Can gravity be considered a force even though the objects are not in contact?

Answers

Answer 1

Answer:

Gravity as well as electrostatic and magnetic attraction and repulsion provide real life examples of forces being exerted by one object on another without them being in contact with each other.

Pls vote for brainliest...


Related Questions

PLS ANSWER BOTH QUESTIONS I ONLY HAVE AN HOUR PLSSSS

PLS ANSWER BOTH QUESTIONS I ONLY HAVE AN HOUR PLSSSS

Answers

The number of moles of carbondioxide that will be produced in the combustion of methane is 3 moles (option D).

How to calculate moles using stoichiometry?

Stoichiometry refers to the study and calculation of quantitative (measurable) relationships of the reactants and products in chemical reactions (chemical equations).

According to this question, methane undergoes combustion in air to produce carbondioxide and water. Methane is the limiting reactant because the other reactant is oxygen of the air which is always present in excess.

Based on the chemical equation given above, 1 mole of methane produces 1 mole of carbondioxide.

This means that 3 moles of methane will produce 3 moles of carbondioxide.

Learn more about stoichiometry at: https://brainly.com/question/9743981

#SPJ1

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Which portion of a molecule of F2O has partial positive charge?
Question 3 options:

A)

The F atoms

B)

The central O atom

C)

The partial charge on each atom is zero

D)

The partial charge on each atom is negative

Answers

The partial charges on each fluorine atom are negative. Option B) The central O atom is the correct answer. Option B

The partial charges in a molecule are determined by the electronegativity values of the atoms involved. Electronegativity is the ability of an atom to attract electrons towards itself in a chemical bond. In the case of \(F_2O\), fluorine (F) is more electronegative than oxygen.

Fluorine is the most electronegative element on the periodic table, meaning it has a high ability to attract electrons. Oxygen is also relatively electronegative but less so than fluorine. When fluorine atoms bond with oxygen, the shared electrons will be pulled more towards the fluorine atoms, creating a polar covalent bond.

In \(F_2O\), each fluorine atom will pull the shared electrons towards itself, resulting in a higher electron density around the fluorine atoms. This creates a region of partial negative charge around the fluorine atoms.

Conversely, the oxygen atom will have a region of lower electron density and, therefore, a partial positive charge. This is because the shared electrons spend more time around the fluorine atoms due to their higher electronegativity.

Option B

For more such question on partial charges visit:

https://brainly.com/question/29974793

#SPJ8

what happens to a circuits resistance (R), voltage (V), and current (I) when you increase the diameter of the wire in the circuit?

a. R increases, V is constant, I increases

b. R decreases, V is constant, I increases

c. R decreases, V increases, I increases

d. R increases, V decreases, I decreases

Answers

Answer:

b. R decreases, V is constant, I increases

Explanation:

when we increase the diameter of wire increases ,resistance decreases and current increases.Therefore, the option is b.  

Resistance is an electrical quantity which opposes the electric current in the circuit. Resistance is directly proportional to the length of the wire and inversely proportional to the diameter of the wire. If length of wire increases resistance will increases and if the diameter of the wire increase resistance will decreases.

                                R = ρ L/A

Here ρ is the resistivity

        L is the length of the wire

        A  is the cross-sectional area of wire/diameter of the wire

Voltage is the potential difference between two terminals of voltage source. Current is the flow of electrons in the circuit. Voltage is the product of current and resistance.

                              V=IR

Rewrite the above equation interms of current

                              I=V/R

From the above equation we can say that current is inversly proportional to the resistance.Therefore,the correct option is b.

Learn more about,resistance

https://brainly.com/question/4289257

Explain two positive aspects of using methane recapture systems.

Answers

Answer:

Two positive aspects of using methane recapture systems are able to generate significant electricity. Another benefit is that the process of anaerobic digestion creates heat that can be used to warm buildings where animals are kept

Answer:  The correct answer is;

Two positive aspects of using methane recapture systems include lowering the impact on greenhouse gasses and the production of energy. Methane is a very potent greenhouse gas that is contributing to global warming. As a result, the recapturing process reduces the methane impacts of global warming by reclaiming and reusing the gas for other purposes. Recaptured methane can be stored and used to generate electricity or used as fuel to power updated vehicles and other engines on the farm. The overall benefits from this combination are reducing impacts causing global warming and lower the cost of electricity or fuel on the farm.

Explanation:  This answer has been confirmed correct.

When of a certain molecular compound X are dissolved in of benzene , the freezing point of the solution is measured to be . Calculate the molar mass of X. If you need any additional information on benzene, use only what you find in the ALEKS Data resource. Also, be sure your answer has a unit symbol, and is rounded to the correct number of significant digits.

Answers

The question is incomplete. Here is the complete question.

When 2.10 g of a certain molecular compound X are dissolved in 65.0 g of benzene (C₆H₆), the freezing point of the solution is measured to be 3.5°C. Calculate the molar mass of X. If you need any additional information on benzene, use only what you find in the ALEKS Data resource. Also, be sure your answer has a unit symbol, and is rounded to 2 significant digits.

Answer: MM = 47.30 g/mol.

Explanation: There is a relationship between freezing point depression and molality. With this last one, is possible to calculate molar mass or molar weight of a compound.

Freezing Point Depression occurs when a solute is added to a solvent: the freezing point of the solvent decreases when a non-volatile solute is incremented.

Molality or molal concentration is a quantity of solute dissolved in a certain mass, in kg, of solvent. Its symbol is m and it's defined as

\(m=\frac{moles(solute)}{kg(solvent)}\)

Freezing point depression and molal are related as the following:

\(\Delta T_{f}=K_{f}.m\)

where

\(\Delta T_{f}\) is freezing point depression of solution

\(K_{f}\) is molal freezing point depression constant

m is molality

Now, to determine molar mass, first, find molality of the mixture:

\(\Delta T_{f}=K_{f}.m\)

\(m=\frac{\Delta T_{f}}{K_{f}}\)

For benzene, constant is 5.12°C/molal. Then

\(m=\frac{3.5}{5.12}\)

m = 0.683 molal

Second, knowing the relationship between molal and moles of solute, determine the last one:

\(m=\frac{moles(solute)}{kg(solvent)}\)

\(mol(solute)=m.kg(solvent)\)

mol(solute) = 0.683(0.065)

mol(solute) = 0.044 mol

The definition for Molar mass is the mass in grams of 1 mol of substance:

\(n(moles)=\frac{m(g)}{MM(g/mol)}\)

\(MM=\frac{m}{n}\)

In the mixture, there are 0.044 moles of X, so its molecular mass is

\(MM=\frac{2.1}{0.044}\)

MM = 47.30 g/mol

The molecular compound X has molecular mass of 47.30 g/mol.

What is the rate of reaction

Answers

Answer:

The reaction rate is defined as the amount of substance that is transformed into a given reaction per unit volume and time.

Calculate the pH of mixing 24 mL of 1M acetic acid with 76 mL of 1M sodium acetate. For the purpose of this calculation, assume the Ka of acetic acid is 1.8 X 10-5. You must include units to obtain full credit. You must show all your work to obtain any credit.

Answers

Answer:

pH = 5.24

Explanation:

Mixture of acetic acid with acetate ion is a buffer (Mixture of a weak acid with its conjugate base). The pH of a buffer can be determined using Henderson-Hasselbalch equation:

pH = pKa + log₁₀ [A⁻] / [HA]

Where pKa is -log Ka = 4.74; [A⁻] is the concentration of conjugate base (Acetate ion) and [HA] is molar concentration of the weak acid.

Concentration of the acetic acid in the 100mL≡0.1L (76mL + 24mL) solution is:

[HA] = 0.024L ₓ (1mol / L) / 0.1L = 0.24M

[A⁻] = 0.076L ₓ (1mol / L) / 0.1L = 0.76M

Replacing in H-H equation:

pH = 4.74 + log₁₀ [0.76M] / [0.24M]

pH = 5.24

PART A:
How many g of carbon dioxide are produced at the same time as 360 g of water vapor in the burning of ethane?

PART B:
How many grams of sodium carbonate, NA2CO3, reacting with excess barium sulphate, BASO4, would be required to produce 85 g of barium carbonate?

pls help!! i rlly don’t understand

Answers

A. Approximately 586.52 grams of carbon dioxide are produced at the same time as 360 grams of water vapor in the burning of ethane.

B. Approximately 45.79 grams of sodium carbonate (Na2CO3) would be required to produce 85 grams of barium carbonate (BaCO3) when reacting with excess barium sulfate (BaSO4).

PART A:

To determine the amount of carbon dioxide produced when burning ethane, we need to know the balanced chemical equation for the combustion reaction. The balanced equation for the combustion of ethane (C2H6) is as follows:

2 C2H6 + 7 O2 -> 4 CO2 + 6 H2O

From the balanced equation, we can see that 2 moles of ethane produce 4 moles of carbon dioxide. Therefore, the ratio is 2 moles of ethane to 4 moles of carbon dioxide.

Now, let's convert the given mass of water vapor (360 g) to moles. The molar mass of water (H2O) is approximately 18 g/mol, so:

360 g H2O * (1 mol H2O / 18 g H2O) = 20 mol H2O

According to the balanced equation, 6 moles of water (H2O) are produced for every 4 moles of carbon dioxide (CO2). Therefore, the ratio is 6 moles of water to 4 moles of carbon dioxide.

Since we know that 20 moles of water vapor were produced, we can use the ratio to determine the moles of carbon dioxide produced:

20 mol H2O * (4 mol CO2 / 6 mol H2O) = 13.33 mol CO2

To convert moles of carbon dioxide to grams, we need to multiply by the molar mass of carbon dioxide, which is approximately 44 g/mol:

13.33 mol CO2 * 44 g CO2/mol = 586.52 g CO2

PART B:

To determine the amount of sodium carbonate (Na2CO3) required to produce 85 g of barium carbonate (BaCO3), we need to consider the balanced chemical equation for the reaction between sodium carbonate and barium sulfate. The balanced equation is as follows:

Na2CO3 + BaSO4 -> BaCO3 + Na2SO4

From the balanced equation, we can see that 1 mole of sodium carbonate produces 1 mole of barium carbonate. Therefore, the ratio is 1 mole of sodium carbonate to 1 mole of barium carbonate.

Now, let's convert the given mass of barium carbonate (85 g) to moles. The molar mass of barium carbonate (BaCO3) is approximately 197 g/mol, so:

85 g BaCO3 * (1 mol BaCO3 / 197 g BaCO3) ≈ 0.431 mol BaCO3

According to the balanced equation, the ratio of sodium carbonate to barium carbonate is 1:1. Therefore, we would need approximately 0.431 moles of sodium carbonate.

To convert moles of sodium carbonate to grams, we need to multiply by the molar mass of sodium carbonate, which is approximately 106 g/mol:

0.431 mol Na2CO3 * 106 g Na2CO3/mol ≈ 45.79 g Na2CO3

For more question on carbon dioxide click on

https://brainly.com/question/25385913

#SPJ11

(biological process in an organism that produces methane)​

Answers

The biological process in an organism that produces methane is called methanogenesis.

What is methanogenesis?

Methanogenesis,  can as well be regarded as the biomethanation, which can be consiered as a form of anaerobic respirationwhereby there is a utilization of the carbon as the terminal electron acceptor, resulting in the production of methane.

It shoud be noted that Methanogenesis do follows the process of anaerobic respiration here there is a generation of methane as the final product of metabolism in theprocess the organic matter such as glucose is oxidized to CO2, however in hydrogenotrophic methanogenesis, H2 is oxidized to H+.

Learn more about methane at:

https://brainly.com/question/25649765

#SPJ1

complete qustion;

What is biological process in an organism that produces methane​

Identify the state(s) of matter that each property describes.

Answers

Answer:solid,liquid,gas,plasma

Explanation:

This question seems incomplete. I believe the full question is as followed:

Identify the state(s) of matter that each property describes.

1.) takes the shape of its container:

O gas

O liquid

O solid

2.) fills all available space:

O gas

O liquid

O solid

3.) maintains its shape:

O gas

O liquid

O solid

4.) can be poured:

O gas

O liquid

O solid

5.) is compressible:

O gas

O liquid

O solid

6.) has a fixed volume:

O gas

O liquid

O solid

The answers to the 1st are gas and liquid.

The answer to the 2nd is gas.

The answer to the 3rd is solid.

The answer to the 4th is liquid.

The answer to the 5th is gas.

The answers to the 6th are liquid and solid.

give an example of a primary income from the rest of the world​

Answers

Answer:

(1) Income Associated with the Production Process

(a) Compensation of employees

(b) Taxes and subsidies on products and

production .

(2) Property Income

(a) Investment income:

• Dividends and withdrawals from income of

quasi-corporations

• Reinvested earnings

• Interest

(b) Rent .

I hope this is correct :-)

Is NaCI a compound, atom, molecule, or element?​

Answers

Answer:

Compound.

Explanation:

NaCl, or sodium chloride, is an ionic compound that is formed from the element Sodium (Na) and Chlorine (Cl). It is commonly known as salt.

Something like table salt (NaCl) is a compound because it is made from more than one kind of element (sodium and chlorine), but it is not a molecule because the bond that holds NaCl together is an ionic bond. If you like, you can say that sodium chloride is an ionic compound.

A gas has a pressure of 2.70 atm at 50.0 °C. What is the pressure at standard temperature (0°C)?

Answers

Answer:

2.282 atm

P1V1/T1 = P2V2/T2

2.70atm / (50+273) = X/ 273

make x subject of formula

:. X = 2.28 atm

or 2.28 * 1.01 *10⁵ N/m²

you can support by rating brainly it's very much appreciated ✅✅

you find a mysterious white powder in your kitchen. it could be cream of tartar (pH=5), sugar (pH=7), baking soda (pH=8), or drain cleaner (pH=14). explain which pH indicator(s) you would use to determine the unknown substance.

Answers

The pH indicators that would be used to determine the unknown substance are :

Litmus Methyl orangePhenol Red

pH Indicators

The pH indicators that can be used to identify the mysterious white powder in the kitchen must be an acid-base indicator such as Litmus or other form of effective pH indicators like methyl orange and Phenol red.

The pH value of the substance as indicated by the acid-base indicators will help to determine what the mysterious white powder is based on the varying pH of the substances resembling the white powder.

Hence we can conclude that The pH indicators that would be used to determine the unknown substance are :Litmus , Methyl orange, Phenol Red.

Learn more about pH indicators : https://brainly.com/question/25031970

The basic unit of structure and function of living things is the .
nucleus
cell
tissue
membrane

Answers

Answer &

Explanation:

eukaryotic: Having complex cells in which the genetic material is contained within membrane-bound nuclei. cell: The basic unit of a living organism, consisting of a quantity of protoplasm surrounded by a cell membrane, which is able to synthesize proteins and replicate itself.

therefore it is cell

Patient added a 17-g measured dose of polyethylene glycol 3350 (MIRALAX) to 180 mL of water to use as a laxative. If the volume of the resultant mixture was 195.6 mL, calculate the apparent density of polyethylene glycol 3350 and the specific gravity of the mixture

Answers

The density of a Substance is the ratio of the mass of that substance to its volume.

The apparent density of ethylene glycol 3350 = mass/Volume

the volume of polyethylene glycol = volume mixture -the volume of water

= 195.6 - 180

  15.6 mL =

Apparent density of polyethylene glycol 3350 = 179/15.6 mL

1.099/m2

Now Density of water. 1.008/ml

Mass of water = Density X volume. 180g

=1.00 X 180 = 180g

Mass of solution = mass substance + mass of water

(17+180)g

=197g

Quantity mixture = mass of mixture/Volume

= 197g/195.6 mL

the specific gravity of mixture = density of mixture/density of water

1.01g/mL/1.00g/ml

The specific gravity of the mixture = 1.01.

Polyethylene glycol 3350 is used to treat occasional constipation. Polyethylene glycol 3350 belongs to a class of drugs called osmotic laxatives. It works by retaining water with the stool. This increases the frequency of bowel movements, softens the stool, and makes it easier to pass. This drug belongs to a class of drugs called osmotic laxatives. It works by increasing the amount of water in the intestinal tract. Polyethylene glycol 3350 is commercially available under the brand name MiraLax.

Learn more about Polyethylene glycol here:-https://brainly.com/question/14282655

#SPJ1

What
limitations might an atomic model have in properly illustrating the structure of an atom?

Answers

Atomic models can help us comprehend how atoms and their component particles behave, but they fall short of accurately capturing the intricacy of atomic structure.

What is the atomic model?

The models show electrons as separate objects that orbit the nucleus in predetermined ways.

The genuine behavior of electrons, which is better represented as a cloud or wave-like distribution surrounding the nucleus, cannot be oversimplified in this way. The models do not account for the effects of quantum mechanics, which govern the behavior of subatomic particles.

Learn more about atomic model:https://brainly.com/question/1596638

#SPJ1

The rate constant for this first-order reaction is 0.0459 s¹ at 300 °C.
A → products
If the initial mass of A is 15.49 g, calculate the mass of A remaining after 0.731 min.

Answers

The concept half life is used here to determine the mass of 'A' remaining after 0.731 min. The rate constant of a reaction is defined as the rate of the reaction when the molar concentration of each of the reactants is unity. The mass of A remaining is 5.163 g.

What is half life?

The half life period of a reaction is defined as the time in which the concentration of a reactant is reduced to half of its initial concentration. The expression for half life period of a first order reaction is:

\(t _{1} /_{2} = 0.693 / k\)

k - rate constant

k = 0.693 / 0.0459 = 15.098 s

Divide by 60 to convert half life into minutes.

15.098 s = 0.251 minutes

The number of half lives that have past is:

0.731 min / 0.251 min = 2.912 ≈ 3

Initial mass / number of half lives = 15.49 / 3 = 5.163 g

Thus the mass of A remaining after 0.731 min is 5.163 g.

To know more about half life, visit;

https://brainly.com/question/29388424

#SPJ9

Which metal does not form cations of differing charges?

Answers

Transition metals

Most transition metals differ from the metals of Groups 1, 2, and 13 in that they are capable of forming more than one cation with different ionic charges. As an example, iron commonly forms two different ions

The smallest quantity of energy that can be released is called an

A photon
B quantum
C electron
D atom

Answers

Answer:

Quantum is the correct answer.

Explanation:

PennFoster

Graphite and diamond are both solid forms of the element carbon. Which statement explains
the different properties of these two forms of carbon?
(1) Diamond has ionic bonding and graphite has metallic bonding.
(2) Diamond has metallic bonding and graphite has ionic bonding.
(3) Diamond has a different crystal structure from graphite.
(4) Diamond has carbon atoms with more valence electrons than graphite.

Answers

Answer: C diamond has a different crystal structure from graphite

Explanation:

The difference between the properties of  two forms of carbon is that

Diamond has a crystal structure  different from graphite.

Graphite and Diamond are known as allotropes of Carbon as they have the

same chemical properties but different crystal structure.

Diamonds form a 3 crystal lattice with no flexibility while Graphite are

bonded to sheets which makes them slide easily within one another and

gives it its soft texture.

Read more on https://brainly.com/question/23491824

Enough water was added to ten grams of sugar
to form two liters of solution. How many grams
of sugar are needed to make five liters of a
solution with the same concentration?

Answers

Answer:

25 grams (25g) of sugar

Explanation:

We can set this up algebraically:

10g = 2L

÷ 2    ÷ 2

5g = L

meaning that 5 g are needed to make 1 L

So, if we have 5 L, we will need (5 × 5) 25 grams to produce the same concentration.

Which factors were affected by the breakup of the supercontinent Pangaea? Check all that apply.

the shape of Earth’s orbit
global wind patterns
ocean currents
the tilt of Earth’s axis
global climates

Answers

Answer:

Global wind patterns

Ocean currents

Global climates

Explanation:

Edge2021 correct

The factors that were affected by the breakup of the supercontinent Pangaea include global wind patterns, ocean currents, and global climates.

What was Pangea?

The Pangea was a super-landmass that originally gave rise to all continents on the Earth planet.

According to the theory of continental drift, the Pangea break up millions of years ago to generate the continents.

This theory (continental drift) has been replaced by the tectonic plate model, but the idea of Pangea has still support in the scientific community.

In conclusion, the factors that were affected by the breakup of the supercontinent Pangaea include global wind patterns, ocean currents, and global climates.

Learn more about the Pangea here:

https://brainly.com/question/1557027

considering the temperature vs. time graph below, how does the temperature at the beginning of a change of state
ompare with the temperature at the end of the change?

O The temperature is always lower.
O The temperature is always the same.

O The temperature is usually lower.
The temperature is usually higher.

considering the temperature vs. time graph below, how does the temperature at the beginning of a change

Answers

Answer:

temp is same

Explanation:

The change of state portionsof the graph are at 2  and 4....and the temp is the same at the beginning and ends.

 change of state is a constant temp process

Helpppp!!!!! Please help me

Helpppp!!!!! Please help me

Answers

Answer:

10.)Weight and mass are different because only weight describes the force of gravity on an object.

11.)On a planet with more mass than earth your weight would be higher because greater gravitational pull.

On a planet with less mass than earth your weight would be less because of the lower gravitational pull.

Explanation:

Hydrogen gas (h2) and oxygen gas (o2) combine. Which change occurs that indicates a release of bond energy?(1 point).

Answers

The release of heat energy and the formation of water (H2O) indicate a release of bond energy.

What is heat energy?

Heat energy is the energy transferred between two objects or systems that have different temperatures. It is a form of energy that is created when molecules move faster, creating kinetic energy in the form of heat. Heat energy is transferred by conduction, convection, and radiation. Conduction is the transfer of heat energy through direct contact between two objects. Convection is the transfer of heat energy through the movement of a fluid, such as air or water. Radiation is the transfer of heat energy through electromagnetic waves. Heat energy is used in many applications, including cooking, heating, and power generation.

To learn more about heat energy
https://brainly.com/question/19666326
#SPJ1

How many carbon dioxide molecules react to form one glucose molecule during photosynthesis

Answers

Answer:

6 molecules

Explanation:

Only three elements are present in the products of photosynthesis: oxygen, carbon, and hydrogen. These same elements are present in the reactants of photosynthesis. Notice that it takes six molecules of water and six molecules of carbon dioxide to make one molecule of glucose

Answer:

6 molecules of carbone dioxide.

Which bone is located between the incus and the inner ear?

cochlea

stapes

incus

malleus

Answers

Answer: The answer is incus

Each of the following sets of quantum numbers is supposed to specify an orbital Choose the one set of quantum numbers that does NOT contain an error.
a) n=4, I=4, m/=1
b) n=5, I=3, m/=- 3
c) n=3, I=1, m/= -2
d) n=3, I= 2, m/=+3 ​

Answers

Answer:

C

Explanation:

The correct answer is C because the first quantum numbers containing and encompass in an orbital m contain a definite she'll of 2 and hence

Other Questions
ANSWER ASAP! EASY 80 POINTS! :DRead the paragraph and answer questions! :D"I believe that the Union can only be preserved by maintaining inviolate the Constitution of the United States as our fathers have made it. That Constitution guarantees to the people of every State the right to have slavery or not have iteach State being left free to decide for itself. The framers of that Constitutionwell understood that each one of the thirteen States had distinct and separate interests, and required distinct and separate local laws and local institutions."-Douglas__________________________________________________Answer the 4 questions:What is Douglass point of view regarding the Constitution?Which statement from the excerpt shows his point of view? What is an historical idea or event that supports Douglass point of view (concerning states rights)? Suppose that the market demand curve is given by Q = 100 - P and the market supply curve is given by Q = 3P. (a) If the government were to institute a price cap of $20 in this market, docs it lead to a deadweight loss? If so, what is the deadweight loss? (b) If the government were to institute a price cap of $30 in this market, does it lead to a deadweight loss? If so, what is the deadweight loss? You are selling boxes of candy for $3 a box for your school fundraiser. Write a function for the revenue, R, you have earned based on the number of boxes of candy, c, that you have sold. You must use function notation. In what way is Benny's dialogue about jazzmusic ("I think that's ... to the melody")similar to his dialogue about a love story (It'slike ... they're not")? Please help I don't understand! Kyle is wrapping a large container of tennis balls for a gift. The radius of each end of the cylindrical container is 3 inches. The height is 8.4 inches. In terms of , how much wrapping paper does he need to completely cover the container? Responses A 48.2 in2 48.2 in 2 B 68.4 in2 68.4 in 2 C 50.4 in2 50.4 in 2 D 59.4 in2 Liam is making8 sculptures. Eachsculpture needs 2/3 yard of wire for thebase and another piece of wire for thetop. He uses 10 2/3 yards of wire in all.How much wire is needed for the top ofeach sculpture? Adoption of ASC Topic 842 related to leases represents a Multiple ChoiceO.voluntary change in accounting principle. O mandatory change in accounting estimate. O voluntary change in accounting estimate.O mandatory change in accounting principle. cre 3-0 response of a plant to a stimulus Research plastic problems in the environment and explain how this new development in biology could help to resolve the issue hana is 4 year older than her brother. 2 years ago, her brothers age was of her age. how old will her brother be in 5 years? 6. The complex number \( (2+j 4) \) is one of the roots to the quadratic equation \( x^{2}+b x+c=0 \) a) Find the values for \( b \) and c, given they are real numbers. b) Determine the other (second) Looking at the diagram, Are these congruent by ASA or AAS write me a paragraph from real or imagined experiences or events with foreshadowing, point of view, figurative language, imagery, and symbolism, Photosynthesis is an endothermic reaction because it uses solar energy to build glucose molecules. Rubisco, anenzyme found in plants, is critical to this process.How does the presence of rubisco affect the change in free energy consumed or produced by the reactants andproducts?The presence of rubisco increases the free energy produced by the reactants, but the free energy consumed byglucose stays constantO The presence of rubisco increases the free energy consumed by glucose, but maintains the free energy producedby the initial reactantsO The presence of rubisco decreases the energy required for activation in the transition state and increases the freeenergy consumed by glucoseO The presence of rubisco decreases the energy required for activation in the transition state, but the change in thefree energy of the reactants and products remains constant HELP ME ON THIS PLEASE IS NO ONE SMART HERE OR WHAT??????????????????????????THE FLOOR OF A GAZEBO IS IN THE SHAPE OF A HEPTAGON FOUR OF THE INTERIOR ANGLES MEASURE 135 THE OTHER INTERIOR ANGLES HAVE EQUAL MEASURES FIND THEIR MEASURES SHOW YOUR WORK Vocabulary Words assured: said in a way to make someone feel certain convinced: caused someone to accept or believe debate: discussion between two people or groups withdifferent opinions on a topic functional: having a practical purpose predicted: saw in advanceFill in the BlanksComplete the passage below with the missing content words. 1. Malik knew Jen was nervous, so he _______________ herthat everything would be okay.2. Jen _______________ Malik that she was right by making agood point.3. They had a _______________ in school where each sideargued their points.4. Courtney guessed who would win and _______________ theresult of the game well.5. The statue on the wall was not just for looking at, it was_______________ too because you could hang your coat onit. Which of the following is closest in size (radius) to a neutron star?A) the EarthB) a cityC) a football stadium D) a basketballE) the SunAnswer: B imperialism made latin america economies largely dependent on the _____ of raw materials to european countries What provoked the nationwide protests in 2020? Why were they criticized, and how did activists who support the protests respond to these criticisms?