Calculate the approximate distance point A (5,3, -2) and point B (2, -4, 8) are from the origin. Round to the
nearest tenth.
How much farther from the origin is point B than point A?
3.0 units
3.7 units
4.7 units
O 5.7 units

Answers

Answer 1

Answer:

3.0 units

Step-by-step explanation:

Distance between two points:

Suppose that we have two points, (x1,y1) and (x2,y2). The distance between them is given by:

D=(x2x1)2+(y2y1)2

Origin:

The origin is given by point (0,0,0).

Distance of point B to the origin:

Since the origin is all 0, just put the points into the square root.

D=22+42+82=84=9.2

9.2 units.

Distance of point A to the origin:

D=52+32+22=37=6.1

How much farther from the origin is point B than point A?

9.2 - 6.1 = 3.1 units

So approximately 3 units.

Answer 2

Answer:

a

Step-by-step explanation:


Related Questions

Based on the supply graph and the demand graph shown above, what is the price at the point of equilibrium?
Hint: Think about the point where they both meet. For example, if you were to place the graphs on top of each other, what would be the point of intersection?

Type the correct number below without the dollar sign.

Based on the supply graph and the demand graph shown above, what is the price at the point of equilibrium?Hint:

Answers

Based on the supply graph and demand graph shown above, the price at the point of equilibrium is $ 30.

Demand refers to quantity of a commodity that the consumers are willing to, able to purchase at a given price during a given period of time. Supply refers to quantity of a commodity that the producers are willing to, able to offer for sale at a given price during a given period of time.

Demand curve slopes downward due to inverse relationship between price and quantity demanded whereas supply curve slopes upward due to direct relationship between quantity supplied and price. When both demand and supply curve intersect with each other balance is achieved. Intersection point between demand and supply curve is known as equilibrium.

At this point when prices are equal is known as equilibrium price and when quantiy demanded or supplied are equal it is known as equilibrium quantity. When we combine the given graph. Equilibrium is achieved at a point when price is equal to $ 30 and quantity is equal to 20 units.

To learn more about equilibrium of demand and supply:

https://brainly.com/question/30237240

3. A fair coin is tossed once and lands heads or tails. Find the probability the the coin
lands
a. tails.
b. heads or tails.
c. heads and tails.

Answers

Step-by-step explanation:

a) tails - 1/2

b) heads or tails - 1

c) heads and tails - 1/4

Is the event independent or overlapping:
A spinner has an equal chance of landing on each of its eight numbered regions. After spinning, what is the probability you land on region three and region six?
Mutually exclusive or independent:
A bag contains six yellow jerseys numbered 1-6. The bag also contains four purple jerseys numbered 1-4. You randomly pick a jersey. What is the probability it is purple or has a number greater than 5.
Mutually exclusive or overlapping:
A box of chocolates contains six milk chocolates and four dark chocolates. Two of the milk chocolates and three of the dark chocolates have peanuts inside. You randomly select and eat a chocolate. What is the probability that is is a milk chocolate or has no peanuts inside?
Mutually exclusive or independent:
You flip a coin and then roll a fair six sided die. What is the probability the coin lands on heads up and the die shows an even number?

Answers

Let's analyze each scenario:

1. A spinner has an equal chance of landing on each of its eight numbered regions. After spinning, what is the probability you land on region three and region six?

In this case, the spinner's outcome of landing on region three is independent of landing on region six. Each spin is unrelated to the previous spin, and the outcome of one region does not affect the outcome of the other region. Therefore, the events are independent. The probability of landing on both region three and region six is the product of their individual probabilities: 1/8 * 1/8 = 1/64.

2. A bag contains six yellow jerseys numbered 1-6. The bag also contains four purple jerseys numbered 1-4. You randomly pick a jersey. What is the probability it is purple or has a number greater than 5?

In this scenario, the events are overlapping. A jersey can be both purple and have a number greater than 5 at the same time. Therefore, the probability of it being purple or having a number greater than 5 is the sum of their individual probabilities, minus the probability of the overlapping event (purple jerseys with a number greater than 5). There are 4 purple jerseys out of 10 total jerseys, and there is 1 jersey with a number greater than 5 out of 10. However, there is one jersey that satisfies both conditions (purple and number greater than 5), so we need to subtract it from the sum. So the probability is (4/10 + 1/10) - (1/10) = 4/10 = 2/5.

3. A box of chocolates contains six milk chocolates and four dark chocolates. Two of the milk chocolates and three of the dark chocolates have peanuts inside. You randomly select and eat a chocolate. What is the probability that it is a milk chocolate or has no peanuts inside?

In this scenario, the events are mutually exclusive. A chocolate cannot be both a milk chocolate and have no peanuts inside at the same time. Therefore, the probability of it being a milk chocolate or having no peanuts inside is the sum of their individual probabilities. There are 6 milk chocolates out of 10 total chocolates, and there are 7 chocolates without peanuts out of 10. So the probability is 6/10 + 7/10 = 13/10, which is greater than 1. However, probabilities cannot exceed 1, so we need to take the maximum value of 1. Therefore, the probability is 1.

4. You flip a coin and then roll a fair six-sided die. What is the probability the coin lands heads up and the die shows an even number?

In this case, the events are independent. The outcome of the coin flip does not affect the outcome of the die roll. The probability of the coin landing heads up is 1/2, and the probability of the die showing an even number is 1/2. To find the probability of both events occurring, we multiply their individual probabilities: 1/2 * 1/2 = 1/4.

I hope this clarifies the nature of each event. Let me know if you have any further questions!

The first question:

"A spinner has an equal chance of landing on each of its eight numbered regions. After spinning, what is the probability you land on region three and region six?"

Since the spinner has an equal chance of landing on each of its eight regions, the probability of landing on region three is 1/8, and the probability of landing on region six is also 1/8.

To find the probability of both events occurring (landing on region three and region six), you multiply the probabilities together:

P(landing on region three and region six) = P(landing on region three) * P(landing on region six) = (1/8) * (1/8) = 1/64.

Therefore, the probability of landing on both region three and region six is 1/64.

The events are mutually exclusive because it is not possible for the spinner to land on both region three and region six simultaneously.

--------------------------------------------------------------------------------------------------------------------------

The second question:

"A bag contains six yellow jerseys numbered 1-6. The bag also contains four purple jerseys numbered 1-4. You randomly pick a jersey. What is the probability it is purple or has a number greater than 5?"

To find the probability of either event occurring (purple or number greater than 5), we need to calculate the probabilities separately and then add them.

The probability of picking a purple jersey is 4/10 since there are four purple jerseys out of a total of ten jerseys.

The probability of picking a jersey with a number greater than 5 is 2/10 since there are two jerseys numbered 6 and above out of a total of ten jerseys.

To find the probability of either event occurring, we add the probabilities together:

P(purple or number greater than 5) = P(purple) + P(number greater than 5) = (4/10) + (2/10) = 6/10 = 3/5.

Therefore, the probability of picking a purple jersey or a jersey with a number greater than 5 is 3/5.

The events are overlapping since it is possible for the jersey to be both purple and have a number greater than 5.

--------------------------------------------------------------------------------------------------------------------------

The third question:

"A box of chocolates contains six milk chocolates and four dark chocolates. Two of the milk chocolates and three of the dark chocolates have peanuts inside. You randomly select and eat a chocolate. What is the probability that it is a milk chocolate or has no peanuts inside?"

To find the probability of either event occurring (milk chocolate or no peanuts inside), we need to calculate the probabilities separately and then add them.

The probability of selecting a milk chocolate is 6/10 since there are six milk chocolates out of a total of ten chocolates.

The probability of selecting a chocolate with no peanuts inside is 7/10 since there are seven chocolates without peanuts out of a total of ten chocolates.

To find the probability of either event occurring, we add the probabilities together:

P(milk chocolate or no peanuts inside) = P(milk chocolate) + P(no peanuts inside) = (6/10) + (7/10) = 13/10.

Therefore, the probability of selecting a milk chocolate or a chocolate with no peanuts inside is 13/10.

The events are mutually exclusive since a chocolate cannot be both a milk chocolate and have no peanuts inside simultaneously.

--------------------------------------------------------------------------------------------------------------------------

The fourth question:

"You flip a coin and then roll a fair six-sided die. What is the probability the coin lands heads up and the die shows an even number?"

The probability of the coin landing heads up is 1/2 since there are two possible outcomes (heads or tails) and they are equally likely.

The probability of rolling an even number on the die is 3

/6 or 1/2 since there are three even numbers (2, 4, and 6) out of a total of six possible outcomes.

To find the probability of both events occurring (coin lands heads up and die shows an even number), we multiply the probabilities together:

P(coin lands heads up and die shows an even number) = P(coin lands heads up) * P(die shows an even number) = (1/2) * (1/2) = 1/4.

Therefore, the probability of the coin landing heads up and the die showing an even number is 1/4.

The events are independent since the outcome of flipping the coin does not affect the outcome of rolling the die.

\textcolor{lime}{I\:hope\:this\:helps\:!\:\:}

♥️ SUMITROY(:

9x-5
14x+24
A
Determine the value of x.
1) x= -5.8
2) x= -7
3) x= 7
4) x= 32.2

9x-514x+24ADetermine the value of x.1) x= -5.82) x= -73) x= 74) x= 32.2

Answers

Answer:

the answer to the question

is x=-5.8

a ball is thrown with an initial height of 4 feet with an initial velocity of 36 ft/s. h= 4 + 36t - 16t^2 find the values of t for which the rockets height is 25 meters

Answers

The value of t for which the rockets height is 25 meters is 40.7 seconds

How to calculate the time?

From the information, the ball is thrown with an initial height of 4 feet with an initial velocity of 36 ft/s. h= 4 + 36t - 16t².

Therefore, the values of t for which the rockets height is 25 meters will be:

h= 4 + 36t - 16t².

where h = 25

25 = 4 + 36t - 16t².

Collect like terms

25 - 4 - 36t + 16t² = 0

16t² - 36t -21 = 0

Using almighty formula

t = 40.7 seconds.

Therefore, the value of t for which the rockets height is 25 meters is 40.7 seconds

Learn more about velocity on:

brainly.com/question/24445340

#SPJ1

Find the equation of the rational function f whose graph satisfies the conditions horizontal asymptote is y=0 vertical asymptote is x=-3 and contains the point (0,1)

Answers

A function assigns the values. The function is f(x) = (8x - 8)/(x² + 2x).

What is a Function?

A function transfers each element's value from one set to a particular element in another set.

There is a denominator and a numerator in a rational function.

The x-values that the function approaches but never reaches are known as vertical asymptotes. We can get the vertical asymptotes by setting the denominator to zero.

Since x=-2 and x=0 are the vertical asymptotes, our function's denominator will be x(x+2) = x2+2x.

Y values that the function approaches but never reaches are known as horizontal asymptotes. The degree of the numerator must be less than the degree of the denominator since the horizontal asymptote is y=0. Our numerator will be x - 1 because the x-intercept is equal to 1.

At this time, One can assume that the function is f(x) = (x - 1)/(x2+2x).

Next, we must apply the f(2)=1 condition. If we enter x=2, f(x) ought to be equal to 1. However, we must multiply the function's right side by a constant called C.

Then, the constraint f(2)=1 must be used. F(x) should be equal to 1 if we substitute x=2. The right side of the function must be multiplied by a constant C, though.

1 = C(2 - 1)/(2²+2(2))

Solve for C.

1 = C / 8\s8 = C

Consequently, the equation will be f(x) = [8(x - 1)] / [(x2 + 2x)].

f(x) = (8x - 8) / (x² + 2x)

Thus, f(x) = (8x - 8)/(x2 + 2x) is the function.

Learn more about Function refer to:

https://brainly.com/question/11624077

#SPJ1

3
DO
Show how this expression can be written in simpler form. Explain you process.
5 to the third power x 25

Answers

Answer:

5^5

Step-by-step explanation:

25 is five to the second power, and when you multiply exponents, you add them together. So you have 5^3 x 5^2 which will be 5^5.

3(4x-10)= 2(3x-30) help

Answers

The solution to the equation 3(4x-10) = 2(3x-30) is x = -5.

What is algebra?

Algebra is a branch of mathematics that deals with mathematical operations and symbols used to represent numbers and quantities in equations and formulas. It involves the study of variables, expressions, equations, and functions.

Let's solve for x:

3(4x - 10) = 2(3x - 30)

First, we can simplify both sides by distributing the coefficients:

12x - 30 = 6x - 60

Next, we'll move all the x terms to one side of the equation and the constants to the other side:

12x - 6x = -60 + 30

Simplifying further:

6x = -30

Finally, we can solve for x by dividing both sides by 6:

x = -5

Therefore, the solution to the equation 3(4x-10) = 2(3x-30) is x = -5.

To learn more about equation from the given link:

https://brainly.com/question/27893282

#SPJ1

which of the following statements are true about the normal distribution (choose one or more) group of answer choices the curve is symmetrical the mean, median and mode are the same approximately 68% of values fall within one standard deviation of the mean the tails are asymptotic

Answers

A, C and D are all true statements about the normal distribution.

A. The curve is symmetrical

C. Approximately 68% of values fall within one standard deviation of the mean

D. The tails are asymptotic

A normal distribution may not have an identical mean, median, or mode, hence statement B is untrue.

C is true because, under the normal distribution, 68% of values will lie within one standard deviation of the mean.

The normal distribution's tails are asymptotic, which means they approach but never reach a particular value, which explains why D is true.

Hence, A, C, and D are the correct answers.

Complete Question:

Which of the following statements are true about the normal distribution? (Choose one or more.)

A. The curve is symmetrical

B. The mean, median and mode are the same

C. Approximately 68% of values fall within one standard deviation of the mean

D. The tails are asymptotic

To learn more about standard deviation visit:

https://brainly.com/question/475676

#SPJ4

Find the circumference of the circle.

Find the circumference of the circle.

Answers

Answer:

72 .22 inches is the answer bro

Answer:

72.22 inches

Step-by-step explanation:

Formula for circumference given diameter is:

c = πd

If you use 3.14 for pi, you get 72.22 inches:

c = 3.14(23)

c = 72.22

208+7x−108−5x PLEASE SIMPLIFY

Answers

Answer:

100+2x

Step-by-step explanation:

Answer:

100+2x

Step-by-step explanation:

Break it down.

Change the order:

208-108+7x-5x

100+2x

Please award brainliest and mark THANKS!

1st question answer pls

 1st question answer pls

Answers

let's take a peek at the picture above, hmmm let's notice the vertex is at (-1 , 2), now let's get a point besides the vertex hmmm let's see it passes through (-2 , -1).

So we can reword that as what's the equation of a quadratic whose vertex is at (-1 , 2) and it passes through (-2 , -1)?

      vertical parabola vertex formy=a(xh)2+k{(h,k)vertexopens a is negativeopens a is positive \dotfill

Unsupported use of \hfill

Answer:

y = -3(x + 1)^2 + 2

Step-by-step explanation:

y = a(x - h)^2 + k is the vertex form of a quadratic, where

(x, y) are any point that lies on the parabola,a is a constant determining whether the parabola opens upward or downward,and (h, k) are the coordinates of the vertex.

Finding (h, k):

We see from the graph that the vertex is a maximum and its coordinates are (-1, 2).  Thus h is -1 and k is 2.  Since h becomes negative, it will be 1 in the parentheses: (x - (-1) = (x + 1).

Finding a:

In order to find a, we will need to plug in a point on the parabola for (x, y) and (-1, 2) for h and k.  We see that (0, -1) lies on the parabola so we can use this point for (x, y).

-1 = a(0 - (-1))^2 + 2

-1 = a(0 + 1)^2 + 2

-3 = a(1)^2

-3 = a

Thus, a = -3.

Thus, the exact equation in vertex form of the parabola is:

y = -3(x + 1)^2 + 2

I attached a picture from Desmos Graphing Calculator that shows how the equation I provided works and contains the two points you marked on the parabola, including (-1, 2) aka the maximum, and (0, -1) aka the y-intercept.

 1st question answer pls

Li Wei and Colleen have the same reading assignment. After one week Li Wei has read 90 pages and Colleen has read 126 pages. If Li Wei can you read 30 pages in an hour and Colleen henry 24 pages an hour, when will they be on the same page 

Answers

Equating the expressions, if Li Wei can read 30 pages in an hour and Colleen Henry 24 pages an hour, they will be on the same page in 6 hours.

What are equivalent expressions?

Equivalent expressions are two or more algebraic expressions that have the same value when the variables are substituted with real numbers.

In this situation, we can determine the time that Li Wei and Colleen Henry can be on the same page by equating the expressions representing their reading rates.

The number of pages Li Wei can read in a week = 90

The number of pages Collen can read in a week = 126

Li Wei's reading rate per hour = 30 pages

Collen's reading rate per hour = 24 pages

Let the hours that Li Wei and Colleen can be on the same page= x

Expressions:

The total number of pages Li Wei can read = 90 + 30x

The total number of pages Colleen can read = 126 + 24x

For Li Wei and Colleen to be on the same, the two expressions are equated.

90 + 30x = 126 + 24x

6x =  36

x = 6

Learn more about equivalent expressions at https://brainly.com/question/2972832.

#SPJ1

3 solutions for x<-2

Answers

Answer:

-3,-4,-5

Step-by-step explanation:

those are all numbers less than -2! your welcome! please give me brainliest!

Answer: -3, -16, and -642,000

Step-by-step explanation: In this problem, we're asked to state three solutions for the following inequality, x < -2.

The inequality x < -2 means that any number

less than -2 is a solution to the inequality.

For example, -3 is a solution because -3 is less than -2.

Another solution would be -16 because -16 is less than -2.

One other solution would be -642,000 because it's less than -2.

It's important to understand that these are only 3 possible

answers and there are many answers to choose from.

Quadrilateral A'B'C'D' is the image of
quadrilateral ABCD under a dilation with a scale
factor of 3. What is the length of segment BC?

Answers

By using the concept of dilation factor, length of BC obtained is 3 units

What is dilation factor?

Dilation is a transformation which changes the size of a figure by a certain factor.

That factor is called the scale factor

In the figure, A'B'C'D' is the image of ABCD under dilation with a scale factor of 3

A'B'C'D' is the dilated figure

Length of B'C' = 9 units

Length of BC = 9÷3 = 3 units

To learn more about dilation factor, refer to the link-

https://brainly.com/question/3457976

#SPJ9

Complete Question

The figure has been attached here

Quadrilateral A'B'C'D' is the image ofquadrilateral ABCD under a dilation with a scalefactor of 3. What

PLEASE HELP!!!

Find the measure of the angle indicated in black (top angle).

6x+4


F. 70
G. 55
H. 95
J. 80

PLEASE HELP!!! Find the measure of the angle indicated in black (top angle).6x+4F. 70G. 55H. 95J. 80

Answers

Answer:

F. 70

Step-by-step explanation:

(6x+4)=(5x+15)

[Alternate angles]

(6x5x)=(154)x=11

Therefore;

angle=6(11)+4=66+4=70\degree

Simone purchased a new car for $18,700. There
was also a 6% sales tax. What was the total
amount Simone paid for the car, including tax?

Answers

Answer:

19,822

Step-by-step explanation:

HELPDetermine the equation of the line shown in the graph:y = −1y = 0x = −1x = 0

HELPDetermine the equation of the line shown in the graph:y = 1y = 0x = 1x = 0

Answers

in this problem we have a vertical line

The equation of a vertical line is equal to the x-coordinate of the point that passes through it

so

in this case

the equation of the line is

x=-1

I NEED HELP PLEASE, THANKSSS! :)

I NEED HELP PLEASE, THANKSSS! :)

Answers

Answer: A) max at (14, 6) = 64,   min at (0,0) = 0

Step-by-step explanation:

Graph the lines at look for the points of intersection.

Input those points into the Constraint function (2x + 6y) and look for the maximum value and minimum value.

Points of Intersection: (0, 0), (17, 0), (0, 10), (14, 6)

Point     Constraint 2x + 6y

(0, 0):                    2(0) + 6(0) = 0              Minimum

(17, 0):                    2(17) + 6(0) = 34

(0, 10):                    2(0) + 6(10) = 60

(14, 6):                    2(14) + 6(6) = 64           Maximum

I NEED HELP PLEASE, THANKSSS! :)

Use the following table to find the probability that a randomly chosen member of the Student Government Board is a graduate student or lives in on-campus housing. Express your answer as a fraction in lowest terms or a decimal rounded to the nearest millionth.
Students on the Student Government Board
On-Campus Housing Off-Campus Housing
Freshman 2 2
Sophomore 2 4
Junior 0 3
Senior 4 2
Graduate Student 2 0

Answers

The probability that a randomly chosen member of the Student Government Board is a graduate student or lives in on-campus housing is 8/25 or 0.32 (rounded to the nearest millionth).

1. Calculate the total number of students on the Student Government Board by summing up the numbers in the table:

  Total Students = 2 + 2 + 2 + 4 + 0 + 3 + 4 + 2 = 19

2. Calculate the total number of graduate students on the Student Government Board:

  Total Graduate Students = 2 + 0 = 2

3. Calculate the total number of students living in on-campus housing:

  Total On-Campus Housing = 2 + 2 + 0 + 4 + 2 = 10

4. Calculate the probability of selecting a graduate student from the Student Government Board by dividing the total number of graduate students by the total number of students:

  Probability of Graduate Student = Total Graduate Students / Total Students = 2 / 19

5. Calculate the probability of selecting a student living in on-campus housing by dividing the total number of students in on-campus housing by the total number of students:

  Probability of On-Campus Housing = Total On-Campus Housing / Total Students = 10 / 19

6. Calculate the probability that a randomly chosen member of the Student Government Board is a graduate student or lives in on-campus housing by summing up the probabilities from steps 4 and 5:

  Probability = Probability of Graduate Student + Probability of On-Campus Housing = 2 / 19 + 10 / 19

7. Simplify the fraction if necessary. In this case, the fraction cannot be simplified further, so the final probability is 2 / 19 + 10 / 19 = 12 / 19.

8. Convert the fraction to a decimal by dividing the numerator by the denominator: 12 / 19 ≈ 0.631578947, which rounds to 0.632 (rounded to the nearest thousandth).

9. Finally, express the probability as a fraction in lowest terms: 12 / 19 is already in lowest terms.

Therefore, the probability that a randomly chosen member of the Student Government Board is a graduate student or lives in on-campus housing is 12/19 or approximately 0.632 (rounded to the nearest thousandth).

For more such questions on probability, click on:

https://brainly.com/question/31048927

#SPJ8

Bandhan Bank employee salary after 10 years

Answers

Answer:

- Banking Operations salary in India with less than 1 year of experience to 10 years ranges from ₹ 1.4 Lakhs to ₹ 7 Lakhs with an average annual salary of ₹ 3.1 Lakhs based on 261 latest salaries

expand and simplify

(y – 2) (+1) (y+3)​

Answers

Answer:

y² + y - 6

Step-by-step explanation:

(y - 2)(+ 1)(y + 3) simplifies to

(y - 2)(y + 3)

Each term in the second factor is multiplied by each term in the first factor, that is

y(y + 3) - 2(y + 3) ← distribute parenthesis

= y² + 3y - 2y - 6 ← collect like terms

= y² + y - 6

Can someone help me

Can someone help me

Answers

Answer: Around 38.2°

Step-by-step explanation:

Set ∠A = x & a = 15Set ∠B = 27° & b = 11

Substitute them into the formula for the law of sines:

sinAa=sinBbsinx15=sin2711

Cross-multiply:

11sinx=15sin27

Solve for x:

sinx=15sin2711x=sin1(15sin2711)=38.2488

If a yard of fabric cost $5.90,how much does 0.7 yards of fabric cost?

Answers

Answer:

$4.13

Step-by-step explanation:

Given that,

→ 1 yard of fabric costs $5.90

Then the cost of 0.7 yards of fabric is,

→ 5.90 × 0.7

→ $4.13

Hence, the cost of 0.7 yards is $4.13.

Calcula el 23 % de 175

Answers

Answer:40.25

Step-by-step explanation:

23% of 175

23/100 x 175

(23 x 175)/100

4025/100=40.25

What the meaning of statement this?

What the meaning of statement this?

Answers

The statement is asserting that the universal class (V) is defined as the collection of all sets, where every set is included. It signifies that V encompasses all possible sets within the given set theory framework.

The statement "The universal class set, or universe, is the class of all sets: V = {x: x = x}" is referring to the concept of the universal class or the universe in set theory.

In set theory, the universal class set, denoted as V, represents the collection or class that contains all sets. It includes every possible set that can be defined or exists within the context of the set theory being considered.

The notation "{x: x = x}" is used to define the elements of the universal class. Here, "x = x" represents a condition that is always true for any object or element, regardless of its nature. In other words, this condition holds for everything in the universe, as anything is equal to itself.

Learn more about sets here:

https://brainly.com/question/30705181

#SPJ1

Aaron tracks the time it takes him to mow lawns by writing coordinate points relating x, the time in hours it takes to mow a lawn, and y, the area of land mowed in acres. Two of his points are (3, 1.5) and (5, 2.5). Which statement describes the slope of the line through these two points? It takes Aaron about 1 hour to mow 2 acres. Aaron’s rate for mowing lawns is 0.5 acres per hour. The ratio of acres to time is 5 acres to 3 hours. The rate to mow a lawn is 0.6 hours per acre.

Answers

Answer: Aaron’s rate for mowing lawns is 0.5 acres per hour

Step-by-step explanation:

Hope this helps!!

The statement "The rate to mow a lawn is 0.5 acres per hour" correctly describes the slope of the line passing through the given points.

We have,

To determine the slope of the line passing through the points (3, 1.5) and (5, 2.5), we can use the slope formula:

Slope = (change in y) / (change in x)

Given the two points, we can calculate the change in y and the change in x:

Change in y = 2.5 - 1.5 = 1

Change in x = 5 - 3 = 2

Plugging these values into the slope formula:

Slope = 1 / 2 = 0.5

The slope represents the rate of change of the y-coordinate (area) with respect to the x-coordinate (time).

In this case, a slope of 0.5 means that for every hour it takes Aaron to mow a lawn (change in x), the area mowed (change in y) increases by 0.5 acres.

Therefore,

The statement "The rate to mow a lawn is 0.5 acres per hour" correctly describes the slope of the line passing through the given points.

Learn more about slope here:

https://brainly.com/question/23087740

#SPJ2

5t+7+8b
I need also help on -2(x+3)=_-6

Answers

The solution to the equation -2(x + 3) = -6 is x = 0.

To simplify the expression 5t + 7 + 8b, we can combine like terms.

There are two like terms in the expression: 5t and 8b.

Combining the like terms gives us:

5t + 8b + 7

Therefore, the simplified form of the expression 5t + 7 + 8b is 5t + 8b + 7.

Regarding the equation -2(x + 3) = -6:

To solve this equation, we can follow these steps:

Distribute the -2 to the terms inside the parentheses:

-2 * x + (-2) * 3 = -6

This simplifies to:

-2x - 6 = -6

Move the constant term to the right side by adding 6 to both sides of the equation:

-2x = 0

Divide both sides of the equation by -2 to isolate the variable x:

x = 0 / -2

Simplifying the right side of the equation gives us:

x = 0

The solution to the equation -2(x + 3) = -6 is x = 0.

The simplified expression 5t + 7 + 8b remains as 5t + 8b + 7, and the solution to the equation -2(x + 3) = -6 is x = 0.

For more questions on equation

https://brainly.com/question/17145398

#SPJ8

Point C has the same y-coordinate as point B and the distance between point B and point C is equal to the distance between point C and the y-axis. Point A has the same x-coordinate as point C and the distance between point A and point C is twice the distance between point B and point C. What is one possible location of point A? How many possible locations are there for point A?

Answers

The possible location of point A is (x, y), which is the same as the location of point B and point C, there is only one possible location for point A, and it is the same as the location of point B and point C.

Let's solve this step by step.

First, let's consider the information given:

Point C has the same y-coordinate as point B.

The distance between point B and point C is equal to the distance between point C and the y-axis.

Point A has the same x-coordinate as point C.

The distance between point A and point C is twice the distance between point B and point C.

Let's denote the coordinates of point B as (x, y), and we'll let y be the y-coordinate of point B.

From point 2, we know that the distance between point B and point C is equal to the distance between point C and the y-axis. This implies that point C lies on the vertical line passing through point B. So, the x-coordinate of point C is the same as that of point B, which is x.

From point 1, we know that point C has the same y-coordinate as point B, so the coordinates of point C are (x, y).

From point 4, we know that the distance between point A and point C is twice the distance between point B and point C. Since the distance between two points can be calculated using the distance formula, let's write the equations based on the given information:

Distance between point B and point C = Distance between point C and y-axis

√((x - x)² + (y - y)²) = √(x² + y²)

Simplifying the equation:

0 = √(x² + y²) - √(x² + y²)

This implies that the distance between point B and point C is 0, which means point B and point C coincide. Therefore, point A and point C also coincide since they have the same x-coordinate.

In summary, the possible location of point A is (x, y), which is the same as the location of point B and point C. So, there is only one possible location for point A, and it is the same as the location of point B and point C.

For such more questions on One Location for Point A

https://brainly.com/question/31857605

#SPJ8

what’s the domain and range of this graph ? PLEASE HELP URGENT

whats the domain and range of this graph ? PLEASE HELP URGENT

Answers

Step-by-step explanation:

Domain -5 range 5 ,...............

Other Questions
Which of the following are true of an advertising plan? (Check all that apply.) Multiple select question. It analyzes the marketing and advertising situation. It identifies the objectives of the advertising campaign. It indicates how a firm can determine whether the campaign was successful. It typically follows the same strategies for all campaigns. Why were slaves brought over to America? Can anyone tell me if u pass the ela state exam but u didn't pass the math state exam can u still go to 9th grade cuz im in 8th please answer and my grades are always good so does it help? and my classwork etc is always around 80-100 is it good 1What is the most common blood ta AB-b B-+2How much do fingernailsgrow per month?a 0.75 mmb 1.5 mmc 3 mm3Where exactly is your heart?a On the left of your chest.b In the middle of your chest.c In the middle of your chest, a b4 How long are the human intestinea 3.5 mb 8.5 mC 13.5 m Clans were groups of people connected through family.: True False The cholera toxin targets intestinal epithelial cells and not stomach cells because what type of regulator protein is binding to the operator in this possible operon? an attenuator an activator a repressor a coactivator an inducer 5. Point G(5, 3) is rotated 90counterclockwise about the origin. Whatare the coordinates of its image?A. G'(5,3)B. G'(-3,5)C. G'(-5,-3)D. G'(3, 5) Which of the following is usually set up by a hacker outside the building? Question 15 options: A) a rogue access point B) an evil twin access point C) both A and B D) neither A nor B *PLEASE ANSWER, ITS CONFUSING*What was the significance of the battle at Fort Wagner?a.) The special skills applied by an all-female unit challenged the assumption that women could not be useful agents of war.b.) The mettle showed by African-American troops demonstrated that race was not a significant factor in a soldier's capability or courage.c.) African-American soldiers led the charge, eager to fight, but were stopped and turned by back by white soldiers. six sigma describes the measurement of quality as 3.4 defects per million.T/F choose the correct one compared to conventionally grown fruits and vegetables, those grown with organic farming methods contain significantly higher amounts of vitamins and minerals. group of answer choices true false I will give you BRAINLIEST POINT.Support your explanation of your reaction and interpretation with specific evidence from the story . suppose scientists discover a living unicellular organism on another planet. this organism carries out aerobic respiration with enzymes and electron transport proteins that share both functional and structural similarities to those found in aerobic bacteria on earth. what would such a finding imply? At Mattel the marketing info system stores data on regional sales activities, promotional costs,and international inventory levels. These data are examples of external sources. FALSE Which of the following genres is a short story used to illustrate a moral,usually with animals as characters?O A. FableO B. ParableO C. ParodyD. Satire Select all the statements that are true about rectangles. what was the average rate of change of annual sales between 2001 and 2002? I am having trouble with A I got 9 million & i thought it was correct. Find each product or quotient. xy / 4xy