Answer:
water
Explanation:
In chemistry, an important principle that guides the solubility of a solute in a solvent is the principle of like dissolves like.
A polar solvent will dissolve a polar solute and a non-polar solvent will dissolve a non polar solute.
Ethyl acetate is a polar solute. It will have to dissolve in water which is a polar solvent. Hence, ethyl acetate will dissolve in the water layer.
what is the name of proper organic molecules.?
Carbohydrates, lipids, proteins, and nucleic acids are the 4 types of organic molecules.
What is the name of organic molecules?The simplest organic compounds are hydrocarbons, which carry only carbon and hydrogen. Alkanes contain hardly carbon–hydrogen and carbon–carbon single bonds, alkenes hold at least one carbon–carbon double bond, and alkynes contain molecules with one or more carbon–carbon triple bonds.
Four main classes of organic molecules—carbohydrates, lipids, proteins, and nucleic acids—are debated in the following sections. Examples of organic molecules are hydrocarbons, aliphatic amalgam, aromatic and alicyclic compounds, polymers, biomolecules, and buckyballs. collate inorganic molecules.
So we can conclude that organic compounds are carbohydrates, fats (lipids), proteins, and nucleic acids.
Learn more about organic molecules here: https://brainly.com/question/26556885
#SPJ1
The following two organic compounds are structural isomers to each other. Carefully identify and justify the structural isomers type (skeletal, functional, or positional) with their common molecular formula
Structural isomers are molecules with the same molecular formula but with different structural formulae. This means that they have the same number and types of atoms, but they are arranged differently. The following two organic compounds are structural isomers of each other.
Carefully identify and justify the structural isomers type (skeletal, functional, or positional) with their common molecular formula.Common molecular formula: C6H14Structural isomers:(i) Hexane: Hexane is a straight-chain alkane with six carbon atoms and no double bonds or rings. The carbon atoms are linked together in a linear or straight-chain configuration in the skeletal isomer. The skeletal isomer differs in terms of the arrangement of atoms in its molecule. This indicates that it is a skeletal isomer.(ii) 2-methylpentane: It is a branched-chain alkane with six carbon atoms and no double bonds or rings. It differs from the first molecule in terms of the location of a methyl group on the second carbon of the five-carbon chain, rather than a straight six-carbon chain. This difference is due to a change in the positioning of the carbon atoms in the molecule. As a result, it is a positional isomer, as it differs by the position of the functional group or substituent. Therefore, the skeletal and positional isomerism types are present between these two compounds.For such more question on molecular
https://brainly.com/question/24191825
#SPJ8
What kind of questions CANNOT be answered by chemistry?
Answer:
Why does matter exist?
Explanation:
why do each of the elements react differently?
How many moles of Aluminum are in 54.0 grams of Aluminum (Al)
Answer:
2 moles!
Explanation:
Hi i hope this helped! I researched it and 2 moles was what came up first.
what are the elements in group 5 in the periodic table
Answer:
Vanadium (V), Niobium (Niobium), Tantalum (Ta), Dubnium (Db), Cerium (Ce), and Thorium (Th)
Explanation:
Groups go vertical (up and down) on the periodic table.
Periods go horizontal (left to right) on the period table.
Write the complete group state electron configuration of Ag
The electronic configuration of periodic elements shows the total number of the electrons arranged in the atomic orbital of the element. Let us see electronic configuration of Ag.
Electronic configuration of Ag is given as
1s2 2s22p6 3s2 3p6 3d10 4s2 4p6 4d10 5s1
Silver is the transition metal atom and its symbol is Ag. It is 47th periodic table element, meaning the 47 electrons are present in their atomic orbital.
All electrons are arranged in the different orbits of an atom according to the Bohr or Aufbau principle. We can know the various facts of Ag electronic configuration like Ag electronic configuration notation, unabbreviated electronic configuration, and ground state excited state of Ag.
To know more about electronic configuration, please refer:
https://brainly.com/question/26084288
#SPJ1
Identify the type of reaction and predict the product: Calcium + water -->
Answer:
Exothermic Reaction
Product = Calcium hydroxide + hydrogen
Explanation:
A compound containing phosphorus and oxygen has a molar mass of 157.9 g/mol and an empirical formula of PO3 .
Answer: The molecular formula of the compound is \(P_2O_6\)
Explanation:
The molecular formula is the chemical formula that tells about the number of atoms of each element present in a compound. Molecular formula and empirical formula can also be the same when the number of atoms is in the simplest whole-number ratio.
To calculate the molecular formula, the number of atoms of the empirical formula is multiplied by a factor known as valency that is represented by the symbol, 'n'.
\(n=\frac{\text{Molecular mass}}{\text{Empirical mass}}\) ...(1)
Given empirical formula is \(PO_3\)
Empirical mass = \([(1\times 30.97) + (3\times 15.99)]=78.94 g/mol\)
Molecular mass = 157.9 g/mol
Plugging values in equation 1:
\(n=\frac{157.9 g/mol}{78.94g/mol}\\\\n=2\)
Molecular formula of the compound becomes \(P_{2\times 1}O_{2\times 3}=P_2O_6\)
Hence, the molecular formula of the compound is \(P_2O_6\)
Density of gold is 19.3g/cm^3 what is the density in lbs/in^3 units
The density in lbs/in³ units : 0.697
Further explanationGiven
Density of gold is 19.3 g/cm³
Required
Conversion to lbs/in³
Solution
Density is a quantity derived from the mass and volume
Density is the ratio of mass per unit volume
Density formula:
\(\large {\boxed {\bold {\rho ~ = ~ \frac {m} {V}}}}\)
Conversion factor
1 g = 0,00220462 lbs
1 cm³ = 0,0610237 in³
So the density :
\(\tt 19.3~\dfrac{g}{1~cm^3}\times \dfrac{cm^3}{0.0610237~in^3}\times \dfrac{0.00220462~lbs}{1~g}=0.697~lbs/in^3\)
Consider the following system at equilibrium: N2(g) + 3 H2(g) 2 NH3(g) + heat After reaching equilibrium, an engineer suggests increasing the heat to speed up the reaction to get more product. Will the engineer's suggestion work? Answer using a CER response format. Be sure to include evidence from the equation and apply Le Chatelier's Principle in your explanation.
The engineer's suggestion will not work because according to the Le Chatelier's Principle, the reaction will be favored in the condition that if lower the temperature.
The reaction is as :
N₂(g) + 3 H₂(g) ⇄ 2 NH₃(g) + heat
The forward reaction is the exothermic reaction. According to the Le Chatelier's Principle, the reaction will be favored in the condition that if lower the temperature. At the very low temperature it will create the reaction that is to occur at the very slowly and therefore, it is not the efficient.
At the low temperature and the high pressure the reaction favored the forward reaction.
To learn more about Le Chatelier's Principle here
https://brainly.com/question/29009512
#SPJ1
In a thin layer chromatography experiment, a plate of length 9.3 cm was used and a horizontal line was made at 1.45 cm above the bottom of the plate. After running the experiment (developing and drying), a spot was observed at 5.6 cm from the bottom of the plate, and the solvent front was 7.7 cm from the bottom of the plate. What is the Rf value
Answer: The \(R_f\) value is 0.664
Explanation:
Distance travelled by solvent front = (7.7-1.45)cm = 6.25 cm
Distance travelled by unknown = (5.6-1.45) cm = 4.15 cm
The retention factor or the \(R_f\) value is defined as the ratio of distance traveled by the unknown to the distance traveled by the solvent front.
\(R_f=\frac{\text {distance travelled by unknown}}{\text {distance travelled by solvent}}\)
\(R_f=\frac{4.15}{6.25}=0.664\)
Thus the \(R_f\) value is 0.664
How many milliliters of a 0.1800 M solution of KOH will be required to titrate 44.00 mL of a 0.0683 M solution of H3PO4?
What do we need to know to understand the formation of a chemical bond?
Answer:
A chemical bond is a lasting attraction between atoms, ions or molecules that enables the formation of chemical compounds. The bond may result from the electrostatic force of attraction between oppositely charged ions as in ionic bonds or through the sharing of electrons as in covalent bonds.
Explanation:
You have to put energy into a molecule to break its chemical bonds. The amount needed is called the bond energy. After all, molecules don't spontaneously break
what agricultural is practiced in or near San Diego? Choose a food that is grown or produced locally. Describe the food,Where and when is the food produced and how? What is a recipe that uses this food? What does this food make you wonder about the agriculture in or near San Diego?
please help!!
Answer:
San Diego boasts top crops in nursery, flowers, avocados, tomatoes, citrus, chickens & eggs, shrooms, succulents, strawberries, coffee & cannabis. Most of San Diego County farms are small 1-9 acre proprieties, and that awards San Diego County more certified organic growers than any other county in the nation.
Calculate the cell potential, Ecell, for the following reaction at 298k.
Co(s)+2Ag+(0.010M)=Co+2(0.015M)+2 Ag(s)
To calculate the cell potential, Ecell, for the given reaction at 298K, we need to use the Nernst equation. The Nernst equation relates the cell potential to the standard cell potential, temperature, and the concentrations of the reactants and products. The Nernst equation is given as follows:
Ecell = E°cell - (RT/nF) ln(Q)
where,
Ecell = cell potential
E°cell = standard cell potential
R = gas constant (8.314 J/K.mol)
T = temperature (298 K)
n = number of electrons transferred in the balanced redox reaction
F = Faraday constant (96,485 C/mol)
Q = reaction quotient
The given reaction is a redox reaction, which involves the transfer of two electrons from Co to Ag+. The balanced half-reactions are as follows:
Co(s) → Co2+(aq) + 2 e-
Ag+(aq) + e- → Ag(s)
The standard reduction potentials for these half-reactions are:
Co2+(aq) + 2 e- → Co(s) E°red = -0.28 V
Ag+(aq) + e- → Ag(s) E°red = +0.80 V
The overall standard cell potential can be calculated by subtracting the standard reduction potential of the anode from that of the cathode:
E°cell = E°red,cathode - E°red,anode
= +0.80 V - (-0.28 V)
= +1.08 V
Now we need to calculate the reaction quotient Q using the concentrations of the reactants and products. According to the given information, [Ag+] = 0.010 M and [Co2+] = 0.015 M.
Q = ([Co2+][Ag+]^2)/([Ag+]^2)
= ([0.015][0.010]^2)/([0.010]^2)
= 0.015 M
Substituting the values in the Nernst equation, we get:
Ecell = E°cell - (RT/nF) ln(Q)
= 1.08 - (8.314 x 298 / (2 x 96485)) ln(0.015)
= 0.829 V
Therefore, the cell potential, Ecell, for the given reaction at 298K is 0.829 V.
The number of I atoms in the reactants is greater than the number in the product : True or False
There are 4 atoms of F in both the reactants and the products. True or False
The illustration represents a valid chemical transformation. True or false
Explanation:
We can summarize the reaction shown as:
2F₂ + I₂ → 2F₃I
Since I is purple
F is the green
The number of I atoms in the reactants is greater than the number in the product
False:
The number of I atoms on both side of the expression is 2
There are 4 atoms of F in both the reactants and the products.
False:
There are 4 atoms of F on the reactant side and 6 atoms of F on the product side
The illustration represents a valid chemical transformation. True or false
False
The reaction does not represent a valid chemical transformation because in a valid chemical transformation, the number of atoms on both sides of the expression must be the same.
You are given a sample of several compounds to separate by paper chromatography. You draw a pencil line exactly 1.00 cm from the bottom of the paper, and place a spot of sample on it. You dry the sample, then develop it in a solvent. When the chromatogram is taken out of the solvent, the paper is wet up to 9.2 cm from the bottom of the sheet. The compound you are interested in shows up as a spot 7.1 cm from the bottom of the paper. Calculate the following:
a. How far did the compound move?
b. In the same time, how far did the solvent move?
c. What is the Rf factor for the compound?
Answer:
a) 6.3 cm
b) 8.0 cm
c) 0.7875
Explanation:
(a) The compound has moved above upto 7.3 cm from the bottom of the paper. Let us assume that line is drawn at 1.0 cm mark as the origin of spot. \
Distance traversed by compound= 7.3 - 1.0 cm = 6.3 cm
(b) Distance traversed by the solvent = 9.0 - 1.0 cm = 8.0 cm
(c) The Rf = Compound Migration distance / Solvent front migration distance
= 6.3/8.0 = 0.7875
Can someone help me with this pls
Answer:
i think the correct answer is A
C2H6O + 3 O2 → 2 CO2 + 3 H2O
How many moles of CO2 is produced with 8.5 g of O2
0.32 mol
5.7 mol
0.53 mol
0.18 mol
The number of moles of CO₂ produced from the reaction of 8.5 g of oxygen gas, O₂ is 0.18 mole (last option)
How do i determine the number of mole of CO₂ produced?We shall begin by obtaining the mole in 8.5 g of oxygen gas, O₂. Details below:
Mass of oxygen gas, O₂ = 8.5 grams Molar mass of oxygen gas, O₂ = 32 g/mol Mole of oxygen gas, O₂ =?Mole = mass / molar mass
Mole of oxygen gas, O₂ = 8.5 / 32
Mole of oxygen gas, O₂ = 0.266 mole
Finally, we shall determine the number of mole of CO₂ produced. Details below:
C₂H₆O + 3O₂ -> 2CO₂ + 3H₂O
From the balanced equation above,
3 moles of O₂ reacted to produce 2 moles of CO₂
Therefore,
0.266 mole of O₂ will react to produce = (0.266 × 2) / 3 = 0.18 mole of CO₂
Thus, the number of mole of CO₂ produced is 0.18 mole (last option)
Learn more about number of mole:
https://brainly.com/question/13375719
#SPJ1
the mass of a gas molecule (or atom) can be computed from the specific heat at constant volume cv. given that the specific heat of argon is cv
The mass of a gas molecule (or atom) can be computed from the specific heat at constant volume . The mass of the gas is 6.6 × 10⁻²³ kg. The molar mass of the is 39.74 g/mol
The specific heat at constant volume, cv = 0.075 cal/g °C.
Cv = ( 3/2) R = ( 3/2) ( 1.98) = 2.98 cal /mol K
The molar mass, M = m / n = Cv / cv
= 2.9805/0.075
=39.74 g/mol
The mass = molar mass / Na
The mass = 38.74 / 6.023 × 10²³
The mass = 6.6 × 10⁻²³ kg
This question is incomplete, the complete question is :
The mass of a gas molecule (or atom) can be computed from the specific heat at constant volume cv. given that the specific heat of argon is cv is 0.075 cal/g °C for a gas and calculate (a) the mass of its atom and (b) the molar mass.
To learn more about specific heat here
https://brainly.com/question/13304516
#SPJ4
using the ideal gas law, PV = nRT, in which R is 8.31 (L•kPa/mol-K), what would the temperature be if 0.75 moles of helium gas in a 2.0 L container have a pressure of 202.65 kPa
Answer:
65.0 K
Explanation:
To find the temperature, you need to use the Ideal Gas Law:
PV = nRT
In this equation,
-----> P = pressure (pKa)
-----> V = volume (L)
-----> n = moles
-----> R = Ideal Gas Constant (8.31 L*kPa/mol*K)
-----> T = temperature (K)
You can plug the given values into the equation and simplify to find the temperature.
P = 202.65 pKa R = 8.31 L*kPa/mol*K
V = 2.0 L T = ? K
n = 0.75 moles
PV = nRT
(202.65 pKa)(2.0 L) = (0.75 moles)(8.31 L*kPa/mol*K)T
405.3 = (6.2325)T
65.0 K = T
What ara the differences between the homolytic and heterolytic bond dissociation ? And why homolytic dissociation energy of H-H (104 KJ/mol) is lower than its heterolytic bond dissociation energy (401 KJ/mol)?
Answer:
Following are the difference in homolytic and hetrolytic bond dissociation.
Homolytic dissociation is referred as the amount of energy released during homolytic fission. Homolytic fission is known as the dissociation of chemical bond in two equal fragmentswhereas, Hetrolytic dissociation is referred as the amount of energy released during Hetrolytic fission. Hetrolytic fission is known as the dissociation of chemical bond in two unequal fragments.Homolytic fission gives one electron each to its fragments whereas Hetrolytic fissiongives two electron to one fragment and zero electron to other fragment.Energy released during Homolytic fission is lower than the Hetrolytic fission as the electron distribution to its fragments is uniform in homolytic whereas electron distribution to its fragments is uniform in hetrolytic fission.
Thus bonds form in hetrolytic fission is more stronger than the the bonds formed in homolytic fission.
Hence, more energy is required to break the bonds of hetrolytic fission as compared to homolytic fission
Thus, homolytic dissociation energy of H-H (104 KJ/mol) is lower than its heterolytic bond dissociation energy (401 KJ/mol)
A student applies a force to a box with a mass of 30 kg. If the student applies the same force to a box with a mass of 15 kg, which best describes the effect on the acceleration of the 15-kg box?
The effect on the acceleration of the 15-kg box would be that it would experience a greater acceleration than the 30-kg box.
Newton's second lawAccording to Newton's second law of motion, the acceleration of an object is directly proportional to the net force acting on it and inversely proportional to its mass. Therefore, for a given force, an object with a smaller mass will experience a greater acceleration than an object with a larger mass.
In this scenario, if the student applies the same force to both the 30-kg box and the 15-kg box, the 15-kg box will experience a greater acceleration than the 30-kg box. This is because the smaller mass of the 15-kg box means that it has less inertia and requires less force to accelerate.
Therefore, the effect on the acceleration of the 15-kg box would be that it would experience a greater acceleration than the 30-kg box.
Learn more on Newton's laws of motion here https://brainly.com/question/7578203
#SPJ1
those questions in pictures
For this section:
The acids that would be completely dissociated when dissolved in water are A, (H O)₂SO and B, (H O)IO₃.(i) pH of 7(ii) pH of 4.763I₂ + 2PBr₃ → 6IBr + P₂4LiH + GaCl₃ → 4LiCl + GaH₃NH₃ + BCl₃ → NH₃BCl₃How to determine pH and products?(d) To determine which acid would be completely dissociated when dissolved in water, consider the strength of the acid and its ability to ionize completely. Strong acids are those that ionize completely in water, while weak acids only partially dissociate.
Among the given options:
(H O)₂SO is sulfuric acid (H₂SO₄), which is a strong acid and completely dissociates in water.
(H O)IO₃ is iodic acid (HIO₃), which is also a strong acid and completely dissociates in water.
(H O)₂SO₂ is not a known acid and cannot be evaluated for dissociation.
HCO₂H is formic acid (HCOOH), which is a weak acid and only partially dissociates in water.
Therefore, the acids that would be completely dissociated when dissolved in water are (H O)₂SO and (H O)IO₃.
(e) To estimate the pH of the given solutions formed by titration, compare the moles of the acid and base used in the reaction.
(i) For the titration of 25.0 mL of 0.10 M aqueous NaOH with 25.0 mL of 0.10 M aqueous HCl, the reaction between a strong acid (HCl) and a strong base (NaOH) forms a neutral salt (NaCl) and water. The resulting solution would have a pH of 7, indicating neutrality.
(ii) For the titration of 25.0 mL of 0.10 M aqueous NaOH with 25.0 mL of 0.10 M aqueous acetic acid, consider the ionization of acetic acid and the formation of its conjugate base. The pKa of acetic acid is given as 4.76.
Since the volumes and concentrations of the acid and base are equal, we have a 1:1 mole ratio between them. This means that half of the acetic acid will be neutralized, and the remaining half will be in the form of the conjugate base (acetate ion, CH₃COO-). The resulting solution will be a buffer solution with a pH close to the pKa of acetic acid, which is 4.76.
(f) To predict the products formed from mixing the given reagents, we need to consider the reactions and the possible chemical reactions that occur.
(i) 3I₂ + PBr₃: This reaction involves the combination of iodine (I₂) with phosphorus tribromide (PBr₃). The balanced equation is:
3I₂ + 2PBr₃ → 6IBr + P₂
(ii) 4LiH + GaCl₃: This reaction involves the combination of lithium hydride (LiH) with gallium trichloride (GaCl₃). The balanced equation is:
4LiH + GaCl₃ → 4LiCl + GaH₃
(iii) NH₃ + BCl₃: This reaction involves the combination of ammonia (NH₃) with boron trichloride (BCl₃). The balanced equation is:
NH₃ + BCl₃ → NH₃BCl₃
Find out more on pH here: https://brainly.com/question/26424076
#SPJ1
Which among the given combinations below represent a set of isotopes?
1.40 protons and 40 neutrons
II. 41 protons and 39 neutrons
3.42 neutrons and 48 protons
4 40 protons and 42 neutrons
V. 41 protons and 40 neutrons
A. I, II, III
B. III, IV
C.1, IV and II, V
D. 1, V and II. V
E.1. V
Look for the ones with the same number of protons and different neutrons number
For the reaction
2NaOH+H2SO4⟶Na2SO4+2H2O
how many grams of sulfuric acid, H2SO4, are needed to react completely with 39.9 g of sodium hydroxide, NaOH?
Answer:
48.9 or 49.0 g of sulfuric acid
Explanation:
Check the box of the group that the compound is more likely to be part of??
If one of the elements is a metal and the other is a nonmetal, they will most likely form an ionic bond. Monatomic cations and anions make up these kinds of ionic compounds.
What increases an element's likelihood of bonding?The reactivity of an atom—or propensity to establish chemical interactions with other atoms—depends on the amount of electrons in its outermost shell.
Which elements are compounds, and how do you know?The number of protons in a particular atom, which is an element's smallest building block, is how an element is defined. A compound, on the other hand, is made up of different atoms, and the smallest component of a compound is a molecule.
To know more about ionic compounds visit:-
brainly.com/question/3222171
#SPJ1
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
what would be the observation when pineapple juice is dipped in a red litmus paper
Answer:
red litmus paper change into blue when it is dipped into Pineapple juice.
hope it helps
The red litmus paper will stay red when dipped in pineapple juice.
What are acids and bases?Acids are substances that can donate a proton to another substance. A base is a substance that can accept a hydrogen ion from an acid.
Acidic substances are often characterized by their sour taste. An acid commonly can be energetically favorable after a loss of H⁺ ion and is also known to turn blue litmus paper into red.
Bases are generally recognized for their bitter taste and slippery texture. A base that can dissolve in water is also referred to as alkali and is also known to turn red litmus paper into blue.
The pH value of the pineapple juice lies between 2.5 to 3.9. Therefore, it is acidic in nature as the pH of acidic substances lies in the range of 0 to 7. So the red litmus paper will stay red in pineapple juice.
Learn more about acids and bases, here:
brainly.com/question/3941445
#SPJ2