As of 2012, the proportion of students who use a MacBook as their primary computer is 0.46. You believe that at your university the proportion is actually less than 0.46. The hypotheses for this scenario are Null Hypothesis: p ≥ 0.46, Alternative Hypothesis: p < 0.46. You conduct a random sample and run a hypothesis test yielding a p-value of 0.4734. What is the appropriate conclusion? Conclude at the 5% level of significance.1) We did not find enough evidence to say the proportion of students that use a MacBook as their primary computer is less than 0.46.
2) The proportion of students that use a MacBook as their primary computer is greater than or equal to 0.46.
3) We did not find enough evidence to say the proportion of students that use a MacBook as their primary computer is larger than 0.46.
4) We did not find enough evidence to say a significant difference exists between the proportion of students that use a MacBook as their primary computer and 0.46
5) The proportion of students that use a MacBook as their primary computer is significantly less than 0.46.

Answers

Answer 1

Answer:

We did not find enough evidence to say the proportion of students that use a MacBook as their primary computer is less than 0.46.

Step-by-step explanation:

The hypothesis :

H0 : p = 0.46

H1 : p < 0.46

Pvalue = 0.4734

Level of significance, α = 5% = 0.05

Defining the Decison region :

Using Pvalue :

If Pvalue < α ; We reject the Null, H0 otherwuse, fail to reject the Null ;

0.4734 > α ; Here, Pvalue > α ; Hence, we fail to reject the null

Hence, there is not enough evidence to conclude that proportion of students that use a MacBook as their primary computer is less than 0.46


Related Questions

Which of the following is an irrational number? 9.4 (A. B. V82 OC C. V144 D. 7 9

Answers

Do you have a picture of your problem?

If y varies directly as x, and y = 8 when x = 4, find y when x = 24.

Answers

The value of y is 48

How to calculate the value of y in the variation ?

y= kx

let's solve for k which is the constant

y= 8 , x= 4

k= 8/4

k= 2

Next is to calculate the value of y when x is 24

y = 2 × 24

y= 48

Hence the value of y is 48

Read more on variation here

https://brainly.com/question/16593778?referrer=searchResults

#SPJ1

I NEED URGENT HELP
SOMEONE PLEASE HELP

I NEED URGENT HELPSOMEONE PLEASE HELP

Answers

Answer:

2x + 3y = -13

Step-by-step explanation:

We can first find the equation of the line in point-slope form. The slope of the line is given by (y2y1)/(x2x1), which is (-5-(-3))/(1-(-2)), or -2/3. The equation for a line in point-slope form is yy1=m(xx1) where m is the slope and (x1,y1) is a point on the line -- in this case, we may use (1, -5). Therefore, the equation for the line is y + 5 = -2/3 (x-1).

The question asks for the equation of the line in standard form -- which is Ax+By=C. We can get this by simplifying the equation above to get2x+3y=13.

Let f(x) = -3x - 5
What is the value of f(-5)?

Answers

Answer:

I think its 10

Step-by-step explanation:

The function f(x)=−3x+2 is defined over the domain −1

Answers

The domain of the function f(x) = -3x + 2 is (-∞, +∞), representing all real numbers, and the range is (-∞, 2], representing all real numbers less than or equal to 2.

The function f(x) = -3x + 2 is a linear function defined by a straight line. To determine the domain of this function, we need to identify the range of values for which the function is defined.

The domain of a linear function is typically all real numbers unless there are any restrictions. In this case, there is no explicit restriction mentioned, so we can assume that the function is defined for all real numbers.

Therefore, the domain of the function f(x) = -3x + 2 is (-∞, +∞), which represents all real numbers.

Now, let's analyze the range of the function. The range of a linear function can be determined by observing the slope of the line. In this case, the slope of the line is -3, which means that as x increases, the function values will decrease.

Since the slope is negative, the range of the function f(x) = -3x + 2 will be all real numbers less than or equal to the y-intercept, which is 2.

Therefore, the range of the function is (-∞, 2] since the function values cannot exceed 2.

For more such question on function. visit :

https://brainly.com/question/11624077

#SPJ8

please help me solve this step by step with wrriten explanation. context and words help me

please help me solve this step by step with wrriten explanation. context and words help me

Answers

If we try to rationalize51+7 using 7what happens is we still end up having a denominator with a radical51+777, multiply by 1=571(7)+7(7), distribute 7  to numerators and denominator=577+7 final answer

x-2y+z=2
bx+ay=3
-2y+z=-4
Choose appropriate values for a and b

Answers

Answer:

Attached

Step-by-step explanation:

Just for your reference, this question will get unlimited number of solutions, attached is a few examples I calculated from Excel. Have fun to pick one or create one to be your favorite.

x-2y+z=2bx+ay=3-2y+z=-4Choose appropriate values for a and b

21.
You work for a carpet cleaning
service and must shampoo the
carpet in the small banquet room
of a local hotel. The dimensions of
the room are 200 feet by 180 feet.
Each bottle of carpet shampoo can
be used to shampoo 320 square
feet of carpet. How many bottles
of shampoo do you need to
complete the job?

Answers

Working out:

200 * 180 = 36 000
So the room is 36 000 square feet.

36 000 / 320 = 112,5
You would need 112.5 bottles, but since you can’t get 0.5 bottle, you have to get 113 bottles.

Answer:
113 bottles

The number of bottles of shampoo required to complete the job is, 113

What is area?

An area is total space occupied by two-dimensional or flat surfaces. In other words we can say that it is a number of unit squares present in a closed figure. We use various units for measurement of area like, cm², m², ft², mm².

Area of square = a²

Area of rectangle = a × b

Area of circle  = πr²

Given that,

The dimensions of the room are 200 feet by 180 feet

Each bottle of carpet shampoo can be used to shampoo 320 square feet of carpet

bottles of shampoo  = ?

Total area we need to clean = 200 × 180

                                               =  36000

one bottle can clean area = 320 square feet

number of bottles  = Total area /one bottle can clean

number of bottles  =  36000/320

                               =   112.5

                               ≈ 113 bottles

So, The number of bottles required is 113

To know more about area check:

https://brainly.com/question/11952845

#SPJ1

Please help answer my question

Please help answer my question

Answers

Answer:

x = 6

Step-by-step explanation:

This is a bit of a tricky equation, and it's what we call an exponential equation since it involves some exponents. The way we begin to solve these kinds of problems is make the base on each side of the equals sign the same. On one side, we have 9 as our base, and on the other side, we have 3 as our base. 9 = 3², so we can rewrite our equation as shown below:

(3²)⁴ˣ⁻¹⁰ = 3⁵ˣ⁻²

From there, we can use the exponent rule (xᵃ)ᵇ = xᵃᵇ to simplify the left side of the equation.

3²⁽⁴ˣ⁻¹⁰⁾ = 3⁵ˣ⁻²

3⁸ˣ⁻²⁰ = 3⁵ˣ⁻²

Since our bases are now the same, we can take just the exponents and turn it into a new equation as shown below:

8x - 20 = 5x - 2

Hopefully at this point, this problem becomes easy for you, but I'll show how I solved this new equation below in case it doesn't make sense.

8x - 20 = 5x - 2

8x - 20 - 5x = 5x - 2 - 5x

3x - 20 = -2

3x - 20 + 20 = -2 + 20

3x = 18

3x/3 = 18/3

x = 6

Hopefully that's helpful! Let me know if you need more help. :)

What function is being described Justify each part of your function, explaining how you determined it.

My function has a vertical asymptote at x = -5 and x = 3 , a point discontinuity at x = 2. It has end behavior of f(x) goes to 0 as x goes to negative infinity and f(x) goes to 0 as x goes to positive infinity. The domain is (-inf, -5)U(-5, 2)U(2, 3) U (3,inf).

Answers

The end behavior of the function is as x tends to infinity, f(x) tends to zero. It is power function.

What is the end behavior of a polynomial function?

The end behavior of a polynomial function is the behavior of the graph of f(x) as x approaches positive infinity or negative infinity.

The degree and the leading coefficient of a polynomial function given is determine the end behavior of the graph.

Given that function has a vertical asymptote at x = -5 and x = 3 , a point discontinuity at x = 2.

The end behavior of f(x) goes to 0 as x goes to negative infinity and f(x) goes to 0 as x goes to positive infinity.

The domain is (-inf, -5)U(-5, 2)U(2, 3) U (3,inf).

Hence, we can conclude that the end behavior of the function is as x tends to infinity, f(x) tends to zero.

Learn more about the end behavior of function here:

brainly.com/question/11808280

#SPJ1

A bag contains 10 green,8 blue, and 2 white balls. Naomi seclets 2 balls from the bag at random, one at a time, without replacing them. What is the probability that she selects all two white balls?


E.) 2/95

F.) 1/95

G.) 1/190

H.) 1/380

Answers

To find the probability that Naomi selects both white balls, we need to consider the total number of possible outcomes and the number of favorable outcomes.

Total number of outcomes:

Naomi selects 2 balls without replacement, so the total number of outcomes is the number of ways she can choose 2 balls out of the total number of balls in the bag. This can be calculated using combinations:

Total outcomes = C(20, 2) = (20!)/(2!(20-2)!) = (20 * 19)/(2 * 1) = 190

Number of favorable outcomes:

Naomi needs to select 2 white balls. There are 2 white balls in the bag, so the number of favorable outcomes is the number of ways she can choose 2 white balls out of the 2 white balls in the bag:

Favorable outcomes = C(2, 2) = 1

Probability = Favorable outcomes / Total outcomes = 1/190

Therefore, the correct answer is (G) 1/190.

An AP has first term as 3 and Common difference of 2 how many terms are needed to make the sum to 99

Answers

Answer:

9

Step-by-step explanation:

The nterm is 2n+1.

Sn=3+2n+12(n)=99n(2n+4)2=99n(n+2)=99n2+2n99=0(n+11)(n9)=0n=9 (n>0)

The number of terms that needed to make the sum to 99 is 9

The first term of the arithmetic progression = 3

The common difference = 2

The sum of n term is = (n/2) [2a+(n-1)d]

Where a is the initial term

d is the common difference

Substitute the values in the equation

(n/2) [2(3)+(n-1)2] = 99

(n/2) [6 + 2n - 2] = 99

(n/2)[4+2n] = 99

n(2 + n) = 99

2n + n2 = 99

n2 + 2n - 99 = 0

Split the terms

n2 - 9n +11n - 99 =0

n(n -9) + 11(n - 9) = 0

(n + 11)(n - 9) = 0

n = -11 or 9

Since n cannot be a negative number, therefore n = 9

Hence, the number of terms that needed to make the sum to 99 is 9

Learn more about sum of n terms here

brainly.com/question/11688485

#SPJ1

Marco is coaching football 24 out of 30 days in June which decimal is equivalent to the fraction of days until he coach football

Answers

Answer:

Since the fraction of this is very obviously 24/30, here's how you can get a decimal out of that:

First, you simplify that fraction.

24/30 = 4/5, since 5x6 is 30 and 6x4 is 24

Now, it's pretty easy to convert 4/5 into a decimal.

This is how I like to do it. You re-convert the fraction one step higher, so it's 8/10, and you just turn it into 0.8, since it's all out of 10.

I hope I helped, and I'd appreciate a "Brainliest"! ☺

5/7 divided by 3 and 1/3

Answers

Answer:

3/14

Step-by-step explanation:

Example: Divide 3 loaves between 5 people First, divide two of the loaves into thirds... each person gets one third each, with one third left over Then divide the left-over third from the second loaf into fifths So, each person gets: 1/5 and the third loaf into fifths each person gets one fifth each each person gets a slice (one fifteenth) 1/15 3/5 The Egyptians used the approximated process to work on the area of a circle as shown in the picture. 1.4 Show the representation of the fractions on the second row. (2) 1.5 Show the algorithm/abstract strategy to justify the 3/5 found as the answer. (3)​

Answers

The algorithm justifies the answer of 3/5 as the fraction each person gets.

Representation of the fractions on the second row:

From what you described, two of the loaves were divided into thirds.

This means each person receives one third, and there is one third remaining. Then, this remaining third from the second loaf was further divided into fifths.

Therefore, each person receives one fifth from this remaining third.

So, the representation of the fractions on the second row would be:

Each person receives 1/3 (one third) from the two loaves.

Each person receives 1/5 (one fifth) from the remaining third.

Algorithm/Abstract strategy to justify the 3/5 found as the answer:

To find the final answer of 3/5, we can follow the steps you provided:

Divide two loaves into thirds, giving each person 1/3.

Divide the remaining third from the second loaf into fifths, giving each person 1/5.

Combining the fractions, each person has 1/3 + 1/5.

To add these fractions, we need to find a common denominator. In this case, the least common multiple (LCM) of 3 and 5 is 15. We can convert 1/3 and 1/5 to have a denominator of 15:

1/3 = 5/15 (multiplying numerator and denominator by 5)

1/5 = 3/15 (multiplying numerator and denominator by 3)

Now, we can add the fractions:

5/15 + 3/15 = 8/15

Therefore, each person receives 8/15 of a loaf.

Simplifying this fraction, we get 3/5.

Hence, the algorithm justifies the answer of 3/5 as the fraction each person gets.

Learn more about Algorithm/Abstract strategy click;

https://brainly.com/question/29438718

#SPJ1

a water snake in a well is 30 M below the ground level its lights 20 m upward and then slips down 10 M how far it is from the ground level
30+2010

Answers

If the water snake is initially 30 meters below the ground level and then climbs 20 meters upward, it will be 30 - 20 = 10 meters below the ground level. However, if it then slips down 10 meters, it will be 10 + 10 = 20 meters below the ground level.

NEED HELP PLEASE!!!!!!

NEED HELP PLEASE!!!!!!

Answers

Answer:

i wish i knew im in the same situwantion

Step-by-step explanation:

An organization published an article stating that in any one-year period, approximately 10.3 percent of adults in a country suffer from depression or a depressive illness. Suppose that in a survey of 100 people in a certain town, eight of them suffered from depression or a depressive illness. Conduct a hypothesis test to determine if the true proportion of people in that town suffering from depression or a depressive illness is lower than the percent in the general adult population in the country.

Answers

Answer:

We accept H₀ we don´t have enough evidence to support that the proportion of certain town differs from that of National Information

Step-by-step explanation:

National Information:

p = 10,3 %      p = 0,103

Sample

Sample size    n₁  = 100

x₁  = 8

p₁  = x₁/100         p₁  = 8 / 100     p₁ = 0,08 %  

q₁  =  1 - p₁       q₁  = 1  - 0,08      q₁  = 0,92

Confidence Interval  CI = 95 %   significance level  α  = 5 %   α = 0,05

z(c) for α = 0,05  from z-table is  : 1,64

Test Hypothesis:

Null Hypothesis                                       H₀       p₁  = p

Alternative Hypothesis                           Hₐ       p₁ <  p

The alternative hypothesis suggest a one tail test to the left

z(s)  =  (  p₁  - p ) √p₁*q₁ / n₁

z(s)  = ( 0,08 - 0,103 )/√ 0,08*0,92/100

z(s)  =  - 0,023 / 0,027

z(s)  = - 0,85

Comparing  z(s)   and  z(c)

z(s) > z(c)     - 0,85  > -1,64

z(s) is in the acceptance region, we accept H₀

Select the correct answer. Simplify the following expression. ​

Select the correct answer. Simplify the following expression.

Answers

The simplified exponential expression for this problem is given as follows:

D. 1/49.

How to simplify the exponential expression?

The exponential expression for this problem is defined as follows:

756×776


When two terms with the same base and different exponents are multiplied, we keep the base and add the exponents.

Hence the exponent is given as follows:

-5/6 - 7/6 = -12/6 = -2.

The negative exponent is moved to the denominator, hence:

1/7² = 1/49.

More can be learned about exponent rules at https://brainly.com/question/11975096

#SPJ1

A cylinder has a base diameter of 16 feet and a height of 4 feet.

Answers

Answer:

Step-by-step explanation:

radius = 16/2 = 8

Then you can apply the formula to calculate the base area, lateral surface or surface or even perimeter

Answer:

268 cubic feet

Step-by-step explanation:

=PI 8^2 (3/4)

How many times can 1/5 go into nine

Answers

Answer:

1.8

Step-by-step explanation:

The two trolleys move at a constant velocity what is the magnitude of the acceleration of each trolleys​

Answers

Answer:

0

Step-by-step explanation:

A constant velocity means no speeding up or slowing down. So the acclereation will be 0.

Which problem solving strategy would be best to solve this problem?


Brandon went to the store and spent $2.50 on pencils. He spent half of what he had left on a notebook and paper. When he got home he had $5.00 left. How much money did Brandon have before going to the store?

Answers

Answer: The best problem solving strategy to solve this problem with is a formula. Additionally Brandon had $12.50 before going to the store.

Step-by-step explanation: Formula and Solving it

He Spent $2.50 on pencils.

Amount left after buying a pencil = x - 2.50

Next, he spent half of the amount left in his pocket.

He spent (x - 2.50)/2 on notebook and paper.

So the total amount he spent = 2.50 + (x -2.50)/2

Amount left when he got home =$ 5.00

That means, x - Total amount spent = 5

=> x - (2.50 + (x -2.50)/2 ) = 5

=> x - 2.50 -x/2 + 2.50/2 = 5

=> x/2 - 2.50/2 = 5

=> x/2 = 5 + 2.50/2

=> x/2 = 6.25

=>x = $12.5

please help
What is the distance to the earth’s horizon from point P?

Enter your answer as a decimal in the box. Round only your final answer to the nearest tenth.

x =
mi

please help What is the distance to the earths horizon from point P?Enter your answer as a decimal in

Answers

The measure of distance x, that is, the distance between a point P and the point of horizon, is equal to 284.372 miles.

How to find the distance to the earth horizon from a given point

In this problem we must determine the distance between a point P located about earth's circumference and the point of horizon, located on earth's circumference. Since the line between these two points is tangent to earth, then, distance x can be found by Pythagorean theorem:

x = √[(3959 mi + 10.2 mi)² - (3959 mi)²]

x = 284.372 mi

The distance x is equal to 284.372 miles.

To learn more on Pythagorean theorem: https://brainly.com/question/14930619

#SPJ1

Jasmine has a circular swimming pool with a radius of 4.2 meters. What is the circumference of the pool? Use 3.14 for π
. Round to the nearest hundredth if necessary.
__ m

Answers

If the radius of Jasmine's swimming pool is 4.2 meter, then it's circumference is 26.4 meters.

The "Circumference" of a circle is known as the distance around the boundary of a circle.

The circumference of a circle is given by the formula : 2 × π × radius,

where π (pi) is a mathematical constant approximately equal to 3.14,

We are given that Jasmine's swimming pool has a radius of 4.2 meters.
So, we can calculate the circumference of the pool as :

⇒ Circumference = 2 × 3.14 × 4.2 meters,

⇒ Circumference ≈ 26.4 meters,

Therefore, the circumference of Jasmine's swimming pool is 26.4 meters.

Learn more about Circumference here

https://brainly.com/question/16125353

#SPJ1

The values in the table represent an exponential function. What is the
common ratio of the associated geometric sequence?
х
у
1
9
2
36
3
144
4
576
5
2304
O A. 4
B. 27
C. 45
O
D. 9

Answers

Answer:

It is 4.

Step-by-step explanation:

9(4)=36

36(4)=144

144(4)=576

576(4)=2304

Hope this helps:)

Help please urgent omg?

Help please urgent omg?

Answers

Addictive property Becayse it’s adding and it’s using that type of property. D
Answer: D
Hope this helps :)

How can trigonometric ratios be used to solve for unknown angle measures of right triangles?

Answers

Answer:

the sine of the angle of one corner equals the opposite side divided by the hypotenuse. the cosine of the angle of one corner equals the adjacent side divided by the hypotenuse. the tangent of the angle of one corner equals the opposite side divided by the adjacent side.

Find the length of the missing side 42ft 56ft

Answers

Answer:

46 feet is the missing side

30 points

All of the following ratios are equivalent except_____.

A. 6/4
B. 8 to 12
C. 2:3
D. 6/9

Answers

Answer:

A. 6/4

Step-by-step explanation:

all of the other answers are equivalent to 0.666667

while 6/4 is equivalent to 1.5

Hope this helped :)

Answer:

A. 6/4

Step-by-step explanation:

B, C, and D are all equal to the ratio 2:3.

On the other hand, A is not equivalent to the other 3.

If we simplify A, it gets us the ratio 3:2, instead of 2:3

So, A is the ratio that is not equivalent to the others.

Other Questions
In the last week, Mariahs ranking in a video game changed by places on the high scores list. Which statement BEST describes the change in Mariahs ranking? Identify at least two reasons that support your position. Use examples from your reading to write one or two sentences. Btw this is for the uh why do u support the alien and sedition acts A material that provides resistance to the flow of electric current is called a(n):circuitconductorinsulatorresistor Kyle liked Lucy more than any other girl in the school, but he had an odd way of showing it.When she walked ahead of him in line, he kicked at her shoe. When she passed him on theschoolyard, he called her "Lucy the Loser." He even wrote a mean word on her homeworkduring the bus ride to school. But what puzzled Lucy the most was receiving an invitation toKyle's birthday party. Figuring that he was just planning a mean trick on her, Lucy decided not togo. As Kyle eagerly awaited Lucy's arrival, Lucy talked on the phone to Jacob. When Kylefinally realized that Lucy was not coming to his party, he was devastated.5. What is the theme of this story? _______________________________________________________________________________________________________________________________6. What happens in the story that leads you to believe this? ___________________________________________________________________________________________________________ Using complete sentences, compare and contrast urban and rural life in the Middle East. all of the following occur during inflammation. what is the first step? group of answer choices diapedesis phagocyte migration margination vasodilation repair Compare and Contrast the House of Representatives and the Senate. How are they alike and how are they different? How to solve 3 equations with 3 unknowns? how old do you have to be to work at kickback jacks Why might overhead be underapplied in a year? why might it be overapplied? provide examples. A man sitting in a chair. he has on tall socks, shoes with a buckle, and a long coat with large cuffs and many buttons. he's sitting in a high back chair next to a desk. this example of intaglio by william hogarth, was created using what type of intaglio printing? a. etching b. aquatint c. drypoint d. engraving please select the best answer from the choices provided a b c d Solve for the force in members GF, CD and FC and state whether it is in tension or compression using the method of sections. The horizontal member length is L = 20 ft. Take P=6 kip. P H P 2P/3 T IG 0.8L P/2 0.4L E B C ID - L - L - L - an ionization-type survey meter is also referred to asa. cutie pieb. flux capacitorc. little rascald. warp drive Which student is completing an impactful act of Turbo?a: Thomas joined a volunteer club to run a book drive for kids.b: Piper did an extra workout for swim team.c: Cheru remembered his soccer uniform.d: Chelsea finished her math homework before watching TV. Question 2 Fill in the blanks to complete the sentence. A recipe for sparkling grape juice calls for 112 quarts of sparkling water and 34 quart of grape juice. a. How much sparkling water would you need to mix with 9 quarts of grape juice? 12 quarts b. How much grape juice would you need to mix with 154 quarts of sparkling water? Use decimal notation. 6 quarts c. How much of each ingredient would you need to make 100 quarts of punch? Round your answer to the nearest whole quart. sparkling water: quarts grape juice: quarts in dante av, with the jpeg2000 codec and a 1 gbps connection, what resolution and frame rates are currently supported? Emma was excited because she would help Granny decorate the Easter eggs. (Convert into a compound sentence using for.) what is 4 pls pls help client indicates readiness to look at a new colostomy which actino would be most effective in preparing the client convert direct speech into indirect speech