The pressure of the Helium gas can be obtained as 0.28 Pa.
What is the pressure?We have to call to mind the Avogadro's law in this case and we would have to make use of the law. Let us note that we have the number of the particles that are present as 1.16 * 10^18 particles
From Avogadro's law;
1 mole of the helium gas contains 6.02 * 10^23 alpha particles
x moles of the helium gas would contain 1.16 * 10^18 particles
x = 1.16 * 10^18 particles * 1 mole/ 6.02 * 10^23 particles
x = 1.9 * 10^-6 moles
We have that;
PV = nRT
P =pressure
V = volume
n = Number of moles
R = gas constant
T = temperature
P = 1.9 * 10^-6 * 0.082 * 298/0.125
P = 3.7 * 10^-4 atm or 0.28 Pa
Learn more about pressure of the gas:https://brainly.com/question/18124975
#SPJ1
Baking a chocolate cake is an example of a?
-Physical change
-Physical property
-chemical change
-chemical property
Sat 4 write about six uses of salt
Salt is an essential mineral that has many uses in various industries and in everyday life. Here are six uses of salt:
Food seasoning: Salt is commonly used to add flavor to food and is found in many types of cuisine around the world.
Food preservation: Salt has antimicrobial properties that can help preserve food and prevent spoilage. This is why it has been used for centuries to preserve meat, fish, and other perishable items.
Water treatment: Salt is used in the water treatment process to soften hard water and remove impurities.
Chemical manufacturing: Salt is used as a raw material in the production of chemicals such as chlorine, sodium hydroxide, and sodium carbonate.
De-icing: Salt is often used to melt ice and snow on roads and sidewalks during the winter months.
Health and beauty: Salt is used in various health and beauty products, including bath salts, body scrubs, and toothpaste. It is also used in some medicinal treatments, such as saline solutions for nasal irrigation.
What are 3 balanced chemical equations?
Balanced chemical equation - A chemical equation in which the number of each type of atom is equal on the two sides of the equation. Subscripts - Part of the chemical formulas of the reactants and products that indicate the number of atoms of the preceding element.
Examples of Balancing Chemical Equations
Example 1. C5H12 + O2 ---> CO2 + H2O. ...Example 2. Zn + HCl ---> ZnCl2 + H2 ...Example 3. Ca(OH)2 + H3PO4 ---> Ca3(PO4)2 + H2O. ...Example 4. FeCl3 + NH4OH ---> Fe(OH)3 + NH4Cl. ...Example 5. S8 + F2 ---> SF6 ...Example 6. C2H6 + O2 ---> CO2 + H2O. ...Example 7. Al2(CO3)3 + H3PO4 ---> AlPO4 + CO2 + H2O.What does a control group show in an experimental investigation?
Answer:
the effects that the scientists are causing by manipulating varuables
7) An atom is electrically neutral because the
A) number of protons equals the number of neutrons
B) ratio of the number of neutrons to the number of electrons is 1:1
C) number of protons equals the number of electrons
D) ratio of the number of neutrons to the number of protons is 2:1
C
The proton and electron have the same amount of charge but opposite type or charge (-/+). So it called electrically neutral. if the proton number larger than the electron so it would Positively charged, so with the electron number more than the proton it would be negatively charged
5. If iron filings are added to the reaction above, and they are allowed to rust
according to the following reaction, then they will remove the oxygen from the
above reaction. How will equilibrium shift upon addition of iron?
4 Fe (s) + 3 O2 (g) 2 Fe2O3 (S)
Upon addition of iron, the equilibrium will shift toward forward according to Le Chatelier’s principle in the reaction 4 Fe (s) + 3 O\(_2\) (g) →2 Fe\(_2\)O\(_3\) (S)
What is equilibrium?Equilibrium is commonly characterized as a condition of rest in which no change occurs. A body in equilibrium will have no negative or positive energy exchanges.
The equilibrium state is defined differently in biology, physics, and chemistry. However, the underlying principle remains the same. External forces will have little effect on an organism that is in balance. Upon addition of iron, the equilibrium will shift toward forward according to Le Chatelier’s principle in the reaction 4 Fe (s) + 3 O\(_2\) (g) →2 Fe\(_2\)O\(_3\) (S)
Therefore, upon addition of iron, the equilibrium will shift towards forward according to Le Chatelier’s principle.
To learn more about equilibrium, here:
https://brainly.com/question/30104201
#SPJ9
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
1) Kinetic energy is the energy an object has due to its
Position
Weight
Mass
Gravity
Motion
Answer:
the answer to the answer above is motion
A gas has a volume of 450. mL at 55.0 °C. If the volume changes to 502 ml, what is the new temperature?
Answer:
92.9 °C
Explanation:
Step 1: Given data
Initial volume (V₁): 450. mLInitial temperature (T₁): 55.0 °CFinal volume (V₂): 502 mLStep 2: Convert 55.0 °C to Kelvin
We will use the following expression.
K = °C + 273.15 = 55.0 + 273.15 = 328.2 K
Step 3: Calculate the final temperature of the gas
If we assume constant pressure and ideal behavior, we can calculate the final temperature of the gas using Charles' law.
T₁/V₁ = T₂/V₂
T₂ = T₁ × V₂/V₁
T₂ = 328.2 K × 502 mL/450. mL = 366 K = 92.9 °C
Use the diagram below to answer the question: What element does this atom likely represent?
Lithium is the element because only lithium atom with 3 protons in this diagram.
What do you mean by an element ?An element is a pure substance that cannot be broken down into simpler substances through physical or chemical means.
Lithium is the symbol for the element. Because lithium has three protons, it has the atomic number 3. Because lithium atoms contain either 3 or 4 neutrons, it has an atomic mass of 6.94. On the periodic table, lithium is in group 1 and has one valence electron.
Thus, Lithium is the element because only lithium atom with 3 protons in this diagram.
To learn more about an element, follow the link;
https://brainly.com/question/13025901
SPJ1
component of fuel for engines is organic compound or hydrocarbons
CnHm is the general closed chemical formula of liquid hydrocarbons used as a fuel in the internal combustion engines. However, hydrocarbons consist of hydrogen and carbon and also small amounts of O2, H2, S, H2O, and some metals containing crude oil derivatives .
During laparoscopic surgery, CO2 gas is used to expand the abdomen to help create a larger
working space. If the CO2 injected into the abdomen produces a pressure of 20.0 mmHg
and a volume of 4.00 L at 32.0C, how many grams of CO2 were used?
Answer:
The answer to your question is V2 = 4.97 l
Explanation:
Data
Volume 1 = V1 = 4.40 L Volume 2 =
Temperature 1 = T1 = 19°C Temperature 2 = T2 = 37°C
Pressure 1 = P1 = 783 mmHg Pressure 2 = 735 mmHg
Process
1.- Convert temperature to °K
T1 = 19 + 273 = 292°K
T2 = 37 + 273 = 310°K
2.- Use the combined gas law to solve this problem
P1V1/T1 = P2V2/T2
-Solve for V2
V2 = P1V1T2 / T1P2
-Substitution
V2 = (783 x 4.40 x 310) / (292 x 735)
-Simplification
V2 = 1068012 / 214620
-Result
V2 = 4.97 l
Draw out the skeletal structure of cis-2-methylcyclohexano
The chemical structure of the compound is shown in the image attached.
How do you draw a chemical structure?Ascertain the molecule's atomic composition and the types of bonds (covalent, ionic, etc.) that each atom forms.
The skeletal structure, which is a straightforward illustration of the molecule's framework, should be drawn first. To do this, a series of lines are drawn to symbolize the atoms' bonds.
By positioning the atoms at the ends of the bond lines, you may complete the skeleton framework.
Learn more about chemical structure:https://brainly.com/question/30261824
#SPJ1
Which element has the largest atomic radius?
4 be
56 ba
31 ga
9 f
Answer:
Ba
Explanation:
bc it = 268 pm
The radius of a potassium
atom is 0.227 nm. Express this
radius in the unit centimeters.
Answer:
0.227 nm can also be written as
0.227 * \(10^{-9}\)m
and we know that 1 cm = 1m * 100
so we will multiply by with 100:
0.227 * \(10^{-7}\) cm
2.27 * \(10^{-8}\) cm
The radius of a potassium atom is 0.227 nm. In centimeters, the radius of potassium is 2.27 × 10⁻⁸ cm
Potassium is an element on the periodic table with the atomic number 19. It has white, lustrous, and shiny color. They exhibit a low melting point and are a great conductor of electricity.
Given that:
The radius of a potassium atom is 0.227 nm
Using the standard conversion analysis:
Since 1 nanometer (nm) = 1.0 × 10⁻⁷ centimeters (cm)
Then, 0.227 nm is:
= \(\dfrac{(0.227 \ nm \times 1.0 \times 10^{-7} (cm))}{1 \ nm}\)
= 2.27 × 10⁻⁸ cm
Therefore, we can conclude that the radius of a potassium atom in centimeters is 2.27 × 10⁻⁸ cm
Learn more about conversion rates here:
https://brainly.com/question/21630826?referrer=searchResults
given the incomplete reaction which compound is represented by x
The compound that is shown as X can be seen in the option labelled C
What is esterification?The process of esterification involves the condensation of an alcohol (or phenol) with an acid to produce an ester. To create the ester bond, the water molecule must be removed from the alcohol and acid (dehydration).
Usually, an acid catalyst is used to catalyze the reaction, which makes it easier to remove water and encourages the creation of the ester. The acid catalyst aids in protonating the acid's carbonyl oxygen, which increases its electrophilicity and makes it more vulnerable to alcohol's nucleophilic attack.
Learn more about esterification:https://brainly.com/question/31118260
#SPJ1
Q2) Describe the position of electrons in a metal
Electrons in metals are delocalised. Electrons in ionic bonds are transferred from a metal to a non-metal. Electrons in a covalent bond are shared between two non-mtal ions.
- Eddie
Balance the following equation and express the rate in terms of the change in concentration with time for each substance: NO(g) O2(g) LaTeX: \longrightarrow N2O3 (g) When N2O3 is forming at 0.221 M/s, at what rate is NO decreasing
The balanced equation is:
4 NO(g) + O₂(g) ⇒ 2 N₂O₃(g)
The expression of the rate in terms of change in concentrations are:
\(v = \frac{-\Delta [NO]}{4\Delta t } = \frac{-\Delta [O_2]}{1\Delta t } = \frac{\Delta [N_2O_3]}{2\Delta t }\)
When N₂O₃ is forming at 0.221 M/s, NO is disappearing at 0.442 M/s.
What is the reaction rate?The reaction rate is the speed at which a chemical reaction takes place, defined as proportional to the increase in the concentration of a product per unit time and to the decrease in the concentration of a reactant per unit time.
Step 1: Write the balanced equation.4 NO(g) + O₂(g) ⇒ 2 N₂O₃(g)
Step 2: Express the rate in terms of the change in concentration with time for each substance.We will need to consider the stoichiometric coefficient of each species.
\(v = \frac{-\Delta [NO]}{4\Delta t } = \frac{-\Delta [O_2]}{1\Delta t } = \frac{\Delta [N_2O_3]}{2\Delta t }\)
Step 3: Given the rate of formation of N₂O₃ is 0.221 M/s, calculate the rate of disappearance of NO.The molar ratio of NO to N₂O₃ is 4:2.
\(\frac{0.221molN_2O3}{L.s} \times \frac{4molNO}{2molN_2O_3} = \frac{0.442 molNO}{L.s}\)
The balanced equation is:
4 NO(g) + O₂(g) ⇒ 2 N₂O₃(g)
The expression of the rate in terms of change in concentrations are:
\(v = \frac{-\Delta [NO]}{4\Delta t } = \frac{-\Delta [O_2]}{1\Delta t } = \frac{\Delta [N_2O_3]}{2\Delta t }\)
When N₂O₃ is forming at 0.221 M/s, NO is disappearing at 0.442 M/s.
Learn more about reaction rate here: https://brainly.com/question/1898560
An organism that gets its energy from eating is called a(n) _
or
Describes the subatomic parts of the atom.
Subatomic particles include "Electrons", and those include the "heavier" building blocks of the nucleus of an atom, the electrically neutral neutrons and positively charged protons
5. What part of soil is made up of decayed organic materials? (1. clay 2. bedrock 3. humus 4. sand
please help me .
Answer:humis
Explanation:because I looked it up
Answer:
It is C humus! also this is correct!
Explanation:
draw the organic product(s) of the following reactions including stereochemistry when it is appropriate. h2 lindlar catalyst
Draw the organic by product(s) of the subsequent reactions, taking stereochemistry into account as necessary. The formula for H2 lindlar catalyst is:
Lindlar catalyst for CH3-C-CH2-CH2-CH3 + H2 - CH2 - CH2 - CH2 - CH3
| |
H H
The bond is hydrogenated into double bonds using the lindlar catalyst. Alkynes that include triple bonds are converted into alkenes that contain double bonds using the H2 + lindlar catalyst. Alkenes do not react with the H2 + lindlar catalyst. The following is a description of the H2 + lindlar catalyst reaction:
Using the Lindlar catalyst, the reaction goes from CH3-C to C-CH2-CH2- CH3 and then to CH3-C=C-CH2-CH2- CH3 and then to hexyne.
H H
(2) Hexene
To know more about H2 lindlar visit:-
https://brainly.com/question/14464125
#SPJ4
Which of the following best describes a scientific model? (3 points) a Something used to represent an idea or process b A way to prove a theory is true c A direct experience in nature d A prediction that can be tested
Answer: A. Something used to represent an idea or process.
Explanation:
3. A helium filled balloon has a volume of 39.0mL at 17C and the current atmospheric pressure is reading 802mmHg on the barometer. What volume will the helium gas take up when the pressure reading on the barometer drops to 637mmHg and the temperature plummets to 7C?
Answer:
.0466 L
Explanation:
To start off, use dimensional analysis to convert everything to standard PV=nRT units.
\(\frac{39.0}{1}\) x \(\frac{1}{1000}\) = .039 L
\(\frac{802}{1}\) x \(\frac{1}{760}\) = 1.055 atm
17 +273 = 290
...and so on.
Solve for n for the starting pressure, volume and temp. You'll need it for the final equation.
n= PV/RT \(\frac{1.055 *.039}{.0821 * 290}\)= .0017 number of moles
Solve for volume of the end point.
V= nRT/P \(\frac{.0017*.0821*280}{.838}\) = .0466 L of helium, or 46.6ml Less pressure means it will take up more space.
Prepare one solution that has 0.12 M of FeCl3 and 0.40 M of HCl with the reagents 3 M HCl and Solid FeCL3 * 6H20. Provide the calculations and protocol to make the solution in a lab.
To prepare a 0.12 M solution of FeCl₃, the amount of solid FeCl₃ to be dissolved in a given volume of solvent will be 9.72 grams.
Given,
Molarity of FeCl₃ (M)= 0.12 M
The molecular weight (m) of FeCl₃ is = 162 gm
The volume of the solution (V) to be prepared is =500 ml
The amount of FeCl₃ to be dissolved to make a 0.12 M solution is= x
So,
MV= x ÷ m × 1000
0.12× 500 = x ÷ 162 × 1000
x = 60 × 162 ÷ 1000
x= 9.72 gm
So 9.72 grams of FeCl₃ is dissolved to make 500 ml of 0.12 M solution.
For preparing 0.4 M HCl from 4M HCL:
If we need to make 500 ml of solution with 0.4M of HCL, then we use the formula:
M₁V₁= M₂V₂
0.4 × 500= 4 × x
x= 50 ml
So 50 ml of 4M HCL is taken to make 0.4 M HCL.
To learn more about FeCl₃, refer to the link:
https://brainly.com/question/32098087
#SPJ1
Thermal energy transfer lab report.
I need answers for questions 1-11.
If you cannot answer every question, that is ok. I just need the help. Here are the questions.
1. What is the purpose of the lab, the importance of the topic, and the question you are trying to answer?
2. What is your hypothesis (or hypotheses) for this experiment?
3. What methods are you using to test this (or each) hypothesis?
4. Locate the data and observations collected in your lab guide. What are the key results? How would you best summarize the data to relate your findings?
5. Do you have quantitative data (numerical results or calculations)? Do you have qualitative data (written observations and descriptions)? How can you organize this date for your report?
6. What do the key results indicate?
7. If you constructed graphs, what trends do they indicate in your data?
8. Were there any problems with the experiment or the methods? Did you have any surprising results?
9. What do the results tell you about your hypothesis(es)?
10. How do the data support your claim above?
11. If you could repeat the experiment and make it better, what would you do differently and why?
Thermal energy flows from hot to colder bodies and is determined by the process of calorimetry.
What is thermal energy?Thermal energy is the energy transfer process which occurs as a result temperature difference between two bodies.
Thermal energy flows from hot to colder bodies.
The quantity of Heat transfer is determined using a calorimeter.
The calorimeter works on the principle of conservation of energy. The principle of the calorimeter is stated as follows:
Heat lost = Heat gainedThe quantity of Heat, q = mass × specific heat capacity × temperature difference
Therefore, it can be concluded that thermal energy flows from hot to colder bodies.
Learn more about thermal energy at: https://brainly.com/question/7541718
Answer:
I did this earlier, here's what I put.
A hurricane is a type of severe cyclone
A hurricane is a type of severe cyclone formed when winds rotate as the pressure between low and high-pressure areas increases.
What is a hurricane?A cyclone is a violent storm that occurs when cyclone winds exceeds a speed of 74 miles (119 kilometers) per hour.
Hurricanes are classified according to their strength and catastrophic potential on a scale ranging from 1 to 5 (more violent).
In conclusion, a hurricane is a cyclone formed when a it rotates as the low and high-pressure areas increases.
Learn more about hurricanes here:
https://brainly.com/question/10163890
#SPJ1
How many moles of H2O are found in a sample containing 7.1 * 10 (19) molecules
The sample containing 7.1 × 10^19 molecules of H2O corresponds to approximately 1.18 × 10^(-4) moles of H2O.
To determine the number of moles of H2O in a sample containing 7.1 × 10^19 molecules, we need to use Avogadro's number, which states that 1 mole of any substance contains 6.022 × 10^23 molecules.
Given that there are 7.1 × 10^19 molecules of H2O in the sample, we can calculate the number of moles using the following formula:
Moles = Number of molecules / Avogadro's number
Moles = 7.1 × 10^19 / 6.022 × 10^23
Moles ≈ 1.18 × 10^(-4) moles
For more such questions on molecules
https://brainly.com/question/24191825
#SPJ8
If the density of a 5.25 g blood sample is 1.05 g/mL, what is the volume of the sample, reported in mL?
The volume of the blood sample is 5mL
HOW TO CALCULATE VOLUME:
The volume of a blood sample can be calculated by dividing the mass (g) by its density (g/mL). That is;Density = mass ÷ volume
Volume = mass ÷ density
The density of the blood sample is given as 1.05g/mL while the mass is given as 5.25g. The volume can be calculated as follows:Volume = 5.25 ÷ 1.05
Volume = 5mL
The The volume of the blood sample is 5mL.
Learn more: https://brainly.com/question/6034174?referrer=searchResults
For two acids of equal concentration, the stronger acid has-