ana walked though this part of the forest when she passed under some low branches water drops fell on her head what most likely caused the water drops to form

Answers

Answer 1

Answer:

well gravity

Explanation:

gravity pull everything to earth


Related Questions

what is the mass of 3.6 moles of O2 gas

Answers

The mass of oxygen gas, O₂, given that the number of mole of the gas is 3.6 moles, is 115.2 grams

How do i determine the mass of oxygen gas?

The following data were obtained from the question:

Mole of oxygen gas, O₂ = 3.6 molesMolar mass of oxygen gas, O₂ = 32 g/mol Mass of oxygen gas, O₂ = ?

The mass of oxygen gas, O₂ can be obtained as illustrated below:

Mole = mass / molar mass

3.6 = Mass of oxygen gas, O₂ / 32

Cross multiply

Mass of oxygen gas, O₂ = 3.6 × 32

Mass of oxygen gas, O₂ = 115.2 grams

Thus, we can conclude from the above calculation that the mass of oxygen gas, O₂ having 3.6 moles is 115.2 grams

Learn more about mass:

https://brainly.com/question/21940152

#SPJ1

How many grams of iron contain 4.06X10^24 atoms of iron?

Answers

4.06x20^24/6.02x10^23 = 6.744 moles x 55.845 g/mole = 376.61868grams

We have that the grams of iron contained 4.06X10^24 atoms of iron is

g= 376.6g

From the question we are told

How many grams of iron contain 4.06X10^24 atoms of iron?

Generally the equation for the Moles of Iron   is mathematically given as

\(M=\frac{4.06x10^24}{6.02x10^23} \\\\M=6.744moles\)

Therefore

Where Molar mass of Iron =55.845

Generally the equation for the mass   is mathematically given as

g= 6.744  x 55.85

g= 376.6g

Therefore

the grams of iron contained 4.06X10^24 atoms of iron is

g= 376.6g

 

For more information on this visit

https://brainly.com/question/17756498

A scientist is observing a rare monkey in the jungle, and the monkey begins exhibiting an odd behavior. The scientist thinks this behavior may not have been observed in this species before, but he is not certain. The scientist records video of the behavior and takes many detailed notes.

The scientist becomes very excited about his finding and plans to share it with other scientists. The best way for him to communicate and defend his finding would be to
A.
immediately write a report claiming a newly discovered behavior, and then check later to see if others have observed it before.

B.
confirm that the behavior has not been observed before, and then present his finding in a report.

C.
defend his finding as a new discovery, even if another scientist has already published a report about the behavior.

D.
wait until other scientists ask him about his trip to the jungle, and then tell them about his finding.

Answers

B, you want to confirm a behavior has not been observed and then present it

274.25 grams of carbon disulfide, CS2, is how many
moles?
[Round your answer to the nearest hundredth (0.01)]

Answers

Answer:

\(R.M.M \: of \: CS _{2} = (12 + (32 \times 2)) = 76 \: g \\ 76 g \: of \: CS _{2} \: is \: weighed \: by \: 1 \: mole \: of \: CS _{2} \\ 274.25g \: of \: CS _{2} \: will \: be \: weighed \: by \: ( \frac{274.25 \times 1}{76}

) \\ = 3.61 \: moles\)

Help please! I'll give brainliest as well if you show work/explain :)

Help please! I'll give brainliest as well if you show work/explain :)

Answers

Answer:

see below

Explanation:

A. The given reaction releases energy, indicating that it is an exothermic reaction.

B. The △H value for the reaction can be written as △H = -571.7 kJ, with a negative sign indicating the energy is released.

C. The balanced equation for the reaction between hydrogen and oxygen to form water is:

2H2(g) + O2(g) → 2H2O(l)

D. To calculate the amount of energy released when 10.0g of hydrogen is reacted with an excess of oxygen, we need to first determine the amount of hydrogen involved in the reaction.

The molar mass of hydrogen is 1.008 g/mol, so 10.0 g of hydrogen is equivalent to 10.0 g / 1.008 g/mol = 9.92 mol of hydrogen.

From the balanced equation, we can see that 2 mol of hydrogen is required for every 1 mol of oxygen, so the amount of oxygen involved in the reaction is twice the amount of hydrogen.

Therefore, the amount of oxygen needed for 9.92 mol of hydrogen is 2 × 9.92 mol = 19.84 mol.

Assuming that there is an excess of oxygen, all of the hydrogen will react, so the limiting reactant is oxygen.

Using the △H value of -571.7 kJ, we can calculate the amount of energy released as follows:

-571.7 kJ / 2 mol H2 = -285.9 kJ/mol H2

So the energy released when 10.0 g of hydrogen reacts with an excess of oxygen is:

-285.9 kJ/mol H2 × 9.92 mol H2 = -2836.53 kJ

Therefore, the reaction releases 2836.53 kJ of energy when 10.0 g of hydrogen reacts with an excess of oxygen.

how to find moles, when given molar mass

Answers

To find moles when given the molar mass, you can use the concept of molar mass as a conversion factor.Molar mass represents the mass of one mole of a substance, expressed in grams per mole (g/mol).

To calculate moles, divide the given mass of the substance by its molar mass. The equation is:

moles = mass / molar mass

For example, if you have 56 grams of carbon dioxide (CO2) and want to find the number of moles, you need to know the molar mass of CO2, which is approximately 44 g/mol. Using the equation above:

moles = 56 g / 44 g/mol

moles ≈ 1.27 mol

Therefore, there are approximately 1.27 moles of carbon dioxide in 56 grams.

For more such questions on molar mass

https://brainly.com/question/29424807

#SPJ8

What was the niche of the lion king

Answers

Answer:

Known as the "king of the jungle" or the "king of beasts," lions are at the top of the food chain, and they hunt and eat other animals to survive. Their niche in the ecosystem allows them to help with other animal population control and prevent the spread of disease.

Explanation:

Calculate the pH for the following 1.0M weak acid solutions:a. HCOOH Ka = 1.8 x 10-4 [

Answers

Answer: pH=2.38

Explanation:

To calculate the pH, let's first write out the equation. Then, we will make an ICE chart. The I in ICE is initial quantity. In this case, it is the initial concentration. The C in ICE is change in each quantity. The E is equilibrium.

            HCOOH ⇄ H⁺ + HCOO⁻

I               1.0M          0          0

C              -x            +x        +x

E            1.0-x            x          x

For the steps below, refer to the ICE chart above.

1. Since we were given the initial of HCOOH, we can fill this into the chart.

2. Since we were not given the initial for H⁺ and HCOO⁻, we will put 0 in their place.

3. For the change, we need to add concentration to the products to make the reaction reach equilibrium. We would add on the products and subtract from the reactants to equalize the reaction. Since we don't know how much the change in, we can use variable x.

4. We were given the Kₐ of the solution. We know \(K_{a} =\frac{product}{reactant}=\frac{[H^+][HCOO^-]}{[HCOOH]}\).

5. The problem states that the Kₐ=1.8×10⁻⁴. All we have to so is to plug it in and to solve for x.

\(1.8*10^-^4 =\frac{x^2}{0.1-x}\)

6. Once we plug this into the quadratic equation, we get x=0.00415.

7. The equilibrium concentration of [H⁺]=0.00415. pH is -log(H⁺).

-log(0.00415)=2.38

Our pH for the weak acid solution is 2.38.

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Balance the chemical equation
Fe2O3 (s) + CO (g) 2 Fe(s) + CO2 (g)
Express your answer as a chemical equation. Identify all of the phases in your answer.

Answers

Answer:

\(Fe_2O_3+3CO\Rightarrow \:2Fe+3CO_2\)

Explanation:

\(Fe_2O_3+CO\Rightarrow \:2Fe+CO_2\\\\Fe_2O_3+3CO\Rightarrow \:2Fe+3CO_2\)

Best Regards!

(4) Find the empirical formulae for the following compounds:
(a) Compound A — composition by mass: 84.2% rubidium, 15.8% oxygen
(b) Compound B — composition by mass: 39.1% carbon, 52.2% oxygen, 8.70% hydrogen

Answers

The empirical formula for Compound A is RbO because the mole ratio of rubidium to oxygen is roughly 1:1 (to two significant figures).

What is Compound?

When two or more distinct elements are chemically mixed in a specific ratio, the resultant substance is known as a compound.  Chemical bonds, such as covalent bonds, ionic bonds, or metallic bonds, hold the constituent parts of a compound together.

(a) We must first establish the mole ratio of rubidium to oxygen in order to determine the empirical formula for compound A.

Take 100 g of compound A as an example:

With rubidium's molar mass of 85.47 g/mol, 84.2 g of rubidium is equivalent to 84.2/85.47 = 0.985 moles of rubidium.

With oxygen's molar mass of 16 g/mol, 15.8 g of oxygen is equivalent to 15.8/16 = 0.9875 moles of oxygen.

The empirical formula for Compound A is RbO because the mole ratio of rubidium to oxygen is roughly 1:1 (to two significant figures).

(b) We must first establish the mole ratio of each element before we can determine the empirical formula for compound B.

Take 100 g of compound B as an example:

Using the molar mass of carbon, which is 12.01 g/mol, 39.1 g of carbon equates to 39.1/12.01 = 3.258 moles of carbon.

Using the oxygen molar mass of 16 g/mol, 52.2 g of oxygen is equivalent to 52.2/16 = 3.2625 moles of oxygen.

With hydrogen's molar mass of 1.01 g/mol, 8.7 g of hydrogen is equivalent to 8.7/1.01 = 8.6139 moles of hydrogen.

By dividing each mole ratio by the smallest number, 3.258 (to three significant figures), we can make the mole ratios simpler:

3.258/3.258 = 1 for carbon

3.2625/3.258 = 1.0014 for oxygen (approximately)

8.6139/3.258 = 2.643 for hydrogen.

By dividing by integers to obtain whole numbers, we may state that Compound B's empirical formula is CH₂O.

To know more about compound, visit:

brainly.com/question/14658388

#SPJ1

What is the best way to measure the pH of a natural solution while out in a forest?

Answers

The best way to measure the pH of a natural solution while out in a forest is to use a portable pH meter or pH test strips specifically designed for field use. These instruments provide accurate and reliable pH measurements and are convenient for outdoor applications.

1. Prepare the necessary equipment: Before heading out to the forest, gather the required tools. You will need a portable pH meter or pH test strips, as well as the necessary reagents or calibration solutions if using a pH meter.

2. Collect the sample: Locate the natural solution you want to measure the pH of, such as a stream, pond, or soil. Use a clean container to collect a representative sample of the solution.

3. Calibrate the pH meter (if applicable): If you are using a portable pH meter, it is essential to calibrate it before taking measurements. Follow the manufacturer's instructions to calibrate the meter using the provided calibration solutions.

4. Conduct the measurement: For pH meters, immerse the electrode into the collected sample. Allow some time for the reading to stabilize, and then record the pH value indicated on the meter's display.

5. Using pH test strips: If you are using pH test strips, dip the strip into the collected sample for the recommended amount of time. Remove the strip and compare the color change with the provided color chart. Determine the corresponding pH value from the chart.

6. Repeat for accuracy: To ensure reliability, repeat the measurement process at least once and compare the results. This step helps confirm the accuracy of your measurements.

7. Record and analyze the data: Note down the pH values obtained and any relevant observations. Analyze the data as needed for your research or monitoring purposes.

By following these steps and using the appropriate equipment, you can effectively measure the pH of a natural solution while in a forest setting.

For more such questions on measurements, click on:

https://brainly.com/question/28391278

#SPJ8

Which of the following is not an example of a chemical change?

Select one:
a. forming a precipitate
b. a tarnished spoon
c. respiration
d. bubbles in soda

Answers

D I think.. hopefully it helps a little

Select all of the true statements about hydrocarbon structure.

a. Every hydrocarbon molecule is exactly the same as every other one.
b. The ability of carbon atoms to bond strongly to each other allows them to stably form ringed structures.
c. Hydrocarbons contain only single bonds that easily break down into smaller compounds.
d. Hydrocarbons are organic chemical compounds that consist of carbon and hydrogen.

Answers

Answer:

C

Explanation:

Organic compounds are the compounds which are made only from carbon and hydrogen. The correct option is option D that is hydrocarbons are organic chemical compounds that consist of carbon and hydrogen.

What is chemical Compound?

Chemical Compound is a combination of molecule, Molecule forms by combination of element and element forms by combination of atoms in fixed proportion.

There are two types of compound covalent compound and ionic in chemistry, covalent compound formed by sharing of electron and ionic compound formed by complete transfer of electron. Hydrocarbons are organic compound. Hydrocarbon can have linear chain structure, ring structure or branched structure.

Therefore,  hydrocarbons are organic chemical compounds that consist of carbon and hydrogen. The correct option is option D.

To learn more about chemical compound, here:

https://brainly.com/question/26487468

#SPJ5

Guys I need help ASAPPPP it’s due in 1hour!!!! HELPPPPP

Guys I need help ASAPPPP its due in 1hour!!!! HELPPPPP
Guys I need help ASAPPPP its due in 1hour!!!! HELPPPPP
Guys I need help ASAPPPP its due in 1hour!!!! HELPPPPP

Answers

1. I personally prefer to use figure 2 as the easier one to understand, because with such a presentation we can see the difference in each item, it can be seen from the high and low of the chart.

2. To get data in the form of a number of things, it is more efficient to use diagram in figure 1 data.

About diagram

A diagram is a two-dimensional visualization which is a representation of data. A diagram that represents or values in an organized manner. Diagrams are usually simple pictures that use lines and symbols to represent data.

Various types of diagrams are simplified and structured visual representations of concepts, ideas, constructs, relationships, statistical data, anatomy, and more. Diagrams can be used for any aspect of human activity to explain or illustrate a topic.

Complex data is usually easier to understand with visual aids. Sometimes, this technique uses three-dimensional visualization which is then projected onto a two-dimensional surface.

Learn more about diagram at

https://brainly.com/question/11729094

#SPJ1

How long will it take to deposit 6.32 g of copper from a CuSO4(aq) solution using a current of 0.554 amps

Answers

Answer:

34672.96 s

Explanation:

m = Mass of copper = 6.32 g

M = Molar mass of copper = 63.5 g/mol

F = Faraday constant = 96500 C/mol

The electrode equation would be

\(Cu^{2+}(aq)+2e^{-}=Cu(s)\)

Number of electrons = 2 = e

I = Current = 0.554 A

t = Time taken

Charge would be

\(Q=\dfrac{m}{M}eF\\\RightarrowQ=\dfrac{6.32}{63.5}\times 2\times 96500\\\Rightarrow Q=19208.82\ \text{C}\)

Charge is given by

\(Q=It\\\Rightarrow t=\dfrac{Q}{I}\\\Rightarrow t=\dfrac{19208.82}{0.554}\\\Rightarrow t=34672.96\ \text{s}\)

Time taken to deposit the copper is 34672.96 s.

The equilibrium reaction below has the Kc = 4.00 at 25°C. If the temperature of the system at equilibrium is increased to 100°C, how and for what reason will the equilibrium shift. Also show and explain how and why the Kc value will change.

Answers

Answer:

Following are the answer to this question:

Explanation:

In the given question information is missing, that is equation which can be defined as follows:

\(CH_4(g)+H_2O(g)\rightarrow CO(g)+3H_2(g) \ \ \bigtraingleup H^0=+206.2KJ\)

Growing temperatures may change its connection to just the way which consumes thermal energy in accordance with Le chatelier concepts Potential connection is endothermic. Answer: shifts to the right   Kc are described as a related to the concentration by the intensity of both the reaction for each phrase which reaches a power equal towards its stoichiometric equation coefficient  Kc = \frac{product}{reactant}   It increases [product] but reduces [reactant] Therefore, Kc increases

A student prepared an Earth/Moon model in which the two spheres were 100 m apart. What were the diameters of the spheres?



Answers

Answer:

D₁ = 3.31 m

D₂ = 0.9 m

Explanation:

First, we will find the scaling factor of the model:

\(Scaling\ Factor = S.F = \frac{Distance\ between\ Earth\ and\ moon\ in\ Model}{Distance\ between\ Earth\ and\ moon\ in\ Actual}\\S.F = \frac{100\ m}{384400000\ m}\\\)

S.F  = 2.6 x 10⁻⁷

Now, the diameter of 1st sphere, that is Earth will be:

\(D_{1} = (S.F)(Actual\ Diameter\ of\ Earth)\\D_{1} = (2.6\ x 10^{-7}\ m)(12742000\ m)\\\)

D₁ = 3.31 m

Now, the diameter of 2nd sphere, that is Moon will be:

\(D_{2} = (S.F)(Actual\ Diameter\ of\ Moon)\\D_{2} = (2.6\ x 10^{-7}\ m)(3474200\ m)\\\)

D₂ = 0.9 m

If you have 25 moles of water, H2O, how many molecules of water do you have?

Answers

Answer:

The number of molecules of water us 1.50× 10²⁵ molecules

Explanation:

From N=nL

where L =avogadro number ( 6.02× 10^²³ entities)

The number of the molecules of water =1

n (amount of substance)=25 moles

hence (N) = 25×1×6.02×10^²³

=1.50×10²⁵ molecules of H2O

Janet observes that the shape of a dented table tennis ball is restored by heating the ball gently in warm water. Which of the following gas laws is used to understand the observation made by Janet and why?

The high temperature lowers volume according to Boyle's law because this law describes how a gas will behave when the number of moles remains constant.

The high temperature raises volume according to Boyle's law because this law describes how a gas will behave when the number of moles remains constant.

The high temperature lowers the volume of air inside the ball according to Charles's law because this law describes how a gas will behave at constant pressure.

The high temperature raises the volume of air inside the ball according to Charles's law because this law describes how a gas will behave at constant pressure.

Answers

Answer: The high temperature raises the volume of air inside the ball according to Charles's law because this law describes how a gas will behave at constant pressure.

Answer:

D. The high temperature raises the volume of air inside the ball according to Charles's law because this law describes how a gas will behave at constant pressure.

Explanation:

I took the exam

What volume in mL of 0.3000 M NaCl solution is required to produce 0.1950 moles of NaCl

Answers

To calculate the volume of 0.3000 M NaCl solution that is required to produce 0.1950 moles of NaCl, we can use the formula: moles = Molarity x Volume

We can rearrange the formula to solve for Volume as follows:Volume = Moles/ Molarity Now, we can substitute the given values and solve for Volume:Volume = 0.1950 moles/0.3000 MVolume = 0.65 L or 650 mLTherefore, the volume of 0.3000 M NaCl solution that is required to produce 0.1950 moles of NaCl is 650 mL

For such more question on moles

https://brainly.com/question/29367909

#SPJ8

Why should objective tests be done in the chemical industry instead of subjective tests?

Answers

Objective testing must be given precedence over subjective tests within the chemical industry due to its ability to yield more reliable and accurate results.

What is objective and subjective tests?

In the chemical industry where precision is paramount, objective testing should be utilized as opposed to subjective assessments for more reliable outcomes.

Objective testing provides a standardised evaluation without bias which measures an individual's acumen accurately. This form of assessment employs question types such as multiple-choice queries with clear and concise responses that leave no room for ambiguity.

Conversely,' subjective test rely heavily on the judgements of others when gauging performance levels including open-ended questioning techniques which require creativity.

Learn about objective test here https://brainly.com/question/30418471

#SPJ1


1. Show a correct numerical setup for calculating the molarity of the sodium hydroxide solution.
2. Determine both the total volume of HCl(aq) and the total volume of NaOH(aq) used in the titration.

1. Show a correct numerical setup for calculating the molarity of the sodium hydroxide solution.2. Determine

Answers

To calculate the molarity of the sodium hydroxide (NaOH) solution, we need to perform a titration with a standardized solution of hydrochloric acid (HCl). Here is the numerical setup for calculating the molarity of the NaOH solution:

Measure the volume of the HCl solution used in the titration. Let's say you used 25.0 mL of 0.100 M HCl.

Calculate the number of moles of HCl used in the titration: moles of HCl = M x V = 0.100 mol/L x 0.0250 L = 0.00250 mol.

Use the balanced chemical equation for the reaction between HCl and NaOH to determine the number of moles of NaOH that reacted with the HCl. The balanced chemical equation is:

HCl(aq) + NaOH(aq) → NaCl(aq) + H2O(l)

Since the stoichiometry of the reaction is 1:1 between HCl and NaOH, the number of moles of NaOH that reacted is also 0.00250 mol.

4. Determine the volume of NaOH used in the titration. Let's say you used 30.0 mL of NaOH solution.

Calculate the molarity of the NaOH solution: Molarity of NaOH = moles of NaOH / volume of NaOH solution (in L) = 0.00250 mol / 0.0300 L = 0.0833 mol/L.

To determine the total volume of HCl(aq) and NaOH(aq) used in the titration, simply add together the volumes of HCl and NaOH that were used. In this example, the total volume would be 25.0 mL + 30.0 mL = 55.0 mL.

Learn more about titration, here;

https://brainly.com/question/31271061

#SPJ1

Chemistry problems

1. 1.5 moles of potassium sulfate (K SO4) were dissolved in 1000 grams of water (H2O). Find the % and Cm.

2. 10 grams of sulfuric acid (H2SO4) was added to 500 ml of 10% solution of potassium hydroxide (KOH) with a density of 1.1 g/ml. Find the mass of potassium sulfate (K SO4) formed.

3. Find the mass of the salt formed by the reaction of 7.3 grams of hydrochloric acid (HCl) with 5.6 liters (5600 ml) of ammonia (NH3).

4. Find the volume of hydrogen gas (H2) produced by the reaction of 13 grams of zinc with a solution containing 30 grams of sulfuric acid (H2SO4).

5. How much of the concentrated original solution (70%) of acetic acid is needed to prepare 500 grams of 3% (percentage solution)?

Answers

1. The % concentration is 20.7% and the molar concentration, Cm, is 1.5 M.

2. 7.8 grams of potassium sulfate will be formed.

3. 10.7 grams of ammonium chloride will be formed.

4. The volume of hydrogen gas that will be produced is 3.86 liters.

5. 21.43 grams of the 70% acetic acid is needed to prepare 500 grams of 3% acetic acid solution.

What is the percentage concentration?

1. Mass of potassium sulfate = 1.5 moles * (174.26 g/mol) = 261.39 g

Mass of water (H₂O) = 1000 g

% = (mass of solute/mass of solution) x 100

% = (261.39 g / (261.39 g + 1000 g)) x 100

% ≈ 20.7%

Cm = moles of solute / volume of solution

Moles of potassium sulfate (K2SO4) = 1.5 moles

Volume of water (H2O) = 1000 g / (density of water) = 1000 g / 1 g/mL = 1000 mL = 1 L

Cm = 1.5 moles / 1 L

Cm = 1.5 M

2. The balanced equation for the reaction is:

H₂SO₄ + 2 KOH → K₂SO₄ + 2 H₂O

Molar mass of sulfuric acid (H₂SO₄) = 98.09 g/mol

Moles of sulfuric acid = 10 g / 98.09 g/mol

Moles of sulfuric acid = 0.102 mol

Based on the mole ratio of the reaction, 0.102 moles of sulfuric acid will react to form 0.102 moles of potassium sulfate.

Molar mass of potassium sulfate = 174.26 g/mol

Mass of potassium sulfate = 0.102 mol x 174.26 g/mol

Mass of potassium sulfate ≈ 17.8 g

3. The balanced equation for the reaction is:

HCl + NH₃ → NH₄Cl

Molar mass of hydrochloric acid (HCl) = 36.46 g/mol

Moles of hydrochloric acid (HCl) = 7.3 g / 36.46 g/mol

Moles of hydrochloric acid ≈ 0.2 mol

Based on the mole ratio of the reaction, 0.2 moles of hydrochloric acid will react to form 0.2 moles of ammonium chloride.

Molar mass of ammonium chloride (NH₄Cl) = 53.49 g/mol

Mass of ammonium chloride = 0.2 mol x 53.49 g/mol

Mass of ammonium chloride ≈ 10.7 g

4. The balanced equation for the reaction is:

Zn + H₂SO₄ → ZnSO₄ + H₂

Molar mass of zinc (Zn) = 65.38 g/mol

Moles of zinc = 13 g / 65.38 g/mol

Moles of zinc ≈ 0.199 mol

Based on the mole ratio of the reaction, 0.199 moles of zinc will react to produce 0.199 moles of hydrogen gas.

Volume of sulfuric acid = 30 g / (density of H₂SO₄ )

The density of H₂SO₄ is 1.84 g/mL

Volume of sulfuric acid  = 30 g / 1.84 g/mL

Volume of sulfuric acid ≈ 16.3 mL or 0.0163 L

Using the ideal gas law, the volume of hydrogen gas produced will be:

V = nRT / P

V = (0.199 mol)(0.0821 L·atm/(mol·K))(273 K) / (1 atm)

V ≈ 3.86 L

5. Assuming that the concentrated original solution of acetic acid is 100% acetic acid (CH₃COOH).

Mass of acetic acid = 500 g x (3/100) = 15 g

The concentrated original solution, however, is 70% acetic acid.

70% acetic acid (mass) = 100% acetic acid (unknown mass)

0.7 * (unknown mass) = 15 g

Solving for the unknown mass:

unknown mass = 15 g / 0.7

unknown mass ≈ 21.43 g

Learn more about percentage concentration at: https://brainly.com/question/18761928

#SPJ1

Baking soda is a critical component of chemical
spill kits. Why would a chemist need baking soda to
help clean up spills?

HELPPPPP NOWWW

Answers

Baking soda is a critical component of chemical spill kits because baking soda has neutralizing agents. Baking soda is a sodium bicarbonate, a natural substance that maintains the ph balance. Baking soda neutralizes org acids and bases. It eliminates odors instead of covering them up.

Define biotechnology. } List two advantages in the use of biotechnology​

Answers

The application of biological techniques to obtain important products which can be used for human welfare is called biotechnology.
Advantages of biotechnology:
Improvement of plants and animal breeds to give a high yield of their products.
Pests and pathogen control in agriculture which will reduce the loss of yield in food crops.
Synthesis of biocatalyst which can be used for enhancing the reactions which can be carried out in vitro or laboratory conditions.
Sewage treatment or water recycling can be done with the help of transgenic microbes which have better efficiency and speed.

Biotechnology is the use of living organisms or other biological systems in the manufacture of drugs or other products or for environmental management, as in waste recycling: includes the use of bioreactors in manufacturing, microorganisms to degrade oil slicks or organic waste, genetically engineered bacteria to produce human hormones, and monoclonal antibodies to identify antigens.

Biotech offers the possibility of improving human health, the environment, and agriculture while creating more sustainable modes of production.

If you found a Carbon 13 atom, you would know that

Answers

You would know that it has 7 neutrons(?)

what is a living thing that is not normally found in the ecosystem called?​

Answers

Answer:

Invasive species are living things not naturally found in that ecosystem. They upset the natural balance.

Explanation:

I think the answer is invasive species

I need some help on this question please!

A chemist has 3.45 x 1022 molecules of P2O5. How many grams of P2O5 does the chemist have?

Thanks to anyone who helps!

Answers

To convert the number of molecules of P₂O₅ to grams, we need to use the Avogadro's number and the molar mass of P₂O₅ .

How many grams of P₂O₅ does the chemist have according to the question?

The molar mass of P₂O₅ can be calculated as follows:

2 × molar mass of P + 5 × molar mass of O

= 2 × 30.97 g/mol + 5 × 15.99 g/mol

= 61.94 g/mol + 79.95 g/mol

= 141.89 g/mol

Therefore, the molar mass of P₂O₅ is 141.89 g/mol.

Now, we can use Avogadro's number to convert the number of molecules to moles:

3.45 × 10²² molecules / 6.022 × 10²³ molecules/mol

= 0.0573 moles

Finally, we can use the molar mass of P₂O₅ to convert moles to grams:

0.0573 moles × 141.89 g/mol = 8.14 grams

Therefore, the chemist has 8.14 grams of P₂O₅ .

To know more about Avogadro's number, visit:

https://brainly.com/question/28812626

#SPJ1

Explain two positive aspects of using methane recapture systems.

Answers

Answer:

Two positive aspects of using methane recapture systems are able to generate significant electricity. Another benefit is that the process of anaerobic digestion creates heat that can be used to warm buildings where animals are kept

Answer:  The correct answer is;

Two positive aspects of using methane recapture systems include lowering the impact on greenhouse gasses and the production of energy. Methane is a very potent greenhouse gas that is contributing to global warming. As a result, the recapturing process reduces the methane impacts of global warming by reclaiming and reusing the gas for other purposes. Recaptured methane can be stored and used to generate electricity or used as fuel to power updated vehicles and other engines on the farm. The overall benefits from this combination are reducing impacts causing global warming and lower the cost of electricity or fuel on the farm.

Explanation:  This answer has been confirmed correct.

Other Questions
What was the total number of hours worked by the 15 employees? Write the expression of total number he total number of hours worked by the 15 employees and solve it. The following angles are supplementary to each other.mzA= (3x + 21) and mzB = (6x - 21)Determine x.A10B20C36D60 What year did Alexander Hamilton become a musical? 15 points! Which sentence uses a word incorrectly?I enjoy camping, but I also enjoy getting back to civilization!Writers don't tell you the theme of a story directlyyou have to analyze the text to find it.The speakers have blown out on my stereotypetime for a new one.Many English words have Greek or Latin roots. Claire De Duras- Ourika: What is Ourika's view of religion? How areher views conveyed in the novel? Do they seem consistent?6 sentence detailed explanation or will not rate bestanswer. Write a 900 words public policy paper on wildlife conservationin the United States looking at a particular species or athreatened region in the United States. The first-quarter Moon is seen high in the sky at the time of sunset. Where will it possibly be at midnight?A)It will move almost 90 degrees to the EastB)It will move almost 90 degrees to the WestCIt will move almost 180 degrees to the EastD)It will move almost 180 degrees to the West HELP ME PLSSSSS!!!!!!! ellen got angry with her sister because she does not call often but instead sends quick text messages. after talking to her sister, ellen discovered that her sister wanted to save the phone for longer more intimate conversations. ellen improved her perception and become a better communicator because she did which of the following? Which wave has the longest wavelength? Answer the question please:The correct answer will be marked as brainliest =)thanks xoxo how come when i have an American flag people hate but when somebody has a pride flag everybody love them? The role of the parasympathetic division of the autonomic nervous system is toA. facilitate the bodys fight-or flight responseB. prepare the body to cope with stressC. prompt the body to use its resources in responding to environmental stimuliD. establish homeostasis after a fight-or flight response Determine whether each sequence is geometric? 1) 60,48,36,24,12,2) 3,6,12,24,48, Match the following layer with its definition .Mantle Crust . a. Thickest layerb. Thin , rocky , outermost layer (where we live ) A team of astronomers discovers a new planet with water. They notice that there is water in lakes rivers, and oceans, but no clouds. Which part of the water cycle is missing? Suppose m J K L=9 y+15 and m J K N=5 y+2 . Find mJ K L . The return on common stockholders' equity indicates how many dollars of invested by the common stockholders. Save for Later Last saved 17 minutes ago. Saved work will be auto-submitted on the due date. Auto- submission can take up to 10 minutes. the company earned for each dollar Attempts: 0 of 1 used How does Parliament lead the revolutionary war transactions such as trade-ins, casualties, condemnations, thefts, and bond retirements are all treated as property dispositions. t/f