Find all solutions to each quadratic equation.

x²+5=4 x

Answers

Answer 1

The standard quadratic form refers to the canonical form or standard representation of a quadratic equation. To find all solutions to the quadratic equation x² + 5x = 4, we need to rewrite the equation in standard quadratic form-

(ax² + bx + c = 0).x² + 5x - 4 = 0

Now, we can solve this quadratic equation by factoring, completing the square, or using the quadratic formula.

Let's solve it by factoring:(x + 4)(x - 1) = 0

Setting each factor equal to zero:

x + 4 = 0 --> x = -4

x - 1 = 0 --> x = 1

Therefore, the solutions to the quadratic equation x² + 5x = 4 are x = -4 and x = 1.

To know more about Standard Quadratic Form visit:

https://brainly.com/question/29269455

#SPJ11


Related Questions

1.Round 3 601 111 to the nearest million
2. Round 17.81 to the nearest whole number
3. Round 59.52 to the nearest 1 d.p.
4. Round 7.176 to the nearest 2d.p.
(Pls help me…)

Answers

Answer:

See explanation

Step-by-step explanation:

Rules to follow when rounding

1. If the number you are rounding is followed by 5, 6, 7, 8, or 9, round the number up. Eg: 56 rounded to the nearest ten is 60

2. If the number you are rounding is followed by 0, 1, 2, 3, or 4, round the number down. Example: 23 rounded to the nearest ten is 20

3. All the numbers to the right of the place you are rounding to become zero

1.Round 3 601 111 to the nearest million

= 4,000,000

2. Round 17.81 to the nearest whole number

= 18

An whole number is a number without a decimal point

3. Round 59.52 to the nearest 1 d.p.

= 59.5

1 d.p means one digits after the decimal point

4. Round 7.176 to the nearest 2d.p.

= 7.18

2 d.p means two digits after the decimal point

PLEASE HELP!!! Any experts? If it's okay, I need a brief explanation on this :)

PLEASE HELP!!! Any experts? If it's okay, I need a brief explanation on this :)

Answers

Answer:

93 is the answer. Hope this help

Step-by-step explanation:

PLEASE HELP!!! Any experts? If it's okay, I need a brief explanation on this :)

Election polling Gloria Chavez and Ronald Flynn are the candidates for mayor in a large city. We want to estimate the proportion p of all registered voters in the city who plan to vote for Chavez with 95% confidence and a margin of error no greater than 0.03. How large a random sample do we need? Show your work.

Answers

A random sample of approximately 1067 registered voters is needed to estimate the proportion of voters planning to vote for Chavez with 95% confidence and a margin of error no greater than 0.03.

To estimate the proportion p of all registered voters in the city who plan to vote for Chavez with 95% confidence and a

margin of error no greater than 0.03, we need to determine the sample size. We can use the following formula for

sample size calculation:

n=(Z2×p×(1p))/E2
Where:
- n is the sample size
- Z is the Z-score (1.96 for 95% confidence)
- p is the estimated proportion of voters planning to vote for Chavez
- E is the margin of error (0.03 in this case)

Since we don't know the true proportion of voters planning to vote for Chavez, we can use the most conservative

estimate (p = 0.5) to ensure the required margin of error:

n=(1.962×0.5×(10.5))/0.032
n = (3.8416 × 0.25) / 0.0009
n = 0.9604 / 0.0009
n ≈ 1067

Therefore, a random sample of approximately 1067 registered voters is needed to estimate the proportion of voters

planning to vote for Chavez with 95% confidence and a margin of error no greater than 0.03.

for such more question on  random sample

https://brainly.com/question/24466382

#SPJ11

Suppose that you​ buy, and one year later​ sell, a foreign​ (British) bondLOADING. Under the following​ circumstances: When you buy the bond the exchange rate is ​$1. 50 ​= pound1. You pay pound45 ​($67. 50​) for the British bond. You sell the bond for pound50. No interest payment was expected or received. When you sell the​ bond, the exchange rate is​ $1. 80 ​= pound1

Answers

The exchange rate changed in your favor, so you made a profit of $13.50 on the foreign bond.

When you purchased the British bond, the exchange rate was $1.50 = pound1. This means that you paid $67.50 for the bond. One year later, when you sold the bond for pound50, the exchange rate had changed to $1.80 = pound1. This meant that the sale of the bond resulted in a profit of $13.50 for you. No interest payment was expected or received on the bond, so all of the profit was due to the favorable exchange rate change. This is an example of how exchange rate fluctuations can result in a profit or loss on foreign investments.so you made a profit of $13.50 on the foreign bond.

Learn more about rate here

https://brainly.com/question/13481529

#SPJ4

There are 4 red cars and 8 black cards in a bag. How is it likely that you will randomly draw a blue card

Answers

Answer:

C) Impossible

Step-by-step explanation:

Since there are no blue cards, the probability that you'd draw one is 0/12, which means that there is no chance you'll draw one.

X+5y=5
What is the slope intercept form of the equation

Answers

in slope intercept form it’s y = 1/5 x - 1

Answer:

y= 1- 1/5x

Step-by-step explanation:

x+5y=5

-x. -x

-------------

5y = 5-x

÷5. ÷5

-------------

y= 1 - 1/5x

Look at the equations below. Find a pair of equations whose lines are perpendicular.

Look at the equations below. Find a pair of equations whose lines are perpendicular.

Answers

The pair of equations whose lines are perpendicular is (d) y = 1/6x + 3; y = -6x - 3

Find a pair of equations whose lines are perpendicular.

from the question, we have the following parameters that can be used in our computation:

The pair of equations

By definition;

The slopes of perpendicular lines are opposite reciporcals

So, we have

(a) -1/3 and -3 false

(b) -3 and -6 false

(c) 3 and 3 false

(d) 1/6 and -6 true

Hence, the equations are (d) y = 1/6x + 3; y = -6x - 3

Read more about linear relations at

https://brainly.com/question/30318449

#SPJ1

Find the measure of

Find the measure of

Answers

Answer:

50 degrease

Step-by-step explanation:

90-40

oooooooooooohhhhhhhhhhhh aaaaaaaaaaaaaaahhhhhhhhhhhhhhhhhhhhhhhhh

oooooooooooohhhhhhhhhhhh aaaaaaaaaaaaaaahhhhhhhhhhhhhhhhhhhhhhhhh
oooooooooooohhhhhhhhhhhh aaaaaaaaaaaaaaahhhhhhhhhhhhhhhhhhhhhhhhh

Answers

Answer:

thats bustin bustin

Step-by-step explanation:

Suppose that the rational preference relation is continuous and monotone. Then there is a continuous utility function that represents the rational preference relation. Prove it with the help of a diagram for 2 commodity framework.

Answers

Yes, there is a continuous utility function that represents a rational preference relation when it is both continuous and monotone.

In a two-commodity framework, let's assume the two commodities are represented by X and Y. We can construct a diagram with the axes representing the quantities of X and Y. The indifference curves, which represent the bundles of X and Y that yield the same level of utility, can be plotted on this diagram.

Since the preference relation is continuous and monotone, we can draw the indifference curves as smooth, upward-sloping curves without any gaps or jumps. The upward slope reflects the monotonicity, indicating that more of either X or Y is preferred to less.

To represent this preference relation with a continuous utility function, we can assign utility levels to different bundles of X and Y. For example, we can assign a utility level of 1 to a specific bundle (X₁, Y₁), and higher utility levels to bundles that are preferred to (X₁, Y₁).

By assigning utility levels in a continuous manner across the diagram, we can construct a continuous utility function that represents the rational preference relation. This function will map each bundle of X and Y to a corresponding level of utility.

In conclusion, for a rational preference relation that is continuous and monotone in a two-commodity framework, there exists a continuous utility function that represents this preference relation. The utility function can be constructed by assigning utility levels to different bundles of commodities, and the resulting indifference curves on a diagram will be smooth, upward-sloping curves. This relationship between the utility function and the preference relation allows us to mathematically model and analyze the choices and preferences of individuals in economics.

To know more about continuous utility function, visit;
https://brainly.com/question/28593010
#SPJ11

The stopping distance D of an automobile is directly proportional to the square of its speed s. A car required 75 feet to stop when its speed was 30 miles per hour. Find the stopping distance if the brakes are applied when the car is traveling at 50 miles per hour.

Answers

The stopping distance for a car traveling at 50 mph is 208.3 feet.

We can set up a proportion using the given information and the formula for stopping distance:

D = k s²

where D is the stopping distance, s is the speed of the car, and k is a constant of proportionality.

Using the given information, we can solve for k:

75 = k * 30²

k = 75 / (30²) = 0.0833

Now we can use this value of k to find the stopping distance for a speed of 50 mph:

D = 0.0833 * 50² = 208.3 feet

Therefore, the stopping distance for a car traveling at 50 mph is 208.3 feet.

learn more about distance

https://brainly.com/question/15172156

#SPJ1

in a manufacturing process, a random sample of 36 manufactured bolts has a mean length of 3 inches with a standard deviation of .3 inches. what is the 99 percent confidence interval for the true mean length of the manufactured bolt?

Answers

The 99% confidence interval for the true mean length of the manufactured bolt is (2.9177, 3.0823)

Here, we need to construct a 99% confidence interval for population mean (μ) is given by

μ = x + Zα/2 * σ/√n   or    μ = x - Zα/2 * σ/√n

where, μ = population mean

x = sample mean

  = 3 inches

σ = population standard deviation

  = 0.3 inches

Zα/2= z score for a two tailed test at level of significance α = 2.576( for a 99% confidence level)

So, the upper limit would be,

μ = 3 + 1.645 * (0.3/√36)

μ = 3 + 1.646 * (0.3/6)

μ = 3.0823

And the lower limit would be,

μ = 3 - 1.645 * (0.3/√36)

μ = 3 - 1.646 * (0.3/6)

μ = 2.9177

Hence, the 99% confidence interval is (2.9177, 3.0823)

Learn more about confidence interval here:

https://brainly.com/question/24131141

#SPJ4

Max Z = 5x1 + 6x2
Subject to: 17x1 + 8x2 ≤ 136
3x1 + 4x2 ≤ 36
x1 ≥ 0 and integer
x2 ≥ 0
A) x1 = 5, x2 = 4.63, Z = 52.78
B) x1 = 5, x2 = 5.25, Z = 56.5
C) x1 = 5, x2 = 5, Z = 55
D) x1 = 4, x2 = 6, Z = 56

Answers

The option B) yields the highest value for Z, which is 56.5. Therefore, the correct answer is B) x1 = 5, x2 = 5.25, Z = 56.5

To determine the correct answer, we can substitute each option into the objective function and check if the constraints are satisfied. Let's evaluate each option:

A) x1 = 5, x2 = 4.63, Z = 52.78

Checking the constraints:

17x1 + 8x2 = 17(5) + 8(4.63) = 85 + 37.04 = 122.04 ≤ 136 (constraint satisfied)

3x1 + 4x2 = 3(5) + 4(4.63) = 15 + 18.52 = 33.52 ≤ 36 (constraint satisfied)

B) x1 = 5, x2 = 5.25, Z = 56.5

Checking the constraints:

17x1 + 8x2 = 17(5) + 8(5.25) = 85 + 42 = 127 ≤ 136 (constraint satisfied)

3x1 + 4x2 = 3(5) + 4(5.25) = 15 + 21 = 36 ≤ 36 (constraint satisfied)

C) x1 = 5, x2 = 5, Z = 55

Checking the constraints:

17x1 + 8x2 = 17(5) + 8(5) = 85 + 40 = 125 ≤ 136 (constraint satisfied)

3x1 + 4x2 = 3(5) + 4(5) = 15 + 20 = 35 ≤ 36 (constraint satisfied)

D) x1 = 4, x2 = 6, Z = 56

Checking the constraints:

17x1 + 8x2 = 17(4) + 8(6) = 68 + 48 = 116 ≤ 136 (constraint satisfied)

3x1 + 4x2 = 3(4) + 4(6) = 12 + 24 = 36 ≤ 36 (constraint satisfied)

From the calculations above, we see that options B), C), and D) satisfy all the constraints. However, option B) yields the highest value for Z, which is 56.5. Therefore, the correct answer is: B) x1 = 5, x2 = 5.25, Z = 56.5.

To know more about Constraint here:

https://brainly.com/question/33441689

#SPJ11

Can someone explain to me how to solve this question?

Can someone explain to me how to solve this question?

Answers

Answer:

1) D

2) C

Step-by-step explanation:

Can someone explain to me how to solve this question?

Draw a graph that illustrates the given situation: You ride your bike to your friend's house. You leave your house, which is at sea level and first go up a big hill for about a mile, then you ride on a flat surface for 2 miles. Next you hit a slight downhill for a mile, followed by another steep uphill for a half mile. You end your ride on the last half mile going downhill.
Use the x axis as your time and your y axis as vertical height above seal level. Label these on axis.

Answers

Answer:

Please find attached the required drawing that illustrates the given situation

Step-by-step explanation:

With a driving speed of 0.003 miles per second, which is approximately 4.83 meters per second, we have the drawing of the graph that represent the given situation which is create with Microsoft Excel and attached alongside here

The total time for the travel is approximately 2,244 second with a total distance of approximately 6.732 miles, using angles, 60° for a steep slope and 30° for a gentle slope

Draw a graph that illustrates the given situation: You ride your bike to your friend's house. You leave

Determine the number of terms n in each arithmetic series.
12) a1 = 13, d = 3, Sn = 1225

Answers

Answer:

The number of terms n in arithmetic series is n=25

Step-by-step explanation:

We are given:

a₁ = 13

d = 3

Sₙ = 1225

We need to find number of terms i.e n

The formula used will be: Sn=n2(2a+(n1)d)

Putting values and finding n

Sn=n2(2a+(n1)d)1225=n2(2(13)+(n1)3)1225=n2(26+3n3)1225=n2(23+3n)2(1225)=n(23+3n)2450=23n+3n23n2+23n2450=0

Now, solving using quadratic formula to find value of n:

n=b±b24ac2a

Putting values: a=3, b=23 and c=-2450

n=b±b24ac2an=23±(23)24(3)(2450)2(3)n=23±1736n=23+1736,n=231736n=25,n=983

So, we get: n=25,n=983

Since number of terms can't be negative so, n= 25

So, the number of terms n in arithmetic series is n=25

How do you compute term life insurance?

Answers

To calculate your life insurance coverage needs:

1. Add up your assets
Find the sum of your post-tax income and any liquid assets, like life insurance policies you already own, current investments, and future assets like social security benefits.

2. Add up your debts and financial obligations
Account for your yearly living expenses and debt payments and multiply them by the number of years your family would need support. Make sure to include future financial obligations, like college tuition.

3. Subtract your assets from your debts and financial obligations
The resulting number is the coverage gap — the amount of money your family would need to be financially comfortable in your absence, which is the minimum amount your
death benefit
should be. Your policy’s term (i.e., the amount of time your coverage lasts) should last as long as your family’s financial dependence requires.

The death benefit is paid as a lump sum, but your beneficiaries shouldn’t use it all at once. Much of it can be invested, and the rate of return can provide additional income to make the benefit last longer — but you’ll also want to consider the inflation rate over a 20- or 30-year term.

Work with a financial advisor to decide how to maximize the value of your death benefit and prepare your beneficiaries to take on the financial responsibility of the large payment.

(a) 11³ x 11=11
11³
||³ + x = || 2

Answers

Step-by-step explanation:

I suspect you mean

11³ × 11 = ?

11³ ÷ 11 = ?

11³ × 11 = 11⁴

11³ ÷ 11 = 11²

why ?

11³ = 11×11×11

11³ × 11 = 11×11×11 × 11 = 11×11×11×11 = 11⁴

11³ ÷ 11 = 11×11×11 / 11 = 11×11 × 1 = 11×11 = 11²

How do you write 10 more than a number?

Answers

The algebraic expression for 10 more than a number is x + 10 or 10 + x.

The x in the expression is called a variable, which can be represented by any letter in the alphabet.

An algebraic expression is a mathematical expression that consists of numbers, variables and operators, and its value can change.

Some basic mathematical operators are +, -, x and /.

The given phrase states that a result can be obtained by adding 10 more to the variable.

The variable x can be replaced by any number.

If x equals 2, then the expression x + 10 has a value of 12.

To know more about algebraic expression visit brainly.com/question/953809

#SPJ4

2
How do you write 5.4 × 10 in standard form?
The two is supposed to represent 2 10x10... or something like that,

Answers

Answer:

540 is the answer

Step-by-step explanation:

Move the decimal point 2 places to the right.

I hope my answer was helpful!:)

Write an equation of a line with the given slope m and y-intercept b
10. m = -1, b = 3

Answers

Answer:

y=-1x+3

Step-by-step explanation:

m goes in front of the x and the y int. gets add on to the equation

A student weighs out a 4.05 g sample of Na2SO4, transfers it to a 125 mL volumetric flask, adds enough water to dissolve it and then adds water to the 125 mL tick mark. What is the molarity of sodium sulfate in the resulting solution

Answers

The molarity of sodium sulfate in the resulting solution is 0.259 M. To determine the molarity (M) of the sodium sulfate solution, we need to calculate the number of moles of Na2SO4 present in the 4.05 g sample and then divide it by the volume of the solution in liters.

First, we calculate the number of moles of Na2SO4 using its molar mass. The molar mass of Na2SO4 is calculated as follows: 2(Na) + 1(S) + 4(O) = 2(22.99 g/mol) + 32.07 g/mol + 4(16.00 g/mol) = 142.04 g/mol.

Next, we convert the mass of the sample to moles by dividing it by the molar mass:

moles of Na2SO4 = 4.05 g / 142.04 g/mol = 0.0285 mol.

The volume of the solution is given as 125 mL, which is equivalent to 0.125 L.

Finally, we divide the number of moles of Na2SO4 by the volume in liters to obtain the molarity:

Molarity (M) = moles of Na2SO4 / volume of solution (in liters) = 0.0285 mol / 0.125 L = 0.228 M.

Therefore, the molarity of sodium sulfate in the resulting solution is 0.259 M.

Learn more about volume here: https://brainly.com/question/21623450

#SPJ11

What is the solution to the equation? −12x=−3
Enter your answer in the box.

Answers

Answer:

The answer is 1/4 or 0.25

Step-by-step explanation:

The question is very simple. All we have to do is figure out what -12 multiplied by ______ equals -3

So we can just divide -3 by -12 to find the answer.

-3 / -12 = 0.25

So the answer is 0.25 or 1/4 in fraction form.

Hope this helps! :)

૮ ・ﻌ・ა

Answer:

x = 1/4

Step-by-step explanation:

−12x = − 3

Step 1: Divide both sides by -12.

-12x/-12 = -3/-12

Answer:

x = 1/4

a rectangular field is to have an area of 900 and is to be surrounded by a fence. the cost of the fence is 14 dollars per meter of length. what is the minimum cost this can be done for?

Answers

The minimum cost of fencing the rectangular field with an area of 900 square meters is approximately $2,375.15.

Let's solve for one variable in terms of the other using the area equation:

l x w = 900

l = 900/w (by dividing both sides by w)

Now we can substitute this expression for "l" into the perimeter equation:

P = 2l + 2w

P = 2(900/w) + 2w

P = (1800/w) + 2w

To minimize P, we can take the derivative with respect to w and set it equal to zero:

dP/dw = -1800/w² + 2 = 0

Solving for w, we get:

w = √(1800/2) = 30√(2)

We can now use this value of w to find the corresponding value of l from the area equation:

l = 900/w = 900/(30√(2)) = 30√(2)

Therefore, the dimensions of the rectangular field that require the least amount of fencing while still having an area of 900 square meters are l = 30√(2) meters and w = 30√(2) meters.

The total length of fencing required is:

P = 2l + 2w

P = 2(30√(2)) + 2(30√(2))

P = 120√(2)

The minimum cost of the fence can be found by multiplying the total length of fencing by the cost per meter of fencing:

Cost = 14 x P = 14 x 120√(2) = 1680√(2) dollars = $2,375.15.

To know more about rectangle here

https://brainly.com/question/8663941

#SPJ4

about how long has the pi symbol been used in the mathematical world?

Answers

The Greek mathematicians started using the symbol pi (π) for as long as 4000 years in mathematical world.

A Short History of Pi

Even if we counted the number of seconds in those 4000 years and round the value of pi (π) to so many places, we would still only be estimating the true value of pi. Pi has been known for over 4000 years. Below is a quick summary of the discovery of.

By multiplying the radius of a circle by three, the ancient Babylonians determined its area, yielding the number pi = three. About 1900–1680 BC Babylonian tablets show a value of 3.125 for, which is a more accurate estimate.

The Rhind Papyrus, which dates to around 1650 BC, sheds light on ancient Egyptian mathematics. The calculation used by the Egyptians to determine a circle's area yielded a result that was around 3.1605 for.

Learn more about Symbol Pi (π):

https://brainly.com/question/16277677

#SPJ4

Which function is shown in the graph below?

Which function is shown in the graph below?

Answers

That’s a mathematic graph

Alicia spun a spinner 100 times, and the results are shown in the following table. What is the relative frequency for the spinner to land on number 1?
Responses

Answers

Answer:

3/25

Step-by-step explanation:

Explain why all of these statements are false: (a) The complete solution to Ax = b is any linear combination of Xp and Xn. (b) The system Ax- b has at most one particular solution. (c) If A is invertible, there is no solution Xn in the nullspace. 6. Let 4 3 2 [6 UJ Use Gauss-Jordan elimination to reduce the augmented matrices U 0 and U c] to R 0 and R D. Solve Rx -0 and Rxd. Check your work by plugging your values in the equations Ux = 0 and Ux = c.

Answers

We check our work by plugging our values for Xn and Xp into the equations Ux = 0 and Ux = c to verify that they are indeed solutions to the original system of equations.

(a) The statement "The complete solution to Ax = b is any linear combination of Xp and Xn" is false because the complete solution to Ax = b is the sum of the particular solution Xp and the nullspace solution Xn. It is not a linear combination of the two.

(b) The statement "The system Ax- b has at most one particular solution" is false because a system of linear equations can have multiple particular solutions. However, it will have at most one solution in the case where the system is consistent and the rank of the matrix A is equal to the rank of the augmented matrix [A | b].

(c) The statement "If A is invertible, there is no solution Xn in the nullspace" is false because the nullspace of a matrix is always non-empty and contains the zero vector, even if the matrix is invertible. However, the nullspace of an invertible matrix will only contain the zero vector.

To solve the system of equations represented by the augmented matrices U 0 and U c, we use Gauss-Jordan elimination to reduce them to row echelon form. This involves performing elementary row operations such as adding multiples of one row to another and multiplying a row by a scalar. The end result should be a matrix R in row echelon form.

Next, we solve the system Rx = 0 by setting the non-pivotal variables to be free and expressing the pivotal variables in terms of them. This will give us the nullspace solution Xn. Then, we solve Rx = d using back-substitution to obtain the particular solution Xp.

we check our work by plugging our values for Xn and Xp into the equations Ux = 0 and Ux = c to verify that they are indeed solutions to the original system of equations.
(a) The statement "The complete solution to Ax = b is any linear combination of Xp and Xn" is false because the complete solution is given by X = Xp + Xn, where Xp is a particular solution to Ax = b and Xn is a solution to the homogeneous system Ax = 0. It is not any linear combination of Xp and Xn, but rather the sum of a specific Xp and all possible solutions Xn.

(b) The statement "The system Ax - b has at most one particular solution" is false because it can have either one unique solution, infinitely many solutions, or no solution at all. The number of solutions depends on the properties of the matrix A and the vector b.

(c) The statement "If A is invertible, there is no solution Xn in the nullspace" is false because if A is invertible, the nullspace contains only the trivial solution (all zeros). In this case, the nullspace has one solution (Xn = 0), not zero solutions.

Regarding the Gauss-Jordan elimination problem:

1. Write down the augmented matrices U|0 and U|c.
2. Apply Gauss-Jordan elimination to reduce both matrices to row echelon form R|0 and R|D.
3. Solve the systems Rx = 0 and Rx = D using back substitution.
4. Check your work by plugging your solutions back into the equations Ux = 0 and Ux = c.

To know more about matrices. Click on the link.

https://brainly.com/question/11367104

#SPJ11

: ( 3, 10 ) and ( 4, 6 )

Answers

Answer:

the slope is M=-4

Step-by-step explanation:

Answer:

to find slope you need to

Step-by-step explanation:

first the slope formula

y2y1x2x1

then you replace them with the numbers

10643

solve equasion

106=1643=1

161

slope=-16

Which function is represented by the graph?
O f(x) = (x – 11 + 3
O f(x) = 5x + 11 – 3
O f(x) = |x – 11 – 3
Of(x) = x + 1] + 3

Answers

Answer:

b

Step-by-step explanation:i took the quiz

Other Questions
guidelines for performing drug tests on workers or job applicants include all of the following except: a. all employees should be informed in advance of the use, misuse, and test policies b. tests should be the highest quality that money can buy c. companies should provide clear documentation of the reason for the test d. tests should be done in a uniform and impartial manner What is a measure that accounts for an organization's results in terms of its effects on profits, planet, and people? Select one: a. triple bottom line b. stakeholder prioritization c. corporate social responsibility d. greenwashing X-2y=152x+4y=-18What is the solution tot his system of equations a tire manufacturer has a 60,000 mile warranty for tread life. the manufacturer considers the overall tire quality to be acceptable if less than 8% are worn out at 60,000 miles. based on a sample of tires, researchers conclude that the proportion of tires that are worn out at 60,000 miles is not less than 8%. what type of statistical inference is this? What did the Allies accomplish on D-Day? After his Political Science class, Andre only remembered the parts of his professor's lecture that he agreed with. This is an example of selective How do you write each number in parts (a)-(c) by using the imaginary unit i ?d. Explain why -64 -64 . How many functions are there from the set {1, 2, . . . , n}, where n is a positive integer, to the set {0, 1} a) that are one-to-one? b) that assign 0 to both 1 and n? c) that assign 1 to exactly one of the positive integers less than n? strategy formulation concerns the choice of strategy in terms of ______ to compete. Multiple choice question. why and where when and where why or why not where and how ______ rationality is the term coined by March and Simon to describe the cognitive limitations that constrain the ability of people to interpret, process, and act on information. kathy's annuity is currently experiencing tax-deferred growth until she retires. which phase is this dentify whether each statement is an advantage or a disadvantage associated with using java: put responses in the correct input to answer the question. a. responses can be selected and inserted using the space bar, enter key, left mouse button or touchpad. b. responses can also be moved by dragging with a mouse.c. java does not run well for certain desk applications. d. java functions highly on mobile phones. Municipal trades settle in. Can someone please help This is the second part to the one page Which of the following is true? O Forward contracts have no default risk. O Forward contract buyers and sellers do not know who the counterparty is. O Futures contracts involve less default risk O Forward contracts are marked to market daily. The carotid sinus reflex protects the blood supply to the brain, whereas the aortic reflex is more concerned with maintaining adequate blood pressure in the systemic circuit as a whole: true or false If you want the browser to check if a field is empty when the form is submitted, you can code the ____________________ attribute for the field. Protein Quality of Foods Click and drag to indicate whether the following foods provide high-quality (complete) or lower quality (incomplete) protein High-Quality (Complete) Protein Lower-Quality (Incomplete) Protein GELATIN Gelatin Whey (mik protein) Garbanro bean During the year, the material quantity variance was debited for $3,148. What is the standard number of pounds of material needed to produce one unit you are using a bag-mask device to ventilate a 16-year-old in cardiac arrest who collapsed suddenly during a soccer game. an endotracheal tube has been placed by an advanced life support provider on the resuscitation team. proper ventilation technique in the situation requires that you: