Define the set S = {a, b, c, d, e, f, g}. (a) Give an example of a 4-permutation from the set S. (b) Give an example of a 4-subset from the set S. (c) How many subsets of S have exactly four elements? (d) How many subsets of S have either three or four elements?

Answers

Answer 1

In set S, a 4-permutation example is (b, d, e, g), a 4-subset example is {a, c, d, e}, there are 35 subsets with exactly four elements, and there are 70 subsets with either three or four elements.

(a) A 4-permutation from the set S is an ordered arrangement of 4 distinct elements from the set. Example: (b, d, e, g)

(b) A 4-subset from the set S is a selection of 4 distinct elements without considering the order. Example: {a, c, d, e}

(c) To determine the number of subsets of S with exactly four elements, you can use the combination formula: C(n, k) = n! / (k!(n-k)!), where n is the total number of elements in the set (7 in this case) and k is the number of elements you want to select (4 in this case).

So, C(7, 4) = 7! / (4!3!) = 35 subsets with exactly four elements.

(d) To find the number of subsets of S with either three or four elements, calculate the number of subsets for each case separately, and then add them together.

For 3-element subsets, use C(7, 3) = 7! / (3!4!) = 35 subsets.

Then, add the results from (c) and this step: 35 (4-element subsets) + 35 (3-element subsets) = 70 subsets with either three or four elements.

Your answer: In set S, a 4-permutation example is (b, d, e, g), a 4-subset example is {a, c, d, e}, there are 35 subsets with exactly four elements, and there are 70 subsets with either three or four elements.

Know more about sets here:

https://brainly.com/question/28365114

#SPJ11


Related Questions

Of the 100 employees at a
company, 75 are married and
57 have at least one child.
Thirty-three of the employees
married do not have any
children. If an employee is
chosen at random, find
P(has at least one child | married).

Of the 100 employees at acompany, 75 are married and57 have at least one child.Thirty-three of the employeesmarried

Answers

Answer: 0.56

Step-by-step explanation:

If 33 of the married people do not have a child, then 75 - 33 of the married people do have a child. 75 - 33 = 42.

* n = intersection (both events occur)

P At least 1 child 'given' that they are married)

= p (at least 1 child  n  married) / p (married)

= (42/100) / (75/100)

= 42/75

= 0.56

can someone please help me with this

can someone please help me with this

Answers

Answer:

well what are the figures

Step-by-step explanation:

Write a function describing the relationship of the given variables. a varies directly with r and when r = 6 , a = 18

Answers

The function describing the relationship of the given variables is a= 6r

How to write a function describing the relationship of the given variables.?

The statement is givn as:

a varies directly with r

This means that

a= kr

Where k is the constant of variation

When r = 6 , a = 18, we have

18= 6k

Divide by 6

k = 3

Substitute k = 3 in a= kr

a= 6r

Hence, the function describing the relationship of the given variables is a= 6r

Read more about direct variation at:

https://brainly.com/question/6499629

#SPJ4

Raul is 27 years old, and he owns his car, which he uses to get to work. His collision deductible is $100, and he does not have comprehensive coverage. If his car's safety rating is 20, how much does he pay each month for car insurance?

Answers

Answer:

$225.50

Step-by-step explanation:

a p e x

Verify That Y1(X)=Ex Is A Solution Of The Differential Equation Xy′′+(1−2x)Y′+(X−1)Y=0. (B) Use The Result In (A) To Find A Second Solution For Xy′′+(1−2x)Y′+(X−1)Y=0 And Give The General Solution For The Homogeneous Differential Equation. (C) Use The Result In (B) To Find A Particular Solution For Xy′′+(1−2x)Y′+(X−1)Y=Xex And Give The General

Answers

The general solution to the differential equation y1(x) = ex is y(x) = c1ex + c2exp[2x^2/2 - Xx] ex + C.exp[ex] and the particular solution is yp(x) = C.exp[ex].

Given differential equation is Xy′′+(1−2x)Y′+(X−1)Y=0.

(A) To verify that y1(x) = ex is a solution of the given differential equation, we need to find the first and second order derivatives of y1(x) and substitute them in the differential equation.

So, y1(x) = ex and its first and second order derivatives are:

y'1(x) = ex

and y''1(x) = ex

So, substituting y1(x), y'1(x) and y''1(x) in the given differential equation, we get:

LHS = Xy''1(x) + (1 - 2x)y'1(x) + (X - 1)y1(x)

LHS = Xex + (1 - 2x)ex + (X - 1)ex

LHS = ex[X + (1 - 2x) + (X - 1)]

LHS = ex[2X - 2x]

LHS = 2xex

RHS = 0

As LHS is equal to RHS, it means y1(x) = ex is a solution of the differential equation.

(B) To find a second solution for the given differential equation, we will use the Wronskian method.

Let y2(x) = vy1(x)W(x)

= y1(x)y2'(x) - y1'(x)y2(x)W(x)

= ex[v'(x) - v(x)]

Now, y2'(x) = v'(x)ex + v(x)ex

= ex[v'(x) + v(x)]

We will now substitute y1(x), y1'(x), y2(x) and y2'(x) in the given differential equation.

LHS = Xy''2(x) + (1 - 2x)y'2(x) + (X - 1)y2(x)

LHS = Xex[v''(x) + v'(x)] + (1 - 2x)ex[v'(x) + v(x)] + (X - 1)exv(x)

LHS = ex[Xv''(x) + (X - 2x)v'(x)]RHS = 0

As LHS is equal to RHS, we get,Xv''(x) + (X - 2x)v'(x) = 0

Separating the variables, we get,Xdv/v' = (2x - X)dxln(v) = 2x^2/2 - Xx + C1v = C.exp[2x^2/2 - Xx]

On substituting v = y2(x) = C.exp[2x^2/2 - Xx]y2(x) = C.exp[2x^2/2 - Xx] ex

Let the general solution of the given differential equation be y(x) = c1y1(x) + c2y2(x)

On substituting the values of y1(x) and y2(x), we get the general solution of the given differential equation to be,y(x) = c1ex + c2exp[2x^2/2 - Xx] ex(C)

To find a particular solution, we will use the method of undetermined coefficients.

Particular solution is y = yp(x)

Substituting yp(x) in the given differential equation, we get:

Xy''p(x) + (1 - 2x)yp'(x) + (X - 1)yp(x) = XexXy''p(x) + (1 - 2x)yp'(x) + Xyp(x) - yp(x) = Xex

Separating the variables, we get,Xdv/v' = exdx

Integrating both sides, we getln(v) = ex + C1v = C.exp[ex]

On substituting v = yp(x) = C.exp[ex]

We get the particular solution to be yp(x) = C.exp[ex]

General solution to the given differential equation is:y(x) = c1ex + c2exp[2x^2/2 - Xx] ex + C.exp[ex]

Let us know more about differential equation : https://brainly.com/question/32645495.

#SPJ11

A tank in the shape of an inverted cone 12 feet tall and 3 feet in radius is full of water. Calculate the work W required to pump all the water over the edge of the tank.

Answers

The work required to pump all the water over the edge of the tank is approximately 271,433.64 foot-pounds.

To calculate the work required to pump all the water over the edge of the tank, we need to consider the weight of the water in the tank and the height it is lifted.

First, let's find the volume of the water in the tank. The volume of a cone is given by the formula V = (1/3)πr²h, where r is the radius and h is the height. Plugging in the values, we have:

V = (1/3)π(3²)(12)

= (1/3)π(9)(12)

= 36π

Next, we need to find the weight of the water. The weight of an object is given by the formula W = mg, where m is the mass and g is the acceleration due to gravity. The mass of the water can be found by multiplying its volume by the density of water, which is approximately 62.4 pounds per cubic foot:

m = (36π)(62.4)

≈ 22619.47 pounds

Now, we can calculate the work done by multiplying the weight of the water by the height it is lifted. In this case, the height is 12 feet:

W = (22619.47)(12)

≈ 271433.64 foot-pounds

Therefore, the work required to pump all the water over the edge of the tank is approximately 271,433.64 foot-pounds.

Learn more about work done here:

https://brainly.com/question/32263955

#SPJ11

Final answer:

The work required to pump water out of an inverted conical tank involves calculating the pressure-volume work at infinitesimally small volumes within the tank and integrating this over the entire volume of the tank. This provides an interesting application of integral calculus in Physics.

Explanation:

The question requires the concept of work in Physics applied to a fluid, in this case, water lying within an inverted conical tank. Work is done when force is applied over a distance, as stated by work = force x distance. In the fluid analogy, the 'force' link is the pressure exerted on the water and the distance is the change in volume of the fluid. Therefore, work done (W) = Pressure x Change in Volume (ΔV).

In this scenario, you are required to pump out water from an inverted conical tank, hence, the work you do is against the gravitational force pulling the water downwards. To calculate the total work done, you have to consider the work done at each infinitesimally small (hence, constant pressure) strip of volume and integrate over the entire volume of the tank.

The detail of calculation would require the knowledge of integral calculus and the formula for volume of a cone. I recommend considering this as an interesting application of integrals in Physics. Also remember that the volume of a cone = 1/3πr²h, where 'r' is the radius of base and 'h' is the height of cone.

Learn more about Work in Physics here:

https://brainly.com/question/26750189

#SPJ12

What does y equal in 30+6y=7(y+6)-5

Answers

Answer:

y=-37

Step-by-step explanation:

0+6y=7(y+6)-5

0+6y=7y+42-5

6y=7y+37

-1y=37

y=-37

An investigator wishes to determine whether alcohol consumption causes a deterioration in the performance of automobile drivers. Before the driving test, subjects drink a glass of orange juice, which, in the case of the treatment group, is laced with two ounces of vodka. Performance is measured by the number of errors made on a driving simulator. A total of 120 volunteer subjects are randomly assigned, in equal numbers, to the two groups. For subjects in the treatment group, the mean number of errors (X1¯) equals_26.4, and for subjects in the control group, the mean number of errors (X2¯) equals 18.6. The estimated standard error equals 2.4.(a) Use t to test the null hypothesis at the .05 level of significance.(b) Specify the p-value for this test result.(c) If appropriate, construct a 95 percent confidence interval for the true population mean difference and interpret this interval.(d) If the test result is statistically significant, use Cohen's d to estimate the effect size, given that the standard deviation, sp, equals 13.15.(e) State how these test results might be reported in the literature, given s1, = 13.99 and s2, = 12.15.

Answers

To answer this question where An investigator wishes to determine whether alcohol consumption we need to know the sample sizes for each group and the standard deviation for each group.

What is standard deviation?

The spread or dispersion of a set of data values is measured by standard deviation. It is calculated as the square root of variance, which is the average of the squared deviations from the mean. In other words, it is a measurement of how widely apart a group of numbers are from one another. A low standard deviation implies that the data are closely grouped around the mean, whereas a large standard deviation suggests that the data are more scattered or spread out. outliers or anomalies in a dataset and to estimate the degree of variation or uncertainty in a population. It is a helpful tool for comparing and measuring.

To learn more about standard deviation, visit:

https://brainly.com/question/16555520

#SPJ4

What percent of 50 is 18?

Answers

Answer:

36%

Step-by-step explanation

Explanation:

To get the percentage of a fraction, we follow these steps:

1- simplify the fraction (get its simplest form)

2- multiply this simplest form by 100%

For the given, we have:

1- the fraction is

We can note that both the numerator and denominator are divisible by 2. Therefore, we can reduce the fraction into

2- Since no further simplification can be applied, therefore, our simplest form is

3- we multiply this simplest form by 100%:

* 100 = 36%

Based on the above:

18 is 36% of 50

Hope this helps :)

Answer:

36%or 0.36

Step-by-step explanation:

hope it help!

an engineer designs an improved light bulb. the previous design had an average lifetime of 1,200 hours. the new bulb had a lifetime of 1,200.2 hours, using a sample of 40,000 bulbs. although the difference is quite small, the effect was statistically significant. the most likely explanation is

Answers

The engineer's improved light bulb likely has a statistically significant longer lifetime than the previous design, with a small but measurable difference of 0.2 hours.

Statistical significance refers to the probability that the observed difference between two groups (in this case, the old light bulbs and the new ones) is not due to chance alone. If the probability is low enough, we can confidently reject the null hypothesis (that there is no difference between the two groups) and conclude that there is a real difference between them.

In this case, a sample size of 40,000 bulbs is quite large, which increases the statistical power of the test and allows for even small differences to be detected as significant. The fact that the new bulb had a slightly longer lifetime of 1,200.2 hours, compared to the old bulb's average lifetime of 1,200 hours, suggests that the engineer's design improvement was successful in making the bulb last longer.

However, it's important to note that while the effect is statistically significant, the practical significance may be less clear. A difference of 0.2 hours may not make a noticeable impact on the bulb's usefulness or longevity in real-world scenarios. Additionally, other factors such as cost or energy efficiency may also need to be considered when evaluating the success of the new design.

Learn more about significant here: brainly.com/question/31037173

#SPJ11

cos(x-30°)=0
how???????????????

Answers

Answer:

Step-by-step explanation:

I'm assuming you're trying to solve this for x. We use the difference identity for cosine and rewrite:

cos(x30)=cosxcos30+sinxsin30 and simplify using the unit circle to help.

cosx(32)+sinx(12)=0cosx(32)=12sinxcosx=12(23)sinxcosx=13sinx1=13sinxcosx1=13tanx3=tanx

and on the unit circle, the angle where the tangent is negative square root of 3 is -60° which is also a positive 300°

Answer:

x = n*360° + 120°      or     x = n*360° + 300°

Step-by-step explanation:

cos(x-30°)=0

x-30° = 90° or x-30° = 270°

it means can be : x-30° = n*360° + 90°    or    x-30° =n*360° + 270°

x = n*360° + 120°      or     x = n*360° + 300°   n is integers

cos(x-30)=0 how???????????????

Put the rational numbers in descending order (greatest to least). Type the letters in the correct order. Convert to decimals and compare. A. 13.5 B. -26/2 C.0 D. 13.5% ​

Answers

Answer:

13.5 , 13.5%, 0 , -26/2

Step-by-step explanation:

to convert a percentage to a decimal alll you have to do it move the decimal point over to the right 2 places up 13.5% would be .135

to convert a fraction into a decimal you can just plug it into a calculator and if you do -26/2 you get -13

have a great day :D

Which expressions are equal to 62⁰?
☐ 6³
12³
126
2³.33
26.33

Which expressions are equal to 62? 6121262.3326.33

Answers

Answer:

2^3 * 3^3 would also be correct if the answer above is 6^6

Step-by-step explanation:

2^3 * 3^3 (multiplying coefficients and adding exponents) 2*3 = 6 and 3+3=6

The liquid base of an ice cream has an initial temperature of 86°C before it is placed in a freezer with a constant temperature of -20°C. After 1 hour, the temperature of the ice-cream base has decreased to 58°C. Use Newton's law of cooling to formulate and solve the initial-value problem to determine the temperature of the ice cream 2 hours after it was placed in the freezer. Round your answer to two decimal places.

Answers

The temperature of the ice cream 2 hours after it was placed in the freezer is 37.40 °C

From Newton's law of cooling, we have that

T(t)=Ts+(T0Ts)ekt

Where

(t)= time

T(t)= the temperature of the body at time (t)

Ts=Surrounding temperature

T0=Initial temperature of the body

k=constant

From the question,

T0=86oC

Ts=20oC

T0Ts=86oC20oC=86oC+20oC

T0Ts=106oC

Therefore, the equation T(t)=Ts+(T0Ts)ekt becomes

T(t)=20+106ekt

Also, from the question

After 1 hour, the temperature of the ice-cream base has decreased to 58°C.

That is,

At time t=1 hour, T(t)=58oC

Then, we can write that

T(1)=58=20+106ek(1)

Then, we get

58=20+106ek(1)

Now, solve for k

First collect like terms

58+20=106ek

78=106ek

Then,

ek=78106

ek=0.735849

Now, take the natural log of both sides

ln(ek)=ln(0.735849)

k=0.30673

This is the value of the constant k

Now, for the temperature of the ice cream 2 hours after it was placed in the freezer, that is, at t=2 hours

From

T(t)=20+106ekt

Then

T(2)=20+106e(0.30673×2)

T(2)=20+106e0.61346

T(2)=20+106×0.5414741237

T(2)=20+57.396257

T(2)=37.396257 oC

T(2)37.40 oC

Hence, the temperature of the ice cream 2 hours after it was placed in the freezer is 37.40 °C

Learn more here: https://brainly.com/question/11689670

the person above me i correct

Which of these statements is true for f(x)=(1/10)^x

A. the range of f(x) is y>1/10

B. it is always increasing

C. the graph contains (1, 1/10)

D. the domain of f(x) is x>0

Answers

Answer: C. the graph contains (1, 1/10)

Step-by-step explanation:

When x=1, y=(1/10)1=1/10.

flipping a fair two-sided coin, the probability of getting heads is equal to the probability of getting tails. if the coin is flipped three times consecutively, what is the probability of getting heads at least twice?

Answers

The probability of getting heads at least twice is 0.5

Since we are given two-sided coin, where the probability of getting heads is equal to the probability of getting tails.NO of outcomes in this case is 2,The probability of getting a head = 1/2, similarly probability of getting a  tail is =1/2 .So when a coin is flipped three times, the sample space for the event will be (HHH, HHT, HTH, HTT, THH, THT, TTH, TTT),  H stands for head and T stands for tails, here for tossing the coin the number of outcomes is 8  .So the probability of getting at least two heads is:  4/8= 1/2 =0.5

To know more about probability refer to the link  brainly.com/question/11234923

#SPJ4

find the npv and irr

if annual discount rate is 8% and

-860 in year 1, $920 in year 3

Answers

The NPV is -$37.65 and the IRR is approximately 11.55%. To calculate the net present value (NPV) and internal rate of return (IRR), we need to consider the cash flows and the discount rate.

Given cash flows:

Year 0: $0

Year 1: -$860

Year 3: $920

Discount rate: 8%

First, let's calculate the present value (PV) of each cash flow using the discount rate:

Year 0: $0 (no cash flow)

Year 1: PV = -$860 / (1 + 0.08)^1 = -$796.30

Year 3: PV = $920 / (1 + 0.08)^3 = $758.65

Now we can calculate the NPV by summing up the present values of all cash flows:

NPV = PV(year 1) + PV(year 3)

= -$796.30 + $758.65

= -$37.65

The NPV is -$37.65.

To calculate the IRR, we need to find the discount rate that makes the NPV equal to zero. In this case, we can use the trial and error method or utilize financial software or calculators to find the IRR. Let's assume the IRR is r%.

Using the cash flows and the IRR:

Year 0: $0

Year 1: -$860

Year 3: $920

Setting the NPV equal to zero:

0 = PV(year 1) + PV(year 3)

0=$860/(1+r)1+$920/(1+r)3

Solving this equation for r gives us the IRR. However, solving this equation analytically can be complex, so it's better to use financial software or calculators.

Using a financial calculator or software, the IRR for these cash flows can be calculated as approximately 11.55%.

Therefore, the NPV is -$37.65 and the IRR is approximately 11.55%.

To know more about NPV here

https://brainly.com/question/33284820

#SPJ11


What is the area of this figure?
Enter your answer in the box

What is the area of this figure?Enter your answer in the box

Answers

area of square is a^2
5^2 =25
area of triangle is base x height divide by 2
5x4=20
20 divide by 2 is 10
add them together
25+10=35

a family of 4 went to a lacrosse game and spent a total of $74. they each had a hot dog, popcorn, and a soda. a hot dog cost $3, popcorn costs $1.50 and a soda cost $2. what was the cost of each ticket?

Answers

Answer:

12$

Step-by-step explanation:

74 - 4(1.50+3+2) = 48

48 / 4 = 12

need help asap use the screen shot

need help asap use the screen shot

Answers

Answer:

7 and 37

Step-by-step explanation:

Imagine our 3rd side becoming smaller and smaller. In the ultimate case the triangle will be a flat line, and the two other lines overlap. The third line will have to be 7, to get from 15 to 22 (22-15=7).

Likewise, if the line increases and increases, again you'll endup with a flat line, but now the two otherlines will span the entire third line, so its length is the sum, i.e., 15+22 = 37

a collection of nickels, dimes, and quarters consist of 70 coins with a total of $ 8.00 . if there are 2 times as many dimes as quarters, find the number of each type of coins.

Answers

The number of each type of coins are as follows:

q = 15 quarters.

d = 30 dimes.

n = 25 nickels.

How to determine the number of each type of coins?

In order to solve this word problem, we would assign a variables to the unknown numbers and then translate the word problem into algebraic equation as follows:

Let d represent the number of dimes.

Let q represent number of quarters.

Let n represent number of nickels.

Let T represent total number of coins.

Note: 1 quarter is equal to 0.25 dollar, 1 nickel is equal to 0.5 dollar, and 1 dime is equal to 0.1 dollar.

Translating the word problem into an algebraic equation, we have;

Dimes; d = 2q     .....equation 1.

Nickels; (70 - (q + 2q)) = (70 - 3q)     .....equation 2.

Total coins; T = n + d + q

0.5(70 - 3q) + 2q(0.1) + q(0.25) = 8.00

Multiplying all through by 100, we have:

5(70 - 3q) + 2q(10) + q(25) = 800

350 - 15q + 20q + 25q = 800

350 + 30q = 800

30q = 800 - 350

30q = 450

q = 450/30

q = 15 quarters.

For the number of dimes, we have:

Dimes, d = 2q

Dimes, d = 2(15)

Dimes, d = 30 dimes.

For the number of nickels, we have:

Nickels, n = (70 - 3q)

Nickels, n = (70 - 3(15))

Nickels, n = (70 - 45)

Nickels, n = 25 nickels.

Read more on equations here: https://brainly.com/question/1511173

#SPJ1

pls help (will give brainliest if possible!)

pls help (will give brainliest if possible!)

Answers

The real number √21 is an example of an irrational number. (Correct choice: C)

What number is real and irrational?

According to number theory, real numbers are formed by the following sets:

Natural numbers - Set of real numbers defined by N = {1, 2, 3, 4, 5, 6, ...}.Whole numbers - Set of real numbers defined by the union of the set of natural numbers and the number 0.Integers - Set of real numbers defined by the union of the set of whole numbers and Z = {- 1, - 2, - 3, - 4, - 5, - 6, ...}Rational numbers - Set of real numbers defined by numbers of the form m / n, where m and n are integers and n is not zero. All integers are also rational numbers, but not all rational numbers are integers.Irrational numbers - Set of real numbers that are not rational. All rational numbers can have an irrational representation, but not all irrational numbers are rational.

Then, by direct inspection we get the following conclusions:

The real number 5.85858585... is a rational number.The real number 63.4 is a rational number (317 / 50).The real number √21 is an irrational number. The real number √36 is a rational number (6).

To learn more on irrational numbers: https://brainly.com/question/17450097

#SPJ1

Solve this equation please!
x+5-3x-9

Answers

Answer:

-2x-4

Step-by-step explanation:

try using photomath for questions like these ;)

help me please, i need a answer asap

help me please, i need a answer asap

Answers

Answer:

14/24 can be a answer?

Step-by-step explanation:

Hope this helped :)

five men and eight women are semifinalists in a lottery. from this group, three finalists are to be selected by a drawing. what is the probability that all three finalists will be men? (enter your probability as a fraction.)

Answers

It's important to note that this probability assumes that the drawing is done randomly and that all semifinalists have an equal chance of being selected as finalists. Additionally, this probability only applies to this specific drawing and may change if the conditions or group of semifinalists is different.

There are 5 men and 8 women, and we need to select 3 finalists from this group by a drawing. The total number of ways to select 3 finalists from the group of 13 semifinalists is given by the combination formula:

C(13, 3) = 13! / (3! * 10!) = 286

Now, we need to find the probability that all 3 finalists will be men. Since there are 5 men in the group, the number of ways to select 3 men from the group is given by:

C(5, 3) = 5! / (3! * 2!) = 10

Therefore, the probability of selecting 3 men as the finalists is:

P(all 3 finalists are men) = C(5, 3) / C(13, 3) = 10 / 286 = 5 / 143

So the probability of selecting all 3 finalists as men is 5/143.

For such more questions on Conditions:

https://brainly.com/question/30340170

#SPJ11

The domain for f(x) and g(x) is the set of all real numbers.

Let f(x) = 3x + 5 and g(x) = x2.

Find f(x) • g(x).



A: 3x2 + 5


B: 3x3 + 5x2


C: x2 − 3x − 5


D: 3x3 + 3x2 + 5

Plsssss help its for a test

Answers

Answer:

3 x³ + 5x²

Step-by-step explanation:

that is the procedure above

The domain for f(x) and g(x) is the set of all real numbers.Let f(x) = 3x + 5 and g(x) = x2.Find f(x)

Distribute
3x(5x-5)

a) 12x^2+8x
b) 15x^2+10x
c) 12x^2-9x
d) 15x^2-15x​

Answers

Answer:

d

Step-by-step explanation:

3x times 5x equals 15x^2

3x times -5 equals -15x

---> 15x^2 - 15x

To join a local square dancing group, Jan has to pay a $100 sign-up fee plus $25 per month. Write an equation for the cost (y) based on the number of months.
a. y = 25x + 100
b. y = 100x + 25
c. y = 25 + 100x
d. y = 100 + 25x

Answers

The correct answer is option A which is y = 25x + 100.

Given the following:

To join a local square dancing group, Jan has to pay a $100 sign-up fee plus $25 per month

We need to write an equation for the cost (y) based on the number of months.

To solve the above problem, the answer is;a. y = 25x + 100

Explanation; Let's break down the problem

The $100 sign-up fee is a fixed cost that is added only once to the monthly fee which is $25. Thus the equation for the cost (y) based on the number of months can be expressed as; y = 25x + 100 where:y is the cost for the number of monthsx is the number of months

Therefore the correct answer is option A which is;y = 25x + 100.

To know more about equation visit:

https://brainly.com/question/29174899

#SPJ11

To join a local square dancing group,

Jan has to pay a $100 sign-up fee plus $25 per month.

The equation for the cost (y) based on the number of months is

y = 25x + 100,

where x is the number of months.

Option A is the correct equation for the cost based on the number of months.

Writing the equation:

y = 25x + 100

Where:

y = Cost based on the number of months

x = Number of months

Therefore, when Jan has been part of the local square dancing group for 1 month, the total cost will be:

$25 * 1 + $100 = $125

And if Jan has been a part of the group for 4 months, then the total cost would be:

$25 * 4 + $100 = $200

Therefore, option A is the correct answer.

To know more about number, visit:

https://brainly.com/question/3589540

#SPJ11

Today, Andrew borrowed R200 000 from a bank. The bank charges interest at 5.25%p.a, a compounded quarterly. Andrew will make make payments of R6 000 at the end of 3 months. His first repayment will be made 3 months from now, how long in years will it take for Andrew to settle the loan

Answers

In order to calculate the time it will take for Andrew to settle the loan, we can use the formula for compound interest. So, it will take Andrew approximately 5.22 years to settle the loan.

The formula is given as A = P(1 + r/n)^(nt), Where: A = the final amount, P = the principal (initial amount borrowed), R = the annual interest rate, N = the number of times the interest is compounded in a year, T = the time in years.

We know that Andrew borrowed R200 000 from a bank at an annual interest rate of 5.25% compounded quarterly and that he will make repayments of R6 000 at the end of every 3 months.

Since the first repayment will be made 3 months from now, we can consider that the initial loan repayment is made at time t = 0. This means that we need to calculate the value of t when the total amount repaid is equal to the initial amount borrowed.

Using the formula for compound interest: A = P(1 + r/n)^(nt), We can calculate the quarterly interest rate:r = (5.25/100)/4 = 0.013125We also know that the quarterly repayment amount is R6 000, so the amount borrowed minus the first repayment is the present value of the loan: P = R200 000 - R6 000 = R194 000

We can now substitute these values into the formula and solve for t: R194 000(1 + 0.013125/4)^(4t) = R200 000(1 + 0.013125/4)^(4t-1) + R6 000(1 + 0.013125/4)^(4t-2) + R6 000(1 + 0.013125/4)^(4t-3) + R6 000(1 + 0.013125/4)^(4t)

Rearranging the terms gives us: R194 000(1 + 0.013125/4)^(4t) - R6 000(1 + 0.013125/4)^(4t-1) - R6 000(1 + 0.013125/4)^(4t-2) - R6 000(1 + 0.013125/4)^(4t-3) - R200 000(1 + 0.013125/4)^(4t) = 0

Using trial and error, we can solve this equation to find that t = 5.22 years (rounded to 2 decimal places). Therefore, it will take Andrew approximately 5.22 years to settle the loan.

For more questions on: compound interest

https://brainly.com/question/31474686

#SPJ8

What equation would you use to find the measure of

What equation would you use to find the measure of

Answers

SOLUTION

The shape is a parallelogram

The consecutive angle of a parallelogram is supplementary that is added up to 180 degree

M+L=1800

Hence we have

L=(2z3)0M=(5z6)0(2z3)0+(5z6)0=1800

Therefore the right option is D

Other Questions
1. a treatment method aimed at making people feel better and function more effectively is called . Mughal Emperor Humayun asked Seydi Ali Reis to? "n 25 kg object is moving at a velocity or 10 ml. the obec has energy. Calculate it. John ran 1 2/5 miles in 1/3 hour. How many miles can John run in 1 hour after concluding that your tests support your hypothesis, you should a publish the results so that other scientists can learn from you. b wait around to see if anyone else discovers the same thing. c keep it secret so that no one steals your idea. d none of the above different types of large and small subunits. b the same types of large and small subunits. c different types of large subunits but the same small subunits. d different types of small subunits but the same large subunits. roger has an incurable disease, and he knows his time on the planet is limited. he hates hospitals and the sterile quality of any institution. he wants to die at home with his family around him, making whatever decisions must be made. which form of care would be a good alternative for roger to consider? group of answer choices an assisted living facility decedent care hospice care nursing home care A student wants to approximate the amount of work that the force due to gravity does on the student as the student walks up a set of stairs. Which of the following measurements must the student collect in order to approximate the amount of work done by earth on the student? select two answers. a first-grade teacher wants to teach the difference between half notes and quarter notes. which of the following would be the most effective instructional strategy? What is the theme of William Shakespeares Sonnet 116? Distinguish between a need and a want and provide examples. Distinguish between a producer and a consumer. Distinguish between a good or service and provide examples. Examine how consumers tend to satisfy their wants and needs by buying goods and services from businesses. Describe how resources are used to produce goods and services in the satisfaction of wants of consumers. Define economic resources as land, labour, capital and enterprise and provide relevant examples. Describe how a business owner identifies the nature of consumer demand by analysing sales, conducting market research and examining social trends. Define scarcity and explain the concept of the economic problem as faced by consumers and producers Explain what is meant by the term consumer sovereignty I give Zoey one Graham cracker and I give Banele two Graham crackers. Zoey is upset, so I split her Graham cracker into two pieces. Zoey is still upset. Zoey has learned this concept: A "vertice" is a common intersection of three or more surfaces. T/F Mara put down 7.5% on the purchase of her new home. If she put down $14.175, find the purchase price of the home using the gas solubility interactive, consider how the solubility of a gas changes when pressure or temperature are changed. how many molecules of co2 are dissolved in solution under each condition? 3,5,7 What is a Loss Leader and why is it beneficial for some retailers? Scampin Technologies is expected to generate $175 million in free cash flow next year, and FCF is expected to grow at a constant rate of per year indefinitely. Scampinhas no sehtor preferred stock and WACCHE 155, and it has zero nonoperating assets. If Scampinhas 50 million shares of stock outstanding, what is the sto's value per share not round intermediate calculation Round your answer to the nearest cent Each share of common stock is worth $ according to the corporate valuation model Hey I'm Chloe, Can You Help Me Thank you :)Chris runs a mile in 8 minutes. How long will it take him to run 3 1/2 miles? laura has a bag with red and blue balls. She picks a ball at random, record its color, puts the ball back in the bag, and picks another ball. Work out the probability that she got two balls of different color _____ involves identifying, evaluating, and managing changes throughout the project life cycle.