The structural formulas of the following compounds areCH3-I, CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH3, cyclo-C5H10, H2C=CH-CH3.
a) Methyl iodide (CH3I) has a structural formula of CH3-I. Since it only contains one type of atom, there will only be one NMR signal expected.
b) 2,4-dimethylpentane (C7H16) has a structural formula of CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH3. There are four different types of hydrogen atoms in this compound, which means four NMR signals would be expected.
c) Cyclopentane (C5H10) has a structural formula of cyclo-C5H10. It contains only one type of hydrogen atom, so only one NMR signal would be expected.
d) Propylene (propene) (C3H6) has a structural formula of H2C=CH-CH3. There are two different types of hydrogen atoms in this compound, which means two NMR signals would be expected.
In summary, the number of NMR signals expected for a compound depends on the number of different types of hydrogen atoms present in the compound. Compounds with only one type of hydrogen atom will only have one NMR signal, while compounds with multiple types of hydrogen atoms will have multiple NMR signals.
To know more about Structural visit:
https://brainly.com/question/29154542
#SPJ11
how many moles of ions is in Magnesium chloride?
My science exam is due tomorrow and I HAVE LIMITED TIME. can someone help me how to absorb anything you read and memorize it...
Answer:
It won't let me type this for some reason but here it is.
A voltaic cell is based on the reaction
Sn(s)+I2(s)→Sn2+(aq)+2I−(aq).
Under standard conditions, what is the maximum electrical work, in joules, that the cell can accomplish if 80.0 gof Sn is consumed?
The maximum electrical work that the cell can accomplish if 80.0 g of Sn is consumed is 87215 Joules (J).
To determine the maximum electrical work that the voltaic cell can accomplish, we need to calculate the maximum cell potential (E°cell) and use it to find the maximum electrical work (Wmax).
First, let's write the half-reactions for the oxidation and reduction processes
Oxidation half-reaction: Sn(s) → Sn₂+(aq) + 2e⁻
Reduction half-reaction: I₂(s) + 2e⁻ → 2I⁻(aq)
Now, we can determine the standard reduction potentials (E°red) for each half-reaction from the ALEKS Data tab
E°red(Sn₂+/Sn) = -0.14 V
E°red(I₂/I-) = 0.54 V
The standard cell potential (E°cell) can be calculated using the formula:
E°cell = E°red(reduction) - E°red(oxidation)
E°cell = 0.54 V - (-0.14 V) = 0.68 V
The maximum electrical work (Wmax) can be calculated using the equation
Wmax = nF E°cell
Where
n = moles of electrons transferred (determined from the balanced equation)
F = Faraday's constant (96485 C/mol)
From the balanced equation, we can see that 2 moles of electrons are transferred per mole of Sn consumed.
Molar mass of Sn = 118.71 g/mol
Number of moles of Sn consumed = 80.0 g / 118.71 g/mol = 0.674 mol
n = 2 moles of electrons/mol of Sn consumed = 2 × 0.674 mol = 1.348 mol
Now we can calculate Wmax
Wmax = (1.348 mol)(96485 C/mol)(0.68 V) = 87215 J
To know more about electrical work here
https://brainly.com/question/32315272
#SPJ4
the pH of a solution is 2.0. what is the [OH^-] concentration?
What does it mean to enrich uranium?
slow the release of neutrons from the uranium.
dig uranium from the earth.
use uranium to cause a fission reaction.
separate uranium to increase the amount of u-235 and u-238.
To enhance the concentration of u-235 and u-238, uranium must first be separated.
what is uranium?About 0.72 percent of naturally occurring uranium is the uranium-235 isotope. It is fissile, meaning it can sustain a nuclear chain reaction, unlike the prevalent isotope, uranium-238. It is the sole fissile isotope that was created as a primordial nuclide in nature.
The process of boosting the amount of uranium-235, which makes up only approximately 0.7 percent of natural uranium, to between 3 and 5 percent for use as nuclear reactor fuel. Gaseous diffusion, gas centrifuges, or laser isotope separation can all be used for enrichment.
By using lasers to separate the different isotopes of uranium, uranium can be enriched. Laser light has the ability to excite molecules, a process known as photoexcitation. A particular isotope's characteristics can be altered and it can be separated if the electrons have more energy thanks to the use of lasers.
To learn more about uranium
https://brainly.com/question/29623106
#SPJ4
Explain in detail what happens when an acid and a base mix. Try to use the words ions, attraction, neutral and bonding in your answer.
( I understand how to use all keywords except from attraction, when does attraction occur in neutralization?)
Answer:
when acid and the base mix it is bonding together and that makes it have a little blast but because of the acid
Explanation:
acid is the mane thing that makes 50% of things blast like as if i were to put baking soada and acid it would blast.
Click the heart if this was helpful
the reaction between r and p appeared to stop when no further changes were observed. do chemical reactions actually stop when this happens? explain
The statement "the reaction between R and P appeared to stop when no further changes were observed" suggests that the observable changes in the reaction have ceased. However, chemical reactions may not actually "stop" completely even when no further changes are visibly observed.
Chemical reactions occur at the molecular level, where individual molecules collide and undergo chemical transformations. Even if the macroscopic changes or observable properties appear to have reached a steady state, the molecular-level reactions can continue at an equilibrium. In other words, while the overall concentrations or properties of the reactants and products may remain constant, the individual molecules are still undergoing constant microscopic fluctuations and interconversions.
In such cases, the reaction is considered to be in a dynamic equilibrium, where the forward and reverse reactions occur at equal rates, resulting in no net change in the macroscopic observable properties. This state of equilibrium does not imply that the reaction has completely stopped but rather that the rates of the forward and reverse reactions have balanced out.
Therefore, even when no further changes are observed at the macroscopic level, chemical reactions can continue at the molecular level in a dynamic equilibrium state.
learn more about Chemical reactions here:
https://brainly.com/question/29762834
#SPJ11
10 points get it right ADVPH
Answer:
Advanced Pharmaceutics Inc
Explanation:
Advanced Pharmaceutics Inc
somehow I know this acroynom
Which explains the change in ionization energy that occurs between removing the first and second electrons from an atom?
Answer:
"The strength of ionization decreases as the proportion including its protons to the excited electrons" is the right solution.
Explanation:
The ionizing procedure, the creation of ions through manipulating individual atoms or revolutionaries, or through decreasing or increasing charged particles in something other than gas by intense electrical fields.It should be the total removal of someone with an electron through an atomic nucleus rather than from molecules. The corresponding molecule has denominated an ion.This question seems incomplete. I believe the answer choices are as followed:
O The ionization energy decreases because the ratio of the protons to electrons increases.
O The ionization energy increases because the ratio of the protons to electrons increases.
O The ionization energy decreases because the ratio of the protons to electrons decreases.
O The ionization energy increases because the ratio of the protons to electrons decreases.
The answer to this is The ionization energy increases because the ratio of the protons to electrons increases. (2nd option).
3. Kristen was arrested for stealing 6.532 tons of gold from the armory in North Carolina.
She escaped capture for 2.45 days; until she was picked up on the side of the road for
jaywalking. At this time, she had had already hid some of the gold, but had 2.34 tons of
gold still with her. The gold with her was confiscated by police. a) How much money did
she make from the gold? b) How much room/volume does the gold take up?
a)
1,63760 money she make from the gold and volume of gold take 5.295 volume is the amount of space occupied by a substance
Here given data is kristen was arrested for stealing 6.532 tons and then She escaped capture for 2.45 days and then she had already hid some of the gold, but had 2.34 tons of gold still with her
We have to find how much money did she have if 2.34 tons of gold still with her = ? and how volume does gold take up = ?
Volume is the amount of 3D space a substance or object occupies
We have to convert 2.34 tons into money
Then 2.34 tons = 1,63760 money
And the formula to find volume is:
volume = mass/density
Mass of gold = 196.96 and density = 18.31
Volume = mass of gold / density
Volume = 196.96 / 18.31
Volume = 5.295
Know more about volume
https://brainly.com/question/13660337
#SPJ1
what are 3 common chemical reactions of the carbon family?
1. form covalent compounds.
2. nonreactive.
3. ionic compounds.
The carbon family elements have widely variable physical and chemical properties. Overall, the carbon family elements are stable and tend to be fairly unreactive. The elements tend to form covalent compounds, though tin and lead also form ionic compounds.
Reaction of carbon with air
Carbon, as graphite, burns to form gaseous carbon (IV) oxide (carbon dioxide), CO2. Diamond is a form of carbon and also burns in air when heated to 600-800°C - an expensive way to make carbon dioxide! ... This reaction is important. In industry, air is blown through hot coke.
A 6 kg rock rolls down a hill with a momentum of 12 kg m/s. Work out the velocity of the rock.
momentum = mass x velocity
When know that:
momentum is 12 km m/s
Mass is 6 kg
Hence, velocity = 12/ 6 = 2m/s
Aditya Birla Cement Manutacturing Company manufactures cement for use in construction of stone builelings. Beginning work in process inclustes 400 urvits that are 20% compiete with respect to conversion and 30% complete with respect to materials. Ensing work in process inclades 200 units that are 40% complete with respect to corversion and 50 E complete with respect to materials, 2,000 units were stated duting the perlod. Also, assume that $9,900 of material costs and $14,880 of cortversion costs were in the beginning inventory and $180,080 of materials and $409,200 of conversion costs were added to paoduction duing the period. What is the total cost pet equivalent unit using the weighted average method? Multiple Choice $26860 $26785 578000 $26500
The correct option is $26785.To calculate the total cost per equivalent unit using the weighted average method, we need to consider the costs incurred in both the beginning work in process and the units added during the period.
First, let's calculate the equivalent units of production for both conversion and materials:
Conversion costs:
Beginning work in process: 400 units × 20% complete = 80 equivalent units
Units added during the period: 2,000 units × 40% complete = 800 equivalent units
Total equivalent units for conversion = 80 + 800 = 880 equivalent units
Material costs:
Beginning work in process: 400 units × 30% complete = 120 equivalent units
Units added during the period: 2,000 units × 50% complete = 1,000 equivalent units
Total equivalent units for materials = 120 + 1,000 = 1,120 equivalent units
Next, let's calculate the total costs incurred:
Conversion costs:
Beginning work in process cost: $14,880
Costs added during the period: $409,200
Total conversion costs = $14,880 + $409,200 = $424,080
Material costs:
Beginning work in process cost: $9,900
Costs added during the period: $180,080
Total material costs = $9,900 + $180,080 = $189,980
Now, we can calculate the total cost per equivalent unit:
Total cost per equivalent unit = (Total conversion costs + Total material costs) / (Total equivalent units for conversion + Total equivalent units for materials)
Total cost per equivalent unit = ($424,080 + $189,980) / (880 + 1,120)
Total cost per equivalent unit ≈ $267.85
Therefore, the correct option is $26785.
To know more about conversion and materials, click here, https://brainly.com/question/1162213
#SPJ11
Hello there user can you explain and solution why is it correct ?
The number of protons, electrons, and neutrons in each of the given isotopes are:
Boron-11:
Protons: 5Electrons: 5Neutrons: 6Chlorine-35:
Protons: 17Electrons: 17Neutrons: 18Magnesium-24:
Protons: 12Electrons: 12Neutrons: 12Aluminum-27:
Protons: 13Electrons: 13Neutrons: 14Sulfur-32:
Protons: 16Electrons: 16Neutrons: 16What are isootopes?Isotopes are atoms of the same element but have different amounts of neutrons despite having the same number of protons.
The Periodic Table's atomic number of an element is determined by the number of protons it contains.
The isotopes of hydrogen and carbon are the most typical instances. Protium, deuterium, and tritium are the three stable atoms of hydrogen, which is an element. These isotopes all have the same amount of protons, but protium has zero neutrons, deuterium has one, and tritium has two.
Learn more about isotopes at: https://brainly.com/question/1598931
#SPJ1
How can you model the movement of a primary wave?
Answer:
P-waves (primary or compressional waves) are longitudinal or compression waves, able to move through solids, liquids, and gases at speeds ranging between 300-5,000 metres per second. As they travel through rock, they move particles back and forth in the same direction that the wave is moving
Explanation:
A state of matter in which material has no definite shape but has a definite volume
Answer:
Liquid
Have a goodnight/day and stay safe
Ethylene is the smallest member in the family of _____ containing a carbon-carbon _____ bond.
Ethylene is the smallest member in the family of hydrocarbons containing carbon-carbon double bond.
Ethylene is a simple organic compound with the chemical formula as C₂H₄ and it is a colorless, flammable gas with a sweet odor. Ethylene is an important industrial chemical that can be used in the production of plastics, synthetic rubber, and other chemicals.
Molecule of ethylene consists of two carbon atoms connected by double bond and each carbon atom is bonded to two hydrogen atoms. Double bond in ethylene is a type of covalent bond formed by the overlapping of two sp² hybrid orbitals on each of the carbon atom.
To know more about ethylene, refer
https://brainly.com/question/14797464
#SPJ11
What type of protons do you need to create a galaxy
According to the question ,\(10^{80}\) protons create a galaxy.
Why do protons exist?1.67262 1027 kg, or 1,836 times the mass of an electron, is the rest mass of the proton, a stable subatomic particle with a positive charge that is equivalent to one electron's charge.
What materials make up proton?
One down quark and two up quarks make up protons. Two down quarks and one up quark make up neutrons. One of the four fundamental forces, the "strong nuclear force," keeps the nucleus together (gravity and electromagnetism are two others).
The amount of protons in the cosmos is measured by the Eddington number , in astrophysics. Eddington estimated it to be approximately 1.571079; according to recent estimations \(10^{80}\).
To know more about proton visit:-
https://brainly.com/question/1252435
#SPJ10
Which of these is true about electrons? posses a positive electrical charge of one (+1) have a negative electrical charge of one (-1) indicates the number of protons in each atom equals the sum of protons plus neutrons in each atom
Answer:
have a negative electrical charge of one (-1)
Explanatio
Electrons have an electrical charge of negative one. When you think electron, always think -1
Which best describes a neutralization
reaction?
A) a reaction between an acid and a base
B) a reaction between two acids
C) a reaction between a base and a salt
D) a reaction between two salts
Explanation:
The Answer is a reaction between two acids
What is an alkene?
A. A hydrocarbon containing all single bonds
B. A hydrocarbon containing a carbon-carbon triple bond
C. A hydrocarbon containing a carbon-carbon double bond
O D. A hydrocarbon containing an aromatic ring
The answer is B. It’s b.
Answer:
A hydrocarbon containing a carbon - carbon double bond.
Explanation:
Alkene is hydrocarbon containing a
carbon - carbon double bond.
( Refer the attachment to understand more clearly )
An alkene is a hydrocarbon containing a carbon-carbon double bond and the correct option is option C.
What is a Hydrocarbon?Hydrocarbons are organic compounds that are entirely made up of only two kinds of atoms – carbon and hydrogen.
The carbon atoms join together to form the framework of the compound, and the hydrogen atoms attach to them in many different configurations.
Aliphatic hydrocarbons are divided into three main groups according to the types of bonds they contain: alkanes, alkenes, and alkynes.
Alkanes have only single bonds, alkenes contain a carbon-carbon double bond, and alkynes contain a carbon-carbon triple bond.
Therefore, An alkene is a hydrocarbon containing a carbon-carbon double bond and the correct option is option C.
Learn more about Hydrocarbons, here:
https://brainly.com/question/30907363
#SPJ2
(7.6 x 104m) x (1.5 x 107m)
Answer:
the answer should 126 859.2 m2
What is molarity a measurerhent of?
A. The grams of a substance dissolved in a liquid
B. The concentration of a substance dissolved in a liquid
C. The number of moles of a dissolved substance
O O
D. The volume of liquid containing a dissolved substance
add (from buret) slowly, with constant stirring, calculated amount of 0.2 f agno3. add 10% excess. [instructor will provide the 0.2 m agno3.]
To perform the procedure, slowly add the calculated amount of 0.2 F AgNO3 from a buret while maintaining constant stirring. Additionally, incorporate a 10% excess of AgNO3 as directed by the instructor.
In this procedure, the objective is to add a specific amount of 0.2 F AgNO3 solution with constant stirring. The use of a buret allows for precise control over the volume being added. By adding the solution slowly, the reaction can be monitored and controlled more effectively.
Furthermore, it is mentioned that a 10% excess of AgNO3 should be added. This means that an additional 10% of the calculated amount of AgNO3 should be incorporated. The purpose of this excess is to ensure that all the reactants are fully consumed, promoting a complete reaction and maximizing the desired outcome.
The instructor will provide the 0.2 M AgNO3 solution, which is a solution with a known concentration. This concentration allows for accurate calculations of the required volume to achieve the desired amount of AgNO3.
Learn more about excess of AgNO3
brainly.com/question/10052452
#SPJ11
Which example of observations would provide a scientist with the best data for planning a new investigation
about plant growth?
A: The scientist observed that, after exactly four weeks, the lima bean plant labeled "C" in soil was 3.25
inches taller than the other plants.
B: The scientist observed that after exactly four weeks, the bean plant in the darker soil was about 3
inches taller than the other plants.
C: The scientist observed that after about a month, the green plant in some soil looked taller than the
rest of the plants.
D: The scientist observed that after about 30 days, the bean plant labeled "C" in the soil was a couple of
inches taller than most of the other plants.
HELPPPPPPPPPP
An example of observation that would provide a scientist with the best data for planning a new investigation about plant growth is; Choice C; The scientist observed that after about a month, the green plant in some soil looked taller than the rest of the plants.
Discussion:
An observation like that in Choice C where in; what soil the green plant looked taller than the rest of the plants is unknown forms a basis for the planning a new investigation.
Ultimately, there must be unknown or unsure data for the planning of a new investigation.
Read more:
https://brainly.com/question/1854911
What is a chemical? Give examples of at least two substances that can be described as a chemical?
Answer:
water and salt
Explanation:
water because it is made of water molecules
salts are ionic compounds
Organic molecules are defined as chemical compounds that contain ______ in distinct ratios and structures. Multiple Choice
Organic molecules are defined as chemical compounds that contain carbon and hydrogen in distinct ratios and structures.
What are organic molecules?Organic molecules are the foundation of life, and they are the building blocks of all known biological systems. They are generally composed of carbon, hydrogen, and other elements in distinct ratios and structures.
They are found in living organisms, including humans, animals, plants, and other microorganisms. Organic molecules come in a variety of shapes and sizes, and they serve a variety of functions.
These molecules can be simple or complex, small or large, and they can exist as solids, liquids, or gases depending on their chemical composition. Organic molecules include carbohydrates, proteins, lipids, and nucleic acids.
To know more about organic molecules click on below link :
https://brainly.com/question/14160379#
#SPJ11
What is the smallest piece of compound you can have?
Answer:
the answer is molecule
A compound is a substance that consists of two or more elements in a unique composition. The smallest particle of a compound is called a molecule. Chemical bonds hold together the atoms of molecules. Compounds can form only in chemical reactions, and they can break down only in other chemical reactions.
Explanation:
Explain what is a nuclear force?
Answer:
a strong attractive force between nucleons in the atomic nucleus that holds the nucleus together.
Explanation:
a compound was found to contain 68.42% Cr and the rest oxygen by mass. what is the empirical and molecular formula of the substance? the compound has a molecular weight of 456.00 g/mol
Given that the compound contains 68.42% chromium and the rest oxygen, we can assume that the total mass of the compound is 100 grams. Therefore, the mass of chromium in the compound is:mass of Cr = 68.42 The mass of oxygen in the compound is:mass of O = 100 g - 68.42 31.58 g.
What is a compound ?A compound is a substance that is made up of two or more different elements that are chemically bonded together in a fixed ratio. Compounds can be formed through chemical reactions between atoms, ions, or molecules, and they can have a wide range of physical and chemical properties.
Compounds are distinct from mixtures, which are combinations of substances that are not chemically bonded together and can be separated by physical means. In contrast, the atoms in a compound are held together by strong chemical bonds, and the compound has a unique set of properties that are different from those of its constituent elements.
Examples of common compounds include water (H2O), carbon dioxide (CO2), sodium chloride (NaCl), and glucose (C6H12O6). Compounds play an important role in many areas of science and industry, including medicine, agriculture, materials science, and environmental science.
To know more about Compounds visit :
https://brainly.com/question/30904369
#SPJ1