Use an indirect proof to prove SSS Inequality Theorem (Theorem 5.14 ).

Answers

Answer 1

To prove the SSS Inequality Theorem using an indirect proof, we need to assume the opposite of what we are trying to prove and show that it leads to a contradiction.

The SSS Inequality Theorem states that for any triangle, the sum of the lengths of any two sides must be greater than the length of the third side.

Assume that there exists a triangle ABC where the sum of the lengths of two sides is not greater than the length of the third side. Without loss of generality, let's assume that AB + BC ≤ AC.

Now, consider constructing a triangle ABC where AB + BC = AC. This would mean that the triangle is degenerate, where points A, B, and C are collinear.

In a degenerate triangle, the sum of the lengths of any two sides is equal to the length of the third side. However, this contradicts the definition of a triangle, which states that a triangle must have three non-collinear points.

Therefore, our assumption that AB + BC ≤ AC leads to a contradiction. Hence, the SSS Inequality Theorem holds true, and for any triangle, the sum of the lengths of any two sides is greater than the length of the third side.

Learn more about Inequality here

https://brainly.com/question/30238989

#SPJ11


Related Questions

What is -5+20 equal?

Answers

Answer:

15 it is like normal addition

need help ace

help pls

need help acehelp pls

Answers

Answer:

Hello I am an ace! answer: 8

Step-by-step explanation:

Volume for a cube is just length × width × height so you only need to know 1 for a cube because they will all be the same number so 8 is the answer because 8 × 8 × 8 = 512 Hope this helps!

I need help to solve the equation

I need help to solve the equation

Answers

Answer:

D) X=-6

Step-by-step explanation:

PPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPL::::::::::::::::::PPease

PPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPL::::::::::::::::::PPease

Answers

The slope of the line 8/5.

A walking path across a park is represented by the equation y = - 4x + 10. A new path will be built perpendicular to this path. The paths will intersect at the point (4, -6). Identify the equation that represents the new path.

A. y = 1/4 x - 7

B. y = 4x - 22

C. y = -4x + 10

D. y = -1/4 x - 5​

A walking path across a park is represented by the equation y = - 4x + 10. A new path will be built perpendicular

Answers

Answer

C. y = -4x + 10 is your answer

Step-by-step explanation:

Thank you for adding the image I hope I helped :)

I’m having trouble converting mixed fractions to proper fractions can someone explain?

Answers

Answer:

See below

Step-by-step explanation:

To get the fraction from mixed number you just need to take the number standing alone, multiply with the denominator and add with the numerator and keep it on top with the denominator in place to turn it into a fraction.

For example, [2]3/4 = 2*4 + 3 = 11 => the fraction is 11/4.

Solve -6x +18> -30.
A. x < 2
B. x > 2
C. x > 8
D. x < 8

Answers

Answer: D, x < 8

Step-by-step explanation: Subtract 18 from both sides.

Simplify the expression

Subtract the numbers

Subtract the numbers

Divide both sides by the same factor, and flip the relation because the factor is negative

Cancel terms that are in both the numerator and denominator

Divide the numbers

−6x+18−18>−30−18=

=x<8

in triangle ABC, AB = 6 cm, BC = 13cm and angle ACB = 23 degrees. Calculate angle BÁC, which is obtuse.

in triangle ABC, AB = 6 cm, BC = 13cm and angle ACB = 23 degrees. Calculate angle BC, which is obtuse.

Answers

Answer:

BAC=18013sin236

Step-by-step explanation:

sin(BAC)13=sin236sinBAC=13sin236BAC=18013sin236

Please help me! thank you
Suppose an object is thrown upward with initial velocity of 48 feet per second from a high of 120 feet. The height of the object t seconds after it is thrown is given by h(t)=-16t^2+48t+120. Find the average velocity from t=2 to t=4.
Type your answer as a number with no units.

Answers

The average velocity from t = 2s to t = 4s would be - 48 ft/s.

What are algebraic expressions?

In mathematics, an expression or mathematical expression is a finite combination of symbols that is well-formed according to rules that depend on the context.

Mathematical symbols can designate numbers (constants), variables, operations, functions, brackets, punctuation, and grouping to help determine order of operations and other aspects of logical syntax.

Given is that an object is thrown upward with initial velocity of 48 feet per second from a high of 120 feet. The height of the object t seconds after it is thrown is given by h(t) = - 16t² + 48t + 120.

Average velocity

Average rate of change of velocity with time is called average velocity. Mathematically -

v{avg.} = Δx/Δt                                                         .... Eq { 1 }

Δx = x(4) - x(2)

Δx = - 16(4)² + 48(4) + 120 - {- 16(2)² + 48(2) + 120}

Δx = - 96

Δt = 4 - 2 = 2

So -

v{avg.} = Δx/Δt = -96/2 = - 48 ft/s

Therefore, the average velocity from t = 2s to t = 4s would be - 48 ft/s.

To solve more questions on functions, visit the link below-

brainly.com/question/17613163

#SPJ1

Studies suggest that when given negative feedback by teachers, girls tend to attribute their failure to ___, whereas boys attribute their failure to ___. Question 16 options: fussy grading or lack of effort; lack of ability. lack of ability; fussy grading or lack of effort. fussy grading; lack of effort. lack of ability; lack of ability.

Answers

Studies suggest that when given "negative-feedback" by teachers, girls attribute their failure to lack-of-ability, while boys attribute their failure to fussy-grading or lack-of-effort, Option (e) is correct.

This difference in attribution can be attributed to gender-based societal expectations and stereotypes. Girls, often facing societal pressure and stereotypes related to their intelligence and abilities, may internalize negative-feedback and attribute their failures to a lack of inherent ability.

The Boys may feel less societal pressure related to their abilities and may be more likely to attribute failures to external factors such as grading standards or lack of effort. It is important to recognize these gender differences in attribution to promote equitable and unbiased feedback and support for all students, regardless of their gender.

Therefore, the correct option is (e).

Learn more about Feedback here

https://brainly.com/question/32125220

#SPJ4

The given question is incomplete, the complete question is

Studies suggest that when given negative feedback by teachers, girls tend to attribute their failure to ___, whereas boys attribute their failure to ___.

(a) lack of effort; fussy grading

(b) lack of effort; lack of ability

(c) fussy grading; lack of effort

(d) fussy grading; lack of ability

(e) lack of ability; fussy grading or lack of effort.

If the measure of ∠1 is 50°, what is the measure of ∠8?

If the measure of 1 is 50, what is the measure of 8?

Answers

Hey there! :)

Answer:

Measure of ∠8 is 130°.

Step-by-step explanation:

We can solve for ∠8 in multiple steps:

∠1 = 50°

∠5 = 50° due to corresponding angles being equivalent

180° - m∠5 = m∠8 due to supplementary angles

180° - 50° = m∠8 = 130°

Therefore, the measure of ∠8 is 130°.

Answer: The measure of angle 8 is 130 degrees.

Step-by-step explanation:

Angle 8 and angle 4 has the same measures.  The same way angle 1 and angle 5 also have the same measures.So we know that angle 1 is 50 degrees so angle 5 is also 50 degrees. Angle 5 and  8 lies on a straight line.And straight lines have a measure of 180 degrees.So we know that angle 5 is 50 degrees so what angle measure will 50 degrees add up to get 180 degrees.

Use the equation

50 + x =180  solve for x

-50       -50

x = 130

This means angle 8 is 130 degrees .

Given f(x) = 5x - 3

a. Find f(-4). Show your work.



b. Find x when f(x) = 25. Show your work.

Answers

Answer:

a. -23

Step-by-step explanation:

a.

put -4 where x is

5x - 3

5(-4) - 3

-20 -3

-23

b.

5x - 3 = 25

A nonhomogeneous equation and a particular solution are given. Find a general solution for the equation. y" + 15y' +56y=112x² + 60x + 4 + 72 eX, Yp(x) = e* Xp(x)= ex + 2x² CHIE The general solution is y(x) = (Do not use d, D, e, E, i, or I as arbitrary constants since these letters already have defined meanings.)

Answers

The general solution of the differential equation y'' + 15y' + 56y = 112x² + 60x + 4 + 72e^x, Yp(x) = ex + 2x² is given byy(x) = c1e^-7x + c2e^-8x + ex + 56x² - 128x + 1 where c1 and c2 are arbitrary constants.

We are given a nonhomogeneous equation and a particular solution: y" + 15y' + 56y = 112x² + 60x + 4 + 72e^x, Yp(x) = ex + 2x²

We need to find the general solution for the equation. In order to find the general solution of a nonhomogeneous differential equation, we add the general solution of the corresponding homogeneous equation with the particular solution obtained above.

We have the nonhomogeneous differential equation: y" + 15y' + 56y = 112x² + 60x + 4 + 72e^x

We first obtain the characteristic equation by setting the left-hand side equal to zero: r² + 15r + 56 = 0

Solving this quadratic equation, we obtain: r = -7 and r = -8

The characteristic equation of the homogeneous differential equation is: yh = c1e^-7x + c2e^-8x

Now, we find the particular solution for the nonhomogeneous differential equation using the method of undetermined coefficients by assuming the solution to be of the form: Yp = ax² + bx + c + de^x

We obtain the first and second derivatives of Yp as follows:Yp = ax² + bx + c + de^xYp' = 2ax + b + de^xYp'' = 2a + de^x

Substituting these values in the original nonhomogeneous differential equation, we get:

                                 2a + de^x + 15(2ax + b + de^x) + 56(ax² + bx + c + de^x) = 112x² + 60x + 4 + 72e^x

Simplifying the above equation, we get:ax² + (3a + b)x + (2a + 15b + 56c) + (d + 15d + 56d)e^x = 112x² + 60x + 4 + 72e^x

Comparing coefficients of x², x, and constants on both sides, we get:

                                    2a = 112 ⇒ a = 563a + b = 60

                                     ⇒ b = 60 - 3a

                                     = 60 - 3(56)

                                        = -1282a + 15b + 56c

                                      = 4 ⇒ c = 1

Substituting the values of a, b, and c, we get:Yp(x) = 56x² - 128x + 1 + de^x

The given particular solution is: Yp(x) = ex + 2x²

Comparing this particular solution with the above general form of the particular solution, we can find the value of d as:d = 1

Therefore, the particular solution is:Yp(x) = ex + 56x² - 128x + 1

The general solution is the sum of the homogeneous solution and the particular solution.

We have: y(x) = yh + Yp = c1e^-7x + c2e^-8x + ex + 56x² - 128x + 1

The arbitrary constants c1 and c2 will be found from initial or boundary conditions.

The general solution of the differential equation y'' + 15y' + 56y = 112x² + 60x + 4 + 72e^x, Yp(x) = ex + 2x² is given byy(x) = c1e^-7x + c2e^-8x + ex + 56x² - 128x + 1 where c1 and c2 are arbitrary constants.

Learn more about differential equation

brainly.com/question/32524608

#SPJ11

In the past, the output of a process had a mean of 2.050 and a standard deviation of 0.020 liters. If a current sample of output had these values {2.038 2.054 2.053 2.055 2.059 2.059 2.009 2.042 2.053 2.047}, would that indicate that the process is still "in order" (as opposed to being "out of order")? What if the sample was {2.022 1.997 2.044 2.044 2.032 2.045 2.045 2.047 2.030 2.044}?

Answers

For the first sample {2.038 2.054 2.053 2.055 2.059 2.059 2.009 2.042 2.053 2.047}, the process is still "in order," while for the second sample {2.022 1.997 2.044 2.044 2.032 2.045 2.045 2.047 2.030 2.044}, the process might be "out of order."

To determine whether the process is still "in order" or "out of order," we can compare the current sample of output to the known mean and standard deviation of the process.

For the first sample {2.038 2.054 2.053 2.055 2.059 2.059 2.009 2.042 2.053 2.047}:

Calculate the sample mean by summing up all the values in the sample and dividing by the number of values (n = 10):

Sample mean = (2.038 + 2.054 + 2.053 + 2.055 + 2.059 + 2.059 + 2.009 + 2.042 + 2.053 + 2.047) / 10 = 2.048.

Compare the sample mean to the known process mean (2.050):

The sample mean (2.048) is very close to the process mean (2.050), indicating that the process is still "in order."

Calculate the sample standard deviation using the formula:

Sample standard deviation = sqrt(sum((x - mean)^2) / (n - 1))

Using the formula with the sample values, we find the sample standard deviation to be approximately 0.019 liters.

Compare the sample standard deviation to the known process standard deviation (0.020):

The sample standard deviation (0.019) is very close to the process standard deviation (0.020), further supporting that the process is still "in order."

For the second sample {2.022 1.997 2.044 2.044 2.032 2.045 2.045 2.047 2.030 2.044}:

Calculate the sample mean:

Sample mean = (2.022 + 1.997 + 2.044 + 2.044 + 2.032 + 2.045 + 2.045 + 2.047 + 2.030 + 2.044) / 10 ≈ 2.034

Compare the sample mean to the process mean (2.050):

The sample mean (2.034) is noticeably different from the process mean (2.050), indicating that the process might be "out of order."

Calculate the sample standard deviation:

The sample standard deviation is approximately 0.019 liters.

Compare the sample standard deviation to the process standard deviation (0.020):

The sample standard deviation (0.019) is similar to the process standard deviation (0.020), suggesting that the process is still "in order" in terms of variation.

In summary, for the first sample, the process is still "in order" as both the sample mean and sample standard deviation are close to the known process values.

However, for the second sample, the difference in the sample mean suggests that the process might be "out of order," even though the sample standard deviation remains within an acceptable range.

For similar question on standard deviation.

https://brainly.com/question/12402189  

#SPJ8

Write in a verbal expression for each algebraic expression

c+2d

Answers

Therefore , the solution of the given problem of expression comes out to  be the first number plus twice the second number, or the summation of the numbers c and d.

How does one choose an expression?

An algebraic expression must be checked by replacing each variable with a number and performing arithmetic operations. In the example above, the answer variable is identical to 6, since 7 + 8 = 15. If we know the values of the variables, we can replace them with those values and evaluate the expression.

Here,

Assuming that:

The formula is as follows:

= c + 2d

Here, the real numbers are c and d.

c should be the first number.

The following number is d.

A digit is a mental construct that can be employed in the counting, measuring, and naming of objects. The numbers include 1, 2, 56, etc. as an example.

the two-fold sum between the first and second numbers.

In term of c and d, or

the product of c and d divided by two

The first number plus twice the second number, or the summation of the numbers c and d, is what the mathematical equation c + 2d means in verbal form.

Therefore , the solution of the given problem of expression comes out to  be the first number plus twice the second number, or the summation of the numbers c and d.

To know more about expressions visit :-

brainly.com/question/14083225

#SPJ1

someone please answer this, ill give you brainliest and your getting 100 points.

someone please answer this, ill give you brainliest and your getting 100 points.

Answers

Answer: D

Step-by-step explanation:

The solution of the systems would be the intersection between them, which in this case, would be D.

Find the surface area of a square pyramid with base edges of 8 feet. The height of each lateral face is 9 feet. Explain or show how you got your answer.
PLS I WANT FULL EXPLANATIONS ON HOW U GOT UR ANSWER!!!!!!

Answers

Answer:

hey j its me toga my acc. has been banned for 2 days 0-0

Step-by-step explanation:

use the proportion to find the missing dimension of the original rectngle x 3/5 = 20/12

Answers

The missing dimension of the original rectangle is 5 units.

How to find the missing dimension of the rectangle?

We're given a proportion:

x/3 = 20/12

where x represents the missing dimension of the original rectangle.

The equation can be interpreted as:

The ratio of x to 3 is equal to the ratio of 20 to 12.

To solve for x, we want to isolate it on one side of the equation. We can do this by cross-multiplying, which means multiplying both sides of the equation by the product of the denominators:

12 * (x/3) = 12 * (20/12)

Simplifying the right-hand side, we get:

12 * (20/12) = 20

On the left-hand side, we can simplify the fraction by canceling out the factor of 3 in the numerator and denominator:

12 * (x/3) = 4x

Putting it all together, we get:

4x = 20

Now, we can solve for x by dividing both sides of the equation by 4:

4x/4 = 20/4

x = 5

Therefore, using the proportion the missing dimension of the original rectangle is 5 units.

Learn more about proportions

brainly.com/question/30657439

#SPJ11

At a price of one dollar, 200 units are demanded, and at a price of $9, zero units are demanded. If the demand equation is linear, x is the price and D is the number of units, the demand equation is: a. D=-.04x +.36 b.D= -25x +225 c.D=-.04x + 8 d. D = 25x + 175

Answers

The demand equation is  b. D = -25x + 225.

Since the demand equation is linear and involves "x" as the price, and "D" as the number of units, we can use the two points given to determine the equation.

At a price of $1, 200 units are demanded: (1, 200)
At a price of $9, 0 units are demanded: (9, 0)

Now, we can find the slope (m) using the formula:

m = (y2 - y1) / (x2 - x1)

In this case:

m = (0 - 200) / (9 - 1)
m = -200 / 8
m = -25

Now, we can use one of the points (either point will give the same result) to find the y-intercept (b) by plugging the values into the linear equation:

D = m * x + b

Using the point (1, 200):

200 = -25 * 1 + b
b = 200 + 25
b = 225

Now, we have the demand equation:

D = -25x + 225

So the correct answer is: b. D = -25x + 225.

Learn more about "equation": https://brainly.com/question/2972832

#SPJ11

Use the graph shown below to identify the multiplicity of the roots of f(x)=0.

Use the graph shown below to identify the multiplicity of the roots of f(x)=0.

Answers

If the multiplicity of the roots was 3, the curve would still be tangent to the x-axis at -3 and 3, but the curve would cross the x-axis.

The graph below is the graph of the equation f(x) = 0. The equation is graphed on the x-y plane. To determine the multiplicity of the roots, one needs to look at the graph closely.

The multiplicity of the roots of a polynomial function is a way of determining the behavior of the function as it approaches a particular point on the x-axis. In particular, it tells us how quickly the function approaches zero at that point.

The graph shows a curve that intersects the x-axis at -3 and 3. At these two points, the curve is tangent to the x-axis. Since the curve is tangent to the x-axis at these points, this means that the roots are repeated.

The multiplicity of the roots of f(x) = 0 is 2. This means that the curve touches the x-axis at -3 and 3, but doesn't cross it. This is because the roots are repeated.

If the multiplicity of the roots was 3, the curve would still be tangent to the x-axis at -3 and 3, but the curve would cross the x-axis.

For more such questions on tangent, click on:

https://brainly.com/question/30162650

#SPJ8

Apples are prepared in a process with two resources. The first resource has a capacity of 2.1 apples per hour. The capacity of the second resource is 4.4 apples per hour. The first resource has 1 worker and the second resource has 4 workers. Demand for this process is 1.6 apples per hour. Wages are $8 per hour.
What is the cost of direct labor (in $)?per unit

Answers

The cost of direct labor per unit is $5.628 per apple.

To calculate the cost of direct labor per unit, we need to determine the total labor hours required to produce one unit of output and then multiply it by the wage rate.

Let's denote the labor hours required for the first resource as "L₁" and the labor hours required for the second resource as "L₂".

The first resource has a capacity of 2.1 apples per hour, and the demand is 1.6 apples per hour. Therefore, the labor hours required for the first resource per unit of output are:

L₁ = 1 apple / (2.1 apples/hour) = 0.4762 hours/apple (rounded to 4 decimal places)

The second resource has a capacity of 4.4 apples per hour, and the demand is 1.6 apples per hour. Therefore, the labor hours required for the second resource per unit of output are:

L₂ = 1 apple / (4.4 apples/hour) = 0.2273 hours/apple (rounded to 4 decimal places)

Now, let's calculate the total labor hours required per unit:

Total labor hours per unit = L₁ (first resource) + L₂ (second resource)

= 0.4762 hours/apple + 0.2273 hours/apple

= 0.7035 hours/apple (rounded to 4 decimal places)

Finally, to calculate the cost of direct labor per unit, we multiply the total labor hours per unit by the wage rate:

Cost of direct labor per unit = Total labor hours per unit * Wage rate

= 0.7035 hours/apple * $8/hour

= $5.628 per apple (rounded to 3 decimal places)

To know more about direct labor:

https://brainly.com/question/13126873

#SPJ4

A square is divided into three congruent rectangles. The middle rectangle is removed and replaced on the side of the original square to form an octagon as shown. What is the ratio of the length of the perimeter of the square to the length of the perimeter of the octagon?

Give your ratio in its simplest form.

A square is divided into three congruent rectangles. The middle rectangle is removed and replaced on

Answers

Answer:

The ratio of the length of the perimeter of the square to the lenght of the perimeter of the octagon is 3/5

Step-by-step explanation:

Let's call the side length of the square, x

then it's perimeter is the sum of all of it's sides so it is Ps = 4x

for the octagon, we have the small increments which are 1/3x since 3 of these make up a side

Now, there are 5 segments in the octagon with x length and there are 5

segments in the octagon with length 1/3x (3 vertical segments (on the left)

and 2 horizontal segments (top right and bottom right))

so the perimeter for the octagon will be,

Po = 5(x) + 5(1/3)(x)

Po = 5x + (5/3)x

Po = (20/3)x

And the ratio of the length of the perimeter of the square to the octagon is then,

Ps/Po=(4x)/(20/3)xPs/Po=1/(5/3)Ps/Po=3/5

Hence the ratio is 3/5

proof this identity is by using this graph​

proof this identity is by using this graph

Answers

Answer:

I don't know how to solve this mathematics

Step-by-step explanation:

......................

proof this identity is by using this graph

PLEASE HELP ASAP (20 POINTS)
Jim is showing his work in simplifying (−8.5 + 6.1) − 1.3.

Step 1: (6.1 − 8.5) − 1.3
Step 2: 6.1 − (8.5 + 1.3)
Step 3: 6.1 − (9.8)
Step 4: 1.1

Which statement is true?

In step 1, Jim used the associative property.

In step 2, Jim used the distributive property.

In step 3, Jim used the commutative property.

In step 4, Jim's answer is incorrect.

Answers

In step 1, Jim used the associative property

Answer:

In step 1, Jim used the associative property

Step-by-step explanation:

The lenngths of the sides of the triangle are in the extended ratio 8:9:10. The primeter of the triangle is 108 cm.What are the lengths of the sides?
The lengths of the sides of the triangle in cm are____?
Please help I really need this!

Answers

Answer:

Side known in ratio as 8: 32

Side known in ratio as 9: 36

Side known in ration as 10: 40

Step-by-step explanation:

We can add all the numbers in the ration to form the sum of all the sides, or also equal to perimeter. 8+9+10 equals 27.

So we can write 27x=108

x=4. Multiply 4 to 8, then 9, then 10. You get 32, 36, 40

Hope this helped, Have a Great Day!!

Georgia's score report said that her ACT Math score was in the 90th percentile.

1. What does this mean in the context of the problem?

2. Approximate her score (within two tenths of a point) on the Math section of the ACT. (Using Desmos is the easiest way...)

3. If her English score was a 29, what percentile was she in for her English score?

Answers

1. Georgia's ACT Math score in the 90th percentile places her in the top 10%. 2. Approximating Georgia's ACT Math score within two tenths on a scale of 1 to 36. 3. Percentiles vary based on score distribution and test-taker performance, influencing the interpretation of individual scores.

1. In the context of Georgia's ACT Math score being in the 90th percentile, it means that Georgia performed better than approximately 90% of the test-takers who took the ACT Math section. Her score is among the top 10% of all test-takers who took the exam.

2. To approximate Georgia's Math score on the ACT within two tenths of a point. The ACT Math section is scored on a scale of 1 to 36, with 36 being the highest possible score.

3. Percentiles are calculated based on the distribution of scores among test-takers, and they depend on the specific score range and the performance of other test-takers.

To know more about distribution here

brainly.com/question/29509087

#SPJ1

simplify and find each side
angles are 45 45 90!
will mark brainiest!

simplify and find each side angles are 45 45 90!will mark brainiest!

Answers

Answer:

X = 4.47  Y = 8.94

Step-by-step explanation:

25= 2.23606798

2.23606798 x 2 = 4.47213596

-------

4.47213596

4.47213596^2 + 4.47213596^2 = 8.94427192^2

8.94427192^2 = 80

Square root of 80 is 8.94

Consider the following T bills:

Maturity Bid Ask
8-2 6.36 6.20
8-16 6.42 6.26

The T bills maturing August 2nd (8-2) are being offered at par
a. less a discount to yield 6.20%
b. plus a premium to yield 6.20%
c. less a discount to yield 6.36%
d. plus a premium to yield 6.36%

Answers

The correct answers are:

a. less a discount to yield 6.20%

d. plus a premium to yield 6.36%

Based on the provided information, the T bills maturing on August 2nd (8-2) are being offered at a bid yield of 6.36% and an ask yield of 6.20%.

To determine whether the T bills are being offered at a discount or a premium, we compare the bid yield and ask yield to the stated yields.

a. To yield 6.20% (ask yield), the T bills are being offered at a discount. Therefore, option a. "less a discount to yield 6.20%" is correct.

b. To yield 6.20%, the T bills are not being offered at a premium. Therefore, option b. "plus a premium to yield 6.20%" is incorrect.

c. To yield 6.36% (bid yield), the T bills are not being offered at a discount. Therefore, option c. "less a discount to yield 6.36%" is incorrect.

d. To yield 6.36%, the T bills are being offered at a premium. Therefore, option d. "plus a premium to yield 6.36%" is correct.

Learn more about discount  here:-

https://brainly.com/question/29205061

#SPJ11

5. 37°. If maN = (13x)° what is the value of x and the maN?

5. 37. If maN = (13x) what is the value of x and the maN?

Answers

The value of x is approximately 2.8462° and the value of maN is 37°.



To find the value of x and maN, we need to use the given information. According to the question, maN is equal to (13x)°.
To solve for x, we can set up an equation:
maN = (13x)°
Now, since we know that maN is equal to 37°, we can substitute this value into the equation:
37° = (13x)°
To isolate x, we divide both sides of the equation by 13:
37° / 13 = (13x)° / 13
This simplifies to:
2.8462° ≈ x°
Therefore, the value of x is approximately 2.8462°.
Now, let's find the value of maN. We already know that maN is equal to (13x)°. Substituting the value of x that we just found, we get:
maN = (13 * 2.8462)°
Simplifying the multiplication:
maN = 37°
So, the value of maN is 37°.
For more such questions on approximately

https://brainly.com/question/28521601

#SPJ8

x - 9 = 0.7*x + 0.6*x

Answers

Answer:

x = -30

Step-by-step explanation:

0.7x+0.6x=1x9=>1.3x=1x9=>1.3x1x=9=>0.3x=9=>310x=9=>x=9103=30

Other Questions
Which of the following is/are associated with cAMP binding to cAMP-dependent protein kinase/PKA?I. cAMP binds to the regulatory subunitsII. Tetrameric regulatory subunits and catalytic subunits dissociateIII. Catalytic subunits phosphorylate multiple targets with specific serine and threonine residuesIV. cAMP is membrane bound via phosphoinositol attachmenta.III, IVb.II, III, IVc.I, II, III, IVd.I, IIe.I, II, III (a).calculate the height (in m) of a cliff if it takes 2.13 s for a rock to hit the ground when it is thrown straight up from the cliff with an initial velocity of 8.02 m/s(b) How long would it take to reach the ground if it is thrown straight down with the same speed? lilly went to the yummy fork for lunch, and when her food arrived, it was not what she ordered. she later posted a negative comment about the yummy fork on a blog. which one of the five service dimensions was used by lilly to determine she did not like the service by the yummy fork? multiple choice question. empathy tangibles reliability assurance Fawn ran a 5-kilometer race in 66 minutes. To the nearest hundredth, what was her speed in meters per second? A. 1.26 B. 0.08 C. 0.13 D. 75.76 There is a rule of thumb that says it costs _____ times more to acquire a new customer compared to maintaining a loyal one. The equity of Lime Company is $150,000 and the total liabilities are $90,000. The total assets are ________. Group of answer choices on the map of asia, what is the capital of the starred country? question 5 options: ulann bator beijing taipei seoul a transcriptional repressor that controls the transcription of gene a is not normally active unless bound by an effector molecule x. in a certain cell, the domain of the repressor that binds x is mutated so that x can no longer be bound. with all other factors being the same, what effect do you predict on the transcription of gene a if x is aded to the cell when it is already transcribing gene a? Using the given zero, find all other zeros of f(x).PLEASE HELP-2i is a zero of f(x) = x4 - 5x2 - 36 2i, 6i, -6i 2i, 3i, -3i 2i, 6, -6 2i, 3, -3 When a buffalo egg and sperm unite, a fertilized egg with 60 chromosomes is produced. how many chromosomes do the egg and sperm have before fertilization? a.the egg and sperm each have 30 chromosomes, because the fertilized egg receives one set of chromosomes from each parent. b.the egg has 20 chromosomes and the sperm has 10, because eggs are larger and therefore provide more chromosomes during fertilization. c.the egg has 40 chromosomes and the sperm has 20, because eggs are larger and therefore provide more chromosomes during fertilization. d.the egg and sperm each have 60 chromosomes, because the fertilized egg has the same number of chromosomes as all the cells of an organism. Choose the best Spanish word to complete the sentence.No _______en ese cuarto. (Don't enter that room.)entresentranentrarentras What is the measure of angle Y, in degrees? A rectangle A with length 10 centimeters and width 5 centimeters is similar to another rectangle B whose length is 30 centimeters. Find the area of rectangle B.A. 450 centimeters squaredB. 350 centimeters squaredC. 750 centimeters squaredD. 650 centimeters squared The email asked her to provide her password. Sarah later found out that the email was not from her bank and that she had given sensitive information to someone who gained access to her accounts. This is an example of a ____________. What is the final volume of a 5.0 l sample of a gas that is compressed from 1.0 atm to 1.3 atm? Please, discuss the integration of point-of-sales (POS), inventory, procurement, forecasting, vendor management, contracts, manufactures and providers in a retail organization (any type of business). Your document needs to be a white paper format, with table of contents, introduction, problem discussion, solution proposed, conclusions, references. Remember to format your paper according to the APA guidelines. Consider the minimization problem:Minimize:P(w1,w2,w3)=5w1+6w2+4w3Subject to:w1+2w2 65w1+3w2+3w324w1,w2,w3,0.Write down the initial simplex tableau of the corresponding dual problem, and use the theorem of duality to find the minimum value of P in the primal problem. If a 1,000 kg car is accelerating at a rate of 4 and experiencing 300 N of drag force, how much force do the engines have to produce? Ignore any frictional effects with the road. O 3,700N O 16,300NO 4,300N O 15,700N O 4,000N Help on this one plz When performing the urease test, the agar changes from blue to green if the organism is producing urease.TrueFalseMacroscopic examination of the bacterial unknown can provide all the following exceptColony morphologyGrowth patterns in brothOxygen requirementsTemperature preferenceCell arrangement and shape of individual bacteriaGenotypic testing can be used to identify the presence or absence of a specific species of bacteria from a mixed sample.TrueFalse