answers these questions pls need it asap

Answers These Questions Pls Need It Asap

Answers

Answer 1

Marine species refer to the various organisms that inhabit the oceans, seas, and other saltwater environments. The world's oceans are home to a diverse array of life forms, ranging from microscopic plankton to massive whales.

Here are some examples of marine species across different taxonomic groups:

Phytoplankton: These are tiny, photosynthetic organisms such as diatoms and dinoflagellates that form the base of the marine food chain.

Zooplankton: These are small animals, including copepods, krill, and jellyfish, which float or drift in the water column.

Fish: There are numerous species of fish in the oceans, including popular ones like tuna, salmon, cod, and swordfish, as well as thousands of other species with diverse characteristics and habitats.

Marine Mammals: This group includes species like whales, dolphins, seals, sea lions, and manatees, which are adapted to life in the water but breathe air.

Learn more about  microscopic plankton on:

https://brainly.com/question/815977

#SPJ1


Related Questions

Calculate the pH of (a) a solution that is 0.060M in potassium propionate (C2H5COOK or KC3H5O2) and 0.085M in proprionic acid (C2H5COOH or HC3H5O2); (b) a solution that is 0.075M in trimethylamine, (CH3)3N, and 0.10M in trimethylammonium chloride, (CH3)3NHCl; (c) a solution that is made by mixing 50.0 mL of 0.15M acetic acid and 50.0 mL of 0.20M sodium acetate.

Answers

a) The pH of the solution is: 2.58

b) the pH of the solution is: 11.20

c) the pH of the solution is: 5.20

(a) To solve this problem, we need to use the equilibrium expression for the ionization of proprionic acid:

C2H5COOH + H2O ⇌ C2H5COO- + H3O+

The acid dissociation constant, Ka, for proprionic acid is 1.3 x 10^-5 at 25°C. The concentration of proprionate ion, C2H5COO-, can be calculated from the concentration of potassium propionate, C2H5COOK, since potassium propionate completely dissociates in water:

C2H5COO- = C2H5COOK = 0.060 M

Now, we can set up an ICE table and use the Ka expression to solve for the pH:

C2H5COOH + H2O ⇌ C2H5COO- + H3O+

I 0.085 M 0 M 0.060 M 0

C -x +x +x +x

E 0.085-x x 0.060+x x

Ka = [C2H5COO-][H3O+]/[C2H5COOH]

1.3 x 10^-5 = (0.060+x)x/(0.085-x)

Solving for x, we get:

x = 2.61 x 10^-3 M

Therefore, the pH of the solution is:

pH = -log[H3O+]

pH = -log(2.61 x 10^-3)

pH = 2.58

(b) Trimethylamine acts as a base and reacts with water to produce hydroxide ion and trimethylammonium ion:

(CH3)3N + H2O ⇌ (CH3)3NH+ + OH-

The equilibrium constant for this reaction, Kb, is 6.4 x 10^-5 at 25°C. The concentration of hydroxide ion, OH-, can be calculated from the concentration of trimethylammonium chloride, (CH3)3NHCl, since it completely dissociates in water:

OH- = (CH3)3N = 0.075 M

Now, we can set up an ICE table and use the Kb expression to solve for the pOH:

(CH3)3N + H2O ⇌ (CH3)3NH+ + OH-

I 0.075 M 0 M 0 0

C -x +x +x +x

E 0.075-x x x x

Kb = [(CH3)3NH+][OH-]/[CH3)3N]

6.4 x 10^-5 = x^2/(0.075-x)

Solving for x, we get:

x = 1.57 x 10^-3 M

Therefore, the pOH of the solution is:

pOH = -log[OH-]

pOH = -log(1.57 x 10^-3)

pOH = 2.80

Finally, we can calculate the pH:

pH = 14 - pOH

pH = 14 - 2.80

pH = 11.20

(c) The solution is a buffer solution made by mixing a weak acid, acetic acid, and its conjugate base, sodium acetate. The equilibrium expression for the ionization of acetic acid is:

CH3COOH + H2O ⇌ CH3COO- + H3O+

Follow the same procedure as above.

we get pH = 5.20

For more question on the pH click on

https://brainly.com/question/12609985

#SPJ11

Which of the following statements describes the law of conservation of mass?

a) The mass of the products is equal to the mass of the reactant.

b) the mass of the products is double the mass of the reactant.

c) There should be two reactants and one product in the chemical equation.

d) The mass of the reactants is double the mass of the products.

Answers

Explanation:

I think a is correct answer


1)
Two locations, one in northern Canada and one in the southwestern United States, receive
the same amount of precipitation each year. The location in Canada is classified as a humid
climate. Why would the location in the United States be classified as an arid climate?
A)
The soil-moisture storage in the southwestern United States is more than that in northern
Canada.
B)
The vegetation of the southwestern United States is different from that of northern
Canada,
C)
The potential evapotranspiration is greater in the southwestern United States than in
northern Canada
D)
The yearly distribution of precipitation is different.

Answers

c......…..……...............

need help with this as soon as possible

need help with this as soon as possible

Answers

Mass of Mg is 2.39g and Mass of MgO is 3.48 g. Mg is a chemical element Magnesium.

How to calculate mass ?

The average mass of an element's atoms expressed in atomic mass units is the element's atomic mass. The mass of each isotope is multiplied by its abundance to produce the atomic mass, which is a weighted average of all the isotopes of that element.

The atomic mass of an element, measured in amu, is equal to the mass in grammes of one mole of an element. This relationship between the atomic mass and the mole concept is important in chemistry.

Mass of Mg = Mass of crucible and Mg - Mass of empty crucible = 38.06g - 35.67g = 2.39g

Mass of MgO = 39.15 g - 35.67 g = 3.48 g

To learn more about atomic mass refer :

https://brainly.com/question/3187640

#SPJ1

Drag the handle on the left and adjust the length of the box to 5 nm. (Because no other dimensions of the box change, its length can be used as a substitute for volume. ) Pump the pump handle once fully. This should add 40 to 50 gas molecules to the container. The pressure gauge will fluctuate a little bit, so watch it for a minute to estimate an average value. Record the pressure in the table.


In the Constant Parameter menu, select Temperature. Then drag the handle of the box to change its length to each of the other values in the data table. Record the pressure for each length

Answers

Gay-Law Lussac's explains how the molecules are related to one another. According to the legislation, the relationship between system's absolute temperature and pressure has always been direct.

The pressure rises as a result of gas molecule collisions. The system's pressure was between 7.2 and 8.2 atm as the temperature rose. The system's pressure ranged from 3.6 to 4.1 atm as the temperature dropped. Gay-Law Lussac's explains how the molecules are related to one another. The ideal gas equation for gaseous molecules provides the link between temperature and pressure. The temperature and the temperature have been directly proportionated. When a result, as pressure has increased, so has temperature and vice versa. The energy that raises temperature has been released as a result of the gas molecules' contact with the wall. The temperature rising reflects the pressure rise.  

Learn more about Gas molecule collisions here:

https://brainly.com/question/18689977

#SPJ4

HA(aq)+H2O(l)⇄A−(aq)+H3O+(aq)HA(aq)+H2O(l)⇄A−(aq)+H3O+(aq)ΔG°=+35kJ/molrxnΔG°=+35kJ/molrxn
Based on the chemical equation and ΔG° given above, which of the following justifies the claim that HA(aq) is a weak acid?
A) Because ΔG°>>0, Ka>>1 , and HA completely dissociates.
B) Because ΔG°>>0, Ka>>1, and HA almost completely dissociates.
C)Because ΔG°>>0, Ka<<1, and HA only partially dissociates.
D) Because ΔG°>>0, Ka<<1, and HA does not dissociate.

Answers

The correct answer is C) Because ΔG°>>0, Ka<<1, and HA only partially dissociates for the chemical equation.

The positive ΔG° value indicates that the reaction is not spontaneous and requires energy to proceed in the forward direction. This suggests that the acid HA is not completely dissociating into its ions A- and H3O+.

Additionally, the Ka value for weak acids is typically less than 1, indicating that the acid only partially dissociates in water. Therefore, the correct option is C for the chemical equation.

When an acid dissolves in water, it only partially dissociates, releasing a small amount of hydrogen ions (H+). Strong acids totally dissociate, but weak acids retain an equilibrium in aqueous solution between their undissociated and dissociated forms. The acid dissociation constant (Ka), which controls the degree of acid ionisation, controls this equilibrium. In comparison to strong acids, weak acids typically contain less hydrogen ions and have less obvious acidic properties. Acetic acid (CH3COOH), citric acid, and carbonic acid (H2CO3) are a few examples of weak acids.

Learn more about chemical equation here:

https://brainly.com/question/31852923


#SPJ11

Are these students behaving appropriately? If not, what should they be doing differently?

Are these students behaving appropriately? If not, what should they be doing differently?

Answers

Answer:

No.

Leftmost: Rick shouldn't be smelling any vapors; if required he should be using the wafting technique instead of putting it close to his face. Additionally, He's not wearing gloves nor a lab coat.

Middle: Sarah is not wearing any goggles nor a lab coat and she's at risk as she's pouring two different liquids into a solution at the same time which may pose a hazard of sudden irritation, exposure, heat or combustion.

Rightmost: Andrew is drinking a chemical of supposedly unknown origin putting him at risk by ingestion all the while lacking all of the requisite Personal Protective Equipment.

All of them are also at fault for leaving and not containing a chemical spill off to the side (rightmost), and by the looks of it, enter and operate the lab without their supervisor/professor present.

Explanation:

basta may sagot, sis

Express the concentration (in ppm) of a 910 g solution that contains 55. 0 mg of MgCl2.


Be sure to round your answer to the correct number of significant figures.

Answers

Rounding to the correct number of significant figures, the concentration of the solution containing 55.0 mg of MgCl2 in 910 g of solution is approximately 60.4 ppm.

To express the concentration in parts per million (ppm), we need to calculate the ratio of the mass of the solute (MgCl2) to the mass of the solution and then multiply by 1 million.

Given:

Mass of the solution = 910 g

Mass of MgCl2 = 55.0 mg

First, we need to convert the mass of MgCl2 to grams:

Mass of MgCl2 = 55.0 mg * (1 g / 1000 mg) = 0.055 g

Next, we can calculate the concentration in ppm:

Concentration (ppm) = (Mass of MgCl2 / Mass of the solution) * 1,000,000

Concentration (ppm) = (0.055 g / 910 g) * 1,000,000

Concentration (ppm) ≈ 60.439 ppm

The concentration in parts per million (ppm) expresses the ratio of the mass of the solute to the mas of the solution, scaled by a factor of 1 million. It is a commonly used unit to represent small concentrations in various fields, such as environmental science, chemistry, and toxicology. In this case, the concentration of MgCl2 is expressed in ppm to indicate its relative abundance in the solution.

Learn more about  parts per million (ppm) here:

https://brainly.com/question/16727593

#SPJ11

Water is formed when 48g of oxygen combine with 6g of hydrogen. What mass of oxygen combines with 2g of hydrogen?
A. 12g
B. 16g
C. 96g
D. 144g

Answers

Answer:

B. 16g

Explanation:

What is the volume of a 3.46 g block of glass, if the density of glass is 2.60
g/cm3? *

Answers

Answer:

The answer is

1.33 cm³

Explanation:

The volume of a substance when given the density and mass can be found by using the formula

\(volume = \frac{mass}{density} \\\)

From the question

mass = 3.46 g

density = 2.60 g/cm³

The volume is

\(volume = \frac{3.46}{2.60} \\ = 1.3307692...\)

We have the final answer as

1.33 cm³

Hope this helps you

To earn full credit for your answers, you must show the appropriate formula, the correct substitutions , and your answer including the correct units

One hundred and forty-eight hawks are living on a prairie that is twenty-two square kilometers in size. What is the population density of the hawks?

Answers

The population density of the hawks is 6.73 hawks/sq. km.

What is the population density?

Population density is defined as the number of individuals of a species per unit area.

Population density = Number of individuals / Area

In this problem, we are given:

Number of individuals = 148 hawksArea = 22 square kilometers

Substituting these values in the formula, we get:

Population density = 148 hawks / 22 sq. km

Simplifying this expression, we get:

Population density = 6.73 hawks/sq. km

Learn more about population density here: https://brainly.com/question/16894337

#SPJ1

3. calculate the molarity of a solution that is prepared by dissolving 2.24 grams of naoh in enough deionized water to make 500.0 ml of solution? the molar mass of naoh is 40.0 g. molarity

Answers

The molarity is 0.112 M. if that is prepared by dissolving 2.24 grams of naoh in enough deionized water to make 500.0 ml of solution .

What is molarity and its SI unit?

Molarity is mathematically defined as Molarity = Number of moles of solute Volume of solution in litre. As the number of moles  solute is measured in mol and the volume of solution will be in litre . So, the unit of molarity is mol L - 1 .

Is 1M molarity?

Molarity  also known as molar concentration and is represented by “M”. For example,  solution of 1M of sodium chloride dissolved in water has a molarity of 1M. A number of moles of solute can be calculated by dividing mass by the molecular weight of the solute.

To know more about molarity visit

https://brainly.com/question/8732513

#SPJ4

Coal is a fossil fuel that we burn for fuel. We also use it in water and air purification systems, medical equipment, and as a building material. Describe how coal is formed, where it gets its original source of energy from, and why its distribution varies around the world. Then state whether coal is likely being formed today

Answers

Coal is formed through a process called coalification, which takes place over millions of years. It begins with the accumulation of plant matter in swamps and marshes, where the organic material undergoes decomposition under conditions of heat, pressure, and lack of oxygen.

Coalification, also known as coal formation, is a geological process that transforms organic material into coal over millions of years. It occurs through a series of complex changes involving heat, pressure, and time. The process begins with the accumulation of plant debris, such as leaves, wood, and other organic matter, in swampy environments.

As the organic material gets buried under layers of sediment, it undergoes a transformation known as peatification. Peat, a low-grade form of coal, is formed as the organic matter decomposes in a waterlogged environment. Over time, as more sediment accumulates, the peat becomes subjected to increasing pressure and temperatures due to the weight of the overlying layers.

To know more about Coalification refer to-

brainly.com/question/30100925

#SPJ4

What is the composition of the nuclei modeled by these symbols? How many protons and neutrons?

What is the composition of the nuclei modeled by these symbols? How many protons and neutrons?

Answers

There are six protons and eight neutrons present in the carbon atom as shown.

What is the nucleus?

The nucleus of an atom consists of its protons and its neutrons. The protons are positively charged while the neutrons have no charge.

From the symbol of the element as shown in the question, we can see that there are six protons and eight neutrons present.

Learn more about nucleus of atoms:https://brainly.com/question/10658589

#SPJ1

If the absorbance of the 200 μm solution is 0. 885, what should be the absorbance of the 25μm? write answer to three decimal places

Answers

If the absorbance of the 200 μm solution is 0. 885, then the absorbance of the 25μm is 0.221.

What is absorbance?

Absorbance (A) is also known by the optical density (OD).

Absorbance is the capacity of a solution to absorb quantity of light.

And Transmittance is the quantity of light which is passes through a solution.

As we know that,

Absorbance / Concentration = Constant

That means, absorbance is directly proportional to the concentration

Therefore,

0.885/ 200 μm = x / 25 ,

where,

x is the absorbance at 25μm.

Calculating all values, we get

X = 25( 0.885/ 200 ) = 0.221

Thus, we calculated that the absorbance of the 200 μm solution is 0. 885, then the absorbance of the 25μm is 0.221.

learn more about absorbance:

https://brainly.com/question/23938376

#SPJ4

Two biologists, two chemists, and two physicists go out to dinner and sit at a round table with 6 equally spaced chairs. In how many ways can they sit so that no two scientists of the same type (for example, two biologists) are seated next to each other? (Two seatings that are merely rotations of each other are not considered distinguishably different.)
Why is my approach wrong?
I first seat the biologist to one of the seats, he has one choice. I then seat the other biologist, he has 3 choices. Next, I seat one of the chemists, who has 4 choices. The next chemist then has to choices. Finally, we have the physicists who have no choice but to be in the two remaining seats.
1*3*4*2 = 24.
Why is the answer 32? Please explain, thanks

Answers

By taking into account the different seating possibilities for the biologists, chemists, and physicists, you will find that the total number of valid seating arrangements is indeed 32.

Your approach is incorrect because it does not consider all possible arrangements that satisfy the given conditions. Let's analyze your approach step by step.

You correctly start by seating one biologist, which can be done in 1 way. However, when you proceed to seat the second biologist, you assume that there are 3 choices. This is where the error occurs.

Consider the following possibilities:

If the first biologist is seated at Chair 1, the second biologist cannot be seated at Chair 2 or Chair 6, as they would be sitting next to each other. Therefore, the second biologist can only be seated at Chair 4.

If the first biologist is seated at Chair 2, the second biologist can only be seated at Chair 5.

If the first biologist is seated at Chair 3, the second biologist can only be seated at Chair 6 or Chair 1.

If the first biologist is seated at Chair 4, the second biologist can only be seated at Chair 1.

If the first biologist is seated at Chair 5, the second biologist can only be seated at Chair 2.

If the first biologist is seated at Chair 6, the second biologist can only be seated at Chair 3.

So, there are actually 6 different arrangements for seating the two biologists.

Now, if we continue with your approach, seating the chemists and physicists, we need to consider the additional possibilities that arise due to the constraints of the biologist's seating arrangements.

Therefore, the correct approach would involve considering all possible arrangements that satisfy the given conditions. By taking into account the different seating possibilities for the biologists, chemists, and physicists, you will find that the total number of valid seating arrangements is indeed 32.

Learn more about possibilities from below link

https://brainly.com/question/13604758

#SPJ11

1. Draw the curved mechanism arrows that show the deprotonation of phenol by NaOH and draw the major organic product
2. Draw the curved mechanism arrows that show the sn2 reaction of phenoxide with chloroethane and draw the major organic product

Answers

Deprotonation of phenol by NaOHPhenol is a weak acid with a pKa value of 10, so it is not very acidic but it can be deprotonated with a strong base like sodium hydroxide (NaOH). The mechanism for this reaction is a simple acid-base reaction where NaOH acts as a base and removes the proton (H+) from phenol.

The curved arrow mechanism is shown below:Here, the Na+ ion comes in and removes the H+ ion from the O-H bond in phenol and forms water as a by-product. The major organic product is phenoxide ion (C6H5O−) which is formed after the deprotonation reaction.SN2 reaction of phenoxide with chloroethane Phenoxide ion is a good nucleophile because it has a negative charge on the oxygen atom which is able to attack the positively charged carbon atom in chloroethane. The mechanism for this reaction is a nucleophilic substitution (SN2) reaction where the phenoxide ion acts as a nucleophile and replaces the chloride ion in chloroethane. The curved arrow mechanism is shown below:Here, the phenoxide ion attacks the carbon atom in chloroethane, and the chloride ion leaves as a leaving group. The major organic product is ethyl phenyl ether (C6H5OC2H5) which is formed after the SN2 reaction.

For more information on Deprotonation visit:

brainly.com/question/30706409

#SPJ11

a sample of nitrogen has has a voume if 160.8 at stp. what bolume does the gas occupy if the temperature is increased

Answers

The volume of the gas when temperature is increased will be less than 160.8 L.

Combined gas law:

This law states that " the ratio between the product of pressure, volume and temperature of a system remains constant".

(P₁V₁) / T₁ = (P₂V₂) / T₂

⇒ V₂ = (P₁V₁T₂) / (P₂T₁)

Where,

P₁ is the initial pressure

V₁ is the initial volume

T₁ is the initial temperature

P₂ is the final pressure

V₂ is the final volume

T₂ is the final temperature

From the relation of pressure, volume and temperatures it can be determined that how volume will change with temperature. When the temperature increases the volume of the gas decreases as the volume is inversely proportional to temperature.

Hence, the volume of sample of nitrogen will be less than 160.8 L.

Learn more about combined gas law from the link given below.

https://brainly.com/question/19153869

#SPJ4

1.
(A
Which of the following ground-state electron configurations represents the atom that has the lowest first-ionization
energy?
182 281
(B) 182 2s22p2
(C) 182 2822p6
(D) 182 2822p6 381

Answers

The question is incorrect, the correct question is;

Which of the following ground-state electron configurations represents the atom that has the

lowest first-ionization energy?

a) 1s2

b) 1s22s2

c) 1s22s22p6

d) 1s22s22p63s23p1

e) 1s22s22p63s23p3

The correct ground state configuration that represents the atom that has the lowest first ionization energy is 1s² 2s² 2p⁶ 3s² 3p¹.

The first ionization energy is the energy required to remove an electron from the outermost shell of an atom.

Ionization energy decreases down the group as number of shells increases but increases across the period as nuclear charge increase.

As the number of shells increases, the degree of shielding or screening decreases it easier to remove the outermost electron.

The elements whose ground state electronic configurations were shown are;

Helium - 1s²  

Beryllium - 1s² 2s²  

Neon - 1s² 2s² sp⁶  

Aluminum - 1s² 2s² 2p⁶ 3s² 3p¹    

Phosphorus - 1s² 2s² 2p⁶ 3s² 3p³

Aluminium (1s² 2s² 2p⁶ 3s² 3p¹) is a metal so it has the lowest first ionization energy since metals are highly electropositive.

Learn more: https://brainly.com/question/17783060

rank the bold-faced hydrogens for the following compounds from most acidic to least acidic.

Answers

From one of the most acidic via least acidic, these compounds' bold-faced hydrogens are II > III > V > IV > I.

Why do you use the word "acidity"?

Acidity explains how much acid is present in a material. An acid is a substance that releases hydrogen ions into water and reacts with certain metals to generate salts.

According to the given question:

The strong acids are those which completely ionizes in the aqueous solution. the strong acid will losses more H⁺ ion when it dissolved in the water. The weak acids are those which are partially ionizes in the aqueous solution.  the strong acid will losses few H⁺ ion when it dissolved in the water.

Therefore from most acidic via least acidic, these compounds' bold-faced hydrogens are II > III > V > IV > I.

The complete question is-

Rank the bold-faced hydrogens for the following compounds from most acidic to least acidic. (Attachment below for options)

To know more about Acidity visit:

brainly.com/question/14072179

#SPJ4

1125 J of energy is used to heat 250 g of iron to 55 °C. The specific heat capacity of iron is 0.45 J/(g·°C).

What was the temperature of the iron before it was heated?

55 °C
55 °C

35 °C
35 °C

45 °C
45 °C

20 °C

Answers

Answer:

45 °C.

Explanation:

From the question given above, the following data were obtained:

Heat (Q) = 1125 J

Mass (M) = 250 g

Final temperature (T₂) = 55 °C

Specific heat capacity (C) = 0.45 J/gºC

Initial temperature (T₁) =?

The initial temperature of the iron can be obtained as illustrated below:

Q = MC(T₂ – T₁)

1125 = 250 × 0.45 (55 – T₁)

1125 = 112.5 (55 – T₁)

Divide both side by 112.5

1125/112.5 = 55 – T₁

10 = 55 – T₁

Collect like terms

10 – 55 = –T₁

–45 = –T₁

Multiply through by –1

45 = T₁

T₁ = 45 °C

Therefore, the initial temperature of the iron is 45 °C

sodium chloride is a buffer creating an injectable solution that is isotonic. group of answer choices true

Answers

Yes, the statement is True i.e. Sodium chloride is a buffer creating an injectable solution that is isotonic.

A buffer solution, also referred to as a pH buffer or hydrogen ion buffer, is an aqueous mixture of a weak acid and its conjugate base, or vice versa. The pH scarcely changes at all when a small amount of a strong acid or basic is added to it. Buffer solutions are used in a wide range of chemical processes to keep pH values almost constant. Buffering is used by many living systems to regulate pH in the natural world. For instance, the bicarbonate buffering system regulates the pH of blood, and bicarbonate also acts as a buffer in the ocean. Because of a chemical equilibrium between the weak acid HA and its conjugate base A, buffer solutions are resistant to pH change: HA ⇌ H+ + A− According to Le Chatelier's principle, an equilibrium between a weak acid and its conjugate base shifts to the left when hydrogen ions (H+) are supplied. Because of this, despite the supply of strong acid, the concentration of hydrogen ions increases less than anticipated.

To know more about buffer please refer: https://brainly.com/question/22821585

#SPJ4

How do we get energy from the food we eat?

A
The constantly moving molecules in food give us kinetic energy.

B
Breaking the molecular bonds in the food releases stored chemical energy.

C
Eating hot food transfers thermal energy to our bodies.

D
The chemical energy stored in the food is transferred to us as thermal energy.

Answers

Answer:

B?

Explanation:

okay so honestly i think its b, but dont get me wrong, im not smart

3Li HPO
How many elements?
How many Atoms of Lithium (Li)?
How many Atoms of Hydrogen (H)?
How many Atoms of Phosphorus (P)?
How many Atoms of Oxygen (0)?
How many total Atoms in this Chemical Formula?
1 2 3 4 5

Answers

Answer:

1) There are Four Elements

Li , H , P , O

2) Li have 3 atoms.

3) H have 3 atoms.

4) P have 3 atoms.

5) O have 3 atoms.

What do food webs begin with as the first source of energy A plants B consumers C the sun D decomposers

Answers

Answer:

C:sun

Explanation:

How did greenhouse gasses get their name?

Answers

Answer:

Greenhouse gasses got their name from a greenhouse

Explanation:

Since greenhouses have plants inside in which the building lets sunlight in to the plants and greenhouse gasses trap heat. (sorry if my answer is confusing)

Greenhouse got its name because of what it does it traps the atmosphere Inside and it helps the atmosphere get warmer and is successful at growing plants throughout the year, even when it's too cold outside for some plants to grow.
Hope this helps

For the reaction ?FeCl2 + ?Na3PO4 → ?Fe3(PO4)2 + ?NaCl ,
what is the maximum number of moles of Fe3(PO4)2 which could be formed from
7.23 mol of FeCl2 and 4.39 mol of Na3PO4? Answer in units of mol.

Answers

The maximum number of moles of Fe3(PO4)2 that can be formed is 0.807 mol when 7.23 mol of FeCl2 and 4.39 mol of Na3PO4 are present.

In the given reaction, we have to find the maximum number of moles of Fe3(PO4)2 that can be formed using 7.23 mol of FeCl2 and 4.39 mol of Na3PO4.Reaction: FeCl2 + Na3PO4 → Fe3(PO4)2 + NaClWe will balance the given chemical equation to get the balanced chemical equation. FeCl2 + 3Na3PO4 → Fe3(PO4)2 + 6NaClThe balanced chemical equation is given above. Now we will use stoichiometry to solve the question.The molar ratio of FeCl2 to Fe3(PO4)2 is 1:1 from the balanced chemical equation.The molar ratio of Na3PO4 to Fe3(PO4)2 is 3:1 from the balanced chemical equation.Using the molar ratios and the given number of moles, we can calculate the maximum number of moles of Fe3(PO4)2 that can be formed.Let x be the number of moles of Fe3(PO4)2 formed.

According to the balanced chemical equation, moles of FeCl2 react with moles of Na3PO4 to form moles of Fe3(PO4)2.So, from the given number of moles of FeCl2, the number of moles of Fe3(PO4)2 formed is:x = 7.23 mol of FeCl2 × (1 mol Fe3(PO4)2/1 mol FeCl2)×(1 mol Na3PO4/3 mol Fe3(PO4)2)×(1 mol Fe3(PO4)2/1 mol Na3PO4) = 0.807 mol of Fe3(PO4)2Using the given number of moles of Na3PO4, the number of moles of Fe3(PO4)2 formed is:x = 4.39 mol of Na3PO4 × (1 mol Fe3(PO4)2/3 mol Na3PO4)×(1 mol FeCl2/1 mol Fe3(PO4)2)×(1 mol Fe3(PO4)2/1 mol Na3PO4) = 1.463 mol of Fe3(PO4)2.

for such more questions on moles

https://brainly.com/question/29367909

#SPJ8

a molecule has two bonded atoms around the central atom. the central atom does not have any lone pairs. what is the geometry of the molecule?

Answers

a molecule has two bonded atoms around the central atom. the central atom does not have any lone pairs.  The molecule has a linear geometry.

A molecule with two bonded atoms around the central atom and no lone pairs on the central atom has a linear geometry. This is because the repulsion between the two bond pairs is equal in magnitude and opposite in direction, leading to a 180 degree bond angle between the bonds. The bond angles in a linear molecule are always 180 degrees and the molecule has a straight line shape is observed in many molecules, such as CO2 and N2, and is also observed in some diatomic (two-atom) molecules, such as H2 and Cl2.

Learn more about linear geometry here:

https://brainly.com/question/16178099

#SPJ4

What compound is in the same homologous series as hex-1-ene

Answers

Six carbon atoms make up the alkene hex-1-ene, which also has a double bond at its initial carbon atom.



comparable chemical and physical properties are shared by compounds with comparable structures that are members of the same homologous series and only differ by one CH2 unit.The typical formula for the homologous series of alkenes is CnH2n, where n is the number of carbon atoms. In light of this, the substance belonging to the same homologous series as hex-1-ene would share the same general formula, CnH2n, where n equals 6. The following substance in this chain would have the formula C7H14 and contain seven carbon atoms. It is known as hept-1-ene and, like hex-1-ene, has a double bond at the first carbon atom. As a result, hept-1-ene and hex-1-ene belong to the same homologous series.

learn more about carbon atom here:

https://brainly.com/question/13990654

#SPJ4

a. what mass of silver chloride can be produced from 1.33 l of a 0.234 m solution of silver nitrate? express your answer with the appropriate units.
b.The reaction described in Part A required 3.98L of calcium chloride. What is the concentration of this calcium chloride solution?

Answers

To determine the mass of silver chloride that can be produced, we use balanced chemical equation:\(AgNO3 + NaCl → AgCl + NaNO3\) A)  44.4 g of silver chloride can be produced from 1.33 l of a 0.234 m solution of silver nitrate  B) concentration of the calcium chloride solution is 0.156 M.

From the equation, we can see that 1 mole of silver nitrate  reacts with 1 mole of NaCl to produce 1 mole of silver nitrate. Therefore, we can use the given concentration of silver nitrate and the volume to calculate the moles of silver nitrate, and then use stoichiometry to determine the moles of  silver chloride produced

Moles of silver nitrate= concentration x volume = 0.234 mol/L x 1.33 L = 0.311 mol Moles of AgCl = Moles of silver nitrate  (from balanced equation) = 0.311 mol.

The molar mass of AgCl is 143.32 g/mol, so we can calculate the mass of AgCl produced: Mass of AgCl = Moles of AgCl x Molar mass of AgCl = 0.311 mol x 143.32 g/mol = 44.4 g

To calculate the concentration of the calcium chloridesolution, we need to divide the moles of calcium chloride by the volume in liters: Concentration = Moles of calcium chloride/ Volume = 0.622 moles / 3.98 L = 0.156 M Therefore, the concentration of the calcium chloride solution is 0.156 M.

Know more about molar mass here:

https://brainly.com/question/22997914

#SPJ11

Other Questions
Many prokaryotes that are easily cultured in the lab are human or animal pathogens. why would these species be more readily cultured than non-pathogenic prokaryotes?a.Pathogenic prokaryotes are hardier than non-pathogenic prokaryotes.b.Non-pathogenic prokaryotes require more supplements in their growth media.c.Most of the necessary culture conditions could be inferred for pathogenic prokaryotes.d.Pathogenic bacteria can grow as free bacteria, but non-pathogenic bacteria only grow as parts of large colonies. Religion is not just a matter of being ________ but being righteous in all what you do.a.lucrativeb.piousc.informald.impartial General admission to the zoo is $10 a person. Train passes are an additional $2 per person. Parking is $5 per family. How many family members visited the park if the total cost of the zoo trip was $65 helpppppppp. look at pic -What kind of news stories interest young people in your country?-What differences are there between news reported on TV and the newspaper?-Do you think newspapers will die out in the future? which of the following is seen when a multicellular organism has many specialized cell types, resulting in a division of labor between reproductive functions and growth and maintenance functions? group of answer choices germ-soma distinction. sacrifice of the ability to reproduce. information transfer. economy of scale. one writing strategy for the story of an uncomfortable bed b. False5. Cash Flow is the difference between income and expenses.a. Trueb. False Suppose you wanted to hold up an electron against the force of gravity by the attraction of a fixed proton some distance above it. How far above the electron would the proton have to be? (k = 1/40 = 9.0 109 N m2/C2, e = 1.6 10-19 C, mproton = 1.67 10-27 kg, melectron = 9.11 10-31 kg) however, when you attempt to create your first security profile using the mdm security baseline, you're denied access to the security baseline feature. Which of the following attacks is a form of software exploitation that transmits or submits a longer stream of data than the input variable is designed to handle?Buffer overflow attackTime-of-check to time-of-use attackData diddlingSmurf attack Could you simplify this question? 4xy-6xy+5y-9x Evaluate Do you think that Ford made a good decision in pardoning Nixon? Why? an all-in-one security appliance is best suited for which type of implementation? 8.2.5 find an equation of the tangent to the curve at the given point by both eliminating the parameter and without eliminating the parameter. x why are arm circles considered a dangerous stretching exercise? Molly has a container shaped like a right prism. She knows that the area of the base of the container is 12 in and the volume of the container is 312 in.What is the height of Molly's container?21 in.26 in.31 in.36 in. I need help solving for x A boy at an amusement park has 138 ride tickets. Each ride on the roller coaster costs 9tickets. After riding the roller coaster as many times as he can, how many tickets will the boyhave left? PLEASE HELP, WILL GIVE BRAINLEIST. Explain the difference between primary and secondary succession. please not such a simple answer