consider the acid ionization of HCR03what's the formula of one of the products of this reaction aside from hydronium ion

Answers

Answer 1

The acid ionization of HCrO3 (chromic corrosive) can be spoken to by the taking after condition:

HCrO3 + H2O ⇌ H3O+ + CrO42-

What is the acid ionization of

Acid ionization , also  known as acid separation, alludes to the method by which an acid gives a proton (H+) to a solvent, as a rule water, to make its conjugate base and a hydronium particle (H3O+). This prepare can be spoken to by a chemical condition

HA + H2O ⇌ A- + H3O+

In this condition, HA speaks to the acid, A- speaks to its conjugate base, and H3O+ speaks to the hydronium particle shaped by the acknowledgment of a proton by water.

In this condition, hydronium particle (H3O+) is one of the items of the response. The other item is the chromate particle (CrO42-).

Hence, the equation of one of the items of this response aside from hydronium particle is CrO42-.

Learn more about  acid ionization from

https://brainly.com/question/15101271

#SPJ1


Related Questions

Which best describes a photon?
O A. The possible spins of an electron
B. A positive particle in the nucleus
C. A quantum of light energy
D. The charge an electron can absorb

Answers

I say it is C: A quantum of light energy

Determine the molarity of a solution with a volume of 435. mL and 0.550 mol of solute dissolved.

Answers

Answer:

M = 1.26

Explanation:

Molarity = mole of solution/liters of solution
435mL/1000 = .435L
Plugging in the numbers into the formula, we get:
Molarity = .550 mol/.435L = 1.26 M

Explain to me in detail why Sulfur (S) has a negative charge of 2-. What is it trying to fulfill? *
What does this make it?

Explain to me in detail why Sulfur (S) has a negative charge of 2-. What is it trying to fulfill? *What

Answers

Sulfur has a negative charge of 2 because it has gained two electrons to fulfill its octet rule.

Sulfur and octet rule

Sulfur (S) has a negative charge of 2 because it has gained two electrons to fulfill its octet rule, which is a guideline in chemistry stating that atoms tend to gain, lose or share electrons to achieve a stable electron configuration of eight valence electrons (except for hydrogen and helium, which need only two electrons).

Sulfur is in Group 6 of the periodic table, which means it has six valence electrons. In order to fulfill the octet rule and achieve a stable electron configuration, it needs to gain two more electrons. When sulfur gains two electrons, it forms a stable S2- ion, which has a total of eight valence electrons.

The negative charge on the S2- ion arises because electrons are negatively charged particles. When sulfur gains two electrons, the total negative charge of the ion is increased by the charge of the two electrons, which is -2. Therefore, the S2- ion has a net charge of -2.

This makes sulfur an anion, which is a negatively charged ion. Anions are formed by gaining electrons, which leads to an excess of negative charge. In contrast, cations are positively charged ions, which are formed by losing electrons, resulting in an excess of positive charge.

More on sulfur can be found here: https://brainly.com/question/1478186

#SPJ1

PLEASE HELP 50 POINTS. PLEASE !!! BALANCING CHEMICAL EQUATIONS

PLEASE HELP 50 POINTS. PLEASE !!! BALANCING CHEMICAL EQUATIONS
PLEASE HELP 50 POINTS. PLEASE !!! BALANCING CHEMICAL EQUATIONS

Answers

Answer: 1st one is 1 N2 + 3 H2 > 2 NH3

               2nd one is 2 KCLO3 > 2 KCL+3 O2

              3rd one is 2 NaCL + 1 F2 > 2 NaF+CL2

> are the arrows

The numbers in front of the other numbers are the coefficient.

The numbers behind the numbers are the exponents.

for the precipitation lab, what would be an appropriate use of a beaker?

Answers

We want to explain what would be the appropriate use of the beaker in a precipitation lab.

First, a precipitation lab is an experiment where we study a given precipitation reaction. Where we dissolve two solvents in water, then we mix them and in the process we get a precipitant and a solution (this is just an example).

Assuming that we are dissolving on test tubes, the first use of the beaker is pouring water in the tubes. The beaker allows us to measure the volume of water inside of it, so it is really helpful to know how much water are we pouring inside the test tubes.

Once we have the two test tubes ready, we can combine them. Then using a filter above a beaker, we can pour the mix through the filter, in this way the precipitate is filtered and only the solution pass.

This would allow us to measure how much volume of solution we have at the end.

These are the main two uses of the beaker in these type of experiments.

If you want to learn more, you can read:

https://brainly.com/question/18315601

When you watch a sunset, is the Sun really moving across the sky? What's happening?
(Science)

Answers

It is the earth spinning around its axis. It makes a complete turn every 24 hours. It turns toward the east

Balance the following redox equation in acidic solution. what is the coefficient of the water?CH3OH(aq)+Cr2O2−7(aq)→CH2O(aq)+Cr3+(aq)

Answers

First, let's write the half-reactions for the oxidation and reduction processes:

Oxidation half-reaction:

CH₃OH(aq) → CH₂O(aq) (loss of 2H+ and 2 electrons)

Reduction half-reaction:

Cr₂O₇²⁻(aq) → Cr³⁺(aq) (gain of 3 electrons)

Next, we need to balance the number of electrons in each half-reaction by multiplying the oxidation half-reaction by 3 and the reduction half-reaction by 2:

Oxidation: 3CH₃OH(aq) → 3CH₂O(aq) + 6H+(aq) + 6e⁻

Reduction: 2Cr2O7²⁻(aq) + 14H⁺(aq) + 6e⁻ → 2Cr³⁺(aq) + 7H₂O(l)

Now, we can combine the two half-reactions and cancel out the electrons:

3CH₃OH(aq) + 2Cr₂O₇²⁻(aq) + 14H⁺(aq) → 3CH₂O(aq) + 2Cr³⁺(aq) + 11H₂O(l)

Finally, we can check the balance of each element:

Balance Cr: 2 on both sides

Balance H: 14 + 3 = 11 + 6, balanced

Balance O: 14 = 3 + 11, balanced

So the balanced equation is:

3CH₃OH(aq) + 2Cr₂O₇²⁻(aq) + 14H⁺(aq) → 3CH₂O(aq) + 2Cr³⁺(aq) + 11H₂O(l)

The coefficient of water is 11.

To know more about refer half-reactions here

brainly.com/question/10668307#

#SPJ11

fill in the left side of this equilibrium constant equation for the reaction of hypobromous acid with water.

Answers

For the reaction of hypobromous acid (HOBr) with water, the equilibrium constant equation can be written as follows:
The reaction: HOBr(aq) + H2O(l) ⇌ H3O+(aq) + BrO-(aq)

The equilibrium constant expression (K_a): K_a = [H3O+][BrO-] / [HOBr]
Here, K_a is the acid dissociation constant, which is a specific type of equilibrium constant. This expression represents the ratio of the concentrations of the products (H3O+ and BrO-) to the concentration of the reactant (HOBr) when the reaction has reached equilibrium.

Hypobromous acid (HBrO) is a weak acid that consists of bromine, hydrogen, and oxygen. It is formed when bromine (Br₂) dissolves in water (H₂O) and undergoes a reaction with water molecules.

To know more about  hypobromous acid visit:

https://brainly.com/question/27920173

#SPJ11

suggest two gases in the air that will react with zinc to make zinc carbonate

Answers

Answer:

See explanation

Explanation:

Zinc is a metal and as such can undergo corrosion when exposed to moisture.

Two gases in the atmosphere that can react with Zinc metal and covert it to Zinc carbonate are carbon dioxide and water vapour.

Zinc is oxidized to ZnO in the atmosphere by water vapour. This ZnO subsequently reacts with CO2 to yield ZnCO3.

Question 55
When a body of water becomes acidified, the first aquatic species to disappear are generally:
a. Bacterial decomposers
b. Phytoplankton
c. Fish d. Freshwater shrimp

Answers

The correct answer is b. Phytoplankton. When a body of water becomes acidified, it can affect the pH levels, making it difficult for certain species to survive.

Phytoplankton, which are important producers at the base of the food chain in aquatic ecosystems, are particularly sensitive to changes in pH and are often the first to disappear. This can have a cascading effect on the entire ecosystem, as other species that depend on phytoplankton for food may also struggle to survive. When a body of water becomes acidified, the pH level decreases significantly and the water becomes more acidic. This causes a disruption in the aquatic environment, with the most sensitive species being the first to suffer.

To learn more about acidified click here https://brainly.com/question/28529228

#SPJ11

g what does adding boron impurities do to silicon? what does adding boron impurities do to silicon? boron acts as an acceptor, i.e. electrons are introduced into the conduction band. boron acts as an acceptor, i.e. electrons are introduced into the valence band. boron acts as a donor, i.e. electrons are introduced into the conduction band. boron acts as an acceptor, i.e. holes are introduced into the valence band.

Answers

In semiconductors, Boron acts as a donor, i.e. electrons are introduced into the conduction band when added as impurities to silicon. Option C is the correct answer.

When boron impurities are added to silicon, it acts as a donor, which means that it introduces electrons into the conduction band of silicon. This results in an excess of electrons, which increases the conductivity of the material.

This process is called doping and is used in the semiconductor industry to create p-type semiconductors. The addition of boron impurities creates a p-type semiconductor because the extra electrons in the conduction band create "holes" in the valence band. These holes behave like positive charges and are free to move throughout the material.

Learn more about semiconductors at

https://brainly.com/question/15184439

#SPJ4

If 23.43 mL of a solution of Ba(OH)2 requires 20.4 mL of a 1.13 M solution of HNO3 for complete titration, what is the molarity of the Ba(OH)2 solution? Answer in units of M
Please help

Answers

According to the question the molarity of the Ba(OH)2 solution is then 0.976 M.

What is molarity?

Molarity is a unit of measurement for concentration of a solute in a solution. It is defined as the number of moles of the solute per liter of solution. Molarity is often used to describe the concentration of ions, molecules, or other constituents in a solution. It is an important parameter in many areas of chemistry, including analytical, organic, and inorganic chemistry.

The molarity of a solution can be calculated using the expression M =  moles of solute/liters of solution. In this case, the moles of solute is the amount of Ba(OH)2 in the solution, which can be calculated using the amount of HNO3 required to titrate it.

Since 1 mole of HNO3 reacts with 1 mole of Ba(OH)2, the moles of Ba(OH)2 can be calculated using the amount of HNO3 used in the titration. The equation is moles of Ba(OH)2 = (20.4 mL)(1.13 M)(1 L/1000 mL) = 0.02292 moles. The molarity of the Ba(OH)2 solution is then M = 0.02292 moles/23.43 mL = 0.976 M.

To learn more about molarity

https://brainly.com/question/26873446

#SPJ1

why do atoms exchange or share electrons during bonding?(1 point)

Answers

Atoms exchange or share electrons during bonding to obtain stability by completing their valence shells and also to achieve a lower energy state.

Atoms exchange or share electrons during bonding because of the force of attraction between two oppositely charged ions or particles called the electrostatic force. This force of attraction results in the formation of a bond, holding two atoms together within a compound.

The electrons are either shared or exchanged because they determine the chemical reactivity of an atom and are responsible for forming bonds between atoms. Atoms bond with each other to complete their outer shells and obtain stability, which is usually achieved by acquiring eight electrons in their valence shells. This is known as the octet rule.

The main types of chemical bonds that atoms form include covalent bonds and ionic bonds. Covalent bonds involve the sharing of electrons between atoms, while ionic bonds involve the transfer of electrons from one atom to another. Ionic bonding occurs between atoms that have a large difference in electronegativity, whereas covalent bonding occurs between atoms with a small difference in electronegativity.

In conclusion, atoms exchange or share electrons during bonding to obtain stability by completing their valence shells and also to achieve a lower energy state.

Learn more about electrons

https://brainly.com/question/12001116

#SPJ11

(ch. 17) what is the ph of a solution prepared by dissolving 0.150 mol acetic acid and 0.300 mol sodium acetate in water sufficient to yield 1.00 l of solution? hint: the ka of acetic acid is 1.8 x 10-5.

Answers

pH of a solution prepared by dissolving 0.150 mol acetic acid and 0.300 mol sodium acetate in water sufficient to yield 1.00L of solution is 5.0457.

What is acetic acid?

Acetic acid, also known as ethanoic acid, is an organic acid that is colorless, clear, and has a pungent odor. The carboxylic acid, which has a strong sour taste, is commonly utilized in the food sector.

What is Sodium Acetate?

Sodium acetate is a water-soluble, non-toxic white crystalline compound with the formula CH3COONa+. It is commonly used in the food, paper, and textile industries as a pH regulator, buffer, and emulsifier.

The pH of a solution made by combining 0.150 mol of acetic acid (CH3COOH) and 0.300 mol of sodium acetate (CH3COONa+) in water that yields 1.00L of solution can be calculated using the following formula:

pH= pKa + log([salt][acid])

pH= -log(Ka) + log([salt][acid])

pH= -log(1.8×105) + log(0.3000.150)

pH= 5.0457

Therefore, pH of a solution prepared by dissolving 0.150 mol acetic acid and 0.300 mol sodium acetate in water sufficient to yield 1.00L of solution is 5.0457.

To learn more about pH refer to: brainly.com/question/11903281

#SPJ11

1. The periodic table is a model we can use to predict interactions between * 5 points
elements. Which element would most likely form a combination with
calcium in a 1:1 ratio? (Hint: Compare the number of bonds the elements
can make.)
1.Carbon
2.Qxygen
3.Nitrogen
4.Fluorine

Answers

Fluorine is the element that would most likely form a combination with calcium in a 1:1 ratio.

How are predictions made using the periodic table as a model?

One illustration of a model is the periodic table. By drawing attention to patterns in the characteristics of elements, it enables scientists to make predictions. Scientists were able to complete blanks and fix errors in the original periodic table thanks to the discovery of new elements.

What is predictable based on the periodic table?

Electronegativity, ionisation energy, electron affinity, atomic radius, melting temperature, and metallic nature are important periodic patterns. Chemists can forecast an element's characteristics with great speed thanks to periodic trends, which are created by the periodic table's organisation.

To know more about Fluorine visit:-

https://brainly.com/question/1940697

#SPJ1

Do you think the substances after the reaction was still copper (II) chloride and aluminum?

Answers

When aluminum is reacts copper (II) chloride then it will form aluminum chloride and Copper.

Aluminum as well as copper(II) chloride combine very vigorously, causing the reaction mixture to become extremely hot as heat was produced, the aluminum foil to breakdown, a reddish brown solid to appear, as well as gas bubbles to be released.

The chemical reaction can be written as:

2Al + 3CuCl2 → 3Cu + 2AlCl3

Therefore, Copper and aluminum chloride will be formed after the reaction as a product.

To know more about  aluminum

https://brainly.com/question/28488595

#SPJ1

United Medicine, Inc. claims that a drug, Viro, significantly relieves the symptoms of a certain viral infection for 80% of all patients. Suppose that this drug is given to 8 randomly selected patients who have been diagnosed with the viral infection. Let X be the number of patients whose symptoms are significantly relieved.
a) What probability distribution (with parameters) can be used to model the random variable X?
b) Assuming that the company's claim is correct, find P(X ≤ 5).
c) Suppose that of the 8 randomly selected patients, 3 have had their symptoms significantly relieved by Viro. Would you believe the claim of United Medicine, Inc.? Explain.

Answers

(a)The parameters of the binomial distribution are the number of trials (n = 8) and the probability of success (p = 0.8). (b) The exact value of P(X ≤ 5) is approximately 0.04101368. (c)If the p-value is very small (below a predetermined significance level), we may reject the null hypothesis and question the claim. If the p-value is not small, we may fail to reject the null hypothesis and consider the claim plausible.

a) The probability distribution that can be used to model the random variable X is the binomial distribution, as we have a fixed number of trials (8 patients) and each patient has a binary outcome (symptoms relieved or not relieved). The parameters of the binomial distribution are the number of trials (n = 8) and the probability of success (p = 0.8).

b) To find P(X ≤ 5), we need to calculate the cumulative probability of X up to 5 using the binomial distribution. We can use the binomial cumulative distribution function (CDF) or calculate it manually by summing the individual probabilities.

Using the binomial CDF:

P(X ≤ 5) = Σ(i = 0 to 5) [8C(i) × (0.8i)  (0.2(8-i))]

Calculating it manually:

P(X ≤ 5) = P(X = 0) + P(X = 1) + P(X = 2) + P(X = 3) + P(X = 4) + P(X = 5)

Using the binomial probability formula:

P(X = k) = 8C(k) × (0.8k) × (0.2(8-k))

Therefore, the exact value of P(X ≤ 5) is approximately 0.04101368.

c) To assess whether we should believe the claim of United Medicine, Inc., we can perform a hypothesis test using statistical methods. The claim states that 80% of all patients experience symptom relief. In our sample of 8 patients, if we observed 3 patients with symptom relief, we can compare this to the expected proportion of success (p = 0.8) using hypothesis testing.

We can set up a null hypothesis (H0) that the true proportion of patients experiencing symptom relief is equal to 80% (p = 0.8) and an alternative hypothesis (H1) that the true proportion is different from 80% (p ≠ 0.8). We can then perform a statistical test, such as a chi-square test or a z-test for proportions, to determine the likelihood of observing 3 out of 8 patients with symptom relief if the true proportion is indeed 80%.

Based on the results of the statistical test, we can assess the evidence against the null hypothesis and make an informed decision about whether to believe the claim of United Medicine, Inc. If the p-value is very small (below a predetermined significance level), we may reject the null hypothesis and question the claim. If the p-value is not small, we may fail to reject the null hypothesis and consider the claim plausible.

To know more about binomial distribution:

https://brainly.com/question/32475352

#SPJ4

Which of the following is closest to the ΔG° for a nickel-cadmium voltaic cell?
−14 kJ
125 kJ
−29 kJ
−125 kJ
29 kJ

Answers

To determine the closest value for the ΔG° of a nickel-cadmium voltaic cell, we need to understand the relationship between ΔG° and the cell potential (E°). The formula to calculate ΔG° is:

ΔG° = -nFE°

where n is the number of moles of electrons transferred, F is the Faraday constant (approximately 96,485 C/mol), and E° is the cell potential.

For a nickel-cadmium voltaic cell, the cell potential E° is approximately 1.50 V. The number of moles of electrons transferred (n) is 2. Plugging these values into the formula:

ΔG° = -(2)(96485 C/mol)(1.50 V)

ΔG° ≈ -289,455 J

Since 1 kJ = 1000 J, we can convert the result to kJ:

ΔG° ≈ -289.5 kJ

Among the given options, the closest value to the ΔG° for a nickel-cadmium voltaic cell is -125 kJ.

TO KNOW MORE ABOUT nickel-cadmium voltaic cell CLICK THIS LINK -

brainly.com/question/24280219

#SPJ11

Which of the following structures is a 20:2 (44,9) fatty acid? (2 pts) a) CH3(CH2),CH = CH(CH2)2CH=CH(CH2)2COOH b) CH3(CH2)2CH = CH(CH2)2CH=CH(CH2),COOH c) CH3(CH2)10CH = CH(CH2)3CH = CHCH2COOH d) CH3CH2CH=CH(CH2)2CH = CH(CH2)10COOH

Answers

The structures that is a 20:2 (44,9) fatty acid is d) CH₃CH₂CH=CH(CH₂)₂CH=CH(CH₂)₁₀COOH.

The "20:2" refers to the fatty acid containing a chain of 20 carbon atoms, with 2 double bonds. The numbers in parentheses, (4,9), indicate the positions of the double bonds. In this case, the double bonds are at the 4th and 9th carbon atoms from the methyl (CH₃) end.

Option A has six double bonds, while Option B has five double bonds, and Option C has one double bond, which does not match the 20:2 specification. The structure d) precisely matches these specifications, as it has 20 carbon atoms in total, with double bonds located at the correct positions, making it the correct answer for the given question. Hence, the correct answer is Option D.

Learn more about fatty acid here: https://brainly.com/question/31358016

#SPJ11

What is the structural formula of 4-methyl pentan-2-ol​

Answers

The 4-methyl pentane-2-ol (C6H14O) is an alcohol compound with a methyl group attached to the fourth carbon atom and a hydroxyl group attached to the second carbon atom in a five-carbon chain.

The structural formula of 4-methyl pentane-2-ol is C6H14O. This is an alcohol compound with six carbon atoms, fourteen hydrogen atoms, and one oxygen atom. The first part of the name, 4-methyl, indicates that there is a methyl group (CH3) attached to the fourth carbon atom in the chain. Pentan-2-ol tells us that there are five carbon atoms in the chain and that the hydroxyl group (OH) is attached to the second carbon atom. Therefore, the structural formula of 4-methyl pentane-2-ol can be written as CH3CH(CH3)CH(CH2OH)CH2CH3. This can be further simplified as CH3CH(CH3)CH(CH2OH)CH2CH3which represents the complete structural formula of 4-methyl pentan-2-ol.4-methyl pentane-2-oil is an organic compound with a wide range of applications, including as a solvent, in the manufacture of cosmetics and perfumes, and as a flavoring agent in food and beverages. Its unique structure and properties make it a valuable component in various chemical and industrial processes.

For more questions on methyl group

https://brainly.com/question/31238796

#SPJ8

A material made of two or more different materials

Answers

Mixture is made of 2 or more substances

In a piece of medal, what holds the atoms together?

Answers

Explanation:

Metallic bond, force that holds atoms together in a metallic substance

How is it possible to eat acidic things without changing your blood pH? Select all that apply

How is it possible to eat acidic things without changing your blood pH? Select all that apply

Answers

It is possible to eat acidic things without changing your blood pH because the body contain buffers which help to neutralize acids; option A.

What are buffers?

Buffers are solutions which resist changes in their pH when small amounts of acid or base are added to it.

Buffers are prepared from a mixture of a weak acid and its salt or a weak base and it salt.

Buffers act by neutralizing acids or bases to form water.

In the body, there are natural buffers which help to keep the pH of the blood fairly constant.

The buffers found in the body include:

plasma proteins buffer system.hemoglobin buffer system.phosphate buffer, bicarbonate buffer system, andcarbonic acid buffer system.

When acidic substance are taken into the body, the buffer system of the body acts to neutralize the acid to form water. Similarly, when basic food substances are taken into the body, the buffer systems in the body neutralize the bases to from water.

Learn more about buffer systems at: https://brainly.com/question/11033169

#SPJ1

A 0.075 M aqueous solution of a weak, monoprotic acid is 0.85% ionized. Calculate the value of the ionization constant, Ka, for this acid.

Answers

The value of the ionization constant, Ka, for a weak, monoprotic acid can be calculated as approximately 2.59 x 10⁻⁵.

Determine the value of the ionization constant?

The degree of ionization (α) is defined as the ratio of the concentration of ionized acid ([HA⁺]) to the initial concentration of the acid ([HA]), expressed as a decimal or percentage:

α = [HA⁺] / [HA] * 100%

Given that the solution is 0.85% ionized, α = 0.85/100 = 0.0085.

The ionization constant, Ka, is related to the degree of ionization using the equation:

Ka = (α² * C) / (1 - α)

Where C is the initial concentration of the acid.

Substituting the known values, we have:

Ka = (0.0085² * 0.075 M) / (1 - 0.0085)

Ka ≈ 2.59 x 10⁻⁵.

Therefore, the ionization constant (Ka) for this weak, monoprotic acid is approximately 2.59 x 10⁻⁵.

To know more about ionization constant, refer here:

https://brainly.com/question/30639622#

#SPJ4

Reactants of a combustion reaction include

select all that apply
Fuel
Oxygen
Water
Carbon Dioxide

Answers

Answer:  fuel and oxygen are reactants.

Explanation:

Answer:

fuel and oxygen

Explanation:

I take test

how many electrons does phosphorus need to gain to have a stable outer electron shell
1
2
3
4​

Answers

Answer:

3

Explanation:

Phosphorous valence is 5. so to get stable electronic configuration it has to gain 3 more electrons to its outer shell

Answer:

3

Explanation:

luckily, every phosphorus atom is looking to gain 3 electrons. It's a perfect match. But something to notice though, look how they have a bond with six electrons. That is called triple bond.

Arrange the following compounds in order of decreasing acidity. 1. CH3COOH 2. CH3CH2OH 3. CF3COOH 4. CCI3COOH A. 3214 B. 3412 C. 2143 D. 2431 E. 2134 F. 3142

Answers

The correct order of decreasing acidity for the given compounds is option F, which is 3142.  Acidity of a compound is determined by the strength of its conjugate base.

The stronger the conjugate base, the weaker the acid. In this case, all the given compounds have a carboxylic acid functional group, which is a strong acid. However, the strength of the acid is affected by the electronegativity of the substituents on the carbon atom. The more electronegative the substituent, the stronger the acid.

Therefore, CF3COOH (compound 3) is the strongest acid due to the presence of the highly electronegative CF3 group. CH3COOH (compound 1) is the next strongest acid due to the presence of the moderately electronegative CH3 group. CCI3COOH (compound 4) is weaker than CH3COOH due to the presence of the highly electronegative CCI3 group. Finally, CH3CH2OH (compound 2) is the weakest acid as it does not have any electronegative substituents.

Thus, the correct order of decreasing acidity is 3142 (option F).

To know more about  carboxylic acid refer to

https://brainly.com/question/31050542

#SPJ11

how is the perodic table organized geology

Answers

The periodic table has organization helps geologists understand the properties of elements and their role in the formation of minerals and rocks on Earth.

The periodic table is organized based on the atomic structure of elements and their chemical properties. In the context of geology, the periodic table plays a significant role in understanding the composition of minerals and rocks found in the Earth's crust.

1. The periodic table is arranged in rows called periods and columns called groups.
2. Elements in the same group share similar chemical properties because they have the same number of valence electrons.
3. As you move across a period from left to right, the atomic number (number of protons) increases.
4. As you move down a group, the atomic size increases due to an increasing number of electron shells.

In geology:

5. The composition of minerals and rocks is determined by the elements found within them. These elements can be identified on the periodic table.
6. Elements such as silicon, oxygen, aluminum, iron, and magnesium are common in Earth's crust and are essential in the formation of various minerals.
7. Understanding the chemical properties of these elements, as shown on the periodic table, helps geologists predict the behavior and formation of minerals and rocks under various conditions.

Learn more about periodic table here:

https://brainly.com/question/11155928

#SPJ11

The periodic table is organized by atomic number, electron configuration, and recurring chemical properties.

What is Periodic Table?

The periodic table is organized based on the atomic number, electron configuration, and recurring chemical properties of elements.

1. Atomic number: Elements are arranged in increasing order of atomic number, which is the number of protons in an element's nucleus. This determines the element's identity.

2. Electron configuration: Elements in the same column (also known as a group) have similar electron configurations. This means that they have the same number of electrons in their outermost shell, resulting in similar chemical properties.

3. Recurring chemical properties: As you move across a period (row) in the table, properties of elements change gradually. However, when you start a new period, these properties recur, giving the table its periodic nature.

To know more about Periodic Table:

https://brainly.com/question/23856140

#SPJ11

how do the structures of particles in substances vary?

Answers

Answer:

56

Explanation:

Explain why coal, oil, and natural gas are fossil fuels.

Answers

Answer:

They are fossil fuels because they were formed because of fossilized remains of animals and plants that lived many years ago. They also have a high carbon content.

Other Questions
Why was it called Scramble for Africa? Which of the following molecules would have the highest boiling point?A. hexaneB. 2-methylhexaneC. 2-propylpentaneD. octane has any president appointed 3 supreme court justices Determine whether the given value of the variable is a solution to the inequality 3b + 2 < 14 when b = 4 A divers elevation is -50 feet relative to sea level. She dives down 30 feet. what is her elevation after the dive Does anyone know the answer to this?? a survey investigating whether the proportion of today's high school seniors who own their own cars is higher than it was a decade ago finds a p-value of 0.017. is it reasonable to conclude that more high schoolers have cars? explain Do you think Powhatan (document 3) would agree or disagree with John Lawson (document 4)? Which component of the nervous system mobilizes the body in times of stress?A. Sympathetic nervous systemB. Parasympathetic nervous systemC. Central nervous systemD. Peripheral nervous system What kind of government was the Provisional government?DictatorshipDemocracyMonarchyCommunist inventory strategy in efficient supply chain focuses on deplying buffer stocks of wip and finished goods inventory.truefalse The curve above is the graph of a sinusoidal function. It goes through the points (-9,-4) and (5,-4) Find a sinusoidal function that matches the given graph. Id needed, you can enter pi=3.1416.... as pi in your answer, otherwise use at least 3 decimal digits. The vertex angle of an isosceles triangle measures 42. A base angle in the triangle has a measure given by (2x + 3). What is the value of x? What is the measure of each base angle? HELP PLZ WILL GIVE BRAINLY Can someone plz help me with this one problem!! What type of attitude does the office for civil rights expect to find when investigating a health care facility. Please answer this simple question! I need it ASAPWhat is the value of the x-coordinate that is 6 units to the left of (4, -6)? -One way of celebrating the right to free speech is by complaining about things that we find wrong in our world.-Generate some examples of issues that our society has ceased to complain about. Suppose P(A) = 0.7, P(B) = 0.8, andP (A n B) = 0.56.Calculate P(A U B). based on the video and what you know about the big 5 personality types, trayvon is most likely ________ on ________.