A(n)_______is a balanced chemical equation that includes the
physical states of all reactants and products, and the energy change that
accompanies the reaction. *

thermochemical equation

combustion

released

vaporization

fusion

absorbed

heat

Answer:

0.15M

Explanation:

Molar Concentration = \(\frac{mass}{molar mass}\)

Assuming 20g of the unadulterated aluminium chloride was weighed into the volumetric flask, and given molar mass of AlCl3 = 133.34g/mol

∴ Molarity = \(\frac{20}{133.34}\)

= 0.14999 ≈ 0.15M (to 2 significant figures)

I hope this solution is clear. The same can be calculated from concentration by volume.

The net ionic equation can be given as Sn²⁺ (aq) + S²⁻ (aq) → SnS (s).

The atoms or molecules on losing or gaining electrons in order to achieve the stable configuration results in the formation of positive or negative charge and are termed as ions.

The ionic equation can be given with the formation of the respective ions of the reactant and the product side.

SnSO₄ (aq) → Sn²⁺ (aq) + SO₄²⁻ (aq)

Na₂S (aq) → 2 Na⁺ (aq)  + S²⁻ (aq)

SnS (s) → did not dissociates as form a solid covalent compound

Na₂SO₄ (aq) → 2 Na⁺ (aq)  + SO₄²⁻ (aq)

The complete ionic equation can be given as:

Sn²⁺ (aq) + SO₄²⁻ (aq) + 2 Na⁺ (aq)  + S²⁻ (aq) → SnS (s)  2 Na⁺ (aq)  + SO₄²⁻ (aq)

Eliminating the common ions on the product and the reactant side:

Sn²⁺ (aq) + S²⁻ (aq) → SnS (s)

Learn more about ionic equation, here:

https://brainly.com/question/15467502

#SPJ1

Answer:

A

Explanation:

14=pH + pOH

pOH= 14 - 2

pOH= 12

pOH= -log[OH]

[OH]= 10^-12

=1×10^-12

Answer: 1.325x10^24 atoms S

Explanation:

2.2*avogadro number because S is monoatomic.

The number of moles of CO2 produced is 0.021 moles

If the estimated volume of the balloon is wrong then the amount of glucose reacted must be more than is stated.

The respiration equation represents the chemical process of aerobic cellular respiration, which occurs in the mitochondria of cells and is the primary way in which cells generate energy in the form of ATP (adenosine triphosphate).

The equation of the reaction is;

C6H12O6 + 6O2 → 6CO2 + 6H2O + ATP

We know that;

Number of moles of glucose = 10 g/180 g/mol

= 0.056 moles

PV = nRT

n = PV/RT

n = 1 * 0.55/318 * 0.082

n = 0.021

Learn more about glucose:https://brainly.com/question/2252123

#SPJ1

Answer:

Astronomers identify numerous types of dwarf galaxies based on their shape and composition.

Explanation:

Answer:

A. prefixed with the letter "d"

Explanation:

The IUPAC names of the organic compounds are:

Organic compounds are compounds that are obtained from living or dead organic matter.

Most organic compounds are derived from plants or animals.

One class of organic compounds is hydrocarbons which are derived from petroleum.

The various fractions of hydrocarbons in organic compounds are derived from fractional distillation.

Organic compounds are given IUPAC names that follow the IUPAC nomenclature convention for organic compounds.

Learn more about organic compounds at: https://brainly.com/question/6279332

#SPJ1

The properties of a natural resource that make it useful for humans as a material or energy source is the ability to convert mass into energy and vice versa.

The expression natural resources make reference to all types of matter and energy extracted from nature that can be used to produce goods and services.

Some examples of natural resources include for example irreversible resources such as fossil fuels (i.e., oil, or coal, gas, minerals such as metals, rocks, etc) as well as those based on the use of reversible energy such as eolic air energy, solar radiation or sunlight, soil and hydric resources or water.

Therefore, with this data, we can see that natural resources can be defined as any material and or energy obtained from nature that may be irreversible or reversibly used to produce goods and services.

Learn more about natural resources here:

https://brainly.com/question/24514288

#SPJ1

Answer:D

Explanation: There is one mole of Iron Oxide on the reactants side(left) and two moles of iron on the products side (right).

Answer:

think I did this before and its V

If you increase the pressure of the reaction 2A(g) + B(g)C(g) + 2D(g)the reaction will shift forward to the side with little moles of gas.

Le Chatelier's principle states that if pressure is raised, the reaction will favor the direction with a lower number of gas moles.

On this  case, the cleared out side includes a add up to of three gas moles (two moles of A and one mole of B), whereas the correct side covers four gas moles (one mole of C and two moles of D). In this way, the balance will move towards the left-hand side in arrange to diminish the collective gas particles and relieve the rise in weight. The levels of A and B will rise, as the levels of C and D will decrease.

Learn more about pressure from

https://brainly.com/question/28012687

#SPJ1

Answer:

-1

Explanation:

Proton +1

Neutron 0

Electron −1

The metal X has an approximate molar mass of 42.36 g/mol and the metal is most likely calcium.

The molar mass of the metal carbonate XCO₃ and identify the metal X, we need to calculate the number of moles of XCO₃ and CO₂ using the given masses and molar masses.

The molar mass of CO₂ (carbon dioxide) is 12.011 g/mol (for carbon) + 2 * 15.999 g/mol (for oxygen) = 44.01 g/mol.

The number of moles of CO₂ can be calculated using the formula:

moles of CO₂ = mass of CO₂ / molar mass of CO₂

moles of CO₂ = 0.855 g / 44.01 g/mol

moles of CO₂ ≈ 0.01944 mol

Since the reaction stoichiometry is 1:1 between XCO₃ and CO₂, the number of moles of XCO₃ is also approximately 0.01944 mol.

molar mass of XCO₃ = mass of XCO₃ / moles of XCO₃

molar mass of XCO₃ = 2.012 g / 0.01944 mol

molar mass of XCO₃ ≈ 103.38 g/mol

The molar mass of XCO₃ is approximately 103.38 g/mol.

To determine the metal X:

molar mass of X = molar mass of XCO3 - molar mass of CO3

molar mass of X = 103.38 g/mol - (12.011 g/mol + 3 * 15.999 g/mol)

molar mass of X ≈ 42.36 g/mol

Metal X is most likely Calcium that has a molar mass of 40 g/mol

Learn more about molar mass at: https://brainly.com/question/837939

#SPJ1

Answer:

A change in temperature is characteristic of a chemical change. ... If temperature increases, as it does in most reactions, a chemical change is likely to be occurring. This is different from the physical temperature change. During a physical temperature change, one substance, such as water is being heated.

Answer:

If a reaction is a chemical reaction, then a change of temperature can be noticed, it can either be endothermic  (a decrease in temp.) or it can be exothermic (increase in temp.). Any kind of change in temperature of a substance is considered as a characteristic of a chemical reaction.

125 grams of zinc was reacted, therefore, 125 grams of zinc will produce 42.6 liters of hydrogen gas at STP, and the problem involves stoichiometry, which is the calculation of reactants and products in a chemical reaction.

The balanced chemical equation for the reaction of zinc and hydrochloric acid is:

Zn + 2HCl → ZnCl₂ + H₂

From the equation,

125 g Zn x (1 mole Zn/65.38 g) = 1.91 moles Zn

So, one can expect 1.91 moles of hydrogen gas to be produced.

Now, at STP (standard temperature and pressure), the volume of one mole of gas is 22.4 liters. Therefore, the volume of hydrogen gas produced at STP can be calculated as:

1.91 moles H2 x 22.4 L/mole = 42.6 L H2

Therefore, 125 grams of zinc will produce 42.6 liters of hydrogen gas at STP.

Learn more about the ideal gas law here.

https://brainly.com/question/30556543

#SPJ1

Answer:

Simple Stoich Question

Explanation:

0.870 moles divided by 3 mol ratio of CuO, multiplied by 2 mol ratio of NH3 (ammonia)

\(\frac{0.870}{3 } * 2 = 0.58 \ moles \ of \ Ammonia\)

Answer:

The mole is simply a very large number that is used by chemists as a unit of measurement.

Explanation:

The mole is simply a very large number,

6.022

×

10

23

, that has a special property. If I have

6.022

×

10

23

hydrogen atoms, I have a mass of 1 gram of hydrogen atoms . If I have

6.022

×

10

23

H

2

molecules, I have a mass of 2 gram of hydrogen molecules. If I have

6.022

×

10

23

C

atoms, I have (approximately!) 12 grams.

The mole is thus the link between the micro world of atoms and molecules, and the macro world of grams and litres, the which we can easily measure by mass or volume. The masses for a mole of each element are given on the periodic table as the atomic weight. So, if have 12 g of

C

, I know, fairly precisely, how many atoms of carbon I have. Given this quantity, I know how many molecules of

O

2

are required to react with the

C

, which I could measure by mass or by volume.

Answer:

yes

Explanation:

the density of a solid is the same no matter how big or small the sample

Biotechnology is the use of living organisms or other biological systems in the manufacture of drugs or other products or for environmental management, as in waste recycling: includes the use of bioreactors in manufacturing, microorganisms to degrade oil slicks or organic waste, genetically engineered bacteria to produce human hormones, and monoclonal antibodies to identify antigens.

Biotech offers the possibility of improving human health, the environment, and agriculture while creating more sustainable modes of production.

To calculate the pH of the solution, we need to first determine the concentration of H+ ions in the solution.

HNO3 is a strong acid, so it will dissociate completely to form H+ and NO3- ions. HI is also a strong acid and will dissociate completely. CH3COOH is a weak acid and will partially dissociate according to the following equation:

CH3COOH + H2O ⇌ CH3COO- + H3O+

To determine the concentration of H+ ions, we need to find the equilibrium concentration of H3O+ from the dissociation of CH3COOH. We can use the expression for the acid dissociation constant (Ka) of CH3COOH to find this concentration:

Ka = [CH3COO-][H3O+]/[CH3COOH]

1.8 × 10-5 = (x)(x)/(0.40 - x)

where x is the equilibrium concentration of H3O+.

Assuming that x << 0.40, we can simplify the equation to:

1.8 × 10-5 = x2/0.40

Solving for x, we get:

x = 1.34 × 10-3 M

The total concentration of H+ ions in the solution is then:

(0.035 M) + (1.34 × 10-3 M) + (0.045 M) = 0.08034 M

The pH of the solution can be calculated using the expression:

pH = -log[H+]

pH = -log(0.08034) = 1.09

Therefore, the closest option to the calculated pH value of the solution is 1.22.

To know more about  strong acid, visit :

https://brainly.com/question/16749233

#SPJ1

Answer:

..............,.,.,.,,..,,.,.,

In an ecosystem, the  impact of soil Science to the development of Ghana's agriculture is that it provides suitable conditions for root germination and growth.

Ecosystem is defined as a system which consists of all living organisms and the physical components with which the living beings interact. The abiotic and biotic components are linked to each other through nutrient cycles and flow of energy.

Energy enters the system through the process of photosynthesis .Animals play an important role in transfer of energy as they feed on each other.As a result of this transfer of matter and energy takes place through the system .Living organisms also influence the quantity of biomass present.By decomposition of dead plants and animals by microbes nutrients are released back in to the soil.

Learn more about ecosystem,here:

https://brainly.com/question/1673533

#SPJ9

​

Answer:

D. [HCHO₂] > [NaCHO₂]

Explanation:

Formic acid, HCHO₂, is a weak acid that, in presence of its conjugate base, NaCHO₂ (CHO₂⁻), produce a buffer following H-H equation:

pH = pKa + log [CHO₂⁻] / [HCHO₂]

As pKa of the acid is 3.74 and pH of the solution is 3.11:

3.11 = 3.74 + log [CHO₂⁻] / [HCHO₂]

-0.63 = log [CHO₂⁻] / [HCHO₂]

0.2344 = [CHO₂⁻] / [HCHO₂]

A ratio [CHO₂⁻] / [HCHO₂] < 1, means:

Answer:

B and D could be true

Explanation:

A volume of sodium hydroxide less than expected could occurs for two reasons:

The real concentration of sodium hydroxide was higher than expected or the amount of vinegar added was less than expected:

A. The sodium hydroxide solution had been allowed to stand exposed to the air for a long time prior to the titration.  FALSE. A long expose  to the air decreases concentration of the NaOH.

B. The volumetric flask used to prepare the diluted vinegar solution was rinsed with water prior to use.  TRUE. You add a less amount of vinegar doing you require less amount of NaOH than expected.

C. The burette used to deliver the sodium hydroxide solution was rinsed with water prior to use.  FALSE. Thus, you add a less amount of NaOH than expected. To explain the matter, you add more NaOH than expected.

D. The pipette used to deliver the vinegar solution was rinsed with water prior to use. TRUE. Again, you are adding a less amount of Vinegar than expected doing the necessary NaOH during titration less than expected

The reaction order and specific reaction rate constant can be determined by performing the kinetics experiment on irreversible polymerization A. Kinetic experiments can be used to investigate the rate and mechanism of chemical reactions. Chemical kinetics is the study of chemical reactions' speed and pathway.

For such more question on polymerization

https://brainly.com/question/1602388

#SPJ8