus. To create an Argon nucleus that is more stable, the nucleus emits a beta particle.

Stable isotopes and supposedly unstable or radioactive isotopes are the two categories into which isotopes fall in science. These last ones are stable and don't produce radioactive radiation.

While Xenon and other isotopes are known to be stable, Xenon-124 and Xenon-136 deteriorate over the course of several trillion years.

Learn more about nucleus, here:

https://brainly.com/question/18852772

#SPJ1