Aristonun teorisini çürüten bilim adamı

Answers

Answer 1
Can you please translate to English?

Related Questions

How many minutes are in 2.25 weeks ?

Answers

Answer:

22,680

Explanation:

you multiply the time value by 10080

22, 680 minutes in 2.25 weeks

the isotope sodium-24 has a half-life of 15 hours. starting with 22 grams, how much remains in 60 hours?

Answers

Approximately 1.375 grams of sodium-24 remains after 60 hours.

The half-life of sodium-24 is 15 hours, which means that after every 15 hours, half of the remaining sodium-24 will decay.

To calculate the amount of sodium-24 remaining after 60 hours, we can divide the total time (60 hours) by the half-life (15 hours) to determine the number of half-life intervals.

Number of half-life intervals = 60 hours / 15 hours = 4 intervals

Since each half-life interval results in a halving of the amount, we can calculate the remaining amount of sodium-24 by multiplying the initial amount (22 grams) by (1/2) four times:

Remaining amount of sodium-24 = 22 grams * (1/2)^4 = 22 grams * (1/16) ≈ 1.375 grams

Therefore, approximately 1.375 grams of sodium-24 remains after 60 hours.

You can learn more about sodium-24 at

https://brainly.com/question/15904050

#SPJ11

the form of energy that your lunch represents is?
A) electrical
B) chemical
C) thermal
D) nuclear

Answers

The answer is B. Have a good day.

I need help with these two questions

I need help with these two questions

Answers

halogens have 7

allali have 2

noble gases have 8

K = 1

P = -3

Ra= 7

Cl = -1

N = 5

O = 6

the ph of a 0.115m solution of chloroacetic acid, clch2cooh, is measured to be 1.92. calculate ka for this monoprotic acid.

Answers

The Ka value for chloroacetic acid is 1.4 x 10^-3.

The pH of a 0.115M solution of chloroacetic acid (ClCH2COOH) was measured to be 1.92. To determine the acid dissociation constant (Ka) for this monoprotic acid,

we can use the formula Ka = [H3O+][ClCH2COO-]/[ClCH2COOH]. To begin, we first need to find the concentration of H3O+ ions in solution. Since pH is defined as -log[H3O+],

we can rearrange the formula to find [H3O+] = 10^-pH. Substituting the pH value of 1.92 into this equation gives us [H3O+] = 6.31 x 10^-2 M. We can then use the equation for Ka and substitute the appropriate values to obtain Ka = (6.31 x 10^-2)^2 / (0.115 - 6.31 x 10^-2) = 1.4 x 10^-3.

To learn more about : chloroacetic

https://brainly.com/question/17137710

#SPJ11

You are watching a movie in which one of the characters excitedly claims to have found human remains in Asia dated at 10 million years old. The date was obtained by carbon-14 dating. What is your reaction?

Answers

My reaction to the claim that human remains dated at 10 million years old were found in Asia using carbon-14 dating would be one of skepticism. Carbon-14 dating is not reliable for dating objects older than about 50,000 years.

Carbon-14 has a half-life of approximately 5,730 years, meaning that it decays over time and becomes undetectable after a certain point. Therefore, using carbon-14 dating to determine the age of remains from 10 million years ago would not provide accurate results. To accurately date remains from such an ancient period, other dating methods like potassium-argon dating or uranium-lead dating would be more appropriate. In conclusion, carbon-14 dating is not suitable for determining the age of human remains that are 10 million years old due to its limited range of accuracy.

To know more about Carbon-14 dating visit:

https://brainly.com/question/22184593

#SPJ11

Which description justifies why the theory of evolution is a theory and not a law? (4 points)

a
Explains how organisms change in response to the environment

b
Predicts which organism is best suited to the environment

c
Supported by a small amount of empirical evidence

d
With more evidence, it will become a law

Answers

Answer:a I think it is

What is the law of
Superposition?

Answers

Answer:

The Law of Superposition is an axiom of geology that states that in an undisturbed sequence of sedimentary rocks, each layer of rocks is older than the one.  

Explanation:

According to the law of superposition, each rock layer or strata is older than the one above it. As a result, the relative age of the rock or fossil is older if it is found more profound in the rock layers above it and younger than the one below it.

At times, unfavorable environmental conditions can cause one gender of a certain population of organisms to drastically decline. During such times, the other gender makes up for the decline by reproducing on its own. This type of reproduction is called . The first vertebrate organism to have successfully produced offspring in this manner is the

Answers

Answer: Parthenogenesis, Poecilia formosa

Explanation:

Parthenogenesis can be defined as a natural type of asexual reproduction in which the production and development of the embryos takes place without the fertilization of sperms. This helps the female partner to reproduce offsprings individually. The first vertebrate in which the parthenogenesis was observed was a fish species called  Poecilia formosa in 1932. The female fish undergo asexual reproduction to produce offsprings.

Answer:

1.broadcast spawning

2.guppy

Explanation:

What is the volume of a container that contains 24. 0 grams of N2 gas at 328K and. 884 atm? Also asks to identify the P, V, N, R, and T. If unknown then put "?"

Answers

The volume of the container that  that contains 24. 0 grams of N2 gas at 328K at 884 atm is found to be 2.65 Liters.

The ideal gas equation is given as, PV = nRT, where, P is pressure V is volume, n is the moles, R is the gas constant and T is the temperature.

It is given to us that 24 grams of N₂ is to be stored in the container with 884 atm pressure and 328K temperature.

Now, putting all the values in the equation to find the volume of the container,

884V = 24/28(8.34)(328)

V = 2.65 Liters,

So, the volume of the container will be 2.65 Liters.

To know more about the ideal gas equation, visit,

https://brainly.com/question/27870704

#SPJ4

If you start with 42 g of Fe-53, how much is left after 8.51 minutes? I​

Answers

Answer:

2:38

Explanation:

Answer:

2.58 good luck with everything

If the mass is 12.3 g, volume without mineral is 50ml, volume with mineral is 53ml, then what is: (a) the volume of water displaced and (b) the final density of the mineral?

Answers

a.)  The Volume of water displaced is  3 ml

b.)  The final density of the mineral is 4.1 g/ml.

(a) The volume of water displaced is the ratio of the volume containing mineral to the volume excluding mineral.

Volume of water displaced = Volume with mineral - Volume without mineral

Volume of water displaced = 53 ml - 50 ml

Volume of water displaced = 3 ml.

(b) The following formula can be used to determine the mineral's density:

Mass / Volume equals density.

The difference between the mass of the mineral and the mass without the mineral is the mass of the mineral.

Mass of mineral = Mass with mineral - Mass without mineral

Mass of mineral = 12.3 g - 0 g (since the mass without mineral is not given)

Mass of mineral = 12.3 g

By deducting the volume without the mineral from the volume with, one may determine the volume of the mineral.

Volume of mineral = Volume with mineral - Volume without mineral

Volume of mineral = 53 ml - 50 ml

Volume of mineral = 3 ml

Therefore, the density of the mineral is:

Density = Mass of mineral / Volume of mineral

Density = 12.3 g / 3 ml

Density = 4.1 g/ml

Therefore, the final density of the mineral is 4.1 g/ml.

For such more question on Volume:

https://brainly.com/question/29796637

#SPJ11

what is the molecular formula for a compund that is 38.1%% c,9.60% h,and 51.7% o and has a molar mass of 62.00g

Answers

To find the molecular formula, we would need to multiply the empirical formula by the whole number required to reach the molar mass of 62.00 g, which is likely to be C2H4O2.

How can you calculate the empirical formula?

To obtain the empirical formula, the percentage composition of each element must be converted to moles and divided by the smallest number of moles obtained. From the empirical formula, the molecular formula can be determined by multiplying the empirical formula by the whole number required to reach the desired molar mass.

What is meant by molar mass?

The molar mass is the mass of a substance in grams that contains Avogadro's number of entities of that substance. It is usually expressed in units of grams per mole (g/mol). The molar mass is used to convert the amount of a substance in moles to its mass in grams.

To know more about moles, visit here:

https://brainly.com/question/26416088

#SPJ1

Balance this chemical equation

C4H8 + O2 --> CO2 + H2O​

Answers

Answer:

you're going to start by balancing the carbon first. To do this, you want to times the carbon on the right by 4 so we put a 4 in front of the CO2.C4H8 + O2 --> 4CO2 + H2OWe're now going to try and balance the hydrogen by putting a 4 in front of the H2O.C4H8 + O2 --> 4CO2 +4H2OThen we're going to count the oxygens on both side and balance them by putting a 6 in front of the O2.C4H8 + 6O2 --> 4CO2 + 4H2O

Balance this chemical equation C4H8 + O2 --> CO2 + H2O

Answer:

hope this helps :) please correct me if I'm wrong.

C4H8 + 6O2 --> 4CO2 + 4H2O.

Explanation:

C4H8 + O2 --> CO2 + H2O

C=4 C=1

H=8 H=1

O=2 ---> O=3

C4H8 + 6O2 --> 4CO2 + 4H2O

C=4 C=4

H=8 H=8

O=12 ---> O=12

identify the process in which the entropy decreases. a. the phase transition from a solid to a gas b. an increase in the number of moles of a gas during a chemical reaction c. the phase transition from a gas to a liquid d. the phase transition from a liquid to a gas e. the phase transition from a solid to a liquid

Answers

The phase transition from a gas to a liquid  decreases the entropy. option (c) is correct.

The measurement of randomness or disorder in a system is known as entropy. As for the order of entropy, The increase in disorder causes the entropy to rise when we transition from the solid state to the liquid state to the gaseous state. Entropy will decrease when we transition from a gaseous state to a liquid state and then a solid state because chaos is becoming less disorganized. Entropy is the measurement of the amount of thermal energy per unit of temperature in a system that cannot be used for productive labor. Entropy is also a measure of molecular disorder since work is produced by ordered molecular motion.

Thus, option (c) is correct.

To know more about entropy here

https://brainly.com/question/13926873

#SPJ4

Draw the correct Lewis dot structure from the given shorthand notation below: PLS HELP

Draw the correct Lewis dot structure from the given shorthand notation below: PLS HELP

Answers

The Lewis structure of the element have been shown in the image attached.

Lewis dot structure of an element:

The valence electrons of an atom or molecule are depicted in a simplified manner by the Lewis structure, commonly referred to as the Lewis dot structure or electron dot structure. Gilbert N. Lewis, an American scientist, created it.

The valence electrons of an atom are shown in a Lewis structure as dots surrounding the element's symbol. These dots' placement reveals details about the connectivity and atom-atom bonding in a molecule.

Learn more about Lewis structure:https://brainly.com/question/29756546

#SPJ1

Draw the correct Lewis dot structure from the given shorthand notation below: PLS HELP

arrange this isoelectronic series in order of decreasing radius: cl−, s2−, ca2+, k+.

Answers

Isoelectronic species are atoms, ions or molecules that have the same number of electrons. In this case, the isoelectronic series is composed of four different ions: Cl⁻, S2⁻, Ca²⁺, and K⁺.

To determine the order of decreasing radius, we need to consider the effective nuclear charge (Zeff) and the number of electrons. Effective nuclear charge is the net positive charge experienced by an electron in the outermost shell of an atom, which affects the attraction between the nucleus and the electrons.

In general, as the number of protons in the nucleus increases, the effective nuclear charge also increases, which results in a stronger attraction between the nucleus and the electrons. This leads to a decrease in atomic radius.


- Cl⁻ has 18 electrons and Zeff = 17. The extra electron in the outermost shell increases the repulsion between the electrons, which results in a slight increase in atomic radius compared to a neutral chlorine atom.
- S2⁻ has 18 electrons and Zeff = 16. The extra two electrons in the outermost shell increase the repulsion even further, which results in a larger increase in atomic radius compared to a neutral sulfur atom.
- Ca²⁺ has 18 electrons and Zeff = 20. The loss of two electrons in the outermost shell decreases the repulsion between the remaining electrons, which results in a decrease in atomic radius compared to a neutral calcium atom.
- K⁺ has 18 electrons and Zeff = 19. The loss of one electron in the outermost shell also decreases the repulsion between the remaining electrons, which results in a slightly smaller decrease in atomic radius compared to a neutral potassium atom.

Therefore, the order of decreasing radius for this isoelectronic series is: S2⁻ > Cl⁻ > K⁺ > Ca²⁺.

To know more about isoelectronic series, refer

https://brainly.com/question/14511468

#SPJ11

Which statement best describes the destiny of an atoms nucleus?

Answers

Answer:

The answer would be: An atom’s nucleus occupies very little of the atom’s volume but contains most of its mass

Explanation:

The atomic nucleus is the small, dense region consisting of protons and neutrons at the center of an atom.

Almost all of the mass of an atom is located in the nucleus, with a very small contribution from the electron cloud.

Refer to https://en.wikipedia.org/wiki/Atomic_nucleus for further understanding

True or False: The particles in the GASEOUS state are the furthest apart

Answers

The answer is true, particles in the gaseous state are the furthest apart

A sample of certain gas have Volume of 1.25 L ATM _125 degree Celsius and5.0 ATM the gas is compressed 50.0 ATM a volume of 325 mL. what is final temperature?

Answers

The final temperature of the gas is approximately 40.96 Kelvin.

To determine the final temperature of the gas, we can use the ideal gas law, which states:

PV = nRT

where P is the pressure, V is the volume, n is the number of moles of the gas, R is the ideal gas constant, and T is the temperature in Kelvin.

First, let's convert the given temperatures to Kelvin. We have:

Initial temperature: -125 degrees Celsius = 148 K (approximate)

Final temperature: Unknown

The initial conditions of the gas are as follows:

Initial pressure (P1) = 1.25 atm

Initial volume (V1) = 1250 mL = 1.25 L (since 1 L = 1000 mL)

Initial temperature (T1) = 148 K

The final conditions of the gas are as follows:

Final pressure (P2) = 50.0 atm

Final volume (V2) = 325 mL = 0.325 L

Final temperature (T2) = Unknown

Using the ideal gas law, we can set up the following equation:

(P1 * V1) / T1 = (P2 * V2) / T2

Substituting the known values:

(1.25 atm * 1.25 L) / 148 K = (50.0 atm * 0.325 L) / T2

Simplifying the equation:

T2 = (50.0 atm * 0.325 L * 148 K) / (1.25 atm * 1.25 L)

T2 = 40.96 K

For more such questions on temperature visit;'

https://brainly.com/question/4735135

#SPJ8

Help please!

Read the scenario and decide whether the observations are qualitative and/or quantitative.

Danielle and Heather were in science class when they volunteered to fill the fish tank in the back of the room using a long hose connected to the sink. Mr. Ferris told them to fill the tank almost to the top and to be sure not to overflow the tank. The girls wanted to know how much water the tank could hold, so they recorded the length, width and height of the tank in centimeters. Next, they determined the total volume of the tank using the formula, length x width x height.

Answers

The observation, in this case, is quantitative.

Quantitative observation

Quantitative observations are observations that can be recorded based on quantitative data. In other words, they are observations that can be assigned numerical values.

Quantitative observations are as opposed to qualitative observations because the former cannot be assigned numerical values. They can be ranked or qualified.

In this case, Danielle and Heather could assign numbers to the length, width, and height of the tank in order to calculate its volume.

More on quantitative observations can be found here: https://brainly.com/question/17491501

What is the pH of 0.346 M diethylammonium bromide, (C2H5)2NH2Br. The Kb of diethylamine, (C2H5)2NH, is 6.9 x 10-4.

Answers

The pH of 0.346 M diethylammonium bromide is 3.35.

How to calculate pH levels?

To find the pH of the diethylammonium bromide solution, first write out the equation for the base reaction that occurs between diethylammonium bromide and water:

(C₂H₅)2NH₂Br + H₂O ⇌ (C₂H₅)2NH + H₃O+ + Br⁻

Then write the equilibrium expression for this reaction:

Kb = [C₂H₅)2NH][H₃O+] / [C₂H₅)2NH₂Br]

We are given the Kb for diethylamine, which is the conjugate base of diethylammonium, so we can use the relationship:

Kw = Ka x Kb

where Kw is the ion product constant for water, which is 1.0 x 10⁻¹⁴ at 25°C.

Solving for Ka:

Ka = Kw / Kb = (1.0 x 10⁻¹⁴) / (6.9 x 10⁻⁴) = 1.45 x 10⁻¹¹

Next, set up an ICE table to solve for the concentration of H₃O⁺ in the solution.

Initial:

[C₂H₅)2NH₂Br] = 0.346 M

[H₂O] = 0 M

[C₂H₅)2NH] = 0 M

[H₃O⁺] = x M

[Br⁻] = 0 M

Change:

[C₂H₅)2NH₂Br] -x

[H₂O] +x

[C₂H₅)2NH] +x

[H₃O⁺] +x

[Br⁻] +x

Equilibrium:

[C₂H₅)2NH₂Br] = 0.346 - x

[C₂H₅)2NH] = x

[H₃O⁺] = x

Substituting the equilibrium concentrations into the Kb expression:

Kb = [C₂H₅)2NH][[H₃O⁺] / [C₂H₅)2NH₂Br]

6.9 x 10⁻⁴ = (x)(x) / (0.346 - x)

Simplifying and solving for x:

x = 4.7 x 10⁻⁴ M

Finally, calculate the pH of the solution using the equation:

pH = -log[H₃O⁺]

pH = -log(4.7 x 10⁻⁴) = 3.346

Therefore, the pH of the 0.346 M diethylammonium bromide solution is approximately 3.35.

Learn more on pH levels here: https://brainly.com/question/26424076


#SPJ1

A reaction occur more quickly when powdered iron i ued intead of a ingle piece of iron of the ame ma becaue the powdered iron
Repone

act a a better catalyt than the ingle piece of iron
act a a better catalyt than the ingle piece of iron

ha a greater urface area than the ingle piece of iron
ha a greater urface area than the ingle piece of iron

aborb le energy than the ingle piece of iron
aborb le energy than the ingle piece of iron

i more metallic than the ingle piece of iron

Answers

Breaking bonds in the reagents, rearranging those atoms into new groups (the products), and creating new bonds in the products are all components of a chemical reaction.

What is a reaction in science?

In a chemical reaction, one or more chemicals, usually known as reactants, change into one or more other compounds, frequently referred to as products. Chemical parts or chemical elements make up substances. A response is a behavior, propensity, or course of action that is different from what was first intended. Decisions are taken in the heat of the moment without much thought or consideration of the potential repercussions. Reaction: Making a declaration in response to another person's action or remark.

What are examples of reactions and what causes chemical reactions?

Changes in color, temperature, gas production, or precipitant formation are common outcomes of chemical reactions. Combustion, digestion, and cooking are a few straightforward instances of daily reactions.

Atoms create and break chemical bonds during chemical reactions. Reactants are the molecules that initiate a chemical reaction,

Therefore, a collision between reactant particles must not only take place, but it must also have enough energy to break the all reactant bonds necessary for the formation of the products.Different reactions require different amounts of collision energy. The activation energy, also known as Ea, is the quantity of energy that reactant particles require in order to break the previous bonds and cause a reaction to take place.Looking at an energy diagram, like the one in the figure, is another method to consider this. If particles are to respond, they must be able to overcome the activation energy, or "bump." The reactant particles will rebound (bounce off of one other) if the energy of the collision is less than the activation energy, and no reaction will take place.

To know more about Reaction visit:

https://brainly.com/question/29762834

#SPJ4

What is the latent heat of vaporization of boiling water?
a. 955 Btu/lb
b. 540 cal/gm
c. 2557 Kj/kg
d. 144 Btu/lb

Answers

The latent heat of vaporization of boiling water is 540 cal/gm. Option b is the correct answer.

It is the amount of heat needed to convert 1 gram of water from liquid to vapor state at atmospheric pressure at a constant temperature. The latent heat of vaporization for water is relatively high compared to other liquids because of the strong hydrogen bonding between water molecules. This means that water requires a lot of energy to break these bonds and change from a liquid to a gaseous state. The latent heat of vaporization is also responsible for the cooling effect of evaporation. When sweat evaporates from our skin, it absorbs heat from our body, which helps to cool us down. In conclusion, the latent heat of vaporization of boiling water is 540 cal/gm, which represents the amount of heat required to convert 1 gram of water from liquid to vapor state at atmospheric pressure at a constant temperature.

know more about latent heat

https://brainly.com/question/23976436

#SPJ11

calculate [h3o+] of the following polyprotic acid solution: 0.115 m h2co3.

Answers

The concentration of H3O+ is equal to x2. Plugging in the values of Ka1, Ka2, and x1 into the expression for x2 will give you the concentration of H3O+ in the solution.

The concentration of H3O+ in a 0.115 M H2CO3 (carbonic acid) solution can be calculated by considering the acid dissociation constants and the stepwise dissociation of the acid.

Carbonic acid (H2CO3) is a polyprotic acid that can donate two protons (H+ ions) in separate steps. The stepwise dissociation reactions are as follows:

H2CO3 ⇌ HCO3- + H+

Ka1 = [HCO3-][H+]/[H2CO3]

HCO3- ⇌ CO32- + H+

Ka2 = [CO32-][H+]/[HCO3-]

Since the concentration of H2CO3 is given as 0.115 M, we can assume that the concentration of H+ in the solution is initially zero. Let's denote the concentration of H+ after the first dissociation as x1 and after the second dissociation as x2.

For the first dissociation:

[H2CO3] = 0.115 M

[HCO3-] = 0.115 M

[H+] = x1

Using the equilibrium expression for Ka1, we have:

Ka1 = (x1)(0.115) / (0.115)

Simplifying, we find x1 = Ka1.

For the second dissociation:

[HCO3-] = 0.115 - x1

[CO32-] = 0.115 M

[H+] = x2

Using the equilibrium expression for Ka2, we have:

Ka2 = (x2)(0.115 - x1) / (0.115 - x1)

Simplifying, we find x2 = Ka2(0.115 - x1).

Finally, the concentration of H3O+ is equal to x2. Plugging in the values of Ka1, Ka2, and x1 into the expression for x2 will give you the concentration of H3O+ in the solution.

Learn more about concentration of H3O+ :

https://brainly.com/question/15224713

#SPJ11

How many joules are needed to change the temperature of 40 g of water from 33 0C to 23 0C?

Answers

-1680J I think sssssssssssss

What is the balanced equation for ammonia gas decomposes to form hydrogen gas and nitrogen gas?

Answers

The balanced equation for the decomposition of ammonia gas (NH3) to form hydrogen gas (H2) and nitrogen gas (N2) is:

2NH3 → 3H2 + N2

At a high concentration do you have more or less particles per unit volume

Answers

Answer:

More particles per unit volume

Explanation:

Concentration means the amount of solute in a solution. Now, the amount of solute also means the number of particles of solute present in a solution.

Hence, when we use the term "high concentration", we imply that the amount of solute present or the number of particles present in a solution is high.

Thus, at high concentration, there are more solute particles than solvent particles in a solution.

Compare diamonds and graphite - Structure, bonding, properties, use​

Answers

Answer:

Carbon atoms each form four strong bonds. The bonds are covalent (atoms share electrons). This gives graphite its characteristic properties such as high melting and boiling points, good electrical conductivity, and softness. Use as pencil 'lead', as a lubricant in oil, furnace linings, electrodes, neutron moderators in nuclear power stations.

Diamond atoms each form three strong covalent bonds in the same layer and one weak bond to an atom in another layer.  Diamonds have a high level of hardness, thermal conductivity, and optical dispersion. It is used for jewellery, oil-well drills, abrasives and cutting tools.

Explanation:

Structure of Graphite and Diamond (attached below):

Compare diamonds and graphite - Structure, bonding, properties, use

1. Consider NH3.If it dissolves in water(i) NH3 + H20 + NHẤ4+ H2O(ii)NH3 + H2O → NH+3 + OH-(iii) NH3 + H2O + NH+4+ OH-(iv) NH3 + H2O → NH+4+ OH-Which represents the dissolution of NH3 in water(a) i(b) ii (c) iii (d) iv (e) iii and iv2. HOA2+H20 . → H3O+ + OA-CIn this reaction:(i) OA c is the conjugate base of H2O(ii)OA-c is the conjugate base of HOAc (iii) H3O+ is theсconjugate base of HOA.(iv) H3O+ is the conjugate acid of H2O(a) i(b) ii (c) iii (d) iv (e) none3. Arrange the following according to increasing acid strength(i) Ka= 2.5 + 10-15(ii) Ka= 9.0 + 10-9(iii) pKa= 7.5(iv) % dissociation =100(a) iv, iii, ii, i2(b) ii, I, iii, iv(c) i, iii, iv, ii(d) i, ii, iii, iv(e) iii, iv, ii, i2

Answers

1. Ammonia is a colorless gas with a chemical formula of NH3, when it comes in contact with water, it will be transformed into Ammonium ion and it will produce one hydroxide ion, and this is why Ammonia will present a more basic (pH) behavior, the reaction that represents this behavior is:

NH3 + H2O -> NH4+ + OH-

Number 4 is the only one that represents it well

Number 3 has the same reaction but since there is a plus sign instead of an arrow, I consider it wrong.

Other Questions
(40 POINTS AND BRAINLIEST. SHOW ALL WORK)1) what is y+xy if x = 6 and y = 32) what is (p-r)^2 if p = 4 and r = 1 Carly worked from 8am - 1:15pm and earned $46.20. How much would she earn if she worked from 8am -2:45pm? Escribe un texto que conste de cuatro o cinco prrafos. Debe presentar un prrafo de introduccin, un prrafo de conclusin y algunos prrafos correlativos. Emplea, adems, frases temticas y conectores que relacionen los prrafos entre s. an approach to researching culture that emphasizes the use of interviews and observation as a means of understanding culture from its own point of view is called psychology. a. sociotropic b. cross-cultural c. ethnic d. cultural Question 3 of 45The scatterplot shown below represents data for each of the years from 2006to 2015. The plot shows the percent of people 62 years of age and older whowere working and then retired during each of those years. If this trend continued,which of the following best predicts the percent who retired in 2016? Vous_____amricains. please help asap15. [0/5 Points] DETAILS PREVIOUS ANSWERS LARCALCET7 5.7.069. MY NOTES ASK YOUR TEACHER Find the area of the region bounded by the graphs of the equations. Use a graphing utility to verify your result the mean age of bus drivers in chicago is greater than 56.2 years. if a hypothesis test is performed, how should you interpret a decision that fails to reject the null hypothesis Which situation could be represented by - 7?O A. A jump to 7 inches above the groundB. A depth of 7 feet below sea levelO c. A gain of 7 poundsO D. A score increase of 7 pointsSomeone please help me with this wuestion How are plant root growth (root wedging) and ice wedging similar?A-Both happen only in warm temperatures.B- Both happen only in cold temperatures.C-Both happen quickly.D- Both occur slowly over time.Marking brainliesttt!!! The Internet is having a significant impact on the distribution and selling of books and is the most obvious way that ______ is altering the nature of the book industry. Find the range in wavelengths (in vacuum) for visible light in the frequency range between 7.9 10 Hz (violet light) Express the answers in nanometers. (Express your answer in whole number) Which type of food related activity has been banned entirely in most European countries?Group of answer choicesa Bottom trawlingb Long line fishingc GMO'sd A and B above The image of A(-1, 1) under a reflection is A' (-1, -1). Which reflection produces theimage of A?A: reflection in the line x=2B: reflection in the line y=xC: reflection in the x-axisD: reflection in the y-axis What are the coordinates of the midpoint of CD where C(2,-6) and D(4,10)? Data from the last nine decades for the S&P 500 index yleld the following statistics: average excess return, 8.3%; standard deviation, 20.3% a. To the extent that these averages approximated investor expectations for the period, what must have been the average coefficient of risk aversion? b. If the coefficient of risk aversion were actually 3.5, what risk premium would have been consistent with the market's historical standard deviation? Why do scientists think the cyanophytes are crucial to life? (3) For the reaction 2NH3(g) +202 (9) NO(g) + 3HO(1) =-683.1 kJ and AS = -365.6J/K The standard free energy change for the reaction of 1.57 moles of NH, (9) at 257 K, 1 atm would be This reaction please help ! a water basin starts with 2 liters of water and fills up at a rate of 0.5 liters per second. Another water basin begins with 11 liters of water but drains at rate of 0.4 liters per second. write and solve an equation for the number of seconds it will take for both water basins to have an equal amount of water. What is the ICD 10 code for pyelonephritis?