CAN SOMEONE HELP WITH THIS QUESTION?

CAN SOMEONE HELP WITH THIS QUESTION?

Answers

Answer 1

The usual enthalpy change for the 200g/7.68 mol of ethyne reaction is C2H6g C2H2g Plus 2H2g - 2,388.5kJ.

What does the letter H mean for chemistry?

The quantity of heat released or absorbed during a reaction occurring at constant pressure is known as the enthalpy change.

In thermodynamics, what does H mean?

H stands for "enthalpy change," Hf for "system final enthalpy" (i.e., the enthalpy of the byproducts of the system in equilibrium in a chemical reaction), and Hi for "system initial enthalpy" (i.e., the entropy for the reactants in a chemical reaction).

To know more about enthalpy visit:

https://brainly.com/question/16720480

#SPJ1


Related Questions

What is the energy of a TV wave that NBC broadcasts, if it has a wavelength of 32 meters?

Answers

Answer:

Explanation:

E = hc/λ

h = planck's constant = 6.66 x 10 ^ -34

c = speed of light = 2.98 *10^8 m/s

E = (6.66 x 10 ^ -34 )(2.98 *10^8)/32

  = 19.85 * 10 ^-26

   =0.62 x 10^-26

   = 6.2 x 10^-27 J

When making a fire, without gas, matches, or a lighter, what are two important things about the wood?

Answers

Answer:

that is a solid and that there are other ways to make a fire?

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Which element is more electronegative than nitrogen (N)?
The Periodic Table
A. Phosphorus (P)
B. Fluorine (F)
C. Lithium (Li)
O D. Helium (He)
SUBM

Answers

Fluorine is more electronegative than Nitrogen

Hello I need help please

Hello I need help please

Answers

Answer:

The concentration of an acid in a solution can be determined by making an acid-base titration. To do this, a known volume of the acid solution is gradually added alkali solution whose concentration is known, until a neutral pH is reached.

Explanation:

2. Which state of matter is characterized by particles that are close to each other but are not arranged in a definite pattern?

A)liquid
B)plasma
C)solid
D)gas

Answers

Answer:

Solid

Explanation:

Cus its solid, take a brick for example. It's hard and has no space unlike liquid or gas.

How is it possible to change electrical devices when the power is out?

(Please help!!)

Answers

Answer:

An uninterruptible power supply can save data during an outage, and a surge protector can prevent damage from a surge. Surge protectors absorb or ground overvoltage from spikes. Each time a surge protector does its job, resulting damage can reduce effectiveness for the next surge.

Explanation:

What is the number of molecules of NO, which contains 16 gm of oxygen. 14

Answers

We can start by using the molecular formula of NO, which is NO = N + O. From the formula, we can see that the molecular weight of NO is 30 g/mol (14 g/mol for nitrogen + 16 g/mol for oxygen).

To find the number of molecules of NO that contains 16 g of oxygen, we need to first calculate the number of moles of oxygen in 16 g of oxygen. Using the atomic weight of oxygen (16 g/mol), we can calculate:

moles of O = mass of O / atomic weight of O = 16 g / 16 g/mol = 1 mol

Next, we need to determine the number of moles of NO that contains 1 mol of oxygen. From the molecular formula of NO, we can see that 1 mol of NO contains 1 mol of oxygen. Therefore, the number of moles of NO that contains 1 mol of oxygen is also 1 mol.

Finally, we can use Avogadro's number to convert the number of moles of NO to the number of molecules of NO. Avogadro's number is approximately 6.02 x 10^23 molecules/mol. Therefore, the number of molecules of NO that contains 16 g of oxygen is:

number of molecules of NO = number of moles of NO x Avogadro's number
number of molecules of NO = 1 mol x 6.02 x 10^23 molecules/mol
number of molecules of NO = 6.02 x 10^23 molecules

Therefore, there are approximately 6.02 x 10^23 molecules of NO that contain 16 g of oxygen.

6. Observe the reaction below and choose the best answer which completes the
reaction.

C-C=C + HOH ===> ?

(will you be able to determine the answer?)

Answers

Answer:

The answer to this reaction would be C-C-OH + H2.

8. There are 2850.5 miles between Houston, TX and Vancouver, Canada, site of the 2010 Olympic Games. How many
meters is that equal to if 1 mile is equal to 1.6 km? Express your answer in scientific notation
2850.5
9. A newborn baby eats & times a day At.

8. There are 2850.5 miles between Houston, TX and Vancouver, Canada, site of the 2010 Olympic Games.

Answers

Answer:

4560.8km

Explanation:

2,850.5×1.6 = 4560.8km

What is meant by the rate of a reaction?
A. How concentrated the final products are
B. How slow or fast a reaction progresses
C. How far to completion the reaction goes
D. How much energy the reaction requires

Answers

Answer:

I think its D if I'm wrong I'm so sorry

Answer: b

Explanation:

I just took the test

How many grams of oxygen gas will be produced when 2.50 moles of potassium chlorate is decomposed?

Answers

Answer:

\(m_{O_2}=120gO_2\)

Explanation:

Hello!

In this case, since the decomposition of potassium chlorate is:

\(2KClO_3\rightarrow 2KCl+3O_2\)

We can see a 2:3 mole ratio between potassium chlorate and oxygen (molar mass 32.0 g/mol), thus, via stoichiometry, we compute the mass of oxygen that are produced by the decomposition of 2.50 moles of this reactant:

\(m_{O_2}=2.50molKClO_3*\frac{3molO_2}{2molKClO_3} *\frac{32.0gO_2}{1molO_2}\\\\m_{O_2}=120gO_2\)

Best regards!

What is epoxy?
....................

Answers

A clear chemical compound.

Answer:

1. any class of adhesives, plastics, or other materials that are polymers of epoxies.

2. something like glue or resin

Explanation:

that's the dictionary definition of epoxy.

Chlorine is made up of 75.78% 35cl and 24.22% 37 cl. The atomic mass of 35 CL is 34.969 amu. The atomic mass of 37 CL is 36.966 amu. What is the average atomic mass of a sample of chlorine?

Answers

35.453 amu is the correct answer

what is the change in mass of A in
60 minutes?
Mass of A (g)
12.4
10.4
9.1
7.7
6.2
Time
O
15
30
45
60

Answers

Answer:

To determine the change in mass of A over the given time period, we need to find the difference between the initial mass of A and the final mass of A.

From the given table, we can see that the initial mass of A at t = 0 (start time) is 12.4 g and the final mass of A at t = 60 minutes (end time) is 6.2 g.

Therefore, the change in mass of A over 60 minutes is:

Final mass of A - Initial mass of A

= 6.2 g - 12.4 g

= -6.2 g

The negative sign indicates that the mass of A decreased over time, which means that A underwent some kind of reaction or process that caused it to lose mass.

The change in mass of A over 60 minutes is -6.2 grams.

To determine the change in mass of A over 60 minutes, we need to compare the initial mass to the final mass.

From the given information, we can see that the mass of A decreases over time.

Let's calculate the change in mass.

Initial Mass of A: 12.4 g

Final Mass of A: 6.2 g

Change in Mass of A = Final Mass of A - Initial Mass of A

= 6.2 g - 12.4 g

= -6.2 g

The change in mass of A over 60 minutes is -6.2 grams.

Note that the negative sign indicates a decrease in mass.

For such more questions on mass

https://brainly.com/question/1838164

#SPJ8

Chrysocolla is a copper mineral that contains .016 % silicon. What is the mass of silicon present in 1.5kg of this mineral

Answers

Answer:

 .24 mg

Explanation:

The mineral contains .016 % silicon

mass of the mineral = 1.5 kg

mass of silicon = 1.5 x .016 %

= 1.5 x .016 / 100

= 24 x 10⁻⁵ kg

= 24 x 10⁻² mg

= .24 mg .

3 What is used to test for chlorine?
A a glowing splint
B) damp litmus paper
C limewater
D potassium manganate (VII) solution ​

Answers

Answer:

B. Litmus paper

Explanation:

The test for chlorine can use either type of litmus paper, but blue litmus paper is used most commonly. The litmus paper must be damp - the water dissolves some of the chlorine so that it can react with the indicator on the litmus paper. This test shows that chlorine is a powerful bleach.

An ion of an element can have the same as another element.
A. number of protons
B. None of these
OC. electron configuration
D. atomic mass

Answers

Answer:

A

Explanation:

In a simple perspective, an ion of an element is an element +- \(n\) amount of electrons.

We know that electrons have atomic mass, so we can mark off D

We know that with more or fewer electrons, the electron configuration would change

However, the number of protons won't change in the ion of an element, this is because an ion is only the change in electrons, not protons or neutrons (the particles that make up a nucleus of an atom)

How many grams of magnesium (Mg, 24.30g/mol) are in 7.43 x 102 atoms of Mg?Let's begin by setting up our expression.Which part of the conversion factor shouldgo in the green box?7.43x1022 atoms Mg|[?]A. 6.02 x 1023 atoms MgB. 1 mole MgEnter

How many grams of magnesium (Mg, 24.30g/mol) are in 7.43 x 102 atoms of Mg?Let's begin by setting up

Answers

According to the given question, the part of the conversion factor that should go in the green box is the Avogadro's number, which is 6.02x10^23.

It means the correct answer is A.

In the red box that is above the green box, you should put 1 mole Mg.

In the red box that is next to it, you should put 24.30 grams Mg and in the one that is below, 1 mole Mg.

If molarity of 100 ml glucose is 1.5 then the no of carbon atoms in the solution are

Answers

Answer:

Molarity =[ number of moles* (1000mL/L)] / volume in mL

Explanation:

Given: Molarity =1.5M, volume = 100mL

1.5 =[ (no. of moles) * (1000mL/L) / 100mL

no of moles = (1.5* 100) / 1000

no of moles = 0.15

We know that, 1 mole = 6.023 *10²³ atoms

Since the compound contains 0.15moles, it has

0.15 * 6.023* 110²³

9.0345*10²² atoms of carbon are present in the compound.

To find more about molarity

Help me this, I only have 10 minutes to answer!!!!

Help me this, I only have 10 minutes to answer!!!!

Answers

Answer:sedimentary

Explanation:

The half-life of Po-210 is 140 days. If the initial mass of the sample is 5 kg, how much will remain after 280 days.

Answers

The half-life of Po-210 is 140 days. If the initial mass of the sample is 5 kg, 3.5g will remain after 280 days.

What is chemical kinetics?

Chemical kinetics is a subfield of physical chemistry that studies the speeds of chemical processes. The rate of the reaction may be used to classify it as quick, moderate, or sluggish. Reaction mechanism also enables us to study the effects of temperature and catalyst on reaction rate and rate constant. It informs us about reaction processes and enables us to apply particular rate constants to certain mechanistic stages.

The rate law for first order kinetics is

K=(2.303/T)×log(a/a-x)

half life=0.693/K

Where

k - rate constant

t - time passed by the sample

a - initial amount of the reactant

a-x - amount left after the decay process

K=0.693/half life

K=0.693/140

=0.086

0.086=(2.303/ 280)×log( 5 /a-x)

0.086=0.07×log( 136/a-x)

1.22=log( 136/a-x)

136/a-x=16.5

a-x=3.5g

Therefore, 3.5g will be left after 280 days.

To learn more about chemical kinetics, here:

https://brainly.com/question/12593974

#SPJ1

Science 5th grade very PLZ answer correctly TYSM WILL MARK AS BRAINLIST IF ANSWERED TODAY!

Science 5th grade very PLZ answer correctly TYSM WILL MARK AS BRAINLIST IF ANSWERED TODAY!
Science 5th grade very PLZ answer correctly TYSM WILL MARK AS BRAINLIST IF ANSWERED TODAY!

Answers

Answer:

A

Explanation:

Conducts electricity:

-Steel

-Gold

-Copper

-Aluminum

Does not conduct electricity:

-Plastic

-Glass

-Rubber

-Wood

Metallic bonding causes metals to conduct electricity. Some metals are more highly conductive than others.

Hope this helps :)

Answer:

The first table correctly classifies the materials.

Explanation:

In table 1, all the elements on the left side are transition metals, expect for steel. Steel is not an element, it's an alloy (Which is a combination of two or more elements).Transition metals are very good conductors of heat and electricity. The reason why transition metals make such good conductors is because their outer electrons can move freely in their atom.

The right side of table 1 correctly classifies the materials that do not conduct electricity. The reason why those materials are poor conductors is because they all have their electrons tightly bound to their atoms.

In table 2, it classifies copper has a poor conductor which is wrong. It also classifies wood as a good conductor which also wrong for the reasons I stated above.

Would an object with a higher specific heat absorb more or less energy when heated?

Answers

Answer:

less

Explanation:

the more heat it has, the less a given heat will affect it

Answer:

more heat

Explanation:

A 1 liter solution contains 0.383 M hydrofluoric acid and 0.510 M potassium fluoride.
Addition of 0.096 moles of calcium hydroxide will:
(Assume that the volume does not change upon the addition of calcium hydroxide.)
Raise the pH slightly
Lower the pH slightly
Raise the pH by several units
Lower the pH by several units
Not change the pH
Exceed the buffer capacity

Answers

Answer:

Lower the pH slightly

Explanation:

The mixture of HF, hydrofluoric acid and KF, potassium fluoride produce a buffer that is defined for the equilibrium:

HF(aq) → H⁺(aq) + F⁻(aq)

The buffer can maintain the pH of a solution despite the addition of strong bases or acids.

The reaction of HF with Ca(OH)2 is:

2HF + Ca(OH)2 → 2H2O + CaF2

That means the calcium hydroxide is decreasing the concentration of HF. Based on the equilibrium, the H+ and F- ions will decrease in order to produce more HF. As H+ is decreasing due the equilibrium and not for the addition of a strong base, the pH is decreasing slightly.

what is the magnitude of the force of gravity acting in a box that has a mass of 100 kg at sea level?

Answers

Answer:

force of gravity, F = 980 N

Explanation:

Given that,

The mass of the box, m = 100 kilograms

first we will need to find the magnitude of the force of acting on a box. we can used it with Newton second law.

F = ma

a = acceleration

Here,

F = mg

g = acceleration due to gravity

F=100\ kg\times 9.8\ m/s^2F=100 kg×9.8 m/s2

F = 980 N

Hence, the force acting on the object is 980 N.

980 N Fs I’m sure I’m sorry if it’s incorrect

If a student is titrating 10.0 mL of 1 M HNO3 with 1M NaOH and another students is titrating 10.0 mL of 1 M H2SO4 with 1 M NaOH, would they need the same volume of NaOH to reach the equivalence point? Explain your answer.

Answers

Given the two different titration reactions, the volume of NaOH required to reach the equivalence point of both reaction will be different.

Titration of HNO₃ and NaOH

Balanced equation

HNO₃ + NaOH —> NaNO₃ + H₂O

From the balanced equation above,

The mole ratio of the acid, HNO₃ (nA) = 1The mole ratio of the base, NaOH (nB) = 1

How to determine the volume of NaOHVolume of acid, HNO₃ (Va) = 10 mL Molarity of acid, HNO₃ (Ma) = 1 MMolarity of base, NaOH (Mb) = 1 MVolume of base, NaOH (Vb) =?

MaVa / MbVb = nA / nB

(1 × 10) / (1 × Vb) = 1

10 / Vb = 1

Cross multiply

1 × Vb = 10

Vb = 10 mL

Titration of H₂SO₄ and NaOH

Balanced equation

H₂SO₄ + 2NaOH —> Na₂SO₄ + 2H₂O

From the balanced equation above,

The mole ratio of the acid, H₂SO₄ (nA) = 1The mole ratio of the base, NaOH (nB) = 2

How to determine the volume of NaOHVolume of acid, H₂SO₄ (Va) = 10 mL Molarity of acid, H₂SO₄ (Ma) = 1 MMolarity of base, NaOH (Mb) = 1 MVolume of base, NaOH (Vb) =?

MaVa / MbVb = nA / nB

(1 × 10) / (1 × Vb) = 1/2

10 / Vb = 1/2

Cross multiply

1 × Vb = 10 × 2

Vb = 20 mL

Conclusion Titration of HNO₃ and NaOH required 10 mL of NaOH Titration of H₂SO₄ and NaOH required 20 mL of NaOH

From the above calculations, we can conclude that different volume of NaOH will be required for the different reaction.

Learn more about titration:

https://brainly.com/question/14356286

Match the terms with their definitions

Frequency, Amplitude, Crest, Wavelength, Medium, Trough




Matter distributed by energy


Highest point of transverse wave


Lowest point of transverse wave


Distance between midpoint of wave and crest


Distance traveled in one wave cycle


Number of waves that pass per second

(from brainpop waves.) PLease HeLP (Worth 25 POINTS)

Answers

Answer:

amplitude= distance between midpoint of a wave and crest

crest= highest point of transverse wave

wavelength= distance traveled in one wave cycle

medium= matter distributed by energy

trough=lowest point of transverse wave

frequency=number of waves that pass per second

Explanation:

A wave is a dynamic perturbation of one or even more quantities that propagates in a specific medium.

What is wave?

A wave is a dynamic perturbation of one or even more quantities that propagates in physics, mathematics, or related sciences. When waves oscillate frequently around an equilibrium position at a certain frequency, they are said to be periodic. A traveling wave is one in which the whole waveform moves inside one direction; in contrast, a standing wave is one in which two periodic waves are overlaid and move in the opposing directions.

In a wave form, there are some points in which the wave amplitude seems reduced or even zero, and these positions have null vibration amplitudes. A wave equation or perhaps a one-way wave equation describing single wave propagation inside a specific direction is frequently used to describe waves.

amplitude= distance between midpoint of a wave and crest

crest= highest point of transverse wave

wavelength= distance traveled in one wave cycle

medium= matter distributed by energy

trough=lowest point of transverse wave

frequency=number of waves that pass per second

Therefore, a wave is a dynamic perturbation of one or even more quantities that propagates

To know more about wave, here:

https://brainly.com/question/13779567

#SPJ3

at what point does the radiation start to affect satellites in the atmosphere

Answers

After that have been up for a while thay are metal

Hydrogen gas H2 is the least dense of all gases. A sample of H2 gas is found to occupy a volume of 1.23L at 755 mmHg and 0 degrees Celsius. What volume, in liters, will this same gas occupy at .97 atm and a temperature of 50 degrees Celsius. Please indicate the equation used, variable you solved for and answer with the correct units.

Answers

Answer;

\(1.49L\)

Explanations:

In order to get the required volume in liters of hydrogen, we will use the general gas equation expressed as:

\(\frac{P_1V_1}{T_1}_{}=\frac{P_2V_2}{T_2}_{}\)

P1 and P2 are the initial and final pressure of the gas

V1 and V2 are the initial and final volume of the gas

T1 and T2 are the initial and final temperatures of the gas:

Given the following parameters:

\(\begin{gathered} P_1=755\operatorname{mm}Hg \\ V_1=1.23L \\ T_1=0^0C=273K \\ P_2=0.97\text{atm}=737.2\operatorname{mm}Hg \\ T_2=50+273=323K_{} \\ V_2=\text{?} \end{gathered}\)

Substitute the given parameters into the formula as shown:

\(\begin{gathered} V_2=\frac{P_1V_1T_2}{P_2T_1} \\ V_2=\frac{755\cancel{\operatorname{mm}Hg}\times1.23L\times323\cancel{K}}{737.3\cancel{\operatorname{mm}Hg}\times273\cancel{K}} \\ V_2=\frac{755\times1.23L\times323}{737.3\times273} \\ V_2=\frac{299,953.95}{201282.9} \\ V_2=1.49L \end{gathered}\)

Hence the volume, in liters that the same gas will occupy at 0.97 atm and a temperature of 50 degrees Celsius is 1.49L

Other Questions
Define the sanctions multiplier for the foreign economy as (that is, the change ... only, assume) Domestic output Y and domestic interest rate i are fixed. A mail-order house uses 15,000 boxes a year. Carrying costs are $2.10 per box a year, and ordering costs are $280. The following price schedule applies.Number of Boxes Price per Box (in $)0 to 2; 999 2.003;000 to 4;999 c5; 000 or more 0.98 c1. [6 marks] Determine EOQ. Price per Box (in $) 2:00 c 0:98c2. [3 marks] Determine the average number of orders per year under EOQ.3. [9 marks] If EOQ is optimal, what is the range of the price per box (c) in the second price interval? How can i describe how my reading skills help me with instructions for toys, traffic signs, baking recipes, and " sale" signs at the mall. om Thompson sells shares of Section 1244 stock for $50,000. He purchased the stock years ago for $175,000. How is the loss treated on Tom's tax return if he files a joint tax return with his spouse?A) $125,000 ordinary lossB) $100,000 ordinary loss; $25,000 long-term capital lossC) $ 25,000 ordinary loss; $100,000 long-term capital lossD) $125,000 short-term capital lossE) $125,000 long-term capital loss Cedrick is writing a report. It takes him4 min to typepage of the report.85 Describe two ways that venus does not follow the patterns of the other inner planets. HELP!!! WILL GIVE BRAINLIEST IF YOU HAVE THE ENTIRE LAB REPORT!!! Lab: Mouse Genetics (Two Traits) Assignment: Lab Report 1. Suppose that US dollar (USD) has a continuously compounded interest rate of 1% per annum and Australian dollar (AUD) has a continuously compounded interest rate of 3% per annum. The spot exchange rate is 0.98 USD per AUD. (a) Show that the no-arbitrage 2-year forward rate is 0.9416 USD per AUD. (b) Suppose that the 2-year forward rate is 0.93 USD per AUD in the market. answer the following questions with 2-3 sentences1) should we celebrate columbus day why or why not?2) Is columbus responsible for the actions of his men? why/why not?3)what are some ways other contries/cultures/people celebrate columbus day that is more appropriate?4)Does the fact that other Explorers/conquerors/colonizers of the time did the exact same thing as columbus excuse his actions? Which statement is true? a) Individuals with Parkinson's disease should have no differences in their abilities to complete sequences. b) The ability of individuals with Parkinson's disease to complete sequences should increase. c) Both Parkinson's disease and Huntington's disease will ultimately result in decreases in individuals' ability to complete d) Only Huntington's disease will decrease an individual's ability to complete sequences. Which of the following items handcrafted in Africa would be most likely made by a woman? A. a reed basket B. a musical instrument C. a stone carving D. a wooden mask Please select the best answer from the choices provided A B C D 4CorrectSelect the correct text in the passage.Which sentences identify corporate advertising?A pizza chain underwent a change in its product portfolio to compete with other restaurants. It purchased new equipments and advertised the sale of itsold kitchen equipments in a trade journal . Even after intensive test marketing, the products did not take off as predicted. The team found that price wasthe main issue, as customers opted for other brands due to lower costs. To combat this issue special discounts on combo meals were offered for walk-in customers. For symbiotic growth, the chain formed a strategic alliance with a beverage company to sell beverages along with pizza. But this alsodrew the ire of nutritionists who claimed such junk foods posed various health risks to children and adults. Not wanting to hamper the image of thecompany, the marketing team repositioned the product as a healthier option by mentioning use of fresh and unprocessed ingredients. The tagline 'Freshfrom Farm 'placed the product in the minds of consumers as a healthier option. It also advertised healthy body image by releasing commercials thatstressed healthy eating.Nextthe answers are 3,5 if the profit-maximizing output for the monopoly firm below is q=4, what is the marginal revenue at q=4? 2. A triangle has an angle measuring 90, an angle measuring 20, and a side that is 6units long. The 6-unit side is in between the 90 and 20 angles.a. Sketch this triangle and label your sketch with the given measures.b. How many unique triangles can you draw like this? Oranges are typically grown in warm climates because the trees can be damaged by freezing temperatures. If an orange farmer knows that the temperatures are going to drop to below freezing they will spray orange trees with water. Which of the following explains why this protects the oranges and orange trees from freezing damage?a) The water protects the orange trees by freezing before the oranges do; the process of freezing releases heat which is absorbed by the oranges so they dont freeze.b) The water protects the orange trees by freezing before the oranges do; the process of freezing absorbs heat which is released by the oranges so they dont freeze. So basically how do i ask my best friend out? what is 8/5 divided by 3/5 help would be appreciated :)) 3. Find Each Angle Measure Which is an example of active transport?aCells move sugar into their cells with energyWater moves from where there is more water to where there is lessbSalt moves from a 15% solution to a 2% solutiondDye moves from where it is dropped throughout an entire glass of water A(n) ________ file is usually smaller than the original document, and is easy to send through e-mail.