Calculate the buffer ratio (base/acid) required for a buffer of pH = 5.68 that is prepared by mixing sodium hydrogen oxalate and sodium oxalate. A table of pKa values can be found here. Report your answer to 2 significant figures in scientific notation. Calculate the pH (to two decimal places) of the buffer solution after the addition of 7.77 g of sodium hydrogen carbonate (NaHOCOO) to the buffer solution above. Assume 5% approximation is valid and that the volume of solution does not change.

Answers

Answer 1

122.5 grams of oxalic add dihydrate (MW = 126.07 g/mole) and disodium oxalate (MW = 133.99 g/mole) were required to prepare this buffer if the total oxalate concentration is 0.115 M.

Weak acids are defined as acids that don't completely dissociate in solution. It can be explained as any acid that is not a strong acid. The strength of a weak acid depends on how much it gets dissociates and the more it dissociates, the stronger the acid. The mass of the weak acid in a solution of a certain pH can be determined by calculating the original concentration of the acid after calculating the concentration of the hydrogen ions with the help of the pH value of the solution.

The Concentration of oxalate ion is  0.115 M.

pKa1 is 1.250.

pKa2 is 4.266.

pH is 5.193.

Molarity = (mass / molar mass) / 1 / volume in liter

The molar mass is 126.07g/mole.

Mass = Molarity × molar mass × Volume in liter

Mass=0.972 M × 126.07 g/mole × 1.00 L

        = 122.5 gram

To learn more about concentration

https://brainly.com/question/17206790

#SPJ4

The complete question is,

A buffer prepared by dissolving oxalic add dihydrate (H2C2O4⋅2H2O) and disodium oxalate (Na2C2O4) in 1.00 L of water has a pH of 5.193. How many grams of oxalic add dihydrate (MW = 126.07 g/mole) and disodium oxalate (MW = 133.99 g/mole) were required to prepare this buffer if the total oxalate concentration is 0.115 M? Oxalic acid has pKa values of 1.250 (pKa1) and 4.266 (pKa2).


Related Questions

4. How is the coordination number determined?

Answers

A coordination number can be determined by the usage of an atom towards a molecule from seeing how many numbers of atoms would have to be combined together in an atom.

Write down the formulas of the following compounds: magnesium chloride, alumina, chlorine (VII) oxide, sodium sulfide, calcium oxide.

Answers

Answer:

- Magnesium chloride: MgCl₂.

- Alumina: Al₂O₃.

- Chlorine (VII) oxide: Cl₂O₇.

- Sodium sulfide: Na₂S.

- Calcium oxide: CaO.

Explanation:

Hello!

In this case, according to the naming rules for the given compounds, which state that binary salts have a metal and a nonmetal and oxides contain oxygen, we have:

- Magnesium chloride: MgCl₂.

- Alumina: Al₂O₃.

- Chlorine (VII) oxide: Cl₂O₇.

- Sodium sulfide: Na₂S.

- Calcium oxide: CaO.

Best regards!

Consider the following scenario
A drought hits the habitat of a semi-aquatic bird population. All ponds dry up, and fish populations decline. There are two groups of birds in the population that differ in leg length and diet. Long-legged birds eat fish, while short-legged birds eat insects. The drought has little effect on insect populations
What is the main selective pressure in this scenario?

Oleg length
Odrought
Ofish population
Oinsect population

Answers

Answer: b

Explanation: jk

Describe the model rigid rotor, both mathematically and its meaning.

Answers

Answer: An arbitrary rigid rotor is a 3-dimensional rigid object, such as a top

Explanation: The rigid rotor is a mechanical model of rotating systems. ... A special rigid rotor is a linear rotor requiring only two angles to describe, for example, a diatomic molecule. More general molecules are 3-dimensional, such as water (asymmetric rotor), ammonia (symmetric rotor), or methane (spherical rotor).

_______ capacity is a term used to describe the ability of a solution to prevent large changes in pH with the addition of a base or acid.
a) Heat
b) Buffering
c) Vaporization
d) Cohesive
e) Freezing

Answers

Buffering capacity measures a solution's capability to withstand pH fluctuations by either absorbing as well as desorbing H+ as well as OH- ions.

Aqueous buffer solutions were made up of a weak acid as well as its conjugate base or even a weak base as well as its conjugate acid. The capability of buffer solutions to keep a fairly constant pH value in reaction to the addition of a tiny amount of acid or base is an important attribute.

A buffer would be a solution that avoids pH changes when a minuscule portion of strong acid as well as strong base is added. Technical definition (How does one come up with one?): A buffer was made up of a weak acid and its conjugate base.

Thus, the correct answer will be option (b).

To know more about solution's

https://brainly.com/question/1616939

#SPJ4

15
Density of Metals at Room Temperature
Density
Name of Metal
(g/mL)
Nickel
8.90
Copper
8.96
Palladium
12.02
smi Wetes
Silver
10.5
Platinum
21.4
Gold
19.32
Refer to the Density of Metals at Room Temperature table above. How is the density of a
metal related to its location on the Periodic Table?
A
As the metal's atomic number increases, the density increases.
B
As the metal's atomic mass increases, the density increases.
С
As the metal's number of valence electrons increases, the density increases.
D
As the metal's number of electron energy levels increases, the density increases.

Answers

Answer:

platinum = 21.4 I think it's letter D to be related to it.

A 25.0 g sample of warm water at 40.0⁰C was added to a 25.0 g sample of water in a Styrofoam coffee cup calorimeter initially at 20.0⁰C. The final temperature of the mixed water and calorimeter was 29.5⁰C. Calculate the heat capacity of the coffee cup calorimeter. The specific heat of water is 4.184 J/g∙⁰C.

a.
0.189 J/⁰C

b.
27.3 J/⁰C

c.
11.0 J/⁰C

d.
116 J/⁰C

Answers

Answer:

2024.70 J

Explanation:

The heat capacity of the coffee cup calorimeter can be calculated using the following formula:

q_calorimeter = q_water + q_water_final

where q_calorimeter is the heat absorbed by the coffee cup calorimeter, q_water is the heat lost by the warm water, and q_water_final is the heat gained by the cold water.

First, calculate q_water:

q_water = m_water * c_water * ΔT

where m_water = 25.0 g is the mass of the warm water, c_water = 4.184 J/g°C is the specific heat of water, and ΔT = (40.0°C - 29.5°C) = 10.5°C is the change in temperature.

q_water = 25.0 g * 4.184 J/g°C * 10.5°C = 1057.35 J

Next, calculate q_water_final:

q_water_final = m_water * c_water * ΔT

where m_water = 25.0 g is the mass of the cold water, c_water = 4.184 J/g°C is the specific heat of water, and ΔT = (29.5°C - 20.0°C) = 9.5°C is the change in temperature.

q_water_final = 25.0 g * 4.184 J/g°C * 9.5°C = 967.35 J

Finally, calculate the heat capacity of the coffee cup calorimeter:

q_calorimeter = q_water + q_water_final = 1057.35 J + 967.35 J = 2024.70 J

So the heat capacity of the coffee cup calorimeter is 2024.70 J.

A 25.0 g sample of warm water at 40.0⁰C was added to a 25.0 g sample of water in a Styrofoam coffee cup calorimeter initially at 20.0⁰C. 2024.70 J is the heat capacity of the coffee cup calorimeter.

What is heat capacity?

A physical feature of matter known as heat capacity and thermal capacity is the quantity of heat that must be applied to an object in order to cause a unit change in temperature. Heat capacity is measured in joules per kelvin (J/K), the SI unit. A broad property is heat capacity.

The particular heat capacity, which can be calculated by dividing an object's heat capacity by its mass, is the comparable intense attribute. The molar heat capacity is obtained through dividing the specific heat even by molecular weight of the substance. The heat capacity per volume is gauged by the volumetric heat capacity. The term "thermal mass" is frequently used in civil engineering and architecture to describe a building's ability to hold heat.

q calorimeter = q water + q water final

q water = m ×c water ×ΔT

q water = 25.0 g×4.184 J/g°C ×10.5°C

              = 1057.35 J

q water final = m×c of water × ΔT

q water final = 25.0 g×4.184 J/g°C ×9.5°C

                   = 967.35 J

q calorimeter = q water + q water final

                      = 1057.35 J + 967.35 J

                      = 2024.70 J

Therefore,  2024.70 J is the heat capacity of the coffee cup calorimeter.

To know more about heat capacity, here:

https://brainly.com/question/29766819

#SPJ2

Calculate the molecular formula for a compound whose empirical formula is CH2O and molar mass is 150.0 g/mol.
Step 1: Calculate the molar mass for the empirical formula.
What is the molar mass of CH2O?
(C=12.01 amu, H=1.01 amu, O=16.00 amu) [?] g/mol CH₂O

Answers

The molecular formula is (CH2O)5 when the scale factor is 5 and the empirical formula is CH2O.

Considering the question given above, the following data were obtained:

Empirical formula = CH₂O

Molar mass of compound = 150 g/mol

Scaling factor (n) =?

Empirical formula × n = molar mass

[CH₂O]n = 150

[12 + (2×1) + 16]n = 150

[12 + 2 + 16]n = 150

30n = 150

Divide both sides by 30

n = 5

Therefore, the scaling factor is 5

A scale factor is a ratio between corresponding measurements of an object and a representation of that object.In chemistry, the empirical formula of a chemical compound is the simplest whole-number ratio of atoms present in a compound. .

Learn more about empirical formula at:

brainly.com/question/11185156v

#SPJ1

7.

The form of energy stored in the nucleus of atoms is
energy.

Answers

Answer:

Many forms of energy exist, but they all fall into two basic categories:

Potential energyKinetic energy

The number of protons in an atom is known as its atomic

Answers

Atomic number should be the answer

What does the -40, -42, -43, -44, -46,-48 mean for each isotope of Calcium?

Answers

mass number of calcium isotopes

mass numberi the number of proton + neutron

number of proton for calcium is 20 regardless of isotopes

hence the only difference between calcium isotopes are rhe number of neutron

A 10.0 g gold ring with a specific heat 0.129 at 24.00°C is placed in a calorimeter with 118 g of water at 1.00°C.
What will be the final temperature of the system?

Answers

Answer:

1.06 °C

Explanation:

From the question given above, the following data were obtained:

Mass of gold (M₉) = 10 g

Specific heat capacity of gold (C₉) = 0.129 J/gºC

Initial temperature of gold (T₉) = 24 °C

Mass of water (Mᵥᵥ) = 118 g

Specific heat capacity of water (Cᵥᵥ) = 4.184 J/gºC

Initial temperature of water (Tᵥᵥ) = 1 °C

Equilibrium temperature (Tₑ) =?

The equilibrium temperature of the system can be obtained as follow:

Heat loss by the gold = heat gained by the water

M₉C₉(T₉ – Tₑ) = MᵥᵥCᵥᵥ(Tₑ – Cᵥᵥ)

10 × 0.129 (24 – Tₑ) = 118 × 4.184 (Tₑ – 1)

1.29(24 – Tₑ) = 493.712 (Tₑ – 1)

Clear bracket

30.96 – 1.29Tₑ = 493.712Tₑ – 493.712

Collect like terms

30.96 + 493.712 = 493.712Tₑ + 1.29Tₑ

524.672 = 495.002Tₑ

Divide both side by 495.002

Tₑ = 524.672 / 495.002

Tₑ = 1.06 °C

Therefore, the temperature of the system is 1.06 °C

The amount of heat of the system is measured by a device called a calorimeter. The final temperature of the system will be 1.06 degrees celsius.

What is equilibrium temperature?

The equilibrium temperature is the temperature that follows the law of thermodynamics and is said to be the system that has alike temperatures.  

Given,

Mass of Ag (Mg) = 10g

Specific heat capacity of Ag (Cg) = 0.129J/gC

The initial temperature of Ag (Tg) = 24C

Mass of water (Mw) = 118 g

Specific heat capacity of water (Cw) = 4.184J/gC

The initial temperature of water (Tw) = 1C

Equilibrium temperature = (Te)

The equilibrium temperature can be shown as, heat loss by the gold = heat gained by the water:

MgCg(TgTe)=MwCw(TeCw)

Substituting values in the equation:

10×0.129(24Te)=118×4.184(Te1)1.29(24Te)=493.712(Te1)524.672=495.002Te

Now divide both the sides by 495.002:

Te=524.672495.002Te=1.06C

Therefore, the final temperature of the system is 1.06 degrees celsius.

Learn more about equilibrium temperature here:

https://brainly.com/question/16207236

Which two substances are reactants in the chemical reactions of cellular respiration?

Which two substances are reactants in the chemical reactions of cellular respiration?

Answers

Answer:

The answer is A and C.

Explanation:

The reactants in the process of cellular respiration are oxygen and glucose, respectively. It is ATP that serves as the primary product of cellular respiration, with carbon dioxide and water serving as waste products.

Sugar is a glucose.

Oxygen and glucose are the two  substances that are reactants in the chemical reactions of cellular respiration. Therefore, the correct options are options A, C.

What is cellular respiration?

Through the process of cellular respiration, organisms mix oxygen with food molecules, directing the chemical energy contained in these substances towards life-sustaining processes while excreting carbon dioxide and water as waste. Foods are broken down by microorganisms that do not require oxygen in a process known as fermentation.

Adenosine triphosphate (ATP), an energy-rich compound that absorbs the chemical energy generated by the decomposition of food molecules then releases it to power other cellular functions, is one goal of the breakdown of foodstuffs. ATP is created when the energy found inside chemical bonds is converted from one form to another. Oxygen and glucose are the two  substances that are reactants in the chemical reactions of cellular respiration.

Therefore, the correct options are options A, C.

To know more about cellular respiration, here:

https://brainly.com/question/29760658

#SPJ2

PLEASE HELP ME NO ONE WILL THIS IS IMPORTANT ALOT OF POINTS! A student's favorite drink is sweet tea. Every morning he makes it by adding exactly thirty grams of sugar and one tea bag to one liter of hot water. Some days his tea does not taste as sweet as other days. Those same days he notices that there is sugar sitting at the bottom of the cup that will not dissolve no matter how long he stirs. He decided to filter out the remaining sugar and keep track of the data in the graph below.

Explain why different amounts of sugar might dissolve at different times.

Consider:

1. which day the least sugar dissolved and which day the most sugar dissolved.


2. what could have caused less sugar to dissolve on some days


3. what the student could do to his drink to make more sugar dissolve.


Be sure to consider the completeness of your response, supporting details, and accurate use of terms. Your response should be 6-8 complete sentences.

PLEASE HELP ME NO ONE WILL THIS IS IMPORTANT ALOT OF POINTS! A student's favorite drink is sweet tea.

Answers

The solubility of a substance, such as sugar, depends on several factors, including temperature, pressure, and the presence of other solutes. In this case, the student adds the same amount of sugar and tea bag to the same amount of hot water every day, but the temperature of the water could vary from day to day, affecting how much sugar dissolves.

According to the graph, the least amount of sugar dissolved on day 3, while the most sugar dissolved on day 5. The difference in temperature on these days could explain this variation. On day 3, the water may have been cooler, making it more difficult for the sugar to dissolve. On the other hand, on day 5, the water may have been hotter, which could have increased the solubility of the sugar.

To increase the amount of sugar that dissolves in the tea, the student could try using hotter water or stirring the sugar more vigorously to distribute it evenly throughout the water. Alternatively, the student could try adding the sugar gradually while stirring to give it more time to dissolve before adding more.

Answer:

I'm not 100% sure on this because mine hasn't been graded yet, but here are the answers I submitted.

Explanation:

Which day the least sugar dissolved and which day the most sugar dissolved:

Day 4 is when the least sugar dissolved, and Day 2 is when the most sugar dissolved.

What could have caused less sugar to dissolve on some days:

The temperature of the tea could have caused the sugar not to dissolve on some days.

What the student could do to his drink to make more sugar dissolve.

The student would need to add the sugar to the tea as soon as it's done boiling.  The Sugar will dissolve faster in a warmer tea due to more energy of movement.  

Be sure to stir the tea as you add the sugar.  Stirring the sugar into the tea speeds up the rate of dissolving by helping distribute the sugar particles throughout the tea.  

If the student were to use granulated sugar, those are smaller particles and have greater surface area.  Greater surface area allows for more contact between the tea and the sugar.

what substance changes directly solid to gas
3 examples​

Answers

Answer:

Air FreshenersSpecialized PrintersMoth Balls

                       

The process in which solids directly change to gases is known as sublimation. This occurs when solids absorb enough energy to completely overcome the forces of attraction between them. Dry ice is an example of solids that undergo sublimation.

How many liters does each of the following quantities of O2 occupy at STP: (a) 7.6 mol; (b) 0.58 mol?

Answers

7.6 moles of O2 will occupy 170.24 L at STP, and 0.58 moles of O2 will occupy 12.992 L at STP.

To solve this problem

We can use the ideal gas law and the molar volume of a gas at STP.

The molar volume of a gas at STP is approximately 22.4 liters/mol.

(a) For 7.6 mol of O2:

Volume = Number of moles * Molar volume

Volume = 7.6 mol * 22.4 L/mol

Volume = 170.24 liters

Therefore, 7.6 moles of O2 occupy approximately 170.24 liters at STP.

(b) For 0.58 mol of O2:

Volume = Number of moles * Molar volume

Volume = 0.58 mol * 22.4 L/mol

Volume = 12.992 liters

Therefore, 0.58 moles of O2 occupy approximately 12.992 liters at STP.

Learn more about ideal gas law here : brainly.com/question/12873752

#SPJ1

a) For 7.6 mol of O2 volume occupied at STP is approximately equal to 164.09 L

b) For 0.58 mol of O2 volume occupied at STP is approximately equal to 12.02 L

A temperature of 273.15 K (0 degrees Celsius) and a pressure of 1 atmosphere (atm) are defined as STP (Standard Temperature and Pressure).

We can use the ideal gas law equation to calculate the volume of a gas at STP:

PV = nRT

Where: P is the pressure (1 atm), V is the volume, n is the number of moles, R is the ideal gas constant (0.0821 L·atm/(mol·K)), and T is the temperature in Kelvin.

(a) In the case of 7.6 moles of O2, we can rearrange the equation to solve for the volume (V):

V = nRT / P

V = (7.6 mol) × (0.0821 L·atm/(mol·K)) × (273.15 K) / (1 atm)

On calculating,

V ≈ 164.09 L

(b) In the case of 0.58 moles of O2, we can rearrange the equation to solve for the volume (V):

V = nRT / P

V = (0.58 mol) × (0.0821 L·atm/(mol·K)) × (273.15 K) / (1 atm)

On Calculating,

V ≈ 12.02 L

To learn more about the Volume occupied at STP:

https://brainly.com/question/28437564

Which of the following quantities is equivalent to 3.7 cm?
A. 3.7×10⁻⁵ km
B. 3.7×10⁵ μm
C. 3.7×10⁻² mm
D. 3.7×10² mm
E. 3.7×10⁻³ m

Answers

Answer:

A. 3.7×10^-5 km

Explanation:

Whenever there is scientific notation, you always move the decimal the amount of places that the exponent tells you. For a, you would move the decimal 5 times to the left and the km version will be equivalent to the cm version. I hope this helps!

The quantity is equivalent to 3.7 cm is  3.7×10⁻⁵ km. Therefore, option A is correct.

What do you mean by the scientific notation ?

The term scientific notation is defined as a way of writing very large or very small numbers. A number is written in scientific notation when a number between 1 and 10 is multiplied by a power of 10.

For example, 650,000,000 can be written in scientific notation as 6.5 ✕ 10^8.

Scientific notation is used to simplify numbers that are too big.

In the scientific notation, you always displace the decimal the amount of places that the exponent tells you. Then would move the decimal 5 times to the left and the km version will be equivalent to the cm version.

Thus, The quantity is equivalent to 3.7 cm is  3.7×10⁻⁵ km, option A is correct.

To learn more about the scientific notation, follow the link;

https://brainly.com/question/18073768

#SPJ2

12. 5.6g of solid copper was heated with 476.2 J at room temperature (25°C). Given that
copper has a C of 0.38 J/g°C, what would its final temperature be?

Answers

Answer:

The final temperature of the copper would be 311.3°C.

I hope this helps you

What is the molecular weight of H2O

Answers

Answer:

18.015

Explanation:

Using the periodic table of the elements to find atomic weights, we find that hydrogen has an atomic weight of 1, and oxygen's is 16. In order to calculate the molecular weight of one water molecule, we add the contributions from each atom; that is, 2(1) + 1(16) = 18 grams/mole.

which is the most fluorescent molecule?

Answers

I think neon....................

How many elements are found in nature

Answers

Answer:

There are 92 naturally occurring elements.

Explanation:

question is about atoms but i don’t understand:(

question is about atoms but i dont understand:(

Answers

Answer:

Electrons

Explanation:

The are found in the cloud surrounding the nucleus, but not within

Answer:

electrons as they are found in the outer electron shells

Explanation:

Almost 99% of Earth's atmosphere is made up of two gases. What are the two gases and the percents of each?
A)
21% oxygen and 78% nitrogen
B)
21% water vapor and 78% oxygen
09
21% nitrogen and 78% oxygen
D)
21% carbon dioxide and 78% oxygen

Answers

D 21% carbon dioxide and 78% oxygen

2. How many Cu atoms have a mass of 4.500x10^5 amu? ​

Answers

Answer:

63.55

Explanation:

4.500 x 10^5 amu x 1 Cu atom / 63.55 amu = 7081 Cu Atom

Cu 1 x 63.55 = 63.55

Which conjugate acid/base pair could be used to create a pH 3.20 buffer solution with the largest possible buffercapacity?

a. Sulfurous acid/sodium bisulfite pKa=1.92
b. Hydrofluoric acid/sodium fluoridepKa=3.14
c. Nitrous acid/sodium nitritepKa=3.34
d. Benzoic acid/sodium benzoate pKa=4.20
e. Acetic acid/sodium acetate pKa=4.74

Answers

Answer:

b. Hydrofluoric acid/sodium fluoride (pKa=3.14).

Explanation:

Hello!

In this case, since the buffer capacity is related to how good a buffer behaves under the addition of acidic or basic substances in the light of holding the pH as constant as possible, we need to keep in mind that the best buffer must have a pKa as close as possible to the desired pH, that is, if the desired pH here is 3.20, we must pick the acid/base pair which the pKa cosest to 3.20.

In such a way, since b. Hydrofluoric acid/sodium fluoride (pKa=3.14 ) and c. Nitrous acid/sodium nitrite (pKa=3.34) have a pKa close to 3.20, the closest one is b. Hydrofluoric acid/sodium fluoride pKa=3.14 which is 0.06 pH units away from the desired pH, therefore the answer is b. Hydrofluoric acid/sodium fluoride pKa=3.14.

Best regards!

ch4+br2 ch3br+hbr which type of reaction does this equation represent

Answers

To solve such this we must know the concept of combination reaction. Therefore, the given reaction CH4+Br2 CH3Br+ HBr is a combination reaction.

What is chemical reaction?

Chemical reaction is a process in which two or more than two molecules collide in right orientation and energy to form a new chemical compound. The mass of the overall reaction should be conserved. There are so many types of chemical reaction reaction like combination reaction, double displacement reaction.

CH4+Br2 CH3Br+ HBr

The above reaction is a combination reaction. In combination reaction, more than one reactant combine to form a product. Because new chemicals are created during combination reactions, they are often referred to as synthesis.

Therefore, the given reaction is a combination reaction.

Learn more about the chemical reactions, here:

https://brainly.com/question/3461108

#SPJ1

The decay of a living things allows chemical elements to be lost.

Answers

Answer: is is true

Explanation:

A solution of the ionic salt
NaCI would have
pH.
an acidic
a basic
a neutral

Answers

Answer:

Neutral

Explanation:

NaCl aqueous solution is formed by NaOH and HCl.

NaOH is a base and HCl is an acid, so they go through neutralization process forming a neutral salt and water.

Melamine (C3N3(NH2)3) is a component of many adhesives and resins and is manufactured in a two-step process from urea (CO(NH2)2) as the sole starting material. How many moles of urea would be required if we want to collect 1.00 kg of melamine and if the first step in the process is 100% yield, but the second step is only 65% yield?
(1) CO(NH2)2 (l)  HNCO(l) + NH3(g) (balanced)
(2) HNCO(l)  C3N3(NH2)3 (l) + CO2(g) (unbalanced

Answers

Answer:

nCO(NH2)2=73.3molCO(NH2)2

Explanation:

Hello.

In this case, given the two balanced chemical reactions:

CO(NH2)2(l)HNCO(l)+NH3(g)6HNCO(l)C3N3(NH2)3(l)+3CO2(g)

We first compute the moles of HNCO from the obtained 1.00 kg of melamine (molar mass 126 g/mol) by considering the 65 % yield:

mC3N3(NH2)3theoretical=1.00kg0.65=1.54kg

nHNCO=1.54kgC3N3(NH2)31000g1kg1molC3N3(NH2)3126gC3N3(NH2)36molHNCO1molC3N3(NH2)3nHNCO=73.3molHNCO

Next, we compute the moles of urea in the first chemical reaction:

nCO(NH2)2=73.3molHNCO1molCO(NH2)21molHNCOnCO(NH2)2=73.3molCO(NH2)2

Best regards.

Why are metals so ductile?

Answers

Answer:

throughout the metallic structure allowing the atoms to slide past each other. This sliding is why metals are ductile and malleable. Ionic compound must break bonds to slide past one another, which causes the ionic material to split and crack.

Explanation:

Hope this helps loves mark me brianlest x

Other Questions
Which of the following molecules would be most favorable to undergo an E2 reaction rather than an SN2 reaction with NaOH What would the potential of a standard hydrogen (S.H.E.) electrode be if it was under the following conditions?[H+] = 0.77 MPH2 = 1.4 atmT = 298 K B=6,c=7.5 what is A in Pythagorean therom Which of the following are effective ways for managers to try to boost a company's stock price? Increase the company's dividend payments to shareholders each year by at least $0.05 per share, repurchase shares of common stock, and make every effort to achieve annual increases in earnings per share. Make every effort to achieve a branded market share in each geographic region that is at least equal to the industry average, keep the company's dividend payout ratio in the range of 50%, and repurchase shares of common stock. Increase the company's dividend payments to shareholders each year, keep the company's credit rating at A (or above), strive to increase the company's retained earnings each year by a minimum of 5%, and not issue more than 5,000 shares of common stock in any one year. Spend amounts on corporate citizenship and social responsibility that are above the industry average, boost the company's dividend payout ratio to more than 100%, and issue additional shares of common stock to raise the funds to pay off all long-term debt within 2 years. Cut the dividend to zero and issue additional shares of stock so as to increase the funds available for quickly paying off all long-term debt (ideally in no more than 2 years); then the company should avoid further use of long-term debt, striving to achieve and maintain a credit rating of A or A+. two agronomists analyzed the same data, testing the same null hypothesis about the proportion of tomato plants suffering from blight. one rejected the hypothesis but the other did not. assuming neither made a mistake in calculations, which of these possible explanations could account for this apparent discrepancy? i. one agronomist wrote a one-tailed alternative hypothesis, but the other used 2 tails. ii. they wrote identical hypotheses, but the one who rejected the null used a higher a - level. iii. they wrote identical hypotheses, but the one who rejected the null used a lower a - level. When making a prediction about reading, students should make a(n) educational guess about what is likely to happen next. An educated prediction is one that is made based on information and experience. Hence, such a guess is more likely to be correct. A right triangle is describe as having an angle of measure six less than negative two times a number, another angle measure that is three less than negative one-fourth the number, and a right angle. What are the measure of the angles in degree Samir's statement shows a previous balance of $5,336.22, a payment of $607, and anew transaction totaling $186. What is his new balance if his APR is 29.0%? Roundanswer to hundredths place if answer does not have a hundredths place this usezeros so it does. Do not include the units. Be sure to attach work for creditYour Answer: Assume that array arr has been defined and initialized with the values {5, 4, 3, 2, 1}. What are the values in array arr after two passes of the for loop(i.e., when j = 2 at the point indicated by /* end of for loop */)?a. {2, 3, 4, 5, 1}b. {3, 2, 1, 4, 5}c. {3, 4, 5, 2, 1}d. {3, 5, 2, 3, 1}e. {5, 3, 4, 2, 1} find the acceleration find the acceleration a of the sled. express your answer in terms of some or all of the variables s , v1 , and v2 . pseudocode is written in natural language but often includes programming to assist in writing the program itself. The circle graph below represents the favorite fruit of 300 people How many prefer oranges? b. How many prefer pineapples? c. How many prefer blueberries? d. How many prefer apples? e. How many prefer strawberries? 6. The second section includes this sentence: "He cautioned(the parents, though, that the pendulum could swingback. " This sentence employs which literary device? long-term use of drugs causes changes in brain chemical systems and circuits, affecting functions that include which of the following? luoa The onset of one stimulus occurs at the same moment as the onset of another. This describes a _____ conditioning procedure.a. backwardb. delayedc. traced. simultaneous The highest concentration of eosinophils seen in peripheral smear is seen in which of the following?A. CMLB. CELC. PVD. ET in sarah hrdy article mothers and others in what way does she describe human breeding behavior? A negative point charge is placed next to an uncharged conducting sphere: An electric potential map is shown in the figure. Three regions (A,B , and C) are indicated on the map. Order the electric field in these regions from strongest at the top of the list to weakest at the bottom of the list. FILL IN THE BLANK. According to the revisions made for DSM-5, most people previously diagnosed with __________ will now be diagnosed with somatic symptom disorder.hypochondriasisfactitious disorderbody dysmorphic disorderdissociative disorder convert the following linear programming problem to standard form: maximize 2^i -f x2 subject to 0 < x\ < 2 x\ %2 < 3 x\ 2x2 < 5 x2 >0 .