balance this equation: Al+ HNO3 ---- H2 + Al(NO3)3​

The number of moles of calcium chloride in 250 ml of a 9.0M of solution is 2.25 moles.

The amount of moles in a substance can be calculated by multiplying the molarity of the solution by the volume as follows;

no of moles = molarity × volume

According to this question, 250mL of a calcium chloride solution has a molarity of 9M. The number of moles can be calculated as follows:

no of moles = 9.0M × 0.250L

no of moles = 2.25 moles

Learn more about moles at: https://brainly.com/question/15209553

#SPJ1

Molarity : It is defined as the number of moles of solute present in one liter of solution.

Therefore, the molarity of solution is 3.33

A.  1.9 M

B.  0.0033 M

C.  1,875 M

D.  0.30 M

E. 3.3 M

Given :

Mass of \(H_2SO_4\) is 571.6 g per liter .

Density of solution , \(\rho=1.329\ g/cm^3\) .

To Find :

a. Mass percentage

b. Mole fraction

c. Molality

d. molarity of H2SO4 in this solution.

Solution :

Molar mass of \(H_2SO_4\) , m = 1329 g/mol .

a ) Mass of \(H_2SO_4\) contain in 1 liter is 1329 g .

\(mass \ \%=\dfrac{571.6}{1329}\times 100=43.01 \%\)

b ) Moles of \(H_2SO_4\) = \(\dfrac{571.6\ g}{98\g/mol}=5.83\ mol\) .

Moles of \(H_2O\) = \(\dfrac{1329-571.6\ g}{18\ g/mol}=42.08\ mol\) .

Mole fraction \(=\dfrac{5.83}{5.83+42.08}=0.12\) .

c ) Molarity of \(H_2SO_4\)  \(=\dfrac{5.83\ mol}{1 \ L}=5.83\ M\) .

Hence , this is the required solution .

The process of catalysis  which involves adding a catalyst  to a chemical reaction, increases the rate of the reaction.

Thus, Catalysts are not destroyed during the reaction and are unaffected by it. Very tiny amounts of catalyst are frequently sufficient when the reaction is swift and the catalyst recycles quickly; mixing, surface area, and temperature are key factors in reaction rate.

In order to regenerate the catalyst, it usually reacts with one or more reactants to produce intermediates that then give off the ultimate reaction product.

Homogeneous catalysis, in which all of the components are dispersed in the same phase as the reactant (often a gas or liquid), and heterogeneous catalysis, in which the components are not.

Thus, The process of catalysis  which involves adding a catalyst  to a chemical reaction, increases the rate of the reaction.

Learn more about Catalyst, refer to the link:

https://brainly.com/question/24430084?

#SPJ1

Answer:

Decomposition

Explanation:

Because when it becomes separate it is decomposing.

Answer: People can see if they should prepare to evacuate an area.

Explanation:

Answer:

a

Explanation:

When comparing various liquids, a liquid can be recognized by its behavior on paper, which is a defining attribute of the liquid.

On two distinct paper surfaces, we will test four known liquids and an unknown liquid. we will identify an unidentified liquid using their observations. We will learn that we can effectively identify an unidentified liquid by combining the findings of two experiments. On a coffee filter dipped in green food coloring, we will also add water and salt water. we can tell a big difference in how each liquid separates the hues of the green food coloring. When comparing various liquids, a liquid can be recognized by its behavior on paper, which is a defining attribute of the liquid. The equal quantity of each liquid should be applied to the paper in the same location for the test to be fair.

Learn more about Liquids here-

https://brainly.com/question/4509437

#SPJ9

Answer:

Alcohol?

Explanation:

(for Plato)

Answer:

\(\huge\boxed{f(g(x)) = 4x^2 + 12x + 9}\)

Explanation:

In its raw form, function notation essentially represents an equation with only one unknown variable, expressed in terms of another.  Thus, f(x) = x² + 7x can be expressed as

g(x) = 2x + 3

f(g(x)) = (2x + 3)²

f(g(x)) = 4x² + 12x + 9

Hope it helps :) and let me know if you want me to elaborate.

Answer:

f(g(x) = (2x+3)^2

Explanation:

f(g(x)) = f(2x+3)

stand for

= (2x+3)^2

As combustion always result into the formation of water, the other type of reactions that may result into formation of water are Acid-Base Neutralization Reactions and Hydrogen and Oxygen Reaction.

Acid-Base Neutralization Reactions:

A neutralisation reaction is a chemical process in which an acid and a base combine to produce salt and water as the end products.

H⁺ ions and OH⁻ ions combine to generate water during a neutralisation reaction. Acid-base neutralisation is the most common type of neutralisation reaction.

Example: Formation of Sodium Chloride (Common Salt):

HCl + NaOH → NaCl + H₂O

Hydrogen and Oxygen Reaction:

Water vapour is created when hydrogen gas (H₂) and oxygen gas (O₂) are combined directly. This reaction produces a lot of heat and releases a lot of energy.

Example: 2 H₂ + O₂ → 2 H₂O

Learn more about reactions:

https://brainly.com/question/25769000

A chemist determines that a substance is composed of 30.4% nitrogen by mass and 69.6% oxygen by mass. The molar mass of the compound is 230.5 g/mol, the molecular formula is NO₂.

We must compute the empirical formula in order to ascertain the compound's chemical composition.

If we have 100 grams of the compound.

This suggests we have:

30.4 g of nitrogen

69.6 g of oxygen

Now, we have to convert the mass of each element to moles.

The molar mass of nitrogen (N) = 14.01 g/mol

the molar mass of oxygen (O)  =  16.00 g/mol.

Number of moles of nitrogen (N):

2.17 mol

Number of moles of oxygen (O):

4.35 mol

The simplest whole-number ratio between the moles of nitrogen and oxygen must now be determined. To calculate the ratio, we divide both numbers by the smaller value.

Moles N / moles O = 2.17 mol / 2.17 mol = 1.00

Moles O / moles O = 4.35 mol / 2.17 mol = 2.00

The ratio is approximately N₁O₂.

We divide the subscripts by their greatest common divisor to obtain the simplest ratio, since we are looking for the empirical formula. The empirical formula is NO₂ since the greatest common divisor in this situation is 1.

The molecular formula of the compound is NO₂.

Learn more about molecular formula, here:

https://brainly.com/question/11203434

#SPJ1

The mass of ammonia prepared from 24.5 kg magnesium nitride, according to the reaction Mg₃N₂(s) + 6H₂O(l) → 3Mg(OH)₂(s) + 2NH₃(g), knowing that the process is 71% efficient is 5.87 kg.

The balanced reaction of production of ammonia is:

Mg₃N₂(s) + 6H₂O(l) → 3Mg(OH)₂(s) + 2NH₃(g)   (1)

First, let's find the number of moles of magnesium nitride

\( n_{Mg_{3}N_{2}} = \frac{m_{Mg_{3}N_{2}}}{M_{Mg_{3}N_{2}}} \)  (2)

Where:

\(m_{Mg_{3}N_{2}}\): is the mass of Mg₃N₂ = 24.5 kg

\(M_{Mg_{3}N_{2}}\): is the molar mass of Mg₃N₂ = 100.9494 g/mol

The number of moles is (eq 2):

\( n_{Mg_{3}N_{2}} = \frac{m_{Mg_{3}N_{2}}}{M_{Mg_{3}N_{2}}} = \frac{24500 g}{100.9494 g/mol} = 242.70 \:moles \)

We can calculate the mass of ammonia prepared, knowing that 1 mol of Mg₃N₂ reacts with 6 moles of H₂O to produce 3 moles of Mg(OH)₂ and 2 moles of NH₃ (reaction 1).

\(n_{NH_{3}} = \frac{2\: moles\: NH_{3}}{1\: mol\: Mg_{3}N_{2}}*n_{Mg_{3}N_{2} = \frac{2\: moles\: NH_{3}}{1\: mol\: Mg_{3}N_{2}}*242.70 \:moles \:Mg_{3}N_{2} = 485.4 \:moles\)

Then, the mass of NH₃ is:

\( m_{NH_{3}} = n_{NH_{3}}*M_{NH_{3}} = 485.4 \:moles*17.031 g/mol = 8266.8 g = 8.27 kg \)

Since the process is 71% efficient, the mass that can be prepared is:

\( m = 8.27 kg*0.71 = 5.87 kg \)

Therefore, the mass of ammonia that can be prepared is 5.87 kg.

I hope it helps you!

The answer is 3) Rock Breaking up due to mechanical force

Hope that help :)

||-//

Answer:

neblua is a place for baby stars when they're born

Explanation:

a nebula is a gaseous cloud formed from dead stars. this works as a nursery for baby stars.

hope this helps:)

Answer:

When the concentration of reactants is equal to the concentration of the products. [ when reaction rate is zero ]

Explanation:

This is only observed in a reversible reaction

\(.\)

The reaction is endothermic since the energy level of the products have are higher than that of the reactants.

The activation energy (AE) is the energy difference between the reactants and the transition state.

The change in energy E and the energy difference between the reactants and the products

The data given is as follows:

Reactants: 0 kJ/mol

AE forward 125 kJ/mol

AE reverse: 86 kJ/mol

Products: 39 kJ/mol

The values of ΔE forward and ΔE reverse are as follows:

ΔE forward = (39 - 0) kJ/mol

ΔE forward = +39 kJ/mol

ΔE reverse = (0 - 39) kJ/mol

ΔE reverse =  -39 kJ/mol

3. Given that Ea = 154 kJ/mol and ΔE = 136 kJ/mol

AE reverse = ΔE - AE forward

E = 136 kJ/mol - 154 kJ/mol

E = -18 kJ/mol

Learn more about activation energy at: https://brainly.com/question/1380484

#SPJ1

Answer:

heat energy

Explanation:

Chemical reactions often involve changes in energy due to the breaking and formation of bonds. Reactions in which energy is released are exothermic reactions, while those that take in heat energy are endothermic.

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Answer:

Redox reaction (Reduction-oxidation reaction) is simply the addition of oxygen in a reactant (oxidation) & its reduction in any other reactant (reduction).

For example, Fe2O3 + 3CO ⟶ 2Fe + 3CO2 is a redox reaction because Fe gets reduced while CO is oxidised (refer to the attachment).

________

Note: Remember that the equation should match the law of conservation of mass which states that the mass of the products should match the mass of the reactants always as energy can neither be gained or reduced.

________

Hope it helps ⚜

The correct answer is A

because it's the strong chemical compound

Answer:

fluorine is the most electronegative element

The ideal gas approximation is used for high temperatures and low pressures:

"Low pressure and high temperature, because particles are spread farther apart and moving faster, so the intermolecular forces of attraction are weaker"

Real gases behave like ideal gases when we have:

High temperature: This increases the kinetic energy of the molecules, so it allows the molecules to overcome the intermolecular forces. (At lowest temperatures the intermolecular forces are more relevant).

Low pressure: Low pressure means that there is "more space" between each molecule, and thus, there are fewer interactions between the molecules. If we increase the pressure, also does the number of interactions.

So the correct option is the third one:

"Low pressure and high temperature, because particles are spread farther apart and moving faster, so the intermolecular forces of attraction are weaker"

If you want to learn more about ideal gases, you can read:

https://brainly.com/question/25290815

Answer: Low pressure and high temperature

Explanation:

gas laws assume that gas particles dont repel or attract each other and that volume isn't significant enough to make a difference, so it would be low pressure and high temperature

Answer:

Explanation:

Answer:

what are the questions?

Explanation:

Answer:

B) separation by boiling points

Explanation:

According to the diagram depicted, crude oil is separated into its different units using boiling points.

Answer:A. abandoned realism in favor of conveying feelings of anxiety and instability.

Rather than depicting the habitual esthetical artworks charged with beauty standards, artists from this period begin to express in works representing the struggles of the time. Some went far to represent distorted figures

Explanation:

Answer:

a

Explanation:

Answer:

the water molecules have more energy and are moving faster than the molecules of cold water. This makes it easier for the dye to get mixed throughout the hot water.

Explanation:

Answer:

Because particles moves more by kinetic energy and diffusion will spread with the particles

Explanation:

Answer:

About 7.0 × 10³ J or 7.0 kJ

Explanation:

We want to determine the amount of energy needed to raise the temperature of 67 grams of water from 20°C to 45°C.

We can use the heat equation:

\(\displaystyle q = mC\Delta T\)

Where C is the specific heat of water.

Substitute and evaluate:

\(\displaystyle \begin{aligned} q & = (67\text{ g})\left(\frac{4.2\text{ J}}{\text{g-$^\circ$C}}\right)\left(45^\circ \text{ C}- 20.^\circ\text{ C}\right) \\ \\ & = (67\text{ g})\left(\frac{4.2\text{ J}}{\text{g-$^\circ$C}}\right)(25^\circ \text{ C}) \\ \\ & = 7.0\times 10^3 \text{ J}\end{aligned}\)

Recall that there are 1000 J in a kJ. Hence:

\(\displaystyle \begin{aligned} q & = 7.0\times 10^3 \text{ J} \cdot \frac{1\text{ kJ}}{1000\text{ J}} \\ \\ & = 7.0 \text{ kJ}\end{aligned}\)

In conclusion, it will take about 7.0 × 10³ J or 7.0 kJ of energy to raise the temperature of 67 grams of water from 20 °C to 45 °C.

a. The rate law for this reaction is: Rate = k[Cl] [H₂]. This means that the rate of the reaction is directly proportional to the concentrations of both Cl and H₂ molecules.

Rate law is an equation that describes the rate of a chemical reaction as a function of the concentrations of reactants. The rate law allows us to describe how the rate of a reaction changes when the concentrations of reactants are changed. It is derived from the rate equation, which is a mathematical expression that can be used to calculate the rate of a reaction from the concentrations of the reactants and the rate constant.

b. The rate law for this reaction is: Rate = k[O] [Os]. This means that the rate of the reaction is directly proportional to the concentrations of both O and Os molecules.
c. The rate law for this reaction is: Rate = k[NO₂]₂. This means that the rate of the reaction is directly proportional to the square of the concentration of NO₂ molecules.

To learn more about rate law
https://brainly.com/question/16981791
#SPJ1

Complete Question: