Determine whether the series is absolutely convergent, conditionally convergent, or divergent.[infinity] (−1)nnn3 + 5n = 1(-1)^n (n/sqrt n^3+5)absolutely convergentconditionally convergentdivergent

Answers

Answer 1

The given series is conditionally convergent.

We can use the alternating series test to show that the series converges. First, we can rewrite the terms of the series as:

an = (-1)ⁿ * (n/√(n³ + 5))

The terms of the series are decreasing in absolute value and approach zero as n approaches infinity. Also, the series is alternating in sign, so we can apply the alternating series test. Therefore, the series converges.

To determine whether the series is absolutely convergent or conditionally convergent, we need to check the convergence of the series of absolute values:

∑ |an| = ∑ (n/√(n³ + 5))

We can use the limit comparison test to compare this series with the series ∑ (1/√(n)). We have:

lim (n/√(n³ + 5)) / (1/√(n)) = lim (n*√(n)) / √(n³ + 5) = lim 1 / √(1 + 5/n²) = 1

Since this limit is a positive finite number, the series ∑ |an| and the series ∑ (1/√(n)) have the same behavior. The series ∑ (1/√(n)) is a p-series with p=1/2, which is known to be divergent. Therefore, the series ∑ |an| is also divergent. Since the original series is convergent but |an| is divergent, the original series is conditionally convergent.

To learn more about absolutely convergent, here

https://brainly.com/question/31064900

#SPJ4


Related Questions

describe the structure of the coordinates associated with specific radian measurements on the unit circle

Answers

The structure of the coordinates associated with specific radian measurements on the unit circle follows a distinct pattern. The x and y coordinates represents the cosine and sine values of the angle, respectively.

The unit circle is a circle with a radius of 1 unit, centered at the origin of a Cartesian coordinate system.

It is commonly used in trigonometry to relate angles to the coordinates on the circle.

When we measure an angle in radians on the unit circle, we can associate specific coordinates with that angle.

The x-coordinate of a point on the unit circle represents the cosine value of the angle, while the y-coordinate represents the sine value of the angle.

These coordinates follow a pattern based on the radian measurement.

For example, when the angle is 0 radians (or 0 degrees), the corresponding point on the unit circle is (1, 0), where the x-coordinate is 1 (cosine of 0) and the y-coordinate is 0 (sine of 0).

As the angle increases, the coordinates change accordingly. For instance, when the angle is π/2 radians (or 90 degrees), the point on the unit circle is (0, 1), where the x-coordinate is 0 (cosine of π/2) and the y-coordinate is 1 (sine of π/2).

This pattern continues as the angle increases or decreases, and the coordinates on the unit circle change accordingly.

By using trigonometric functions, we can determine the cosine and sine values of any given angle and associate them with the appropriate coordinates on the unit circle.

In summary, the structure of the coordinates associated with specific radian measurements on the unit circle follows a pattern where the x-coordinate represents the cosine value of the angle, and the y-coordinate represents the sine value of the angle.

Together, these coordinates create points on the unit circle that correspond to the given radian measurement.

Learn more about Cartesian coordinate system here:

https://brainly.com/question/4726772

#SPJ11

Grayce has three diamonds that weigh 0.275 g each. Morgan has two diamonds that weigh 0.412 g each. Who has more grams of diamonds?

Answers

Grayce has 0.825 g of diamonds and Morgan has 0.824 g of diamonds. Grayce has more grams of diamonds

Calculating weights

From the question, we are to determine the person that has more grams of diamonds

From the given information,

"Grayce has three diamonds that weigh 0.275 g each"

and

"Morgan has two diamonds that weigh 0.412 g each"

Thus,

The total mass of Grayce's diamonds is 3 × 0.275 g

3 × 0.275 g = 0.825 g

Also,

The total mass of Morgan's diamonds is 2 × 0.412 g

2 × 0.412 g = 0.824 g

Since 0.825 is greater than 0.824,

Then,

Grayce has more grams of diamonds.

Learn more on Calculating weight here: https://brainly.com/question/27668162

#SPJ1

Find the leading coefficient of the polynomial function f(x) = -5x5 - 6x6 - 3x2 + 9x.

Find the leading coefficient of the polynomial function f(x) = -5x5 - 6x6 - 3x2 + 9x.

Answers

Explanation:

The expression that we have is:

f(x)=5x56x63x2+9x

And we need to find the leading coefficient of this polynomial function.

The leading coefficient is the coefficient of the term that contains the highest degree, or exponent of a variable.

In this case, the term with the highest degree is:

f(x)=5x56x63x2+9x

And the coefficient of this term is -6, therefore, -6 is the leading coefficient.

Answer:

-6

solve the given differential equation by undetermined coefficients. y'' − y' 1 4 y = 2 ex/2

Answers

Answer: The general solution of the differential equation is in the screenshot provided

Step-by-step explanation:

solve the given differential equation by undetermined coefficients. y'' y' 1 4 y = 2 ex/2

please solve bith questions4. [0/1 Points) DETAILS PREVIOUS ANSWERS SCALCET9 9.3.008. MY NOTES ASK Solve the differential equation. dy = 6x(y2 + 1) dx an(3x3 +K) Need Help? Read It 6. (0/1 Points] DETAILS PREVIOUS ANSWERS SCA

Answers

Solve for y:
y = tan(3x² + C)

Solve the differential equation dy = 6x(y2 + 1) dx an(3x3 +K)?

To solve the differential equation dy = 6x(y² + 1)dx, follow these steps:

Separate variables: Divide both sides by (y² + 1) and multiply both sides by dx:
(dy / (y² + 1)) = 6x dx
Integrate both sides:
∫(1 / (y² + 1)) dy = ∫(6x) dx
Evaluate the integrals:
arctan(y) = 3x² + C
Solve for y:
y = tan(3x² + C)

Provided an answer in the form of an(3x³ + K), it seems there may be a typo in the original equation. Please double-check the equation and provide the correct one if necessary.

Learn more about Differential equation

brainly.com/question/31402256

#SPJ11

Find the volume of the cone with the height of 7 and the radius of 10

Answers

Question:-

Find the volume of the cone with the height of 7 and the radius of 10.

Answer:-

Given:-

Radius (r) of the cone = 10 units.

Height (h) of the cone = 7 units.

To Find:-

The volume of the cone.

Solution:-

We know,

Formula of Volume of the cone is 13πr²h

So, Volume of the cone = 13×3.14×(10)²×7

Volume of the cone = 13×3.14×10×10×7

Volume of the cone = 21983

Volume of the cone = 732.66 cubic units. (approx)

The volume of the cone is 732.66 cubic units. [Answer]

Step-by-step explanation:

Given:-

Radius (r) of the cone = 10 units.

Height (h) of the cone = 7 units.

To Find:-

The volume of the cone.

Solution:-

We know,

Formula of Volume of the cone is 1/3πr²h

So,

1/3×3.14×10×10×7

= 732.66 cubic unit.

Each interior angle measure equals each exterior angle measure??

Answers

Answer:

No, they must sum up to give 360 degrees so it's not possible for them to be equal, if they are equal like 180 degrees each, there won't be a polygon formed!

Name two pairs of opposite rays, please. ​

Name two pairs of opposite rays, please.

Answers

Answer:

Ray DE and Ray AE

Step-by-step explanation:

Ray AE and ray CE are the required pair of opposite rays. Option A is correct.

Given that,
A figure has shown, Four rays have been emerging out from a single point E. It is to be determined that which pair of rays are pair of opposite rays.

What is a Line?

A line can be defined by the shortest distance between two points is called a line.

Here, as shown in the figure,
Four trays are emerging out from point E namely, AE, BE, CE, and DE. Rays AE and CE or Ray DE and BE both are pairs of opposite rays

Thus, ray AE and ray CE are the required pair of opposite rays. Option A is correct.

Learn more about lines here:

brainly.com/question/2696693

#SPJ2

find the exact value of sin(0) when cos(0) =3/5 and the terminal side of (0) is in quadrant 4​

Answers

When the cosine of an angle (0) is 3/5 and the angle lies in quadrant 4, the exact value of the sine of that angle is -4/5.

To find the exact value of sin(0), we can utilize the Pythagorean identity, which states that sin2(x)+cos2(x)=1, where x is an angle in a right triangle. Since the terminal side of the angle (0) is in quadrant 4, we know that the cosine value will be positive, and the sine value will be negative.

Given that cos(0) = 3/5, we can determine the value of sin(0) using the Pythagorean identity as follows:

sin2(0)+cos2(0)=1sin2(0)+(3/5)2=1sin2(0)+9/25=1sin2(0)=19/25sin2(0)=25/259/25sin2(0)=16/25

Taking the square root of both sides to find sin(0), we have:

sin(0) = ±√(16/25)

Since the terminal side of (0) is in quadrant 4, the y-coordinate, which represents sin(0), will be negative. Therefore, we can conclude:

sin(0) = -√(16/25)

Simplifying further, we get:

sin(0) = -4/5

Hence, the exact value of sin(0) when cos(0) = 3/5 and the terminal side of (0) is in quadrant 4 is -4/5.

For more question on cosine visit:

https://brainly.com/question/30766161

#SPJ8

Note the correct and the complete question is

Q- Find the exact value of sin(0) when cos(0) =3/5 and the terminal side of (0) is in quadrant 4​ ?

A University only accepts students who score in the top 10%. What Z-score would you use to calculate the score you need to get in?

Answers

To determine the score needed to get into a university that accepts only the top 10% of students, the Z-score corresponding to the 90th percentile is used.

A Z-score measures the number of standard deviations a particular data point is from the mean. In this case, the university only accepts students in the top 10%, which means the desired score would be the value corresponding to the 90th percentile. To calculate this Z-score, you would look up the corresponding value in a standard normal distribution table or use statistical software.

The Z-score represents the number of standard deviations above or below the mean a given data point falls. By finding the Z-score corresponding to the 90th percentile, you can determine the score needed to be within the top 10% of students. The Z-score table provides the critical value for a given percentile, and in this case, it would correspond to the 90th percentile. This critical value is used to convert the desired percentile into a Z-score. With the Z-score, you can then determine the score needed for admission to the university by applying it to the mean and standard deviation of the score distribution.

Learn more about deviation here:

https://brainly.com/question/31835352

#SPJ11


Rewrite in simplest rational exponent form
Show each step of your process.

Rewrite in simplest rational exponent formShow each step of your process.

Answers

The simplest rational exponent form is x34 .

A rational exponent is defined as an exponent that can be expressed as p/q. where q ≠ 0. The common notation for rational exponents is x^m/n. where x is the base (a positive number) and m/n is a rational number.An exponential expression of the form am has a rational exponent if m is a rational number. Powers and roots of numbers are represented together in rational exponents.

We have given a rational exponent x.x4 .     ...(1)

By formula x4 can be written as x14 and x can be written as x12 .

Put in equation (1) , we get

    x.x4=x12.x14              ...(2)

Using formula amn×apq=amn+pq  

Equation (2) can be written as

                                       x.x4=x12+14x.x4=x2+14x.x4=x34

Hence , on simplification , we get  x34 .

Learn more about exponent here :

https://brainly.com/question/847241

#SPJ9

A bakery needs to make 4 batches of bagels before opening in 3 hours. Each batch of bagels takes 2/4 of an hour to make. How many bagel batches can the bakery make before they open

Answers

Answer:6

Step-by-step explanation:

Since each batch of bagels takes 2/4 of an hour to make. This means that in one hour, 2 batches would be made.

Therefore, in 3 hours, the number of batches that would be made will then be:

= 2 × 3

= 6

Therefore 6 batches can be made before opening

Low Carb Diet Supplement, Inc., has two divisions. Division A has a profit of $230,000 on sales of $2,120,000. Division B is able to make only $34,700 on sales of $381,000.
Compute the profit margins (return on sales) for each division. (Input your answers as a percent rounded to 2 decimal places.)
Division A= ______%
Division B= ______%
___________________________________________________________________________________________________________________________________________________
Polly Esther Dress Shops Inc. can open a new store that will do an annual sales volume of $1,220,400. It will turn over its assets 2.7 times per year. The profit margin on sales will be 7 percent.
What would net income and return on assets (investment) be for the year? (Input your return on assets answer as a percent rounded to 2 decimal places.)
Net Income=
Return on Assets= __________ %

Answers

The profit margins (return on sales) for each division are approximately :Division A = 10.85%,Division B = 9.11% and The calculations for the year would be:Net Income = $85,428,Return on Assets = 18.9%.

To compute the profit margins (return on sales) for each division, we divide the profit by the sales and multiply by 100 to express the result as a percentage.

For Division A:

Profit Margin = (Profit / Sales) * 100

Profit Margin = ($230,000 / $2,120,000) * 100

Profit Margin ≈ 10.85%

For Division B:

Profit Margin = (Profit / Sales) * 100

Profit Margin = ($34,700 / $381,000) * 100

Profit Margin ≈ 9.11%

To calculate the net income and return on assets for Polly Esther Dress Shops Inc., we use the given information.

Net Income = Profit Margin * Sales

Net Income = 7% * $1,220,400

Net Income = $85,428

Return on Assets = Profit Margin * Asset Turnover

Return on Assets = 7% * 2.7

Return on Assets = 18.9%

For more such questions on profit,click on

https://brainly.com/question/29785281

#SPJ8  

On a park map, the distance from a picnic table to the hiking trail is 3 centimeters (cm). The map uses a scale of 2 cm = 150 meters (m). What is the actual distance from the picnic table to the hiking trail? *
10 points
a. 60 m
b. 100 m
c. 225 m
d. 375 m

Answers

Answer:

The correct option is c. 225 m

Step-by-step explanation:

Scaling

Objects can be represented in a reduced or augmented size by using scaling which is basically multiplying or dividing by a constant factor. We use scaling when representing geographic locations on a map.

We know on a park map, the distance from a picnic table to the hiking trail is 3 cm and the map uses a scale of 2 cm = 150 m. Dividing by 2, the equivalence between centimeters in the map and meters in the field is

1 cm = 75 m

Based on the scale factor, we can calculate the actual distance:

3 cm * 75 m/cm = 225 m

a. This option is incorrect because it's not 225 m

b. This option is incorrect because it's not 225 m

c. This option is correct because the actual distance is 225 m

d. This option is incorrect because it's not 225 m

Which of the following expressions is equal to 1 divided by 16

Answers

Answer: 21

Step-by-step explanation:

the value of “y” varies directly with “x”. if y= 56, then x= 4

Answers

I'm not sure what the question is here, but they have a simplified ratio of 1:14 (x:y) if it's a direct relationship.

Write an equation in slope-intercept form of the line shown. (-6, 4) (-2, 2)

Answers

Y=-1/2+1, y equals negative one half plus one

I NEED HELP FAST
Which statement about the point (0, 5) is true?




It is on the origin.

It is in Quadrant I.

It is on the x-axis.

It is on the y-axis.

Answers

Answer:

(0,5) is on the y-axis

Step-by-step explanation:

Since the x value is 0, it is not left or right of (0,0), thus it does not leave the y-axis. Since its y-value Is 5, it goes up 5 units from (0,0) but still it does not leave the y-axis.

Answer:

it is on the y-axis

Step-by-step explanation:

Like other birds, emperor penguins use their lungs to
breathe air. Emperor penguins hunt for fish, squid,
and other food underwater. When an emperor
penguin dives into the water, it can hold its breath for
as long as 20 minutes.
What happens to the air that an emperor penguin breathes in? Select all that apply.
The air travels through passageways to all parts of the body.
In the lungs, oxygen from the air is absorbed into the blood.
The air travels through passageways to the lungs.

Answers

When an emperor penguin breathes in, the air travels through passageways to the lungs, where the oxygen from the air is absorbed into the blood. This allows the penguin to hold its breath for as long as 20 minutes while hunting for fish, squid, and other food underwater. However, the penguin's respiratory system contains lungs, just like other air-breathing animals, as well as air sacs, which are a common trait among birds. The air sacs function to help regulate the temperature of the penguin and aid in buoyancy control while diving. Therefore, the oxygen taken in by the penguin is used to sustain its bodily functions while underwater and is not released back into the atmosphere when it exhales.

Here’s another one, this photo and another photo is the last one for tonight help please

Heres another one, this photo and another photo is the last one for tonight help please

Answers

To find the missing side we can do 13ft - 5ft to get 8ft

Answer:

hello

Step-by-step explanation:

the answer is 8Ft hope that helps you

Solve the following multi-step equation: 4(2 - 4x) - 3x = 65

Answers

Answer:

x = -3

Step-by-step explanation:

4(2 - 4x) - 3x = 65

Distribute the 4.

8 - 16x - 3x = 65

Combine like terms.

8 - 19x = 65

-19x = 57

Divide by -19 to isolate x.

x = 57/-19

x = -3

Check.

4(2 - 4(-3)) - 3(-3) = 65

4(2 - (-12) + 9 = 65

4(14) + 9 = 65

56 + 9 = 65

65 = 65

The solution of the given linear equation 4(2 - 4x) - 3x = 65 is  -3.

Two algebraic expressions separated by an equal symbol in between them and with the same value of the expression are called equations.

Example = 2x +4 = 12

here, 4 and 12 are constants and x is variable.

The solution of the equation 4(2 - 4x) - 3x = 65 is calculated as:

4(2 - 4x) - 3x = 65

Multiply the expressions inside the brackets,

8 - 16x -3x = 65

8 - 19x = 65

Subtract 8 from both the sides,

-19x = 65- 8

-19x = 53

Divide both side by -19

x=5319

Thus, the value of x is -3.

Learn more about equations here:

https://brainly.com/question/14686792

#SPJ6

Three cats and three dogs are randomly lined up in a group photo. What is the probability of all the dogs getting grouped together?

Answers

The probability of all the dogs getting grouped together in a random lineup of three cats and three dogs is 1/20.

To calculate the probability, we first need to determine the total number of possible arrangements of the six animals. Since all six animals are distinct, there are 6! (6 factorial) ways to arrange them, which is equal to 720.

Next, we focus on the dogs being grouped together. Since there are three dogs, they can be arranged among themselves in 3! (3 factorial) ways. Additionally, the group of three dogs can be arranged among the other three animals (cats) in 4! (4 factorial) ways.

Therefore, the favorable outcomes (dogs grouped together) consist of the arrangements of the three dogs among themselves and among the cats. This amounts to 3! × 4! = 6 × 24 = 144.

Finally, we calculate the probability by dividing the number of favorable outcomes (144) by the total number of possible arrangements (720). Thus, the probability of all the dogs getting grouped together is 144/720 = 1/5 = 1/20.

Therefore, the probability of all the dogs getting grouped together is 1/20.

Learn more about favorable outcomes here: brainly.com/question/31168367

#SPJ11

the velocity of a particle moving horizontally along the x-axis is given by v(t) = t sin^3(5t) for t ≥ 0. At t = 2 is the particle speeding up or slowing down? Explain.

Answers

a(2) is positive, the particle is speeding up at t = 2. To determine if the particle is speeding up or slowing down at t = 2.

We need to find the acceleration of the particle at that time.

The acceleration of the particle is given by the derivative of the velocity function:

a(t) = v'(t) = 3t^2 sin^2(5t)cos(5t) + sin^3(5t)

To find a(2), we need to evaluate the acceleration function at t = 2:

a(2) = 3(2)^2 sin^2(5(2))cos(5(2)) + sin^3(5(2))

= 12 sin^2(10)cos(10) + sin^3(10)

Since both sin^2(10) and cos(10) are positive, the sign of a(2) will depend on the value of sin(10). We can approximate sin(10) to be about 0.1736 using a calculator.

Plugging in this approximation, we get:

a(2) ≈ 12(0.1736)^2(0.9848) + (0.1736)^3

≈ 0.434

Since a(2) is positive, the particle is speeding up at t = 2.

Learn more about velocity  here:

https://brainly.com/question/31495959

#SPJ11

a rectangle has a length of 1 inches and a width of 6 inches whose sides are changing. the length is increasing by 4 in/sec and the width is shrinking at 2 in/sec. what is the rate of change of the perimeter?

Answers

The rate of change of the perimeter is  4 in/sec .

In the question ,

it is given that ,

the length of the rectangle is = 1 inch

the width of the rectangle is = 6 inch

the rate of increasing length is (dL/dt) = 4 in/sec

rate of shrinking width is (dW/dt) = -22 in/sec ,

We know that the perimeter of the rectangle is = 2(L + W) ,

that is , P = 2L + 2W ,

Differentiating perimeter with respect to time "t" ,

we get ,

dP/dt = 2 × ( dL/dt) + 2 × (dW/dt )

Substituting the values from above ,

we get ,

= 2 × (4) + 2 × (-2)

= 8 - 4

= 4

Therefore , the required rate of change is = 4 in/sec .

Learn more about Rate Of Change here

https://brainly.com/question/29654834

#SPJ4

The box-and-whisker plot below represents some data set. What is the value of the
lower quartile?
48
50
52
54
56
58
60
62

Answers

Answer:

53

Step-by-step explanation:

3+{2×(8-4+6)}-5-{9+4-[3×(1-5)]}​

Answers

Answer:

Step-by-step explanation:

Alright all we need to know is to understand our brackets

So 3+{2×(8-4+6)}-5-{9+4-[3×(1-5)]}​

3+20-5-9+4-3(1-5)

Step 2

3+20-5-9+4-3(1-5)  Simplify

18-9+4-3(1-5)

Step 3

18-9+4-3(1-5)

13-3(1-5)

13-(-12) Here is the tricky part (We aren't going to subtract because the brackets multiply the equations

So,

13+12=25

Your answer is 25

Solve the first equation (a)

Solve the first equation (a)

Answers

The simplified value of the expression is 12km³.

We have,

12k2m8÷4km5

This can be written as:

12k2m84km5

Canceling common expression.

= 12km³

Thus,

The simplified value of the expression is 12km³.

Learn more about expressions here:

https://brainly.com/question/3118662

#SPJ1

Question
Find the whole

140% of what number is 35?

Answers

The 140% of the number 25 will be equal to 35. We will calculate it by the concept of percentage.

What is the percentage?

The Percentage is defined as representing any number with respect to the 100. It is denoted by the sign %.

Here we need to find out 140% of what number is 35

Suppose that number is x so the equation will be

140%×x=35140100×x=35x=35×100140x=25

Hence % of the number 25 will be equal to 35. We will calculate it by the concept of percentage.

To know more about percentage follow

https://brainly.com/question/24304697

#SPJ1

when joe plays a board game with his four sisters, any one of the five players is equally likely to win. they decide to play game repeatedly until joe wins a game. what is the probabilty that they play at least three games?

Answers

The probability that they play at least three games is 16/25. This means that on average, they will need to play 25/16 = 1.56 games until Joe wins.

To solve this problem, we need to consider the different scenarios that could occur when playing the game repeatedly until Joe wins a game. Let's start by calculating the probability that Joe wins in one game.

Since any one of the five players is equally likely to win, the probability that Joe wins in one game is 1/5. Therefore, the probability that he does not win in one game is 4/5.

Now, let's consider the different scenarios that could occur in multiple games until Joe wins. If Joe wins in the first game, then they only play one game, and the probability that they play at least three games is zero. If Joe does not win in the first game, they need to play at least one more game.

If Joe wins in the second game, then they have played two games, and the probability that they play at least three games is zero. However, if Joe does not win in the second game, they need to play at least one more game.

If Joe wins in the third game, then they have played three games, and the probability that they play at least three games is one. If Joe does not win in the third game, they need to play at least one more game.

We can see a pattern emerging here. The probability that they play at least three games is only non-zero if Joe does not win in the first two games. In this case, they must continue playing until Joe wins a game, and this will take at least three games.

The probability that Joe does not win in the first two games is (4/5) x (4/5) = 16/25. Therefore, the probability that they play at least three games is 16/25.

However, it's important to note that this is just an average, and they could play more or fewer games depending on the outcomes of each individual game.

Learn more about probability at: brainly.com/question/28098932

#SPJ11

16. Find the area of the sector.

16. Find the area of the sector.

Answers

The area of the sector with a central angle of 60 degree and radius of 8 units is approximately 33.5 sqaure units.

What is the area of the sector?

A sector of a circle is simply part of a circle made up of an arc and two radii.

The area of a sector of a circle can be expressed as:

Area = (θ/360º) × πr²

Where θ is the sector angle in degrees, and r is the radius of the circle.

From the image:

Measure of central angle θ = 60 degrees

Radius r = 8 units

Plug these values into the above formula and solve for the area:

Area = (θ/360º) × πr²

Area = (60°/360°) × π × 8²

Area = 1/6 × π × 64

Area = 1/6 × π × 64

Area = 33.5 sqaure units.

Therefore, the area is approximately 33.5 sqaure units.

Learn more about area of sector here: brainly.com/question/7512468

#SPJ1

Other Questions
The energies of the bonds broken in a certain reaction are greater than the energies of the bonds formed. Which one of the following statements about this reaction must be true?a. The reaction is endothermic.b. The reaction is exothermic.c. The reaction is spontaneous.d. The reaction is non-spontaneous. Suppose a mutation made the gene for enzyme D nonfunctional. What molecule would accumulate in the affected cells Complete the sentences with the appropriate Passive form Which of the following are steps a sales manager can take to determine how many salespeople are needed to have an effective sales force? (Check all that apply.)Use work and customer statistics to determine how many people are required to achieve company objectives.Specify important sales tasks to be accomplished.Estimate how much work can be done by a single salesperson in a given amount of time. (4/21)Which statement accurately describes the energy needs for photosynthesis and cellularrespiration?A Solar energy is needed for cellular respiration but not for photosynthesis.B Chemical energy in the form of glucose is needed for both cellular respiration andphotosynthesis.C Chemical energy in the form of glucose is needed for photosynthesis, and solar energy isneeded for cellular respiration.D Solar energy is needed for photosynthesis, and chemical energy in the form of glucose isneeded for cellular respiration. Suppose that the relationship between price, P, and quantity, Q, is given by the equation Q = 140-4P.Which of the following equations correctly represents solving Q = 140-4P for P?OP=140-QOP=35-4QOP=140-4QOP=140+QOP=35-10 What else would you want to know about the photograph to help you evaluate its reliability? A nursery owner buys 8 panes of glass to fix some damage to his greenhouse. The 8 panes cost$19.60. Unfortunately, he breaks 3 more panes while repairing the damage. What is the cost ofanother 3 panes of glass?Another 3 panes of glass cost $ A power system is supplied by three generating units that are rated at 100, 300 and 350 MW, respectively. What is the maximum load that can be securely connected to this system if the simultaneous outage of two generating units is not considered to be a credible event Family Dinner Combinations A family special ata neighborhood restaurant offers dinner for four for$39.99. There are 3 appetizers available, 4 entrees, and3 desserts from which to choose. The special includesone of each. Represent the possible dinner combinationswith a tree diagram. Of the nutrients which one should you consume the most in your daily diet? A. Proteins B. Vitamins C. Fats D. Carbohydrates the nurse is assessing a mother who just delivered a 7 lb (3136 g) baby via cesarean delivery. which assessment finding should the nurse prioritize if the mother has a history of controlled atrial fibrillation? Read lines 112-126 on page 80.Which event in the story is told in a flashback in lines 112-126?Select one:a.Balboa's confrontation with a jaguarb.Balboa's discovery of the South Seac.Balboa's trial for treason in Spaind.Balboa's voyage to the New World ____ are more likely to experience depression than ____, and this difference has held up across race, ethnicity, socioeconomics, and culture. identify the correct statements about the life of ayuba diallo. the fifth amendment a) includes a requirement that no warrant for a search or an arrest be issued without probable cause. b) guarantees a speedy trial and a trial by jury. c) includes a protection against self-incrimination. d) includes a protection from unreasonable searches and seizures Find the local maximum and minimum values and saddle point(s)of the function.f(x, y) = 2x3 + xy2 + 5x2 + y2 +9 Read the excerpt from Monster.OBRIENNothing further.CU of MR. SAWICKI. He starts to leave the stand but is then held up by the JUDGE.CUT TO: PETROCELLIPETROCELLIYou said youre a teacher in Mr. Harmons school. Do you live in his neighborhood?SAWICKINo, I dont.What can be inferred?The judge is not sure whether O'Brien is finished questioning Mr. Sawicki.Mr. Sawicki is not familiar with courtroom procedures.Petrocelli does not believe what Mr. Sawicki says.Mr. Sawicki knows that Mr. Harmon's neighborhood is not safe. please discuss brieflydetermine the company decline by research. How Nike company problem of market suppose that the bag is implemented with a linked list. which of these operations are likely to have a constant worst-case time? (ch5)