Can someone please help me with this

Can Someone Please Help Me With This

Answers

Answer 1

Answer:

8*3=24

24 yd^2

3*8

Step-by-step explanation:


Related Questions

María compra mercancía por valor $2.000.000 la cual tiene una utilidad estimada del 25%, ella desea saber el valor que ganara al vender toda su mercancía ¿Cuál sera el valor que corresponde a las ganancias de maría?

Answers

Answer:

Maria buys merchandise worth $ 2,000,000 which has an estimated profit of 25%, she wants to know the value that she will earn by selling all her merchandise. What will be the value that corresponds to Maria's earnings?

Step-by-step explanation:

2,500,000 $ worth of merchandise

Can someone please help me with this i been working so long with this

Can someone please help me with this i been working so long with this

Answers

Answer:

12

Step-by-step explanation:

since both are square it is 12

if corect i will mark brainlest

if corect i will mark brainlest

Answers

Answer:

The blue model is the correct one.

The total amount of deserts is 300.

Simplify the expression

Simplify the expression

Answers

Answer:

             f(x) = x - 6             g(x) = x - 5

Step-by-step explanation:

x28x+12x27x+10x27x+100  x=7±494020  x5  x2x28x+12x27x+10=x22x6x+12x22x5x+10=x(x2)6(x2)x(x2)5(x2)==(x2)(x6)(x2)(x5)=x6x5f(x)=x6g(x)=x5

Sorry no files just type it In

Sorry no files just type it In

Answers

Answer:

3000

300

3000/300 = 10

Hannah has 10 times greater value of 3 than Greg.

Take 3000 from Hannah and DIVIDE the 300 from Greg. You will get 10 and that is the multiplier or "greater times" amount.

3000

300

3000/300 = 10

Toothy the crocodile wants to eat a delicious chicken. His mouth is open to an angle of 30 degrees.

He needs to open his mouth to an angle of 55 degrees for the chicken to fit.

What is the measure of the additional angle Toothy's mouth needs to open so he can eat the chicken?

Answers

Answer: 25°

Step-by-step explanation:

From the question, Toothy the crocodile wants to eat a delicious chicken and his mouth is open to an angle of 30 degrees but he needs to open his mouth to the angle of 55 degrees for the chicken to fit.

The additional angle that Toothy's mouth needs to be open so he can eat the chicken will be:

= 55° - 30°

= 25°

Answer:

25

Step-by-step explanation:

did it on khan academy

the following two-way table describes the preferences in movies and fast food restaurants for a random sample of 100 people. mcdonald's taco bell wendy's iron man 20 12 8 dispicable me 12 7 9 harry potter 6 14 12 what percent of the dispicable me lovers also like mcdonald's?

Answers

The percent of the dispicable me lovers also like mcdonald's is 71%.

Define the meaning of the term percent?Rather than being expressed as a fraction, a percentage is a piece of a whole represented as a number from 0 and 100. Nothing is zero percent; everything is 100 percent.

As the question stated-

The percent of the dispicable me = 12 + 7 + 9 = 28%.

The number of mcdonald's lovers = 20%.

Thus, percent of the dispicable me lovers who also like mcdonald's;

= 20 /28

= 20/28

= 0.71

= 71%

Thus, the percent of the dispicable me lovers also like mcdonald's is 71%.

To know more about the percent, here

https://brainly.com/question/24877689

#SPJ4

A can of tuna fish has a diameter 11.4 cm and height 3.7 cm. Cans are packed snugly for shipping in boxes containing 4 layers of 5 rows by 7. How much empty space does each box contain?

Answers

Answer:

14447 cm³

Step-by-step explanation:

Given that:

Diameter = 11.4cm

Height = 3.7cm

boxes has 4 layers ; 5 rows by 7

Hence, dimension of shipping boxes :

Height = height of can * layer = 3.7 * 4 = 14.8 cm

Length = 5 * diameter of can = 5 * 11.4 = 57cm

Width = 7 * diameter of can = 7 * 11.4 = 79.8 cm

Volume of shipping boxes :

Height * Length * Width

14.8 * 57 * 79.8 = 67319.28 cm³

For fish can:

Radius = diameter / 2 = 11. 4 / 2 = 5.7cm

Volume (V) of can = pi*radius^2*height

V = π * 5.7^2 * 3.7 = 377.66027 cm³

Total volume of cans = number of cans * V

Total volume of cans = (4 * 5 * 7 * 377.66027)

Total volume of cans = 52872.4378 cm³

Empty space = difference in volume

= 67319.28 - 52872.4378

= 14446.8422

= 14447 cm³ (approx)

What is the solution of the equation 3 and minus 2 is equal to 46?

Answers

The solution of the equation 3z minus 2 is equal to 46 is 16.

The given equation '3z minus 2 is equal to 46' can be written as

    3z - 2  =   46

Now solving for z because the value of z will give the required solution of the given equation. So now finding the z from the equation:

   3z = 46  + 2

   3z =  48

   z = 48/3

   z = 16

The value of the z is 16 which represents the solution of the given equation i.e 3z minus 2 is equal to 46.

Therefore it is concluded that the solution of the equation 3z minus 2 is equal to 46 is 16.

You can learn more about equation at

https://brainly.com/question/22688504

#SPJ4

Part C
What is the difference of the x-coordinate of point A and the x-coordinate of point B?

Answers

Answer:

do u have a graph

Step-by-step explanation:

When multiplying 32 and 8, _____.
when we multiply 8 x 2, we will add drop down the 6
when we multiply 8 by 3, we will add 1
both of these are correct
neither of these are correct

Answers

Both of these are correct. When multiplying 32 and 8, we should follow these steps:

Multiply 8 by 2, which is the last digit of 32. This gives us 16.Drop down the 6 and carry the 1.Multiply 8 by 3, which is the second to last digit of 32. This gives us 24.Add the 1 that we carried from the previous step to 24, which gives us 25.Drop down the 5 and carry the 2.Since there are no more digits in 32 to multiply, we can drop down the 2 that we carried.The final answer is 256.

So, the correct answer is 256.

Here is the multiplication shown step-by-step:

 32
   8

 16 --> drop down 6 and carry the 1

1
32
   8

   6

24-   --> drop down the 4 and add 1; carry the 2

 56

2

 32
    8

   6

 5 -

2 - - --> drop down the 2 since no more digits available to multiply

256 --> the answer

Learn more about Multiplication here: brainly.com/question/620034

#SPJ11

Mr. Perez brought his daughter and her friends to
the drive-in movie theater. He purchased all the
tickets and spent $28.75 for snacks at the
concession. If he spent a total of $60.00 between
the 5 tickets and concession, how much did each
ticket cost?

Answers

Answer: $6.25

Step-by-step explanation:

   First, we will find out how much money was spent on tickets.

$60 - $28.75 = $31.25

   Now, we will divide the money spent on tickets by the number of tickets bought. This will give us the answer to your problem.

$31.25 / 5 = $6.25

      Each ticket cost $6.25.

What is the solution of 2x 3y 13?.

Answers

The equation 2x + 3y = 13 has infinitely many solutions.

We know that a linear equation in two variables is of the form ax + by + c = 0, where a, b, c are non-zero real numbers.

Here we have been given a linear equation in two variables 2x + 3y = 13

To find the solution of equation 2x+3y=13, first we solve equation for x and then for any real value of y we find value of x.

We solve this equation for x,

Consider 2x + 3y = 13

2x + 3y - 3y = 13 - 3y            .........(subtract 3y from each side of equation)

2x/2 = (13 - 3y)/2                   .........(divide each side by 2)

x = (13 - 3y)/2

for any real value of y we can find value of x.

This means, an equation 2x + 3y = 13 has infintely many solutions.

The graph of 2x + 3y = 13 is shown below.

From the graph, the y-intercept of line 2x + 3y = 13 is (0, 4.333)

and the x-intercept of line 2x + 3y = 13 is (8, 0)

Learn more about an equation here:

https://brainly.com/question/649785

#SPJ4

The complete question is:

What is the solution of 2x + 3y =13?.

What is the solution of 2x 3y 13?.

On Saturday, Lukas drove 4x – 5 miles. On Sunday, he drove 3x – 10 miles. What is the difference in miles driven?
A. x + 15
B. x – 5
C. x + 5
D. x – 15

Answers

Answer:

C

Step-by-step explanation:

(4x-5) - (3x-10) = ?

(4x-5) - 1 (3x-10) = ? DISTRIBUTE THE INVISIBLE -1 to (3x-10)

Turns into: 4x - 5 - 3x + 10

Which equals: x + 5

Answer:

c

Step-by-step explanation:

A bag contains four red marbles, six green marbles, eight yellow marbles, and two blue marbles. Find the probability of drawing a blue marble, replacing it, then drawing a yellow marble

Answers

Answer:

1/25

Step-by-step explanation:

The probability of drawing a blue marble, replacing it, then drawing a yellow marble is 1/25.

Given,

A bag contains four red marbles, six green marbles, eight yellow marbles, and two blue marbles.

We need to find the probability of drawing a blue marble, replacing it, then drawing a yellow marble.

What is a combination?

A combination is used to select required items from a set where the order of selection does not matter.

It is given by:

n^Cr = n! / r! (n-r)!

Where n = the number of elements present in a set.

Find the number of each marble.

Red marbles - 4

Green marbles - 6

Yellow marbles - 8

Blue marbles - 2

Find the probability of drawing a blue marble

P ( B ) = ^2C_1 / ^20C_1

          = (2! / 1!) / (20! / 19! 1!)

          = 2 / 20

          = 1/10

Find the probability of drawing a yellow marble

P ( Y ) = ^8C_1 / ^20C_1

          = (8! / 1! 7!) / (20! / 191 1!)

          = 8 / 20

          = 2 / 5

Find the probability of drawing a blue marble, replacing it, then drawing a yellow marble

Both the probability is independent so,

P = P ( B ) X P ( Y )

  = 1/ 10 X 2 / 5

  = 1 / 25

Thus the probability of drawing a blue marble, replacing it, then drawing a yellow marble is 1/25.

Learn more about the probability of two independent events here:

https://brainly.com/question/2289129

#SPJ2

Can the sides of a triangle have lengths 2.8, 19.1, and 19.4?

Answers

Answer:

Step-by-step explanation:

Yes

You almost have an isosceles triangle. The lengths of the longest line segments differ by by 0.3. So the base of the triangle is 2.8 and the long segments are connected to each other and each of them at end of 2.8

Find an equation of the line perpendicular to the line 3x+6y=5 and passing through the point (1,3). Write the equation in the standard form.

Answers

The standard form of the equation of a line perpendicular to the line (3x + 6y = 5) and passing through the point (1, 3) is (2x - y = -1)

To determine the equation of a line perpendicular to the line (3x + 6y = 5) and passing through the point (1, 3), we can follow these steps:

1. Obtain the slope of the provided line.

To do this, we rearrange the equation (3x + 6y = 5) into slope-intercept form (y = mx + b):

6y = -3x + 5

y =12x+56

The slope of the line is the coefficient of x, which is \(12\).

2. Determine the slope of the line perpendicular to the provided line.

The slope of a line perpendicular to another line is the negative reciprocal of the slope of the provided line.

So, the slope of the perpendicular line is \(21\) or simply 2.

3. Use the slope and the provided point to obtain the equation of the perpendicular line.

We can use the point-slope form of a line to determine the equation:

y - y1 = m(x - x1)

where x1, y1 is the provided point and m is the slope.

Substituting the provided point (1, 3) and the slope 2 into the equation, we have:

y - 3 = 2(x - 1)

4. Convert the equation to standard form.

To convert the equation to standard form, we expand the expression:

y - 3 = 2x - 2

2x - y = -1

Rearranging the equation in the form (Ax + By = C), where A, B, and C are constants, we obtain the standard form:

2x - y = -1

To know more about  equation of a line refer here:

https://brainly.com/question/29205562#

#SPJ11

HELP ASAP MATH QUESTION The midpoint of a line segment is located at (3, -2). If one of the endpoints is (1, 6), what is the other endpoint? Express your answer as an ordered pair.

Answers

Answer:

(5, -10)

Step-by-step explanation:

Midpoint=(3,2)1stendpoint=(1,6)2ndendpoint=?Let(1,6)bex1y1Let(3,2)bexandyx=(x1+x2)/2y=(y1+y2)23=1+x223×2=1+x26=1+x261=x2x2=5y=(y1+y2)22=6+y222×2=6+y24=6+y246=y2y2=10Answer=(5,10)


Joel borrowed $8,450 at 6.50% p.a. simple interest. How long did
he take to repay the loan if he was charged interest of $360.
_____years and ______days
Round up to the next day

Answers

We need to find the time period in years and days which Joel took to repay the loan.

Given the principal is 8,450, rate of interest is 6.5% per annum, and the interest charged is 360.

Let's solve the problem.

Find the time period using the formula Simple Interest=(P×R×T)/100

Here,P = 8,450R = 6.5%T = ?Simple Interest = $360

Substituting the values in the formula and solving for T.

we get: 360=(8,450×6.5×T)/10036000/552.25=T=65.228Years65yearsand0.228×365 days = 83 days.

To know more about  Simple Interest visit:

https://brainly.com/question/30964674

#SPJ11

PLS HELP
Which of the following is a Pythagorean triple?
A. (3, 4, 6)
B. (6, 8, 10)
C. (10, 12, 15)
D. (5,5, 10)

Answers

Answer:

i believe it's B

Step-by-step explanation:

Answer:

B

Step-by-step explanation:

the sum of a number q and sixty-four divided by eighty-three​

Answers

Answer:

(q + 64) ÷ 83

Step-by-step explanation:

(q + 64) ÷ 83

The answer is (q + 64) ÷ 83

Because of high interest rates, a firm reports that 30 per cent of its accounts receivable from other business firms are overdue. Assume the total number of accounts is quite large. If an accountant takes a random sample of five accounts, determine the probability of each of the following events: at least three of the accounts are overdue?

Answers

To determine the probability of at least three accounts being overdue in a random sample of five accounts, we can use the binomial probability formula. Given that 30% of the firm's accounts receivable are overdue, we can calculate the probability of each event and sum up the probabilities of having three, four, or five overdue accounts.

The probability of an account being overdue is given as 30%, which corresponds to a success in a binomial distribution. Let's denote p as the probability of success (overdue account), which is 0.30, and q as the probability of failure (account not overdue), which is 1 - p = 0.70.

To find the probability of at least three accounts being overdue, we need to sum up the probabilities of three, four, and five successes. We can calculate these probabilities using the binomial probability formula:

P(X = k) = (nCk) * p^k * q^(n-k)

where n is the sample size (5) and k is the number of successes (3, 4, or 5).

P(X ≥ 3) = P(X = 3) + P(X = 4) + P(X = 5)

          = (5C3) * (0.30)^3 * (0.70)^2 + (5C4) * (0.30)^4 * (0.70)^1 + (5C5) * (0.30)^5 * (0.70)^0

Calculating these probabilities will give us the desired probability of at least three accounts being overdue in the random sample.

Learn more about probability here:

https://brainly.com/question/32117953

#SPJ11

Which of the following equations is the result after the first step in solving 5x – 4 = 15?
A 5x = 19
B x = 2
C 5x = 11
D x – 4 = 3

Answers

Answer:

[A} 5x = 19

Step-by-step explanation:

Let's solve to see what the first step in solving the following equations:

5x - 4 = 15

Add 4 to both sides

5x - 4 + 4 = 15 + 4

5x = 19 {First step after solving}

Divide both sides by the same factor

5x/5 = 19/x

x = 3.8

Thus, the answer is [A] 5x = 19

Kavinsky

Answer:

[A] 5x = 19

Step-by-step explanation:

Solving to see first step:

5x - 4 = 15

     +4    +4          {15 + 4 = 19}

-------------------------

5x = 19    

Divide both sides by 5

5x/5 = 19/5

x = 19/5

x = 3.8

As you can see 5x = 19 is the first step result after solving.

~Lenvy~

Interpret, in a written description, what the graph is saying about the relationship between the variables. A graph has time (hours) on the x-axis, and distance (miles) on the y-axis. A line increases to 2 hours, is constant through 3 hours, and then increases through 6 hours. a. You leave home and drive for 6 hours with no stops. b. You leave home, drive for 1 hours at a constant speed, stop for 30 minutes, continue at the same speed, stop for 1 hour and then continue at the same speed as before. c. You leave home, drive for 2 hours at a constant speed, and then stop for 1 hour. Finally you continue at a slower (but constant) speed than before. d. You leave home, drive for 3 hours at a constant speed, and then stop for 2 hours. Finally you continue at the same speed as before.

Answers

The written description of the relationship between the variables as discussed in the task content is; Choice C; You leave home, drive for 2 hours at a constant speed, and then stop for 1 hour. Finally you continue at a slower (but constant) speed than before.

Which answer choice is the best interpretation of what the graph is saying about the relationship between the variables?

According to the task content, the time (hours) is plotted on the x-axis while the distance (miles) is plotted on the y-axis.

Since the graph is described by a line, it follows that it's slope is constant and consequently, its distance covered increases to 2 hours. This signifies driving.

Also, since the distance covered is constant through 3 hours, it follows that no distance is covered in that time and hence, speed is zero which signifies a stop.

Ultimately, when the distance increases through 6 hours, it follows that although the speed is constant, it is slower than the first 2 hour distance.

Therefore, Choice C correctly represents the interpretation of the relationship between the variables.

Read more on distance-time graphs;

https://brainly.com/question/13877898

#SPJ1

Which distribution should you use for this problem? (Round your answers to four decimal places.) p'= N (186 1876 x ) Explain your choice. a.The Student's t-distribution should be used because we do not know the standard deviation. b. The binomial distribution should be used because the two outcomes are "welcome a white person into your home" and "do not welcome a white person into your home." c. The Student's t-distribution should be used because np s 10, which implies a small sample. d. The standard normal distribution should be used because we are interested in proportions and the sample size is large.

Answers

The standard normal distribution should be used because we are interested in proportions and the sample size is large. (D)

The standard normal distribution is a type of probability distribution that is commonly used to describe data that is normally distributed. It is often used in statistics to help analyze data and make decisions about the data. The standard normal distribution is a special case of the normal distribution, with a mean of 0 and a standard deviation of 1.

The standard normal distribution is appropriate for this problem because we are interested in proportions and the sample size is large.

When the sample size is large, the standard normal distribution can be used to approximate the binomial distribution, which is used when there are two possible outcomes. In this case, the two outcomes are "welcome a white person into your home" and "do not welcome a white person into your home."

Therefore, the correct answer is d. The standard normal distribution should be used because we are interested in proportions and the sample size is large.

To know more about standard normal distribution click on below link:

https://brainly.com/question/29509087#

#SPJ11

in triangle ABC, AB = 6 cm, BC = 13cm and angle ACB = 23 degrees. Calculate angle BÁC, which is obtuse.

in triangle ABC, AB = 6 cm, BC = 13cm and angle ACB = 23 degrees. Calculate angle BC, which is obtuse.

Answers

Answer:

BAC=18013sin236

Step-by-step explanation:

sin(BAC)13=sin236sinBAC=13sin236BAC=18013sin236

What is the surface area of a rectangular prism with a length of 3 cm, a width of 10 cm and a height of 4 cm?​

Answers

Answer:

120!

Step-by-step explanation:

3x10x4= (3x10)x4= 30x4=120

The surface area of a rectangular prism will be 164 square centimeters.

What is the surface area of the rectangular prism?

Let the prism with a length of L, a width of W, and a height of H. Then the surface area of the prism is given as

SA = 2(LW + WH + HL)

The dimension of the rectangular prism with a length of 3 cm, a width of 10 cm, and a height of 4 cm. Then the surface area of the rectangular prism is calculated as,

SA = 2(3 x 10 + 10 x 4 + 4 x 3)

Simplify the equation, then we have

SA = 2(30 + 40 + 12)

SA = 2 x 82

SA = 164 square cm

The surface area of a rectangular prism will be 164 square centimeters.

More about the surface area of the rectangular prism link is given below.

https://brainly.com/question/14987814

#SPJ2

3 2/3 divided by 3/4

Answers

Answer:

449

(Picture for problem above.)

Find the value of y. Be sure to keep the exact value (use square root and don’t round your answer).

(Picture for problem above.)Find the value of y. Be sure to keep the exact value (use square root and

Answers

Answer:

y = 8·√3

Step-by-step explanation:

From the drawing of the right triangle, we have;

The length of the opposite leg to the given 60° (reference) angle = 12

The length of the adjacent leg to given 60° (reference) angle = x

The length of the hypotenuse side = y

By trigonometric ratios, we have;

sin(ReferenceAngle)=Opposite leg lengthHypotenuse length

Therefore, we have;

sin(60)=12y

From the value of sin(60°), we have;

sin(60)=32

y=12sin(60)=1232=2×12×33=24×33=83

y = 8·√3

(x=12tan(60)=123=43)

8. Two streets intersect at a traffic light, forming vertical angles. If the
measure of one of the angles formed by the intersecting streets is 78°,
what are the measures of the other three angles? Draw and label a
picture of the scenario. Show your work for how you found the missing
angles. (3 points)

8. Two streets intersect at a traffic light, forming vertical angles. If themeasure of one of the angles

Answers

The measures of the angles in the intersection are 78 degrees, 78 degrees, 102 degrees and 102 degrees

How to determine the measure of the three variables?

The measure of one of the angles is given as 78 degrees

Represent this angle with x

So, we have

x = 78

Vertical angles are congruent angles

This means that

Vertical angle =  x = 78

The other angles adjacent these angles are also congruent

And the measure of these angles is calculated using

y + x = 180

Substitute the known values in the above equation

So, we have

y + 78 = 180

Subtract 78 from both sides of the equation

So, we have

y + 78 - 78 = 180 - 78

Evaluate the like terms in the above equation

So, we have

y = 102

This means that the measure of the other angles is 102 degrees

Hence, the measures of the angles in the intersection are 78 degrees, 78 degrees, 102 degrees and 102 degrees

Read more about angles at

https://brainly.com/question/7620723

#SPJ1

8. Two streets intersect at a traffic light, forming vertical angles. If themeasure of one of the angles
Other Questions
(5) Let f(x)=2x-3x+1. For h0, compute and simplify f(x+h)-f(x) h An equation is shown below:7(2x 3) = 1Which of the following correctly shows the first two steps to solve this equation? Step 1: 9x 7 = 1; Step 2: 9x = 8 Step 1: 9x + 4 = 1; Step 2: 9x = 3 Step 1: 14x 3 = 1; Step 2: 14x = 4 Step 1: 14x 21 = 1; Step 2: 14x = 22 2.) You need a carpet installed in your living room. You reach out to 2 different companiesfor installation pricing. Lowes charges $ 2 a square foot and $60 to bring thematerials. Home Depot Charges $1.50 a square foot and $ 80 to bring the materials.If your living room is 100 square feet, which company would you use? At Georgia's shipyards , ________ were built to transport supplies to troops determine the design angle ( 0 90 ) (090) between members ab and ac so that the 400-lb horizontal force has a component of 600 lb which acts up to the right, in the direction from b toward a. also calculate the magnitude of the force component along ac. take Convert 13 to a decimal. Emilia wrote a total of 12 pages over 4 hours. After spending 6 hours writing this week, howmany pages will Emilia have written in total? Assume the relationship is directly proportional. You purchased a zero-coupon bond with a $1000 face value with 6 years left until maturity at a 7.6% (EAR) yield to maturity. When you sell it exactly one year later, it has a 7% (EAR) yield to maturity. What was the return on your investment expressed as an EAR Your company is streamlining its inventory management systems and has evaluated its inventory purchasing using the Economic Order Quantity (EOQ) model. 5200 units are used annually. Each unit costs $500. The order cost (per order) is $145 and the carrying cost per item per year is $300. On the basis of this information it is recommended that the EOQ is 70 units per order. Unfortunately the supplier of inventory has a minimum order quantity of 100 units. How much more will it cost your company each year in total because of this supplier requirement? Show your workings. john builds cabinets. he makes $8.50 an hour, plus $3 extra for every cabinet he builds. last week he worked 36 hours and built 17 cabinets. how much money did he make? Okay so I need 3-5 sentences and describing your daily routine, using rh following verbs:almorzar,empezar,entender,repetir, please help What replaced wood as the main source of power for locomotives? What developments in transportation eventually encouraged settlement to theMississippi?I Livia eats a chicken drumstick with 11 grams of protein.She also eats x cheese sticks, each with 7 grams ofprotein. The table shows y, the total number of grams ofprotein that Livia will consume if she eats x cheesesticks. Livia may eat only part of a cheese stick, soxmay not always be a whole number. study this chemical reaction: cr 2i2 cri4 then, write balanced half-reactions describing the xidation and reduction that happen in this reaction. Order the following distances from least to greatest :2miles, 4,800ft, 4,400yd.explain Choose the mixture that has the highest melting point. A. 0.100 m C6H12O6 B. 0.100 m AlCl3C. 0.100 m Bal2 D. 0.100 m KI E. They all have the same melting point. To wrap a gift, you can choose from 4 kinds of wrapping paper, 6 gift bags, 2 colors of ribbon, 5 bows, and 2 stickers. You choose either a style of wrapping paper or a gift bag. Then you choose one of each of the remaining items. Find the total number of ways you can wrap the gift. True/False: The Elastic Clause did not allow the government to make new laws. Please Help!!!! 20 Points!!! Will mark Brainliest!!!!