As a nucleus becomes unstable, it will undergo radioactive decay to.?

The concentration of NaOH in molarity is calculated to be equal to 2.186 M.

Concentration of chemical substance expresses the amount of substance present in any mixture.

In a neutralization reaction between NaOH and HCl, the number of moles of HCl will be equal to the number of moles of NaOH.

n(NaOH) = n(HCl)

n is the number of moles.

n(HCl) = M(HCl) x V(HCl)

M is the molarity and V is the volume in liters.

n(HCl) = 0.65 M x 0.037 L = 0.02405 moles HCl

Since the number of moles of NaOH is the same as the number of moles of HCl, we can use the following formula to find the concentration of NaOH:

M(NaOH) = n(NaOH) / V(NaOH)

V(NaOH) = 11.0 mL / 1000 mL/L = 0.011 L

M(NaOH) = n(NaOH) / V(NaOH) = n(HCl) / V(NaOH)

M(NaOH) = 0.02405 moles / 0.011 L = 2.186 M

Therefore, the concentration of NaOH in molarity is 2.186 M.

To know more about concentration, refer

https://brainly.com/question/17206790

#SPJ1

Answer:

The four different bases pair together in a way known as complementary pairing. Adenine always pairs with thymine, and cytosine always pairs with guanine.

Explanation:

The measure of the length of events and the duration of intervals between events is time.

The duration of events or the gaps between them can be measured, compared, or even ordered using time. The lengthy period of time that the Earth's geologic history takes up is known as geologic time. Starting at the beginning of the Archean Eon  formal geologic time runs until the present. Geology is defined as the "Science of the Earth."

Geology is the fundamental Earth science that examines how the earth created, its structure and composition, and the various forces acting on it. It is sometimes known as geoscience or earth science.

Learn more about time  at;

https://brainly.com/question/479532

#SPJ1

The correct answer to the question is option C as that is the only option in which the change in entropy is positive.

Entropy is the degree of randomness in the system.  The gaseous state has the highest entropy among the state of matter.

a) Ag⁺ (aq) + Cl⁻ (aq) → AgCl (s)

Since the aqueous state has higher entropy than solids, the change in entropy is negative

b) H₂O (l) ----> H₂O (s)

Since the liquid state has higher entropy than solids, the change in entropy is negative.

c) 2SO₃ (g) ----> 2SO₂ (g) + O₂ (g)

Since the reactant has only 2 moles of gas and the product has 3 moles of gas, the entropy of the reactant increases with the reaction.

d) CaO (s) + CO₂ (g) -----> CaCO₃ (s)

Since the reactant has one mole of gas and the product has none thus the change in entropy is negative.

e) N₂ (g) + 3H₂ (g) ------> 2NH₃ (g)

Since the reactant has more moles of gases than the product which are 4 and 2 moles of gas respectively, the change in entropy is negative.

Learn more about Entropy:

https://brainly.com/question/30481619

#SPJ1

Answer:

C₂ =  0.52 M

Explanation:

Given data:

Initial volume = 334.75 mL

Initial concentration = 1.28 M

Final volume = 822.18 mL

Final concentration = ?

Solution:

C₁V ₁     =     C₂V₂

By putting values,

1.28 M×334.75 mL = C₂×822.18 mL

C₂ =  1.28 M×334.75 mL / 822.18 mL

C₂ =  428.48 M.mL / 822.18 mL

C₂ =  0.52 M

Answer:

4 millllllermeeters jb

a. The rate law for this reaction is: Rate = k[Cl] [H₂]. This means that the rate of the reaction is directly proportional to the concentrations of both Cl and H₂ molecules.

Rate law is an equation that describes the rate of a chemical reaction as a function of the concentrations of reactants. The rate law allows us to describe how the rate of a reaction changes when the concentrations of reactants are changed. It is derived from the rate equation, which is a mathematical expression that can be used to calculate the rate of a reaction from the concentrations of the reactants and the rate constant.

b. The rate law for this reaction is: Rate = k[O] [Os]. This means that the rate of the reaction is directly proportional to the concentrations of both O and Os molecules.
c. The rate law for this reaction is: Rate = k[NO₂]₂. This means that the rate of the reaction is directly proportional to the square of the concentration of NO₂ molecules.

To learn more about rate law
https://brainly.com/question/16981791
#SPJ1

Complete Question:

The reaction order and specific reaction rate constant can be determined by performing the kinetics experiment on irreversible polymerization A. Kinetic experiments can be used to investigate the rate and mechanism of chemical reactions. Chemical kinetics is the study of chemical reactions' speed and pathway.

For such more question on polymerization

https://brainly.com/question/1602388

#SPJ8

There are approximately 2.8939 x\(10^2^4\) carbon atoms in 0.37 mol of procaine.  The molecular formula of procaine (C₁₃H₂₀N₂₀₂), one can see that there are 13 carbon atoms (C13) in one molecule of procaine.

Avogadro's number (6.022 x \(10^2^3\)) represents the number of particles (atoms, molecules, or formula units) in one mole of a substance

The number of molecules of procaine in 0.37 mol:

Number of molecules = 0.37 mol x (6.022 x\(10^2^3\) molecules/mol)

Number of carbon atoms = Number of molecules x 13 carbon atoms/molecule

Number of molecules = 0.37 mol x (6.022 x \(10^2^3\)molecules/mol)

= 2.22614 x \(10^2^3\)molecules

Number of carbon atoms = 2.22614 x \(10^2^3\) molecules x 13 carbon atoms/molecule

= 2.8939 x \(10^2^4\)carbon atoms

Learn more about the atoms here

https://brainly.com/question/10847297

#SPJ1

To answer this question, we have to use Boyle's Law:

Where P1 is the initial pressure, V1 is the initial volume, P2 is the final pressure and V2 is the final volume.

We have to find V2 by solving the equation for this variable and replacing for the given values:

It means that the volume of oxygen when it is released is 137.17L.

It will take 1200 minutes for the concentration of reactant to drop to 0.025 mol/liter.

The rate of reaction is given by the following equation:

\(-r_{A} = \frac{200C_{A} C_{EO}}{2+C_{A}} \frac{mol}{liter . min}\)

where

\(-r_{A}\) = is the rate of reaction (mol/liter/min)

\(C_{A}\) = is the concentration of reactant A (mol/liter)

\(C_{EO}\) =  is the concentration of enzyme E (mol/liter)

Given that \(C_{EO}\) = 0.001 mol/liter and \(C_{AO}\) = 10 mol/liter. Find the time needed for the concentration of reactant to drop to 0.025 mol/liter.

Set up the following equation and solve for t:

\(C_{AO} - C_A = -r_A t\)

Substituting the given values:

10 - 0.025 = -(200)(0.025)(0.001)t

Solving for t:

t = 1200 min

Therefore, it will take 1200 minutes for the concentration of reactant to drop to 0.025 mol/liter.

Find out more on concentration of reactant here: https://brainly.com/question/30669858

#SPJ1

The temperatures describing the value of C is 100 °C, because it is the boiling point of water.Hence, The correct answer is Option (B)

A phase change is when matter changes to from one state (solid, liquid, gas, plasma) to another.

These changes occur when sufficient energy is supplied to the b(or a sufficient amount is lost), and also occur when the pressure on the system is changed.

The given heating curve has two flat lines (Or plateaus) ;

(Image is attached for reference)

In the given problem, C is the second flat line, so it is boiling point.

Therefore , The temperatures describing the value of C is 100 °C, because it is the boiling point of water.Hence, The correct bis Option (B)

Learn more about Phase change here ;

brainly.com/question/12390797

#SPJ2

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Answer: you convert it into water vapor, which also leaves the pot and mixes with the atmosphere.

The mass of the asteroid is C. 1.2 x \(10^{12}\) Kg

To find the mass of the other asteroid, we can rearrange the equation for the gravitational force between two objects:

F = (G * m1 * m2) / \(r^{2}\)

where F is the force of gravity, G is the gravitational constant, m1 and m2 are the masses of the two asteroids, and r is the distance between them.

Given that the distance between the asteroids is 75000 m, the force of gravity between them is 1.14 N, and one asteroid has a mass of 8 x \(10^{7}\) kg, we can substitute these values into the equation and solve for the mass of the other asteroid (m2):

1.14 N = (6.67430 × \(10^{-11}\) N \(m^{2}\)/\(Kg^{2}\) * 8 x \(10^{7}\) kg * \(m2\)) / \((75000 m)^{2}\)

Simplifying and solving the equation, we find that the mass of the other asteroid (m2) is approximately 1.2 x \(10^{12}\) kg. Therefore, Option C is correct.

The question was incomplete. find the full content below:

Two asteroids are 75000 m apart one has a mass of 8 x \(10^{7}\) kg if the force of gravity between them is 1.14 what is the mass of the asteroid

A. 3.4 x \(10^{11}\) kg

B. 8.3 x \(10^{12}\) kg

C. 1.2 x \(10^{12}\) kg

D. 1.2 x \(10^{10}\) kg

Know more about gravitational force here:
https://brainly.com/question/72250

#SPJ8

Answer:

313.6 L

Explanation:

use mole/mole ratio to find moles of CO2 (=14)

multiply by 22.4

=313.6 L

To kill bacteria, chlorine is added to the water. However, it does not function immediately away and kill CDC.

Thus, When handled correctly, free chlorine* can destroy the majority of bacteria in a matter of minutes.

The CDC advises maintaining a pH of 7.2–7.8 and free chlorine levels of at least 1 ppm in swimming pools and 3 ppm in hot tubs and spas.

The CDC advises a pH of 7.2–7.8 and a free accessible chlorine content of at least 2 ppm in swimming pools when using cyanuric acid, a chlorine stabilizer, or chlorine products containing cyanuric acid (for instance, products generally known as dichlor or trichlor. The CDC advises against using cyanuric acid or chlorine products containing it in hot tubs or spas.

Thus, To kill bacteria, chlorine is added to the water. However, it does not function immediately away and kill CDC.

Learn more about Chlorine, refer to the link:

https://brainly.com/question/19460448

#SPJ1

Answer:

pH = 12.90

Explanation:

THe reaction of HNO₃ with KOH is:

HNO₂ + KOH → KNO₂ + H₂O

That means 1 mole of nitrous acid reacts per mole of potassium hydroxide.

To solve this question, we need to find the moles of each reactant:

Moles HNO₂:

0.0179L * (0.458mol / L) = 0.00820 moles

Moles KOH:

0.0334L * (0.368mol / L) = 0.01229 moles

That means KOH is in excess. The moles in excess are:

0.01229 moles - 0.00820 moles = 0.00409 moles KOH = Moles OH⁻

The [OH⁻] is -Total volume = 17.9mL+33.4mL = 51.3mL = 0.0513L-:

0.00409 moles / 0.0513L =

0.0797M =[OH⁻]

pOH = -log[OH⁻] = 1.098

pH = 14 - pOH

It's a chemical change.

Explanation:-

Formation of crystals of sugar from a sugary syrup is a chemical change. Because, we cannot get sugary syrup back from the sugar crystals. Yet, it is chemical change.

The process by which the molecules of the gas can be able to move is the process of diffusion.

We know that according to the Graham's law, the rate of the diffusion  of the gas is inversely proportional to the molar mass of the gas. When we open the bottles, the molecules of the perfume would begin to move.

As the bottle is opened, the molecules would escape from the bottle and then be able to travel through the room and get to where you are by the principle of diffusion.

Hence, the movement of the perfume is according to the Graham's law of diffusion in gases.

Learn more about diffusion:https://brainly.com/question/24746577

#SPJ1

Okay so if the temperature is constant, and you want either V or T then it is Charles gas law:

We are given the following:

V1 = 1234 mL

T1 = 237 degrees celsius

V2 = 1023.4 mL

T2 = ?

Since we want the answer in degrees celsius, we do not need to covert to kelvin.

T2 = (T1V2)/V1

T2 = (237 x 1023.4)/1234

T2 = 196.5525122 degrees celsius

Answer:

0.2553669915026199 BaSO4

Explanation:

hi, give brainliest?

Answer:

9.5x10¹⁷ s

Explanation:

First we convert 3.41 cubic micrometers (um³) to liters (L), as such:

With the converted rate of 3.41x10⁻¹⁵ L/min, we can calculate how many minutes it would take to fill a 54 L vessel:

Finally we convert 1.58x10¹⁶ minutes to seconds:

Answer:

H2SO4 + CO3 = H2CO3 + SO4

Explanation:

H2SO4 + CO3

This is the reaction of sulphuric acid and carbon trioxide.

Balanced reaction is;

H2SO4 + CO3 = H2CO3 + SO4

So they react to produce carbonic acid and sulfate.

HCN, Na2SO4: Combination of compounds.

Mg3N2: Chemical compound.

CO2, H2O: Dissolution or hydration reaction.

Cu, Zn(NO3)2: Single-replacement reaction.

Na, N2: Combination of elements.

Let's analyze each chemical combination to determine the type of reaction involved:

HCN, Na2SO4:

The combination of hydrogen cyanide (HCN) and sodium sulfate (Na2SO4) does not represent a specific chemical reaction. It is simply the combination of two compounds.

Mg3N2:

Mg3N2 represents a chemical compound, magnesium nitride. It does not indicate a specific reaction.

CO2, H2O:

The combination of carbon dioxide (CO2) and water (H2O) represents a chemical reaction known as hydration or dissolution. When carbon dioxide dissolves in water, it forms carbonic acid (H2CO3), which can further dissociate into hydrogen ions (H+) and bicarbonate ions (HCO3-).

Cu, Zn(NO3)2:

The combination of copper (Cu) and zinc nitrate (Zn(NO3)2) represents a single-replacement reaction. Copper displaces zinc from the compound, resulting in the formation of copper nitrate (Cu(NO3)2) and zinc metal (Zn).

Na, N2:

The combination of sodium (Na) and nitrogen gas (N2) does not represent a specific reaction. It is simply the combination of two elements.

For more question on Combination click on

https://brainly.com/question/28304510

#SPJ11

The appropriate conversion factor for a substance with the following density for each step in the road map is:Converting from grams to milliliters is as follows: 1. 1 g/ml 2. 1 ml = 0.001 L

What does milliliters mean?

To learn more about milliliters

brainly.com/question/26255204

#SPJ4

Answer:

Either direction

Explanation:

If you cook food it would go from cold to hot. If you were to put a drink in the fridge it would go from hot to cold. So it is either direction.

The river will deposit sediment along the inside of a bend in the river. This deposition causes the inside of the curve to become shallower and move farther inward.

Rivers flowing over gently sloping ground begin to curve back and forth across the landscape. These are called meandering rivers.

Meandering rivers erode sediment Larry from the outer curve of each meander bend and deposit it on an inner curve further down stream.

This causes individual meanders to grow larger and larger over time.

Meandering river channels are asymmetrical. The deepest part of the channel is on the outside of each bend. The water flows faster in these deeper sections and erodes material from the river bank.

The water flows more slowly in the shallow areas near the inside of each bend. The slower water can't carry as much sediment and deposits its load on a series of point bars.

Thus  the settling of sediment will make the stream steeper.

To know more about Meandering Rivers

https://brainly.com/question/7560368

#SPJ1

Answer:

The river will deposit sediment along the inside of a bend in the river. The deposition causes the inside of the curve to become shallower and move farther inward.

Explanation:

Edmentum

The evidence in figure 2 and table 1 which describes the changes in the rock after a year is the presence of a round edge.

This is referred to as the breaking down or dissolving of rocks and minerals on Earths surface through elements such as wind, water etc.

In the diagram given, the rock previously had a sharp edge but as time went on there was breakdown of the edges which resulted in it becoming round and is therefore the evidence that weathering most likely occurred in the rock.

Read more about Weathering here https://brainly.com/question/829782

#SPJ1