An electron is released from rest in a uniform electric field of magnitude 2.0×10 4
N/C. Calculate the acceleration of the electron. ( Ignore gravitation.)

Answer:

48 g C

Explanation:

To find the grams, you need to (1) convert atoms to moles (using Avogadro's Number) and then (2) convert moles to grams (using atomic mass). It is important to arrange the conversions in a way that allows for the cancellation of units. The final answer should have 2 sig figs to match the sig figs of the given value.

Avogadro's Number:

6.022 x 10²³ atoms = 1 mole

Atomic Mass (C): 12.011 g/mol

2.4 x 10²⁴ atoms C                   1 mole                       12.011 g
-----------------------------  x  --------------------------------  x  ---------------  =  48 g C
                                         6.022 x 10²³ atoms           1 mole

Explanation:

i am not sure but i think is C

The data collected by Leah and Paul supports Paul's opinion that matter can exist even when it is not visible.

Support is a term used to describe a range of services and resources offered to individuals in need. It can refer to providing help with practical tasks, such as helping someone to manage their finances or providing transport to medical appointments. It can also refer to providing emotional or social support. This could involve providing counselling or having regular conversations to help someone to feel understood and supported. Support can also refer to offering advice and guidance, or providing a safe space for someone to talk and express their feelings. In its broadest sense, support is about helping someone to have the best quality of life they can.

This is because the mass of the inflated bag is greater than the mass of the empty bag despite the fact that the volume of the inflated bag is much greater. This shows that the inflated bag contains air, which is matter, even though it cannot be seen.

To learn more about support
https://brainly.com/question/23849325
#SPJ1

The SI unit to the quantity it measures are:

Mass: The mass of an object is a measure of its amount of matter. The SI unit of mass is the kilogram (kg) or gram (g).

Temperature: Temperature is a measure of the average kinetic energy of the particles in a substance. The SI unit of temperature is the kelvin (K).

Time: Time is a measure of the interval between two events. The SI unit of time is the second (s).

Electric current: Electric current is a measure of the flow of electric charge. The SI unit of electric current is the ampere (A).

Find out more on SI unit here: https://brainly.com/question/16393390

#SPJ1

Complete question:

Drag the tiles to the correct boxes to complete the pairs. Not all tiles will be used.

Match each SI unit to the quantity it measures.

Their Net profit is  $75,000.

Net profits is synonymous with profit since it represents the final measure of profitability for an employer. internet profits are also referred to as internet income because it represents the net quantity of earnings closing in any case prices and charges are subtracted from sales.

Gross profit is the income this is left after production charges have been subtracted from revenue and help investors determine how an awful lot income a company earns from the production and sale of its products. by using evaluation, net income, or net earnings, is the income this is left in any case costs and fees had been removed from sales. It allows displaying of an organization's average profitability, which displays the effectiveness of an enterprise's management.

received amount of past month =  $300,000

Operating cost = $125,000

Gross profit = $200,000

Therefore, net profit = $200,000 - $125,000

                                  =   $75,000

Learn more about Gross profit here:-https://brainly.com/question/21637154

#SPJ9

Answer:

cells come from pre existing cells

Answer:

protons are red neutrons are green electrons are yellow

Explanation:

TIE FIGHTERS GO ZOOOOOM

Answer:

i believe sand and gravel because you can sift the sand

Explanation:

Chlorofluorocarbons (CFCs) are man-made chemicals containing chlorine and fluorine that cause ozone molecules to break down. Thus, option B is the answer.

Chlorofluorocarbons are non-toxic, synthetic compounds that contain atoms of Chlorine, Fluorine and Carbon. They are commonly used in the manufacture of aerosol sprays and are also used as solvents and refrigerants. CFCs were first introduced in 1928 by General Motors Company for its refrigerators.

While CFCs are very safe to use in most applications and are stable in the lower atmosphere, these chemicals when released to the upper atmosphere can cause significant reactions. CFCs when released into the upper atmosphere can lead to the destruction of the ozone molecules followed by the release of the UV radiation into the atmosphere.

Thus, CFCs are man-made chemicals which cause ozone molecules to break down.

Learn more Chlorofluorocarbons, here:

https://brainly.com/question/1393491

Answer: hydrogen gas

Explanation: When magnesium interacts with water, it will form a hydrogen gas that ignites violently due to the excessive heat and oxygen supply.

Answer: 1.3 L

Explanation:

Molarity of a solution is defined as the number of moles of solute dissolved per liter of the solution.

To calculate the volume for given molarity, we use the equation:

\(\text{Molarity of the solution}=\frac{\text{moles of solute}}{\text{Volume of solution in L}}\)

\(6.8M=\frac{8.6mol}{\text{Volume of solution in L}}\)

\(\text{Volume of solution in L}=1.3\)

Thus the volume in Liters is 1.3

Answer:

Idek sorry

Explanation:

So sorry i think its 1.00

Answer:

Paired electrons are the electrons in an atom that occur in an orbital as pairs.

⇒paired electrons always occur as a couple of electrons

unpaired electrons are the electrons in an atom that occur in an orbital alone.

⇒unpaired electrons occur as single electrons in the orbital.

Answer:

Paired electrons are the electrons in an atom that occur in an orbital as pairs whereas unpaired electrons are the electrons in an atom that occur in an orbital alone. Therefore, paired electrons always occur as a couple of electrons while unpaired electrons occur as single electrons in the orbital.

Hope this helps :)

Pls brainliest...

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Complete question is;

An excess of aluminum foil is allowed to react with 225 ml of an aqueous solution of HCl (d=1.088 g/ml) that contains 18% HCl by mass. what mass of H2(g) is produced?

Answer:

1.218 g

Explanation:

We are given d_HCL = 1.088 g/ml

Converting to g/L gives;

d = 1.088 × 1000 = 1088 g/L

Now, we are told the solution contains 18% HCl by mass.

Thus;

d = 1088 × 18%

d = 195.84 g/L

Now, molar mass of HCl is 36.46 g/mol

Thus, molar concentration is;

M = 195.84/36.46

M = 5.37 mol/L

We are told the volume of HCl used was 225 ml or 0.225 L

Thus, number of moles used is;

n = 5.37 × 0.225

n = 1.208

The balanced reaction equation of the aluminum foil and HCl is;

2Al + 3HCl = 2AlCl3 + 3H2

Number of moles of H2 produced will be; n1 = 1.208/2 = 0.604 moles

Molar mass of H2 is 2.016 g/mol

Thus, mass of H2 produced = 0.604 × 2.016 = 1.218 g

0.11M is the concentration of a solution made by dissolving 6.5 g of CaCl\(_2\) in 0.50L of water

Concentration in chemistry is calculated by dividing a constituent's abundance by the mixture's total volume. Mass concentration, concentration in moles, numerical concentration, & volume concentration are four different categories of mathematical description.

Any type of chemical mixture can be referred to by the term "concentration," however solvents and solutes in solutions are most usually mentioned. There are different types of molar (quantity) concentration, including normal concentration or osmotic concentration.

Molarity = number of moles/ volume of solution in liter

number of moles = 6.5/ 110.9= 0.05moles

Molarity =0.05/0.50=0.11M

To know more about Concentration, here:

https://brainly.com/question/20461287

#SPJ1

Answer:

Density of the sample in Kg/L is 8kg/L.

Explanation:

we know that density of a substance can be calculated if we know the mass and volume of the substance.

In this case mass, (M) = 320 g

and Volume (V) = 40 ml

we know that density (ρ) = \(\frac{Mass}{Volume}\) = \(\frac{320}{40}\) g/ml = 8 g/ml

We also know that 1kg = 1000g and 1litre = 1000ml

so to convert g/ml to kg/l

ρ = (8 × \(\frac{1000}{1000} \fra\) )Kg/L = 8 Kg/L

To know more:

https://brainly.com/question/21667661

The acceleration of the car is -2.3m/s².

Acceleration is the rate at which the direction and speed of motion change over time. It is said to have been accelerated when something changes its direction and moves faster or slower. Motion on a circle accelerates even when the speed is constant because the direction is constantly changing.

Velocity is the rate at which displacement changes. The rate at which speed changes is known as acceleration. Because it consists of both magnitude and direction, velocity is a vector quantity. Since acceleration is merely the rate at which velocity changes, it too is a vector quantity.

v = u +at

0 = 35 + a×15

15a = -35

a = -35/15

a = -2.3m/s².

To know more about acceleration visit:

https://brainly.com/question/12550364

#SPJ1

Answer:

B. -2.3 m/s²

Explanation:

To answer this question, we have to use the following formula:
\(\boxed{a = \frac{v - u}{t}}\),

where:

• a ⇒ acceleration

• v ⇒ final velocity

• u ⇒ initial velocity

• t ⇒ time taken for the change in velocity to occur

From the question, we know that initially, the car was travelling at 35 km/h. Therefore, u = 35 km/h. The question also tells us that the car comes to a full stop, meaning its final velocity is 0 m/s. Therefore, v = 0 km/h. It takes the car 15 seconds to stop, so t = 15 s.

Using the information above and substituting it into the formula, we can calculate the acceleration of the car:

\(a = \frac{0 - 35}{15}\)

  = -2.3 m/s²

Therefore, the acceleration of the car is -2.3 m/s², and the correct answer is B.

The compound C4H6O4 can be classified as a dicarboxylic acid. In this case, the presence of four carbon atoms (C4) indicates that it is a relatively larger molecule.

The molecular formula also contains six hydrogen atoms (H6) and four oxygen atoms (O4). The presence of oxygen and carbon atoms suggests the possibility of carboxyl groups (-COOH) in the compound. Carboxyl groups are functional groups consisting of a carbonyl group (C=O) and a hydroxyl group (-OH) attached to the same carbon atom.

Since the compound contains four oxygen atoms, it is possible that it contains two carboxyl groups. A compound with two carboxyl groups is classified as a dicarboxylic acid. Dicarboxylic acids are organic compounds that have two carboxyl functional groups.

They are characterized by their ability to donate two protons (H+) and act as acids. Therefore, based on the molecular formula C4H6O4, the compound is classified as a dicarboxylic acid.

For more such questions on compound

https://brainly.com/question/15929599

#SPJ11

Answer:

I dont understand what the question means

Explanation:

Answer: 380 J. Please mark

Explanation:

What happens to an organism if an organ or organ system does not function properly?

All of the organ systems of the body work together to maintain homeostasis of the organism. If homeostasis fails, death or disease may result.

Why do organisms forget some things and remember others?

The main reason is that in order for us to store information and remember it, our senses have to capture them perfectly.

How are some organisms able to survive as single cells while other types of organisms have multiple body systems each made of many cells?

The one cell can do it all.

Why do some animals have a heightened sense such as sight or smell?

All aspects of an animal's senses, from the structure of its sensory organs to the numbers of receptor cells and the behaviour of its brain, are ultimately derived from its genes. It's the genes that decide how well an animal can smell, see, hear or taste.

Do organisms instinctively know how to respond to the environment, or do they have to learn how to respond?

All animals, including humans, have instinctual behavior, but animals can't survive on their instincts alone. Animals need to be able to respond to their environment to survive. ... This process of modifying behavior based on experience is called learning.

hopefully this helped! :)

The initial temperature of water can be calculated from the heat energy using calorimetric equation. The initial temperature is obtained as 18.65 °C.

Calorimetry is an analytical tool used to determine the heat energy absorbed or released in a chemical reaction. The heat  energy q, mass of the substance m and the specific heat capacity c with a temperature difference ΔT is written as follows:

q = m c ΔT.

Here, the heat energy required for raising the temparture of 125 g of waater to 45 °C is 13750 joules . Then, the initial temperature be x, then x can be calculated as follows:

13750 J  = 125 g × 4.18 J/g °C × (45 - x °C)

     x =   45 -  [ 13750 J / (125 g × 4.18 J/g °C) ]

        = 18. 65 °C.

Therefore, the initial temperature was 18. 65 °C.

To find more on calorimetry, refer here:

https://brainly.com/question/11477213

#SPJ1

Explanation:

Hope this somewhat helped:

a. The equation for the reaction of weak acid, C6H5CO2H, with water is: C6H5CO2H + H2O <=> C6H5CO2^- + H3O^+. We can assume that all the C6H5CO2H has reacted with water to form C6H5CO2^- and H3O^+.

The pH is defined as -log(H30^+ concentration), where H30^+ is the hydronium ion, a measure of the acidic strength of the solution. At the equivalence point, all the C6H5CO2H has reacted with the NaOH to form C6H5CO2^- and Na^+. The stoichiometry of the reaction can be determined by balanced the reaction using the information given.

C6H5CO2H + NaOH <=> C6H5CO2^- + Na^+

This reaction tells us that one mole of C6H5CO2H will react with one mole of NaOH to form one mole of C6H5CO2^- and one mole of Na^+.

Following is the classification of given substances:

Atomic element: Ag

Molecular element: F₂

Molecular compound: CO

Ionic compound: PbI₄

Molecules, groups of two or more atoms that form the smallest identifiable unit that can divide a pure substance and that retain the composition and chemical properties of that substance.

An atom consists of a single positively charged nucleus surrounded by a cloud of negatively charged electrons. As the atoms approach, the electron clouds interact with each other and with the nucleus. This interaction causes atoms to combine to form molecules when the energy of the entire system is reduced. From a structural point of view, a molecule consists of a collection of atoms joined by valences. A diatomic molecule contains two atoms chemically bonded together. When two atoms are identical, like oxygen (O2) molecules, they form a homonuclear diatomic molecule, but when the atoms are different, like carbon monoxide (CO) molecules, they are heteronuclear. Forms a diatomic molecule. Molecules containing two or more atoms are called polyatomic molecules. B. Carbon dioxide (CO2) and water (H2O). A polymer molecule can contain thousands of constituent atoms.

To know more about molecules, visit:

https://brainly.com/question/28069497

#SPJ1

The word "symptom" refers to a specific manifestation or indication of a condition, disease, or disorder that is experienced or observed by an individual.

Symptoms are subjective or objective changes in the body's normal functioning that may be recognized as abnormal, uncomfortable, or problematic. Symptoms can manifest in various ways depending on the nature of the underlying condition. They can be physical, such as pain, rash, cough, fever, or fatigue, indicating an illness or injury affecting the body. Symptoms can also be psychological, such as anxiety, depression, or confusion, reflecting disturbances in mental health.

Symptoms serve as important clues for medical professionals to identify and diagnose diseases or disorders. They provide valuable information about the nature, severity, and progression of an illness, helping healthcare providers formulate appropriate treatment plans. Additionally, symptoms may also be important for individuals to self-assess their own health status and seek appropriate medical attention.

It is essential to note that symptoms alone may not provide a definitive diagnosis, as they can overlap across different conditions. Further evaluation, including medical tests and examinations, is often necessary to confirm a diagnosis and determine the appropriate course of action.

for more such questions on symptom

https://brainly.com/question/21078887

#SPJ8

The river will deposit sediment along the inside of a bend in the river. This deposition causes the inside of the curve to become shallower and move farther inward.

Rivers flowing over gently sloping ground begin to curve back and forth across the landscape. These are called meandering rivers.

Meandering rivers erode sediment Larry from the outer curve of each meander bend and deposit it on an inner curve further down stream.

This causes individual meanders to grow larger and larger over time.

Meandering river channels are asymmetrical. The deepest part of the channel is on the outside of each bend. The water flows faster in these deeper sections and erodes material from the river bank.

The water flows more slowly in the shallow areas near the inside of each bend. The slower water can't carry as much sediment and deposits its load on a series of point bars.

Thus  the settling of sediment will make the stream steeper.

To know more about Meandering Rivers

https://brainly.com/question/7560368

#SPJ1

Answer:

The river will deposit sediment along the inside of a bend in the river. The deposition causes the inside of the curve to become shallower and move farther inward.

Explanation:

Edmentum

Answer:

SI-28

Explanation:

One of five fundamental types can be applied to a wide variety of chemical processes.To accurately forecast the byproducts of an unknown reaction, a detailed grasp of various kinds of reactions is helpful.

To learn more about chemical reactions refer

https://brainly.com/question/11231920

#SPJ1