The first sentence describes beta sheets: "successive R groups point in opposing directions." Alpha helices are described by the second statement, "NH groups point in the same direction."Beta turns are described by the third statement, "contains -NH hydrogen-bonded to
When two or more objects travel in the same direction, it indicates that they are headed in the same general direction. This may occur in a variety of settings, such as when a group of people is strolling together, when a flock of birds is flying in formation, or when a line of cars is passing one another. This idea is referred to as "coherence" in physics, which describes how similar oscillations in a system's phases are. In other words, it serves as a gauge for how well-synchronized the system is. Additionally, the term "alignment" is frequently used in a corporate setting to characterise the extent to which several departments or teams within a company are working towards the same objectives.
Learn more about same direction.here:
https://brainly.com/question/1208107
#SPJ4
Of the following regions of the electromagnetic spectrum, which one has the shortest wavelength?
a.
gamma rays
b.
infrared
c.
radio waves
d.
X rays
e.
microwaves
f.
ultraviolet
Answer:
A ---->gamma ray
Explanation:
Gamma rays have the highest frequencies among all electromagnetic waves and therefore have the shortest wavelengths.
Consider the insoluble compound silver bromide , AgBr . The silver ion also forms a complex with ammonia . Write a balanced net ionic equation to show why the solubility of AgBr (s) increases in the presence of ammonia and calculate the equilibrium constant for this reaction. For Ag(NH3)2+ , Kf = 1.6×107 . Use the pull-down boxes to specify states such as (aq) or (s).
Answer:
- \(AgBr(s)+2NH_3(aq)\rightleftharpoons Ag(NH_3)_2^+(aq)+Br^-(aq)\)
- \(K=1.2x10^{-5}\)
Explanation:
Hello,
In this case, by considering the dissolution of silver bromide:
\(AgBr(s)\rightleftharpoons Ag^+(aq)+Br^-(aq) \ \ \ Ksp=[Ag^+][Br^-]=7.7x10^{-13}\)
And the formation of the complex:
\(Ag^+(aq)+2NH_3(aq)\rightleftharpoons Ag(NH_3)_2^+(aq)\ \ \ Kf=\frac{[Ag(NH_3)_2^+]}{[Ag^+][NH_3]^2}=1.6x10^7\)
We obtain the balanced net ionic equation by adding the aforementioned equations:
\(AgBr(s)+Ag^+(aq)+2NH_3(aq)\rightleftharpoons Ag(NH_3)_2^+(aq)+Br^-(aq)+Ag^+(aq)\\\\AgBr(s)+2NH_3(aq)\rightleftharpoons Ag(NH_3)_2^+(aq)+Br^-(aq)\)
Now, the equilibrium constant is obtained by writing the law of mass action for the non-simplified net ionic equation:
\(AgBr(s)+Ag^+(aq)+2NH_3(aq)\rightleftharpoons Ag(NH_3)_2^+(aq)+Br^-+Ag^+\\\\K=[Ag^+][Br^-]*\frac{[Ag(NH_3)_2^+]}{[Ag^+][NH_3]^2}\)
So we notice that the equilibrium constant contains the solubility constant and formation constant for the initial reactions:
\(K=Ksp*Kf=7.7x10^{-13}*1.6x10^{7}\\\\K=1.2x10^{-5}\)
Best regards.
Which of would be The acid-base pair that can create NaCL with water?
A)LiCland NaOH
B)HCl and NaOH
C)Cl2 and KaI
D)BaO + KO
Answer:
i
Explanation:
Answer:1
Explanation:v
If the heat of fusion of water is 80 cal/g, the amount of heat energy required to change 15.0 grams of ice at 0°C to
15.0 grams of water at 0°C is -
Answer:
1200 cal
Explanation:
80 cal/g * 15 g = 1200 cal
Acrylonitrile, C3H₂N, is a molecule used to produce a plastic called Orlon. How many grams of acrylonitrile
could be produced by reacting 583 g of propene, C3H, with excess ammonia, NH, and oxygen?
2C3H6+ 2NH3 + 30₂ → 2C,H₂N + 6H₂O
a. 368 g
b. 1470 g
C. 462 g
d. 735 g
e. 583 g
d. 735 g of acrylonitrile could be produced by reacting 583 g of propene, \(C_{3}H\), with excess ammonia, NH, and oxygen
To determine the grams of acrylonitrile that could be produced, we need to find the limiting reactant in the given chemical equation. The limiting reactant is the one that is completely consumed and determines the amount of product formed.
First, we need to calculate the molar masses of propene (\(C_{3}H_{6}\)) and acrylonitrile (\(C_{3}H_{2}N\)).
Molar mass of propene (\(C_{3}H_{6}\)):
3(C) + 6(H) = 3(12.01 g/mol) + 6(1.01 g/mol) = 42.09 g/mol
Molar mass of acrylonitrile (\(C_{3}H_{2}N\)):
3(C) + 2(H) + 1(N) = 3(12.01 g/mol) + 2(1.01 g/mol) + 1(14.01 g/mol) = 53.06 g/mol
Next, we calculate the number of moles of propene:
583 g / 42.09 g/mol = 13.86 mol
According to the balanced equation, the stoichiometric ratio between propene and acrylonitrile is 2:2. Therefore, for every 2 moles of propene, 2 moles of acrylonitrile are produced.
Since the stoichiometric ratio is 1:1, the number of moles of acrylonitrile produced is also 13.86 mol.
Finally, we calculate the mass of acrylonitrile:
Mass = moles × molar mass = 13.86 mol × 53.06 g/mol = 735 g
Therefore, Option D is correct.
Know more about Molar mass here:
https://brainly.com/question/24191825
#SPJ8
which word or words best describe Haversian systems?LigamentLigamentBone Bone marrowmarrowCircular Circular structuresstructuresCartilageCartilage
The structural layers of the sun are shown in the cross-sectional diagram. An image of six concentric circles is shown. The six layers thus formed are of varying thickness. The layers in order from inside out are labeled, A, B, C, D, E, F. Which layer represents the corona? C D E F
The outermost of the six sun layers with the letters A, B, C, D, E, and F, layer F in the cross-sectional figure symbolises the corona.
Is the corona of the sun referred to as such?The Sun's atmosphere's outermost region is called the corona. The brilliant brightness of the Sun's surface often obscures the corona. Without employing specialised equipment, it is challenging to see. A total solar eclipse, however, makes the corona visible.
What takes place within the corona layer?The term "corona" refers to the topmost region of the Sun's atmosphere. It rises hundreds of kilometres above the Sun's surface and gradually changes into the solar wind, which travels across our solar system.
To know more about sun layers visit:-
https://brainly.com/question/23930641
#SPJ1
Describe echolocation. Give an example of an animal that uses echolocation.
dolphin and whales use echolocation
A solution is made by dissolving 38.81 grams of nickel (II) sulfate, NiSO4, in enough water to make 0.467
liters of solution. Calculate the molarity of this solution.
The molarity of the NiSO₄ solution made by dissolving 38.81 grams of nickel (ii) sulfate, NiSO₄, in enough water to make 0.467 liters of solution is 0.535 M
How do i determine the molarity of the solution?First, we shall obtain the mole of 38.81 grams of nickel (ii) sulfate, NiSO₄. Details below:
Mass of NiSO₄ = 38.81 grams Molar mass of NiSO₄ = 154.75 g/molMole of NiSO₄ = ?Mole of NiSO₄ = mass / molar mass
= 38.81 / 154.75
= 0.25 mole
Now, we shall determine the molarity of the solution. Details below:
Mole of NiSO₄ = 0.25 moleVolume of solution = 10.467 LMolarity of solution = ?Molarity of solution = mole / volume
= 0.25 / 0.467
= 0.535 M
Thus, the molarity of the solution is 0.535 M
Learn more about molarity:
https://brainly.com/question/16073358
#SPJ1
What is the molarity of a solution made from 325.4g of Aluminum chloride with enough water te
make 500.0 mL?*
(1 Point)
AICIAl = 26.9828 C1 = 35.45
mol
8
mol
0.488M
O 4.88M
0 2.44M
0 2.440M
Answer:
awdaef
Explanation:
A 25.0g sample of brass, which has a specific heat capacity of 0.375·J·g−1°C−1, is dropped into an insulated container containing 250.0g of water at 25.0°C and a constant pressure of 1atm. The initial temperature of the brass is 96.7°C. Assuming no heat is absorbed from or by the container, or the surroundings, calculate the equilibrium temperature of the water. Be sure your answer has 3 significant digits.
Answer:
The equilibrium temperature of water is 25.6 °C
Explanation:
Step 1: Data given
Mass of the sample of brass = 25.0 grams
The specific heat capacity = 0.375 J/g°C
Mass of water = 250.0 grams
Temperature of water = 25.0 °C
The initial temperature of the brass is 96.7°C
Step 2: Calculate the equilibrium temperature
Heat lost = heat gained
Q(sample) = -Q(water)
Q = m*C* ΔT
m(sample)*c(sample)*ΔT(sample) = - m(water)*c(water)*ΔT(water)
⇒m(sample) = the mass of the sample of brass = 25.0 grams
⇒with c(sample) =The specific heat capacity = 0.375 J/g°C
⇒with ΔT = the change of temperature = T2 - T1 =T2 - 96.7 °C
⇒with m(water) = the mass of the water = 250.0 grams
⇒with c(water) = the specific heat capacity = 4.184 J/g°C
⇒with ΔT(water) = the change of temperature of water = T2 - T1 = T2 - 25.0°C
25.0 * 0.375 * (T2 - 96.7) = - 250.0 * 4.184 J/g°C * (T2 - 25.0°C)
9.375T2 - 906.56 = -1046T2 + 26150
9.375T2 + 1046T2 = 26150 + 906.56
1055.375T2 = 27056.26
T2 = 25.6 °C
The equilibrium temperature of water is 25.6 °C
A 25 ml sample of 1.2 molar potassium chloride mix with 15 ml of 0.90 molar barium nitrate solution and precipitate reaction occurs twice case LX + BA no3s aqueous bacl2 solid + 2ks what is the practical yield percentage yield mass is 2.45 g
nkkljihghjhytuyftghvnvm
jkhjkhjkh
Answer:
seriously ....,........
I don't like chemistry
A sample of oxygen gas initially at 0.760 atm is cooled from 27°C to −93°C at constant volume.
What is its final pressure (in atm)?
Answer:
0.38 atm
Explanation:
Gay-Lussac's Law states:
\(\frac{P_1}{T_1} =\frac{P_2}{T_2}\)
p = pressure
T = temperature
Change temps from Celcus to Kelvin:
27+273 = 360
-93+273 = 180
plugging the information in we have:
\(\frac{0.760 atm}{360K} = \frac{x}{180K}\)
Cross multiply:
136.8 = 360x
divide 136.8 by 360 = .38 atm
Cars are the leading cause of____
1. carbon dioxide
2. nitrogen oxide
3.carbon monoxide
pollution
Answer:
nitrogen oxide
Explanation:
Thermal energy that encounters greenhouse gases cannot escape the atmosphere? Yes or no
Answer:
Yes
Explanation:
The point of greenhouse gases is that it absorbs and emits radiant energy within the thermal infrared range and causes it to be trapped.
In the anaerobic fermentation of grain, the yeast Saccharomyces cerevisiae digests glucose from plants to form the products ethanol and propenoic acid by the following reactions: Reaction 1: C6H12O6 2 C2H5OH + 2 CO2 Reaction 2: C6H12O6 2 C2H3CO2H + 2 H2O In an open flow reactor 4000 kg of a 12% glucose-water solution flows in. During fermentation, 120 kg of carbon dioxide is produced together with 90 kg of unreacted glucose. What are the weight percents of ethyl alcohol and propenoic acid that exit the broth? Assume that none of the glucose is assimilated into the bacteria.
Answer:
Explanation:
The first step in order to solve this particular question is to make sure that the two reactions given in the question is balanced. Therefore, we have;
Reaction 1: C6H12O6 -----------------------------> 2 C2H5OH + 2 CO2.
Reaction 2: C6H12O6 ------------------------------> 2 C2H3CO2H + 2 H2O.
Next, we determine the number of moles of water and that of glucose. Recall that we are given from the question that the open flow reactor = 4000 kg of a 12% glucose-water solution flows in that is to say the percentage for water is [100% - 12% = 88%]. Also, the molar mass of water = H₂O = 18 kg/kmol and that for glucose =180 kg/kmol.
Number of moles of water = (4000 kg × 88%) ÷ 18 = 195.6 kmol.
Number of moles of glucose= (4000kg × 12%) ÷ 180 = 2.67 kmol.
Next thing to do is to determine the number of moles in the unreacted glucose . Therefore, the 90 kg of unreacted glucose ÷ 180kg/kmol = 0.5 kmol.
So, we have that During fermentation, 120 kg of carbon dioxide is produced. Thus, the number of kmol = 120kg÷ 44kg/mol = 2.73kmol.
For reaction 1, we have 2 moles of CO₂ that is to say the extent of the reaction = 2.73kmol / 2 moles of CO₂ = 1.365 kmol.
For reaction 2, we have 2 moles of CO₂ that is to say the extent of the reaction = 2.67kmol - 0.5 kmol - 1.365kmol = 0.805 kmol.
For both reaction, the kmol for outflow of glucose = 2.73 kmol.
Also, 2 × 0.805 + 1.365 × 0 = 1.61kmol.
Hence, 195.6 kmol + 1.61 =197.21 kmol.
The mass of ethanol = 46.1 kg/kmol × 2.73 kmol = 125.853 kg.
The weight percent of ethanol has been 29.72%, and the percent mass of propionic acid has been 47.79%.
The balanced chemical equations of the reactions have been:
\(\rm C_6H_1_2O_6\;\rightarrow\;2\;C_2H_5OH\;+\;2\;CO_2\)
\(\rm C_6H_1_2O_6\;\rightarrow\;2\;C_2H_3CO_2H\;+\;2\;H_2O\)
The solution has consisted of 12% glucose.
Water in the solution = 88%
The mass of the solution = 4000 kg.
The moles of glucose = 12% of 4000 kg
Moles of glucose = \(\rm \dfrac{12}{100}\;\times\;4000\;\times\;\dfrac{1}{180\;g/mol}\)
Moles of glucose = 2.67 kmol.
Moles of water = 88 % of 4000 kg
Moles of water = \(\rm \dfrac{88}{100}\;\times\;4000\;\times\;\dfrac{1}{18\;g/mol}\)
Moles of water = 195.6 kmol.
The unreacted glucose in the mixture = 90 kg
Moles of unreacted glucose:
Moles = \(\rm \dfrac{weight}{molecular\;weight}\)
Moles of unreacted glucose = \(\rm \dfrac{90\;\times\;1000\;g}{180\;g/mol}\)
Moles of unreacted glucose = 0.5 kmol
The mass of carbon dioxide produced = 120 kg.
Moles of carbon dioxide produced = \(\rm \dfrac{120\;\times\;1000\;g}{44\;g/mol}\)
Moles of carbon dioxide produced = 2.73 kmol
Since 1 mole of glucose produces 2 moles of carbon dioxide.
2.73 kmol of carbon dioxide has been produced from 1.365 kmol of glucose.
The moles of ethanol produced by reaction 1 = 2 moles/ mole glucose.
The glucose present has been 2.67 kmol.
The ethanol produced = 5.34 kmol.
Moles of propionic acid produced = 5.34 kmol.
The mass of 5.34 kmol ethanol = Moles × molecular weight
The mass of ethanol produced = 5.34 × 1000 × 46.07g/mol
The mass of ethanol produced = 246.0138 kg.
The mass of propionic acid produced = 5.34 × 1000 × 74.08 g/mol
The mass of propionic acid produced = 395.5872 kg.
The mass of water produced = 5.34 × 1000 × 18 g/mol
The mass of water produced = 96.12 kg.
The remained glucose = 90 kg
The total mass in the reactor:
= Mass of glucose + water + propionic acid + ethanol
= 90 + 96.12 + 395.5872 + 246.0138 kg
= 827.721 kg.
% Mass of ethanol = \(\rm \dfrac{Mass\;of\;ethanol}{Total\;mass}\;\times\;100\)
% Mass of ethanol = \(\rm \dfrac{246.0138}{827.721}\;\times\;100\)
% Mass of ethanol = 29.72%
% Mass of Propionic acid = \(\rm \dfrac{Mass\;of\;propionic\;acid}{Total\;mass}\;\times\;100\)
% Mass of Propionic acid = \(\rm \dfrac{395.5872}{827.721}\;\times\;100\)
% Mass of Propionic acid = 47.79 %.
The weight percent of ethanol has been 29.72%, and the percent mass of propionic acid has been 47.79%.
For more information about weight percent, refer to the link:
https://brainly.com/question/18204076
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
To obtain the number of meters from a distance measured in centimeters, you must
By the number
Answer:
Divide by 100
Explanation:
Is the coil of wire a magnet when it is connected to a battery? Explain why or why not.
GIVING BRAINLIEST
Answer:
When an electric current flows in a wire, it creates a magnetic field around the wire. This effect can be used to make an electromagnet . A simple electromagnet comprises a length of wire turned into a coil and connected to a battery or power supply.Explanation:
I hope U like my answer and my answer helped U.Which of the following is not an example of weathering?
Frost wedging
Destruction of rocks at convergent boundaries
Acid rain
Oxidation reactions
Answer:
Destruction of rocks at convergent boundaries
Explanation:
Duuuuuuuuude. Dude.
Let's think for a sec, because this confused me.
Acid rain is chemical weathering. It has acid in it, so it weathers rocks. (Ewwww.)
Frost wedging is a major duh, because frost can weather rocks.
Oxidation reactions are a yes yes because it becomes oxidized.
What would this mechanism look like?
Answer:
Not sure sorry :(
Explanation:
The temperature of a sample of gas in a steel container at 25.0 kPa starts at -50 C and decreases by a factor of three. What is the final pressure inside the tank?
Answer: The final pressure inside the tank is 8.41 kPa.
Explanation: We can use the combined gas law to solve this problem, which relates the pressure, volume, and temperature of a gas:
(P1V1)/T1 = (P2V2)/T2
where P1, V1, and T1 are the initial pressure, volume, and temperature, respectively, and P2, V2, and T2 are the final pressure, volume, and temperature, respectively.
We are given P1 = 25.0 kPa, T1 = -50 C = 223 K, and V1 is unknown. We also know that the temperature decreases by a factor of three, so T2 = T1/3 = 223/3 K.
To find V2, we need to assume that the steel container is rigid and its volume remains constant. Therefore, V1 = V2, and we can cancel out the volume from the equation:
P1/T1 = P2/T2
Substituting the values, we get:
P2 = P1 * T2 / T1 = 25.0 * (223/3) / 223 = 8.41 kPa
Therefore, the final pressure inside the tank is 8.41 kPa.
Answer:
So if pressure of a gas is increased by 25%, the volume of a gas is decreased by 25%.
Explanation:
List all possible values of the magnetic quantum number ml for a 1s electron.
The magnetic quantum number (ml) represents the orientation of the orbital in three-dimensional space the only possible value of the magnetic quantum number ml for a 1s electron is 0.
What is a quantum ?Quantum is the smallest possible unit of a physical quantity, such as energy or momentum. It is a fundamental concept in quantum mechanics, which is the branch of physics that deals with the behavior of matter and energy at the atomic and subatomic level.
The idea of quantization was first proposed by Max Planck in 1900, when he discovered that energy is emitted and absorbed in discrete units called "quanta" when studying the behavior of light and blackbody radiation. Later, this idea was extended to other physical quantities, such as the momentum and position of particles.
According to quantum mechanics, the behavior of particles and systems cannot be fully described using classical mechanics, which assumes that particles have definite positions and velocities at all times. Instead, the behavior of particles and systems is described using wave functions, which represent the probability of finding a particle at a given position and time.
The principles of quantum mechanics have important applications in many areas of physics, including atomic and molecular physics, condensed matter physics, and particle physics. They are also the basis.
To know more about quantum visit :
https://brainly.com/question/16746749
#SPJ1
Iron reacts with chlorine to form iron(III) chloride.
2Fe + 3Cl2 → 2FeCl3
What mass (in grams) of chlorine gas is needed to react with 251 grams of iron?
Select one:
a.
71 grams
b.
392 grams
c.
479 grams
d.
622 grams
The mass (in grams) of chlorine gas is needed to react with 251 grams of iron is 479 grams. Option C.
To determine the mass of chlorine gas needed to react with 251 grams of iron, we need to use the stoichiometry of the balanced chemical equation:
2Fe + 3Cl2 → 2FeCl3
From the balanced equation, we can see that 2 moles of iron (Fe) react with 3 moles of chlorine gas (Cl2) to produce 2 moles of iron(III) chloride (FeCl3).
To calculate the mass of chlorine gas, we can follow these steps:
Step 1: Convert the given mass of iron (Fe) to moles.
Using the molar mass of iron (Fe), which is approximately 55.85 g/mol, we can calculate the number of moles of iron:
moles of Fe = mass of Fe / molar mass of Fe
moles of Fe = 251 g / 55.85 g/mol
moles of Fe ≈ 4.5 mol (rounded to one decimal place)
Step 2: Use the mole ratio from the balanced equation to find the moles of chlorine gas (Cl2) needed.
From the balanced equation, we know that 2 moles of Fe react with 3 moles of Cl2. Therefore, the moles of Cl2 can be calculated as:
moles of Cl2 = (moles of Fe / 2) * 3
moles of Cl2 = (4.5 mol / 2) * 3
moles of Cl2 ≈ 6.75 mol (rounded to two decimal places)
Step 3: Convert the moles of chlorine gas to grams.
Using the molar mass of chlorine gas (Cl2), which is approximately 70.90 g/mol, we can calculate the mass of chlorine gas:
mass of Cl2 = moles of Cl2 * molar mass of Cl2
mass of Cl2 = 6.75 mol * 70.90 g/mol
mass of Cl2 ≈ 479 grams (rounded to the nearest whole number) Option C is correct.
For more such question on mass. visit :
https://brainly.com/question/19385703
#SPJ8
Convert 62.00nm/s to pm/ms
Answer:
62 picometer/millisecond
Explanation:
You multiply the speed value by 1
I need three more brainliest to level up, so if you could mark me as that, that would be great. I hope this helps though!
Please I need help thank you
Answer:
its sodium hydroxide
Explanation:
You have 0.14 moles of sodium chloride (NaCl). How many grams do you have? ( 1 mole of NaCl = 58 grams NaCl) *
0.14 grams NaCl
3.2 grams NaCl
5.9 grams NaCl
8.12 grams NaCl
Answer:
Option D is correct = 8.12 grams of NaCl
Explanation:
Given data:
Moles of sodium chloride = 0.14 mol
Mass of sodium chloride = ?
Solution:
Formula:
Number of moles = mass of NaCl / Molar mass of NaCl
Molar mass of NaCl = 58 g/mol
Now we will put the values in formula.
0.14 mol = Mass of NaCl / 58 g/mol
Mass of NaCl = 0.14 mol × 58 g/mol
Mass of NaCl = 8.12 g of NaCl
Thus, 0.14 moles of NaCl contain 8.12 g of NaCl.
Each sketch below shows three objects with an electric charge. In each case, decide whether there is a net force acting on the object outlined in green. If there
is a net force, decide whether it pushes the green-ring object to the left or right. Then select the appropriate button under the sketch.
For example, if there is a net force pushing the green-ring object in the first sketch to the left, select the left button under the first sketch. If there is no net
force on the green-ring object in the second sketch, select the middle button under the second sketch. And so on.
1. The net force on the -2 Charge is +2; acts to the right
2. The net force on the -1 charge is -1; acts to the left
3. There is no net force on the +3.
What is a net force?The net force is the vector sum of all the force acting at a point taking into consideration the magnitude and direction of each of the individual forces.
Electric charges experience electrical forces due to the electric field.
The two types of electric charges are positive and negative charges.
Like charges repel each other while opposite charges attract each other.
Considering the charges highlighted green;
The net force on the -2 Charge is: +3 - (+ 1) = +2; the net force on the +2 charge acts to the rightThe net force on the -1 charge is: -3 - (-2) = -1; the net force on the -1 charge acts to the leftThe net force on the +3 Charge is: +1 + (-1) = 0; there is no net force on the +3.In conclusion, the net force obtained by vector addition.
Learn more about net force at: https://brainly.com/question/14361879
#SPJ1
______ in a white, crystalline solid at room temperature that is soluble in water, has low melting and boiling points, and held together through covalent bonds. a. Baking soda b. Butter
c. Granulated sugar
d. Table salt
At room temperature, granulated sugar is a white, crystalline solid that is soluble in water, has a low melting and boiling point, and is bound together by covalent bonds.
What types of solids have crystal lattices?
Crystalline solids are made up of atoms, polymers, or ions that are arranged in a predictable, three-dimensional pattern. Solids that have a crystal structure include quartz, diamonds, sodium chloride, and others.
What are the characteristics of a crystalline solid?
Solids with crystalline structures have conventional geometries. In these kinds of solids, atoms, molecules, or ions are arranged in long-range order throughout the 3-dimensional network of a crystal. Sodium chloride, quartz, diamond, etc. are few examples. Crystalline solids' characteristics.
To know more about crystalline solid visit:
https://brainly.com/question/28274778
#SPJ4