calculate the mass of precipitate in mg that you would expect me to form when 250mL of 0.0006M Na2SO4 is added to 500mL of 0.00024 M Pb(NO3)2 (use an ice table)

Answers

Answer 1

1. Identify the given :

• Concentration of Na2SO4 = 0.0006M

Volume = 250 mL

• Concentration of Pb(NO3)2 = 0.00024M

Volume = 500mL.

• We also Know that:

m ={ w(grams) * 1000ml}/ {Mol Mass (g/mol)* V ML}

• A balanced equation of the reaction is:

Na2SO4(aq) +Pb(No3)2(aq) → PbSO4(s) + 2NaNo3(aq)

2. Calculate number of moles for Na2SO4 and Pb(NO3)2

• number of moles Na2SO4 = 0.0006M* 250ml /1000ml

=1.5x10^-4 moles (Na2SO4)

• number of moles Pb(NO3)2=0.00024M * 500mL/1000mL

= 1.2x10^-4 moles ( Pb(NO3)2)

3. Calculate the number of moles of the precipitate ( PbSO4) ; by first determining the moles proportionality from a balanced equation.

Na2SO4(aq) +Pb(No3)2(aq) → PbSO4(s) + 2NaNo3(aq)

initial : 0.00015mol +0.00012 → ------- +---------

change :0.00012 + 0.00012 → 0.00012 + 0.00024 (* by 2)

equilibri : 0.00003 + ---------- →0.00012 + 0.00024

4. Finally the mass of the precipitate (PbSO4) that formed can be calculated by :

Mass = n * Molecular mass

= 0.00012mol * 303.26 g/mol

= 0.036g

• This means that 0.036g of PbSO4 will be formed .


Related Questions

In genetic engineering

Answers

Answer:

what is the question?

Explanation:

Answer:

A

Explanation:

i just did the question :)

In which of the following intermolecular interactions will polar molecules, such as water, commonly participate? (Mark all that apply A. Hydrogen bonding with non-polar molecules B. Hydrogen bonding with polar molecules C. Van der Waal interaction with polar molecules D. Electrostatic interaction with lonic compounds

Answers

B. Hydrogen bonding with polar molecules is the  inter molecular interactions will water participate commonly with polar molecules.

Why does water pull polar molecules toward it?

Polarity causes the water molecules to attract each other. Water is polar despite possessing a zero net charge because of the structure of its molecules. The molecule's hydrogen ends are positive, and its oxygen ends are negative. Water molecules are attracted to other polar molecules and to one another as a result.

What polar molecules are drawn to water?

The polarity of water enables hydrogen bonds to form whenever adjacent water molecules are drawn to each other by their opposing charges. Other polar molecules and ions, such as many biomolecules including sugars, nucleic acids, and certain amino acids, are also attracted to or attracted by water.

Learn more about polar molecule here:

brainly.com/question/15173422

#SPJ4

What is the IUPAC name of the following substance?

What is the IUPAC name of the following substance?

Answers

The International Union of Pure and Applied Chemistry (IUPAC) provides a standard system for naming organic compounds.

It is essential to learn this nomenclature system to communicate correctly about the chemical structures of compounds and how they relate to each other. Here is the IUPAC name of the following substance.Below is the structure of the given compound: In the given compound, there are four carbon atoms that are connected with single bonds. Carbon atoms are also attached to hydrogen atoms. Since it has four carbons in the main chain, the root name will be "but-". The functional group present in the molecule is the carboxylic acid group (-COOH), which gives the suffix "-oic acid." Therefore, the IUPAC name of the given substance is Butanoic acid.Thus, the IUPAC name of the given compound is Butanoic acid. It is essential to know the IUPAC naming of organic compounds to communicate correctly about the chemical structures of the compounds.

for such more questions on Chemistry

https://brainly.com/question/29886197

#SPJ8

Determine the mass of H2O produced if 1.75g of AL(CH)3 reacts with 2.00g of H2SO4 if H2SO4 is a limitating reagent

Answers

Answer: We must first compute the quantity of H2O that can result from the reaction of AL(CH)3 and H2SO4 in order to determine the mass of H2O produced.

Explanation:

Let's begin by formulating the reaction's balanced chemical equation:

Al2(SO4)3 + 6 H2O + 2 CH4 = 2 AL(CH)3 + 3 H2SO4

According to the equation, 2 moles of AL(CH)3 and 3 moles of H2SO4 combine to form 6 moles of H2O.

1.75 g of AL(CH)3 is equal to: 1.75 g / 78.0 g/mol = 0.0224 mol of AL(CH)3 as 1 mole of AL(CH)3 has a molar mass of roughly 78.0 g/mol.

2.00 g of H2SO4 is equal to: 2.00 g / 98.1 g/mol = 0.0204 mol of H2SO4 as 1 mole of H2SO4 has a molar mass of roughly 98.1 g/mol.

In order to calculate the amount of H2O produced, we must now identify the limiting reagent.

We contrast the moles of AL(CH)3 and H2SO4 in use. AL(CH)3 and H2SO4 have a stoichiometric ratio of 2 to 3. As a result, 3 moles of H2SO4 are required for every 2 moles of AL(CH).

The equation states that 2 moles of AL(CH)3 will yield 6 moles of water. Therefore, we can calculate the moles of H2O created for 0.0224 mol of AL(CH)3 as follows: 0.0224 mol AL(CH)3 (6 mol H2O / 2 mol AL(CH)3) = 0.0672 mol H2O

Finally, we may use the molar mass of H2O to convert its moles to grams. H2O has a molar mass of about 18.0 g/mol:

18.0 g/mol x 0.0672 mol H2O = 1.21 g H2O

As a result, the mass of H2O generated is roughly 1.21 grams if H2SO4 is the limiting reagent.

Use the following steps to balance the redox reaction below:
Na + Cu2+ → Na+ + Cu

a. Write the oxidation and reduction half-reactions. Make sure each half-reaction is balanced for number of
atoms and charge. (3 points)

b. Multiply each half-reaction by the correct number, in order to balance charges for the two half-reactions. (1
point)

c. Add the equations and simplify to get a balanced equation (1 point)

Answers

Answer:

(a)

Oxidation

Na -> Na+  +  e

Reduction

Cu2+   + 2e -> Cu

(b) Just multiply oxidation half-reaction by 2 and reduction half-reaction by 1.

2Na -> 2Na+  + 2e

Cu2+  + 2e -> Cu

(c) 2Na + Cu2+ -> 2Na+  +  Cu (2e cancels each other)

Please be reminded, this answer may not be correct.

can anyone help?? The amount of available energy decreases with each step up the energy pyramid. How is this related to the fact that there are so many more producers than consumers on Earth?

please explain!

thanks in advance!

Answers

Answer:

Most of the food energy that enters a trophic level is "lost" as heat when it is used by organisms to power the normal activities of life. Thus, the higher the trophic level on the pyramid, the lower the amount of available energy.

Explanation:

Based on this information, predict the surface tension ranking of the following substances. Order the following from weakest surface tension to strongest. This is a prediction, will will test it later.

Methanol (CH_3OH )

Ethanol (C_2H_5OH)

Butanol (C_4H_9OH)

Pentane (C_5H_{12} )

Pentanol (C_5H_{11}OH )

Hexane (C_6H_{14} )

Hexanol (C_6H_{13}OH)

Octane (C_8H_{18})

Octanol (C_8H_{17}OH )

Decane (C_{10}H_{22} )

Decanol (C_{10}H_{21}OH)

Answers

The order of the surface tension is; Methanol  > Ethanol  > Butanol > Pentanol > Hexanol  > Octanol  > Decanol  > Pentane  > Hexane  > Octane > Decane

What is the surface tension?

We know that the surface tension would have to do with the force that is acting on the surface of a fluid. The surface tension would make the surface of the fluid to act like a stretched elastic spring.

In this case, we know that the magnitude of the intermolecular force that is acting on the object is quite going to determine whether or not the surface tension of the object would be high or low.

Learn more about surface tension:https://brainly.com/question/28146435

#SPJ1

Identify the correct chemical formula. Select one: O a. K₂C₂H₂O2 0 b. K2(OH)2 O c. KCIO3 O d. 504 MATU 20 A www. wowow​

Answers

Answer:

B.K2(OH)2 i think that is the answer

The deltaG for the reaction below implies that the decomposition of H2O2 is thermodynamically favorable. However, H2O2 is typically stable for up to a year when stored in a dark bottle at 298K. The best explanation for this observation is the decomposition reaction
2H2O2 (aq) ⇒2H2O (l) +O2 (g) ΔG°= -234 KJ/molrxn
A. is only thermodynamically favored in the presence of a catalyst
B. occurs with an increase in entropy because O2 is a product
C. is reversible and H2O2 is produced almost as fast as it decomposes
D. has a slow rate at 298 K because the activation energy is relatively high

Answers

the stability of hydrogen peroxide under normal storage conditions despite its negative ΔG° for decomposition can be attributed to the relatively high activation energy required for the reaction to occur.

How to solve the question?

The fact that the ΔG° for the decomposition of hydrogen peroxide (H2O2) is negative (-234 KJ/molrxn) indicates that the reaction is thermodynamically favorable, meaning that the products (water and oxygen gas) are more stable than the reactant (hydrogen peroxide). However, as mentioned in the question, hydrogen peroxide is typically stable for up to a year when stored in a dark bottle at 298K, which seems to contradict the thermodynamic prediction.

The best explanation for this observation is option D: the decomposition of hydrogen peroxide has a slow rate at 298 K because the activation energy is relatively high. Even though the reaction is thermodynamically favorable, it may not occur spontaneously at room temperature because the activation energy required to break the O-O bond in hydrogen peroxide is relatively high. This means that a significant amount of energy is needed to initiate the reaction and form the products, and at room temperature, the rate of the reaction is too slow for any significant decomposition to occur over a period of one year.

Additionally, the reaction is not reversible (option C) because the entropy of the system decreases due to the formation of liquid water from hydrogen peroxide and the release of oxygen gas. Option A is also incorrect because the decomposition of hydrogen peroxide does not require a catalyst to occur, although a catalyst can increase the rate of the reaction by lowering the activation energy.

In summary, the stability of hydrogen peroxide under normal storage conditions despite its negative ΔG° for decomposition can be attributed to the relatively high activation energy required for the reaction to occur.

To know more about thermodynamics visit :-

https://brainly.com/question/419265

#SPJ1

Given 0.08 of KMnO4, calculate the number of molecules

Answers

The number of molecules in the permanganate is 4.8 * 10^22 molecules

What is the number of the molecules?

We know that if we are to obtain the number of molecules form the number of the moles of the substances then as a matter of necessity we would have to turn to the Avogadro's law and that is what we are going to do here.

We have that;

If 1 mole contains about 6.02 * 10^23 molecules

0.08 moles would contain 0.08 * 6.02 * 10^23/ 1

= 4.8 * 10^22 molecules

Hence, we have about 4.8 * 10^22 molecules in the permanganate

Learn more about molecules:https://brainly.com/question/19922822

#SPJ1

Carbon tetrachloride is a solvent used for degreasing electronic parts. If 24.0 mL of carbon tetrachloride has a mass of 38.10 g , what is the density of the liquid

Answers

Taking into account the definition of density, the density of carbon tetrachloride is 1.5875 \(\frac{g}{mL}\).

Definition of density

Density is defined as the property that matter, whether solid, liquid or gas, has to compress into a given space.

In other words, density is a quantity that allows us to measure the amount of mass in a certain volume of a substance.

Then, the expression for the calculation of density is the quotient between the mass of a body and the volume it occupies:

\(density=\frac{mass}{volume}\)

From this expression it can be deduced that density is inversely proportional to volume: the smaller the volume occupied by a given mass, the higher the density.

Density of carbon tetrachloride

In this case, you know that:

Mass= 38.10 gVolume= 24 mL

Replacing in the definition of density:

\(density=\frac{38.10 g}{24 mL}\)

Solving:

density= 1.5875 \(\frac{g}{mL}\)

In summary, the density of carbon tetrachloride is 1.5875 \(\frac{g}{mL}\).

Learn more about density:

brainly.com/question/952755?referrer=searchResults

brainly.com/question/1462554?referrer=searchResults

What part of the underside of a gecko's feet
allows it to stick to surfaces?
O cilia
O heat
O pillars
O webbing

Answers

Answer:

it was pillars

Explanation:

i guessed and it was right LOL

Answer:

O pillars

Explanation:

Right on EDGE 2021

describe what xeriscaping is and what is involved in a successful xeriscaping project

Answers

Xeriscaping is a landscaping approach that focuses on conserving water by using drought-tolerant plants and efficient irrigation techniques. The goal is to create a visually appealing and sustainable garden while minimizing water usage.

Successful xeriscaping projects involve several key elements. Firstly, careful plant selection is crucial, opting for species that can thrive in arid conditions without excessive watering. Mulching is used to reduce evaporation and retain soil moisture.

Proper soil preparation, such as improving drainage and adding organic matter, promotes healthier plant growth. Efficient irrigation systems, like drip irrigation or soaker hoses, deliver water directly to plant roots, minimizing wastage.

Additionally, controlling erosion through the use of retaining walls or terracing is important. Lastly, regular maintenance, including appropriate pruning and weed control, ensures the longevity and vitality of the xeriscape garden. Overall, a successful xeriscaping project harmonizes sustainable practices with a beautiful outdoor environment.

For more such questions on Xeriscaping

https://brainly.com/question/12960529

#SPJ11

If the molar solubility of PbCl2 is 1.62×10-2, what is the solubility product constant Ksp.

Answers

5.2*\(10^{-4}\) is the solubility product constant Ksp.

What makes KSP a solubility product?

The explanation is that it stays at the same concentration throughout the process. Ksp, then, stands for the greatest degree to which a solid can dissolve in a solution. Ksp, also known as the solubility product constant, is the result of the ion concentrations in a saturated solution of an ionic substance.

The equilibrium constant known as the solubility product constant, or Ksp, measures how much an ionic substance dissolves in water. We can compare the Ksp values of compounds to assess their respective solubilities if they dissolve to create the same number of ions.

Pb\(Cl_{2}\)(s)  ↔ \(Pb_{2}\)+(aq)   +  2Cl-(aq)

Ksp  = [Pb2+] [Cl-]^2

Ksp  = S* 2S

S is 1.62×\(10^{-2}\)

Ksp  = 1.62×\(10^{-2}\)* 2 * 1.62×\(10^{-2}\)

Ksp  = 5.2*\(10^{-4}\)

To learn more about solubility product constant use:

brainly.com/question/1419865

#SPJ1

5.2*\(10^{-4}\)  is the solubility product constant Ksp.

What makes KSP a solubility product?

The explanation is that it stays at the same concentration throughout the process. Ksp, then, stands for the greatest degree to which a solid can dissolve in a solution. Ksp, also known as the solubility product constant, is the result of the ion concentrations in a saturated solution of an ionic substance.

The equilibrium constant known as the solubility product constant, or Ksp, measures how much an ionic substance dissolves in water. We can compare the Ksp values of compounds to assess their respective solubilities if they dissolve to create the same number of ions.

Pb(s)  ↔ +(aq)   +  2Cl-(aq)

Ksp  = [Pb2+] \([Cl-]^{2}\)

Ksp  = S* 2S

S is 1.62×\(10^{-2\)

Ksp  = 1.62× \(10^{-2\)*2 * 1.62×\(10^{-2\)

Ksp  = 5.2* \(10^{-4}\)

To learn more about solubility product constant use:

brainly.com/question/1419865

#SPJ1

Ava's best friend has an indoor cat. Ava notices that she sneezes every time that she visits her friend. Ava suspects
that she is allergic to cats but is unsure. What is the best thing for Ava to do next?
O Stop visiting her friend.
O Conclude that she is allergic to cats, and avoid them completely
O Test her suspicion by checking to see whether other cats also make her sneeze,
O Assume that the sneezing has another cause, and reject her original idea.

Answers

Answer:

test her suspicion by checking to see whether other cats also make her sneeze

(6
32. Calcium carbide, CaC2, is an important preliminary chemical for industries producing
synthetic fabrics and plastics. CaC2 may be produced by heating calcium oxide with
CaO + C CaC2+CO
What is the mass of CaC2 which can be produced from the reaction of excess calcium oxi
10.2 g of carbon? (Hint: Balance the equation first)​

Answers

Answer:

18.1 g

Explanation:

Step 1: Write the balanced equation

CaO + 3 C ⇒ CaC₂ + CO

Step 2: Calculate the moles corresponding to 10.2 g of C

The molar mass of C is 12.01 g/mol.

10.2 g × 1 mol/12.01 g = 0.849 mol

Step 3: Calculate the moles of CaC₂ produced from 0.849 moles of C

The molar ratio of C to CaC₂ is 3:1. The moles of CaC₂ produced are 1/3 × 0.849 mol = 0.283 mol

Step 4: Calculate the mass corresponding to 0.283 moles of CaC₂

The molar mass of CaC₂ is 64.10 g/mol.

0.283 mol × 64.10 g/mol = 18.1 g

ecuación iónica de
Ba(CIO4)2 y K2SO4.

Answers

i don't remember yeah yosj



What is the molarity of a solution containing 8.9 g of NaOH in 550. mL of NaOH solution?
Express your answer to two significant figures and include the appropriate unit


Answers

Answer:

0.4 M

Explanation:

Molarity is defined as moles of solute, which in your case is sodium hydroxide,  

NaOH

, divided by liters of solution.

molarity

=

moles of solute

liters of solution

Notice that the problem provides you with the volume of the solution, but that the volume is expressed in milliliters,  

mL

.

Moreover, you don't have the number of moles of sodium hydroxide, you just have the mass in grams. So, your strategy here will be to

determine how many moles of sodium hydroxide you have in that many grams

convert the volume of the solution from milliliters to liters

So, to get the number of moles of solute, use sodium hydroxide's molar mass, which tells you what the mass of one mole of sodium hydroxide is.

7

g

1 mole NaOH

40.0

g

=

0.175 moles NaOH

The volume of the solution in liters will be

500

mL

1 L

1000

mL

=

0.5 L

Therefore, the molarity of the solution will be

c

=

n

V

c

=

0.175 moles

0.5 L

=

0.35 M

Rounded to one sig fig, the answer will be

c

=

0.4 M

Explanation:

Question
What is the molarity of a 400 mL solution containing 0.60 moles of NaCl?

Answers

Answer:

0.24 M

Explanation:

Molarity = Moles solute / Liters solution

Step 1: Identify variables

400 mL = Liters solution

0.60 moles = Moles solute

Step 2: Identify conversions

1 L = 1000 mL

Step 3: Convert mL to L

400mL(1 L/1000mL) = 0.4 L

Step 4: Find molarity

M = (0.4 L)(0.60 mol) = 0.24 M

During which two processes does a substance absorb energy?

Answers

Melting and vaporization

Answer:

melting and vaporization

Explanation:

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

công thức phân tử của glucozo

Answers

C₆H₁₂O₆ is the molecular formula of gulcozo.

Writing Sample: At what pressure would 0.150 mole of nitrogen gas at -23.0 o C occupy 8.90 L?

Answers

Answer:

\(P=0.346atm\)  

Explanation:

Hello!

In this case, since the ideal gas equation is:

\(PV=nRT\)

And we are asked to compute the pressure, we obtain:

\(P=\frac{nRT}{V}\)

Thus, since the temperature must be expressed in Kelvins, we plug in to obtain:

\(P=\frac{0.150mol*0.08206\frac{atm*L}{mol*K}*250.15K}{8.90L}\\\\P=0.346atm\)

Best regards!

21
Select the correct answer.
How many valence electrons does oxygen have?
OA 2
OB. 4
О с. 6
OD. 8
OE. 10

Answers

Answer: 6 valence electrons

Explanation: the atomic number for oxygen is 8. the first shell takes 2, the second 8. so, the outer shell is the last shell, which takes 6 from oxygen because oxygen has only 8.  6 is the number for outer or valence electron for oxygen

Identify the item that does not have kinetic energy.
A. A worm crawling
B. A falling leaf
C. An airplane flying
D. A butterfly sitting on a twig

Answers

Answer:

D

Explanation:

there is no other answer choice that does not move. This is a fool-proof question because all the other answer choices contain movement except the butterfly resting

The model here shows a process by which a hydra, an aquatic organism, produces a new offspring that is a clone of the original organism. If a student is explaining how the organism creates its own clone, which process would be included in the explanation? A) mitosis B) meiosis C) fertilization D) binary fission

The model here shows a process by which a hydra, an aquatic organism, produces a new offspring that is

Answers

The answer is
D.) binary fission

The reproduction of hydra is through budding process from its body. This process of regeneration is called mitosis.Mitosis is a type of cell division process. Thus option A is correct.

What is mitosis?

Mitosis is a cell division process in which one cell produces two identical daughter cells. The term mitosis means the duplication of the genetic material chromosomes with the exact gene information.

Different stages in mitosis together is called mitotic phases. Hydra is an invertebrate freshwater organism. Hydra has a translucent tubular body which can be elongated and contracted.

Hydra is classified to the phylum hydrozoa. It have a regeneratable head. The reproduction of hydra is through budding. A small bud first projects from its tubular body which then develops and emerges out by cell division.

The divided daughter hydra will grow as a matured hydra. This overall budding process takes places through mitosis. Hence, option A is correct.

To find more about mitosis, refer the link below:

https://brainly.com/question/26678449

#SPJ5

Please THANKS FOR WHO EVER WILL ANSWER THESE 14

Please THANKS FOR WHO EVER WILL ANSWER THESE 14

Answers

The above is about the movement of lithospheric plates. See explanation and attached image for details.

What are the process of lithospheric plates movement?

The movement of lithospheric plates is driven by convection currents in the Earth's mantle, which are caused by heat generated from the Earth's core. These currents cause the lithospheric plates to move, and the motion can result in a variety of geological phenomena, including earthquakes, volcanic activity, and the formation of mountain ranges and oceanic trenches.

There are three main types of plate boundaries, and each one results in a different type of movement of lithospheric plates:

Divergent Boundaries: At divergent boundaries, lithospheric plates move away from each other. This movement is caused by the upwelling of hot material from the mantle, which pushes the plates apart. As the plates move away from each other, magma rises up to fill the gap between them, creating new crust. Divergent boundaries are where new oceanic crust is formed.

Convergent Boundaries: At convergent boundaries, lithospheric plates move towards each other. There are three types of convergent boundaries: oceanic-oceanic, oceanic-continental, and continental-continental. At oceanic-oceanic and oceanic-continental convergent boundaries, one plate is forced beneath the other, creating a subduction zone. This movement is caused by the sinking of a denser plate beneath a less dense plate. As the denser plate sinks, it melts and can trigger volcanic activity. At continental-continental convergent boundaries, the plates are too buoyant to subduct, so they instead buckle and push up, forming mountain ranges.

Transform Boundaries: At transform boundaries, lithospheric plates move past each other. This movement is caused by the lateral movement of the convection currents in the mantle. Transform boundaries can create large faults, which can lead to earthquakes.

Overall, the movement of lithospheric plates is a complex and dynamic process, driven by the movement of material within the Earth's mantle.

Learn about movement of lithospheric plates here brainly.com/question/2722711

#SPJ1

Please THANKS FOR WHO EVER WILL ANSWER THESE 14

Make sure your answer includes TWO decimal places. this is an impossible formula. If it were real, determine the molar mass of:

KBr•7H2O

Answers

Molar mass is the summation of the atomic mass of the individual atoms. The molar mass of KBr•7H₂O is 244.99.

What is atomic mass?

Atomic mass or weight is the number of protons and neutrons in the atom of the individual element. The atomic masses are used to calculate the molar mass of the compound.

The compound KBr•7H₂O: 1 K + 1 Br + 14 H + 7O

Inserting the atomic masses of the individual atoms as:

= 1 (39.09) + 1 (79.90) + 14 (1.00) + 7(16)

= 39.09 + 79.90 + 14.00 + 112

= 244.99

Therefore, 244.99 is the molar mass of KBr•7H₂O.

Learn more about molar mass here:

https://brainly.com/question/13461285

#SPJ1

2. 20.0 mL of a 0.75 M solution
of potassium permanganate,
KMnO solution is used to
make a 250.00 mL solution.
What is the concentration of
the new solution?

Answers

The concentration of the new potassium permanganate, KMnO solution is 0.06 M.

To find the concentration of the new solution, we can use the formula,

C₁V₁ = C₂V₂,

C₁ = 0.75,

V₁ = 20.0 mL,

V₂ = 250.0mL

C₂ is what we have to find. Plugging in the values we know, we get,

0.75 M x 20.0 mL = C₂ x 250.00 mL

Solving for C₂, we get the final concentration of the potassium permanganate.

C₂ = (0.75 M x 20.0 mL) / 250.00 mL

C₂ = 0.06 M

Therefore, the concentration of the solution has changed to 0.06 M from 0.75M.

To know more about concentration, visit,

https://brainly.com/question/17206790

#SPJ1

With Regular/Diffuse Reflection, the __________ of the object will determine the SHARPNESS of reflection

Answers

Answer:

shape and texture.... .......

With regular / diffuse reflection, the angle and color of the object will determine the sharpness of reflection.

What is reflection ?

When two distinct media come together at an interface, a wave front might reverse direction so that it returns to the first medium, which is known as reflection. The reflection of light, sound, and water waves are typical examples.

Reflection offers the brain a chance to stop in the middle of the chaos, organize observations and experiences, take into account many interpretations, and come up with meaning. Learning from this meaning can then guide future behaviors and mindsets.

An image is a representation of an item created by light that has been reflected or refracted. A surface must be exceptionally smooth in order for reflection to provide an image that is both clear and crisp. An picture may not develop if the surface is even slightly uneven or lumpy.

Thus, with regular / diffuse reflection, the angle and color of the object will determine the sharpness of reflection.

To learn more about reflection follow the link;

https://brainly.com/question/15487308

#SPJ2

Other Questions
How was Greek slavery different from slavery in the U.S. plantations before the Civil War? How was it the same? which of the following terms identifies the process of reviewing log files for suspicious activity and threshold compliance? Factorise fully the expression 7t + 2t - 9 a door is still perceived as a rectangle even after we vew it from different agnles if i should only give a few pulls at the parish bell-rope, as for a fire, that is, without setting the bell, there is hardly a man on his farm in the outskirts of concord, notwithstanding that press of engagements which was his excuse so many times this morning, nor a boy, nor a woman, i might almost say, but would forsake all and follow that sound, not mainly to save property from the flames, but, if we will confess the truth, much more to see it burn, since burn it must, and we, be it known, did not set it on fire--or to see it put out, and have a hand in it, if that is done as handsomely; yes, even if it were the parish church itself. The height, h, in metres, of a weather balloon above the ground after seconds can be modelled by the function h(t) = -2t + 3r + 149t + 410, for 0 t 10. When is the balloon's height 980 m above the ground? Use intervals/factors method to justify your answer. Select the correct answer.Which scenario is an example of plagiarism?OA. Erin is writing an essay about Emily Dickinson's poetry. In one of her body paragraphs, she uses the ideas from a poetryanalysis she found in a literary Journal but puts them in her own words.OB. Steven is preparing a presentation on emperor penguins. He finds a book on penguin behavior and quotes It In his slideshow,with the author's name in parentheses.OC. Josie is making a poster to present her argument against school uniforms. She finds a study that describes the negative effectsof school uniforms and paraphrases it, including the author's name in parentheses at the end of her sentence.OD Paul is composing a summary of his history research project. He identifies five good sources to use in his summary and liststhem all in his Works Cited page What was a creeping barrage? What were its risks to the attacking soldiers? You are enclosing a circular flower garden with a fence that costs 2.99 per foot. The radius of the garden is 7 feet. How much will it cost to buy the fence? how many diagnosis codes may be reported on each cms-1500 claim? what is the measure of which condition is essential for natural selection Defects in which of the following cellular processes may contribute to an increased incidence of cancer?A. nucleotide-excision repairB. mismatch repairC. base-excision repairD. A, B, and CE. none of the above choose the correct resonance structures for the following compound and use the resonance structures to determine if the substituent has an electron-donating or electron-withdrawing resonance effect. dalton had the first idea of the atom true or false 3- 319 +525(Simplify your answer.) At the moment there is nothing on the scales. A packet of cookies is weighed and the reading on the scales is 300 g. What is the true weight of the packet of cookies?. An open space on the streetsnapped him out of his thoughtsand back to the wheel.He sped up a littleand moved close to the curb,pulling ahead of the space.Just as he shifted his carin reverse, a flashswooped in from behindand took from Squarewhat the morning had offered.Out hopped Trianglefrom his truck, whistling, his pointgleaming in the sun. Square fumedand each of his cornersturned pepper red.What do geometric-shape characters best help the reader visualize?a setting that is mathematicala setting filled with geometrythe pure emotion of the charactersthe attitudes of the characters In paragraph 30 , what does the word laboriously mean The length of the rectangle is one units more than the width. The area of the rectangle is 56 units. What is the width, and units, of the rectangle?