B is between A and C, AB=13.7 and BC=8.3. Find AC.

AC = 20
AC = 22
AC = 17
AC = 19

Answers

Answer 1

Answer:

22

Step-by-step explanation:

add ab and bc to get ac


Related Questions

An architect is designing a water fountain for a park. She uses the given function to model the water jets flowing from the fountain's nozzles,

where h(x) gives the height of the water jet, in feet, x feet from its starting point.

Answers

The two adjacent columns that show an interval with an average rate of change of -0.3 are column 7ᵗʰ and 8ᵗʰ.

We have a function used by an architect is designing a water fountain for a park. The function is defined as h(x) = - x²/20 + x + 15

where h(x) --> height of the water jet, in feet,

x --> distance from its starting point in feet.

Also , the average rate of change = - 0.3

Average rate of change is used to measure the change in value of function per unit, on average over an interval. It is derived from the slope line which is formed bu joining the end points of graph. Formula is represented as

A(x) = {F(b) - F(a)}/(b - a)

where b and a are end points of interval.

In this case, this formula is used as

A(x) = {H(x₂) - H(x₁)}/(x₂ - x₁ )

=> -0.3 = {H(x₂) - H(x₁)}/(x₂ - x₁ )

As we see in above figure the difference between the any two values of x is equals to 2 i.e., the final value - initial value = 2 in an interval.

So, x₂ - x₁ = 2

=> -0.3 = {H(x₂) - H(x₁)}/2

=> -0.3× 2 = H(x₂) - H(x₁)

=> -0.6 = H(x₂) - H(x₁)

=> H(x₂) = H(x₁) - 0.6

so, the columns which follows this relationship are the following

distance , x 12 14

Height of jet , h(x) 19.8 19.2

Hence, the required relationship is H(x₂) = H(x₁) - 0.6.

To learn more about Average rate of change, refer:

https://brainly.com/question/11627203

#SPJ4

Complete question:

An architect is designing a water fountain for a park. She uses the given function to model the water jets flowing from the fountain's nozzles,

where h(x) gives the height of the water jet, in feet, x feet from its starting point. select two adjacent columns that show an interval with an average rate of change of -0.3

An architect is designing a water fountain for a park. She uses the given function to model the water

At a sale on winter clothing, Cody bought two pairs of gloves and four hats for $44.00. Tori bought two pairs of gloves and two hats for $28.00. Solve the system to determine the prices of the hats and gloves.

Answers

Answer:

$6.00 for pair of gloves and $8.00 for a hat

Step-by-step explanation:

the difference between Tori and Cody is $16.00 its two hats. Then one hat is $8.00

If two hats are $16, two pair of gloves must be $12.00

Then one pair of gloves is $6.00

MAN PLEASE STOP ANSWERING WIERD THINGSSS

GUYS PLEASE I ONLY HAVE A FEW MINUTES LEFT...

MAN PLEASE STOP ANSWERING WIERD THINGSSSGUYS PLEASE I ONLY HAVE A FEW MINUTES LEFT...

Answers

Answer:

100.8 cm

Step-by-step explanation:

The square root of 635 is 25.1992... or about 25.2

Because this is the length of 1 side, we multiply it by 4 to get the perimeter

25.2 · 4 = 100.8

oh so Sorry about that Here it is

oh so Sorry about that Here it is

Answers

Answer:

y = 1/4x + 1

1/4 is the slope and 1 is the y-intercept

Suppose f(x) = (5 – x)3 and, g(x) = a + x2, and f(g(x)) = (1 – x2)3. What is the value of a? a = –6 a = –4 a = 4 a = 6

Answers

Answer:

When I work with function composition, I usually convert "( f o g)(x)" to the more intuitive " f (g(x))" form. This is not required, but I certainly find it helpful. In this case, I get:

(g o f )(1) = g( f(1))

This means that, working from right to left (or from the inside out), I am plugging x = 1 into f(x), evaluating f(x), and then plugging the result into g(x). I can do the calculations bit by bit, like this: Since f(1) = 2(1) + 3 = 2 + 3 = 5, and since g(5) = –(5)2 + 5 = –25 + 5 = –20, then (g o f )(1) = g( f(1)) = g(5) = –20. Doing the calculations all together (which will be useful later on when we're doing things symbolically), it looks like this:

(g o f )(1) = g( f (1))

  = g(2(   ) + 3)   ... setting up to insert the original input

  = g(2(1) + 3)

  = g(2 + 3)

  = g(5)

  = –(   )2 + 5    ... setting up to insert the new input

  = –(5)2 + 5

  = –25 + 5

  = –20

Note how I wrote each function's rule clearly, leaving open parentheses for where the input (x or whatever) would go. This is a useful technique. Whichever method you use (bit-by-bit or all-in-one), the answer is:

(g o f )(1) = g( f (1)) = –20

I just computed (g o f )(1); the composition can also work in the other order

Step-by-step explanation:

The value of a is 4.

Hence, a = 4

Here,

f(x)=(5x)3and,g(x)=a+x2,

and f(g(x))=(1x2)3

We have to find the value of a.

What is composite function?

Function composition is an operation that takes two functions f and g and produces a function h such that h(x) = g(f(x)).

Now,

f(x)=(5x)3and,g(x)=a+x2,

and f(g(x))=(1x2)3

f(g(x))=f(a+x2)

f(a+x2)=(5ax2)3

And,

f(g(x))=(1x2)3

(5ax2)3=(1x2)3

Taking cube root both sides,

(5ax2)=(1x2)5ax2=1x2a=4

Hence, The value of a = 4.

Learn more about the composite function visit:

https://brainly.in/question/14333427

#SPJ6

which inequality is represented by this graph

which inequality is represented by this graph

Answers

Answer:

x53

Step-by-step explanation:

Answer:

x ≥ -53

Step-by-step explanation:

Here is a trick the arrow is going to the right so the arrow in the inequality must go to the right and if the circle is closed there must be a line under the arrow in the inequality.

Can I get Brainliest please!

In right triangle ABC, m∠A = 30° and m∠B = 90°. Which of the following are true?

I. sin(A) = sin(C)
II. sin(A) = cos(C)
III. cos(A) = cos(C)
IV. cos(A) = sin(C)
A.
II and IV
B.
I and III
C.
I and II
D.
III and IV

Answers

Answer:

II and IV

Explanation: Plato

Step-by-step explanation:

In the right triangle ABC, mA=30°, and mB=60 then, sin(A)=cos(C) and cos(A)=sin(C).

What is a triangle?

" Triangle is defined as the two-dimensional closed shape with three vertices, three sides, and three angles enclosed in it."

According to the question,

In the  right triangle ABC,

As we know,

mA+mB+mC=180

Given,

mA=30°,

mB=60°

Therefore in the right triangle ABC,

mC=180(90+30)mC=60

Now find the value of the required trigonometric function we get,

sin(30)=12

sin(60)=32

cos(30)=32

cos(60)=12

Therefore,

sin(30)=cos(60)sin(A)=cos(C)sin(60)=cos(30)cos(A)=sin(C)

Hence, Option(A) is the correct answer.

Learn more about triangles here

brainly.com/question/2773823

#SPJ2

Chicken strips at a restaurant sell for the following prices: 4 pieces for $2.40 6 pieces for $3.00 How much do customers save per chicken strip if they buy the larger quantity

Answers

Answer:

10 cents

Step-by-step explanation:

In order to answer this question we have to find how much each chicken strip costs individually.

Let's start with the 4 piece.

To find how much each piece costs we have to divide $2.40 by 4. Like this:

2.404=.60

In the 4 piece, every chicken strip costs .60 cents.

Now, let's do the 6 piece.

Like before we are going to divide $3.00 by 6.

3.006=.50

In the 6 piece, every chicken strip costs .50 cents.

Therefore, customers save 10 cents when they buy the larger quantity.

I hope this helps!

If you have any questions let me know!

- Kay :)

A line segment has an endpoint at (-3, 5) and a midpoint at (6, 2). What are the coordinates of the other endpoint?

a. (15, -1)

b. (0, -4)

c. (1.5, 3.5)

d. (-6, 14)

Answers

The answer is option a. ( 15, -1 )

Let the other endpoint of the line segment's other endpoint's coordinates be (x, y).

We can apply the midpoint formula since we know that the line segment's midpoint is at (6, 2):

( ( x + ( -3 ) ) / 2, ( y + 5 ) / 2 ) = ( 6, 2 ) ( 6, 2 )

When we simplify this equation, we obtain:

(x - 3) / 2 = 6 and (y + 5) / 2 = 2

When we solve for x and y, we obtain:

x - 3 = 12 and y + 5 = 4

x = 15 and y = -1

Hence, the opposite endpoint's coordinates are (15, -1).

Therefore, option a.) is the correct response (15, -1).

To know more about line segment visit : https://brainly.com/question/30072605

#SPJ1

pls help!! it will mean a lot thank you:)

pls help!! it will mean a lot thank you:)

Answers

A. Scientific notation must be written as a number between 1 and 10 multiplied by a power of 10.
B. If the standard form of the number is greater than 1, the exponent will be positive.
C. If the standard form of the number is less than 1, the exponent will be negative.

Evaluate |c2 + b2|, given a = 5, b = -3, and c = -2.

10
6
2
13

Answers

Answer:

10

Step-by-step explanation:

|-2(2) + (-3)(2)|

2(2) + 3(2)

4 + 6

| | indicate absolute value, negative numbers are turned to positive numbers in absolute value, making B and C (negative values) into positive values.

Find in slope intercept form the equation of the line parallel to y + 5x = 2 and passing through the point (-1, 4)

Answers

Step-by-step explanation:

The slope of the line is - 5, the equation will be y=-5x-1.

y+5x=-1

If the limit as n goes to infinity of the quotient of the absolute value of the quantity a sub n plus 1 times the n plus 1 power of the quantity x minus 7 and the absolute value of the product of a sub n and the nth power of x minus 7 for the power series the summation from n equals 1 to infinity of a sub n times the nth power of the quantity x minus 7, then what is the interval over which the power series converges absolutely? You do not need to consider the endpoints.

Answers

In conclusion, the power series converges absolutely over an interval given by |x7|>|an+1||an|nNandn>N,whereNNis a natural number.


The interval over which the power series converges absolutely is given by |x7|>|an+1||an|nNandn>N,whereNN is a natural number.

In other words, for any given N, the series will converge absolutely over the interval \left|x-7\right|>\frac{\left|a_n+1\right|}{\left|a_n\right|}\;\;\;\forall\;\;\;n>N.

This means that the series will converge absolutely over a larger interval as N increases, since the terms \frac{\left|a_n+1\right|}{\left|a_n\right|} get closer to 1 for larger values of n.

for such more questions on intervals

https://brainly.com/question/30378158

#SPJ11

Find the midpoint of the line segment with the given endpoints. (-6, -1), (-6, -3)​

Answers

Step-by-step explanation:

ML = (-6+(-6). (-1+(-3))

---------. +. --------

2. 2

=. (-6 ; -2)

i think

I NEED THE VALUE OF X

I NEED THE VALUE OF X

Answers

Answer:

x=18

Step-by-step explanation:

Since the angle is 90, noted by the right angle symbol, we can say that 5x=90

Now we simplify each side.

5x/5 = 90/5

x=18

What is the equation of the line that best fits the given data? A graph has points (1, 7), (1, 6), (2, 5), (2.5, 5), (3, 3), (4, 1). a. y = negative 5 x + 11 c. y = 3 x + 10 b. y = negative one-third x + 10 d. y = negative 2 x +

Answers

Answer:

D

Step-by-step explanation:

this is correct on edge

Answer:

D on edge

Step-by-step explanation:

ur welcome

Write a numerical expression for the verbal expression.

The difference of twenty-two and six divided by the sum of five and three

Answers

I think it will be 22 minus 6/5+3 (5+3=8)

Statistical process control is used in service industries like a blood testing lab to determine normal levels of variation. Normal levels of variation are the voice of the specification Group of answer choices True False

Answers

True. Statistical process control is commonly used in service industries, including blood testing labs, to monitor and analyze processes and determine normal levels of variation.

These normal levels of variation are often used as the basis for setting specifications and determining if a process is in control or out of control. Therefore, they can be considered the "voice of the specification" in service industries.


True. Statistical process control is used in service industries like a blood testing lab to determine normal levels of variation. Normal levels of variation are considered the voice of the specification. This helps to maintain quality and control the process.

Learn more about variation at: brainly.com/question/13977805

#SPJ11

need help on this question asap!!

need help on this question asap!!

Answers

The measure of angle B in the given triangle is 56°

Calculating the measure of an angle in a triangle

From the question, we are to determine the measure of the unknown angle

From the given information,

We have a right triangle and the measure of one of the angles is 34°

The right triangle is ΔABC, and we are to determine the measure of angle B

m ∠A + m ∠B + m ∠C = 180° (Sum of angles in a straight line)

90° + m ∠B + 34° = 180°

m ∠B + 124° = 180°

m ∠B = 180° - 124°

m ∠B = 56°

Hence, the measure of angle B is 56°

Learn more on Calculating measure of angles here: https://brainly.com/question/25215131

#SPJ1

find the function that describes the graph of f(x)={x} translated 2 units to the right

Answers

Answer:

f(x)=f(x-2)

Step-by-step explanation:

Can someone help me with these? I need some help.

Can someone help me with these? I need some help.

Answers

Answer:

1) 569  2) 8   3) 0.8  4) 6110

Step-by-step explanation:

The equation for pythagoream theorem is

a^2 + b^2 = c^2  (the caret "^" represents exponents)

A = a side length

B = another side length

C = the hypotnuse which is the slanted side of the right triangle.

To solve these problems plug in the known values into the equation then solve.

PLEASE HELP!!! WILL GIVE BRAINLIEST!!!

PLEASE HELP!!! WILL GIVE BRAINLIEST!!!

Answers

Answer:

112 degrees

Step-by-step explanation:

The other 2 interior angles are (180-44)/2 which is 68.

180 (straight line) -68 = 112

POTW 2
Jo needs an 85% average on her five math tests. She earned 99%, 85%, 79%, and 88% on her first four
tests. What score must she earn on her fifth test in order to have an average of exactly 85% for all five
tests?
PLEASE HELP ME WITH THIS

Answers

Answer:

79

Step-by-step explanation:

i dont know y

a scatterplot shows: a. the average value of groups of data. b. scores on one variable plotted against scores on a second variable. c. the frequency with which values appear in the data d. the proportion of data falling into different categories.

Answers

Scores on one variable plotted against scores on a second variable.

The correct answer is (b)

Now, According to the question:

Let's know:

A scatterplot shows:

A scatterplot shows the relationship between two quantitative variables measured for the same individuals. The values of one variable appear on the horizontal axis, and the values of the other variable appear on the vertical axis. Each individual in the data appears as a point on the graph.

Hence, The correct answer is (b) i.e.,

Scores on one variable plotted against scores on a second variable.

Given,

In the question:

A scatterplot shows:

a. the average value of groups of data.

b. scores on one variable plotted against scores on a second variable.

c. the frequency with which values appear in the data

d. the proportion of data falling into different categories.

Learn more about Scatterplot at:

https://brainly.com/question/29366075

#SPJ4

in 2011, a professional climber scaled the outside of the Burj Khalifa, making it all the way up to 828 meters ( the highest point on which a person can stand) in 6 hours answers.

1. How far did they climb in the first 2 hours?

2. How far did they climb in 5 hours

3. How far did they climb in the final 15 minutes?

Answers

Answer:

Step-by-step explanation:

Given that:

A professional climber makes his way up to 828 meters in 6 hours in Burj Khalifa.

Therefore; in two hours, he would have climbed:

x = (828 m × 2hrs)/6 hrs

x = 276 miles

In five hours, he would have climbed;

y = ( 828 m × 5 hrs)/6 hrs

y = 690 miles

SInce 60 minutes = 1 hour

Then 15 minutes will be ( 15)/60 = 0.25 hours

Thus, in the last 15 minutes;

He climbed  = (828 m × 0.25 hrs)/6 hrs = 34.5 miles

 

What is the remainder of 42, 325 divided by 47 ?

A : 25

B : 26

C : 35

D : 36

will give brainliest! pleaseee

Answers

Answer:

remainder 25

Step-by-step explanation:

if 42,325 is divided by 47the result is 25,

firstly divide 42,325 by 47, you will see that it can only divide 42,325 which is 900 without any remainder,then the 900 is the whole number and 25 is remaining from the subtraction of 42,325-42,300=25 ,and 25 has to be divided by 47 but it is not up to 47,then we have it as a remainder,

so 25 is the remainder

PLZ HELP WITH MATH ASAP

PLZ HELP WITH MATH ASAP

Answers

Answer:

C, because the segment in front of it is the smallest

Answer:

yes

Step-by-step explanation:

What is the standard form for 9^2

Answers

Answer:

81

Step-by-step explanation:

help me please ASAP pls

help me please ASAP pls

Answers

The answer would be 2 pizza

Answer:

Approximately 2 pizzas

Step-by-step explanation:

Convert everything into improper fractions. 5&(7/8) = (47/8). 4&(1/16) = (61/16). Then you find the greatest common denominator of the two fractions. You can convert the (47/8) into (94/16) by multiplying everything by 2. You keep the (61/16) the same. Then you subtract the two fractions and you get (33/16). If you turn that into a mixed fraction, you get 2&(1/16). The question asks for the estimate, not exact answer, so you can put 2 as your answer.

Rational Functions
Create a Model to represent the scenario.

Shrek, Donkey, and Fiona are riding in a carriage to Far Far Away. The horses, Prescott and Thaddeus, are pulling the carriage all the way. Prescott alone could pull the carriage all the way to Far Far Away and back to The Swamp in 21 days, but together they are able to pull the carriage to Far Far Away in 9 days.

Answers

Answer:

Step-by-step explanation:

Remark

I suppose the question is what is Thaddeus' time to make the trip. This is a fairly common question but not everyone knows how to solve it.

Derivation of the Formula

Prescott + Thaddeus = 1 trip

So the logic of the equation is this.

distance = 1 trip

time = number of dates

rate = ?

rate = distance / time

To find out what the contribution of Thaddeus is set up  a distance time formula.

1/21 days is the rate for Prescott

1/x days is the rate for Thaddeus

Together the rate is 1/9

Solution

1/21 + 1/x = 1/9

Subtract 1/21  from both sides

1/x = 1/9 - 1/21

It's not obvious what the LCM is.

9 = 3 * 3

21 = 3 * 7

LCM: 7 * 3 *3 = 63

1/x = 7/63 - 3/63 = 4/63

1/x = 4/63                             Cross Multiply

4x = 63                                 Divide by 4

x = 63/4

Answer

x = 15 3/4

x = 15.75

Other Questions
5(2/5) how to solve it? One of the article's central ideas isthat scientists have determined theEarth is 4.5 billion years old.How does the author introduce thiscentral idea? Why is taking a census better than taking samples in a survey? Convection causes tectonic plates to move.Please select the best answer from the choices provided- TRUE- FALSE A type of painting that is large and semi-detailed it uses large broad strokes Triangles v w z and y x z are connected at point z. to prove that vwz ~ yxz by the sas similarity theorem, which other sides or angles should be used? wv and xy wv and zy vzw yzx vwz yxz Write a nuclear equation to describe the neutron induced fission of 23994 pu to form 8936 kr and 14958 ce. determine how many neutrons are produced in the reaction. Why do you think the federal government approved of the kingsbury commitment and allowed at&t to control so much of the market for telephone service?. can someone help me please? how old was aberham lincon A group of friends wants to go to the amusement park. They have no more than $555 to spend on parking and admission. Parking is $7.50, and tickets cost $39.50 per person, including tax. Which inequality can be used to determine p, the maximum number of people who can go to the amusement park? Which Macromolecule forms peptide bonds? Evaluate Why did the powers denied Congress lead to a weak government? Joy wants to select a good location to sell tickets for a dance. Locate point P such that the distance someone would have to walk from Hallway A , to point P on the wall, and then to their next class in Hallway B is minimized. Both (-3)(+3) and (3-) (3+) contain a sum and a difference with each factor only containing a 3 and an x.If each expression is rewritten in standard form, will the two expressions be the same? Explain or show your reasoning. Why is self defense so important when going out alone at night list and state the facts Two spherical objects are separated by a distance that is 1.80 10-3 m. The objects are initially electrically neutral and are very small compared to the distance between them. Each object acquires the same negative charge due to the addition of electrons. As a result, each object experiences an electrostatic force that has a magnitude of 4.5500 10-21 N. How many electrons did it take to produce the charge on one of the objects Why do people choose to use this drug? What purpose does it serve marijuana? Use the given information to find the exact value of each of the followinga. sin 2 b. cos 2 c. tan 2sin =2/5, lies in quadrant II 1. Imagine that you are responsible for filling roles for a mock criminal trial. What parts would need to be represented? What types of responsibilities would each position have? Make a list.2. During the pre-trial phase, witnesses are summoned to the courtroom in which they will testify to the facts of a case. During the trial, both fact witnesses and expert witnesses give testimony. Write a response comparing and contrasting what happens with an expert witness versus a fact witness.3. The Constitution grants all US citizens the right to bail, even when they are facing serious crimes such as murder. Do you agree with this? Why or why not?4. In most states, the post-trial phase requires judges to sentence the convicted using a sentencing table. This means that they cannot go over or under the recommended sentence for that particular crime. Do you think the law should dictate what the sentence for a particular crime should be, or should this be solely at the discretion of the judge? Explain.5. Serving a defendant or witness with court documents is an important part of the pre-trial process. Do you think service should always happen in person or is dropping off the paperwork okay? What should happen to those who refuse to receive a summons? Defend your stance.Please help me out!!