a solution with a ph of 4 has 100 times more h ions than a solution with a ph of 2. has 100 times fewer h ions than a solution with a ph of 2. has 100 times fewer h ions than a solution with a ph of 6. is basic.

Answer:

The second company job of $18 /hr is the better deal

Explanation:

We are told that;

-First job offers a salary of $30,000/yr

-Second job offers a salary of $18/hr.

Now, let's convert the salary of the second job to amount per year.

We are told that full-time work is 49hr/wk, 52 wk/yr.

Since we have 49 hrs in a week, then amount per week = 18 × 49 = $882 per week

Then amount per year = 882 × 52 = $45864 /yr

Thus, the second job pays $45864 /yr.

This is more than the first job. Thus, the second job is the better deal

Answer:

i don't know send on my insta I'd its_arsh_pb27

Explanation:

The comparison between the class barometer data and the air pressure shown in the weather report serves as a means to evaluate the accuracy and effectiveness of the barometer's measurements.

The comparison between the data from the class barometer and the air pressure shown in the weather report revealed a correlation between the two measurements. The class barometer readings were likely taken at the same time as the weather report's air pressure measurement to ensure accurate comparison.

If the class barometer readings closely matched the air pressure indicated in the weather report, it would suggest that the barometer was functioning correctly and providing reliable measurements. This would indicate that the class barometer could be used as a reliable tool for monitoring air pressure changes.

However, if there were significant discrepancies between the class barometer readings and the air pressure reported in the weather report, it could indicate a calibration issue with the barometer or potential inaccuracies in its measurements. In such a case, it would be necessary to investigate the reasons behind the discrepancies and determine the reliability of the class barometer for future use. It helps to determine the barometer's reliability as a tool for monitoring air pressure changes in the local environment.

For such more questions on weather

https://brainly.com/question/1352127

#SPJ8

A solution is defined as a mixture of two or more substances, usually, a solute and a solvent, and the difference between these two are in quantity, solute represents the smallest amount and solvent will represent the highest amount, and while you can have more than one solute, you can only have one solvent for a solution. Therefore the statement is true

Answer:

Potential Energy

Explanation:

Not sure how to explain it but C and D could be crossed off as answers, kinetic energy would be if it was released (?)

sorry if im wrong

The equation for the reaction between T and the ions of X can be represented as T + \(X^{2}\)- -> \(T^{2}\)+ + X.

Both T and X are in the same group of the periodic table, which means that they have the same number of valence electrons. As a result, they tend to react in similar ways, forming ionic compounds with other elements. The fact that hydrogen gas reduces the heated oxide of S but not the heated oxide of X can be attributed to the difference in the reactivity of these elements. S is more reactive than X, which means that it can be easily reduced by hydrogen gas.

On the other hand, X is less reactive, which means that it requires stronger reducing agents to be reduced. The fact that U liberates hydrogen gas from cold water but T does not can be attributed to the difference in the reactivity of these elements with water. U is more reactive than T, which means that it can react with water to liberate hydrogen gas. T, on the other hand, is less reactive, which means that it does not react with water to liberate hydrogen gas.

In conclusion, the reactivity of elements is determined by their position in the periodic table. Elements in the same group tend to have similar reactivity, while elements in different groups tend to have different reactivity. The ability of an element to react with other elements is determined by the number of valence electrons it has, which determines its chemical behavior.

know more about periodic table here:

https://brainly.com/question/15987580

#SPJ11

Answer:

Al and Hcl

Explanation:

Reactants are the elements, compounds etc before the arrow

Answer:

It should be 28 degrees C

Explanation:

Answer:

28°C

Explanation:

Answer:

that's a little bit difficult question

Explanation:

sorry !

The percent yield for the given reaction is 70.37% that is calculated in the below explanation.

The chemical equation can be depicted as follows-

CS2+4 Cl2----> CCl4 +2 SCl2

In the given reaction, the excess reagent is CS2 and the limiting reagent is 6.47 g.

Theoretical yield can be calculated as follows-

6.47 g Cl2 * 1 mol Cl2 / 71 g Cl2 * 1 mol CCl4 /4 mole Cl2  * 154 g CCl4 / 1 mole CCl4

=6.47g * 155 g /71*4 g =3.51 g

Percent yield is the ratio of actual yield to the theoretical yield multiplied by 100.

Percent yield=actual yield/theoretical yield

=2.74/3.51 * 100

=70.37%

To learn more about percent yield check the link below:

https://brainly.com/question/8638404

#SPJ4

1. The percentage composition of iron in the compound is 34.4%

2. The percentage composition of chlorine in the compound is 65.6%

3. The empirical formula of the compound is FeCl₃

Percentage of Fe = (mass of Fe / mass of compound) × 100

Percentage of Fe = (143 / 416) × 100

Percentage of Fe = 34.4%

Percentage of Cl = 100 – 34.4

Percentage of Cl = 65.6%

Divide by their molar mass

Fe = 34.4 / 56 = 0.614

Cl = 65.6 / 35.5 = 1.848

Divide by the smallest

Fe = 0.614 / 0.614 = 1

Cl = 1.848 / 0.614 = 3

Thus, the empirical formula of the compound is FeCl₃

Learn more about empirical formula:

https://brainly.com/question/26273076

Answer:

See explanation

Explanation:

Since the -CH3CN and the -F are in 1,4 position, then the synthesis started with flourobenzene. This has to be because -F is ortho-para directing in nucleophilic substitution.

The next step is the Friedel craft alkylation of the substrate. The alkyl group is directed to the para position by the -F.

Bromination using NBS yields an alkyl bromide that undergoes SN2 substitution to yield the target compound.

Answer:

It is a wrong answer

• It's in theory that 1 hour = 60 minutes

\({ \tt{50 \: hours = (50 \times 60) \: minutes}}\)

• It's in theory that 1 minute = 60 seconds

\({ \tt{(50 \times 60) \: mins = \{(50 \times 60) \times 60 \} \: sec}}\)

» Therefore, correct expression is;

\({ \boxed{ \tt{50 \: hours = (50 \times 60 \times 60) \: seconds}}}\)

A spring tide represents a natural process where more energy is produced when compared to other days in order to turn a turbine.

A renewable energy can be defined as any source of energy that is reversibly obtained from the nature.

In conclusion, a spring tide represents a natural process where more energy is produced compared to other days in order to turn a turbine.

Learn more about renewable energies here:

https://brainly.com/question/545618

#SPJ4

Answer:

C. during a spring tide

Explanation:

:D

To prepare the compound with the given SMILES string, you would start with benzene and isopropyl chloride, and then follow a series of reactions involving nitration and diazotization to introduce the required functional groups.

To prepare the compound with the given SMILES string cc(c)c2cc(/n=n/c1ccc(n(=o)=o)cc1)ccc2n starting from benzene and isopropyl chloride, you can follow the following steps:

1. Start with benzene, which has the molecular formula C6H6.

2. Convert benzene to a substituted benzene by adding an isopropyl group (-CH(CH3)2) to one of the benzene carbons. This can be achieved by reacting benzene with isopropyl chloride (C3H7Cl) in the presence of a Lewis acid catalyst, such as aluminum chloride (AlCl3).

3. The reaction between benzene and isopropyl chloride results in the substitution of one of the hydrogen atoms in benzene with the isopropyl group, giving you the compound isopropylbenzene (also known as cumene) with the molecular formula C9H12.

4. Next, you need to introduce the remaining functional groups in the desired compound. The SMILES string indicates the presence of a nitro group (-NO2) and an azo group (-N=N-).

5. To introduce the nitro group, you can react isopropylbenzene with nitric acid (HNO3) and sulfuric acid (H2SO4). This results in the nitration of isopropylbenzene, where a nitro group replaces one of the hydrogen atoms on the benzene ring.

6. Finally, to introduce the azo group, you can react the nitro-substituted isopropylbenzene with an appropriate reducing agent, such as zinc dust (Zn), to convert the nitro group to an amino group (-NH2). Then, you can diazotize the amino group using sodium nitrite (NaNO2) and hydrochloric acid (HCl) to form the desired azo compound with the structure specified by the SMILES string.

Learn more about compound -

brainly.com/question/29547278

#SPJ11

Answer:

The answer is

Explanation:

To find the number of atoms in an element given it's number of moles we use the formula

where n is the number of moles

N is the number of entities

L is the Avogadro's constant which is

6.02 × 10²³ entities

From the question

n = 7.2 mol

The number of atoms in iron ( Fe) is

N = 7.2 × 6.02 × 10²³

We have the final answer as

Hope this helps you

Receive digital payments faster and deposit them directly into your bank much faster than paying with cash or a check.

P2P payments send money from one person to another in a matter of seconds. Money is usually delivered to the recipient within 1-3 days. Many platforms give recipients instant access to funds for a small fee. P2P payments are payments made directly to another person using a P2P payment service.

P2P payments allow users to send money quickly while keeping their account details private. All you need to send a payment is the recipient's email address or phone number. P2P payment providers like let you send and receive money instantly. You can pay without cash, so you can trade even if you forgot your wallet at home. Most P2P payments are free to use.

Learn more about P2P users here:-https://brainly.com/question/26974810

#SPJ4

Answer:

2.45kPa

Explanation:

THIS IS A COMPLETE QUESTION

A gas pressure of 1.26 kPa and occupies a volume of 2.39 L, what will its new pressure be if the volume is 1.23L ? Round to the nearest hundredth place.

From Boyles law

P1 V1= P2V2

Where P1= initial pressure= 1.26 kPa

V1= initial volume= 2.39 L,

V2= final volume= 1.23L

P2= final pressure= ?

P1 V1= P2V2

P2= (P1 V1)/V2

= (1.26 × 2.39)/1.23

=2.45kPa

Hence, its new pressure is 2.45kPa

The Electron geometry is trigonal bipyramid. molecular geometry is Liner

3orbitals are used to keep loan pairs on Rn

2 orbital are used to form two pi  bonds in the chlorine

Total hybridized orbital needed = 5

i.e. S,3p,1s

Hybridization = Sp^3d.

Electron geometry  = trigonal bipyramid

molecular geometry = Liner

We need to understand the Lewis electron dot structure in order to identify the forms of molecules. The Lewis hypothesis is the initial step in predicting molecular shapes, even though it does not itself specify how molecules would look. We can distinguish between bond pairs and lone pairs with the aid of the Lewis structure. We next use the Lewis structure to determine the molecular geometry and the electron-group geometry using the valence-shell electron-pair repulsion (VSPER) theory.

learn more about Electron geometry here:

https://brainly.com/question/7558603

#SPJ4

Answer:

O

Explanation:

O is in the red which says nonmetal

Answer:

What??? I don't understand.

Explanation:

Answer:

D. The government determines what is right & wrong for everyone

Explanation:

Answer:

D

-----------------------------------------------------------------

The definition of colloids is very disputed on whether or not it is homo/heterogenous. I wouldn't go with this answer, but its based on what you learned it was. At a microscopic level its hetero but at a macroscopic its homo.

They do have somewhat large dispersed particles but this better describes suspensions

They don't easily settle out.

And in order to be a mixture, they are made up of at least two substances

D is likely the best answer out of the bunch.

Colloids are made up of at least two substances. Therefore, option d is correct.

A colloid can be described as a mixture in which one substance consisting of dispersed insoluble particles is throughout another substance. The particles should be dispersed in a liquid. The term colloidal suspension can be referred to unambiguously as the overall mixture.

A colloid exhibits a dispersed phase and a continuous phase. The dispersed phase particles have a diameter of about 1 nm to 1 μm. Some colloids are translucent due to the Tyndall effect and other colloids can be opaque or have a slight color.

Hydrocolloids can be described as certain chemicals that are colloidally dispersible in water. Therefore becoming very "soluble" they can change the rheology by raising the viscosity.

A colloid possesses a dispersed phase and a continuous phase. A solute in a solution is individual molecules, whereas colloidal particles can be bigger.

Learn more about colloids, here:

https://brainly.com/question/11640006

#SPJ2

Answer:

C) Na2HAsO4 and Na2SO4

Explanation:

Got it right on Edg

Answer:

The answer is C 65 g/100 mL of water

Explanation:

The energy of 1.10 mol of photons is E ≈ 1.47 x 10⁻¹⁸ J

To determine the energy of photons, you can use the equation E = hc/λ, where E is the energy, h is Planck's constant (6.626 x 10⁻³⁴ J·s), c is the speed of light (3.00 x 10⁸ m/s), and λ is the wavelength of light.

For Part A, infrared radiation with a wavelength of 1460 nm, we can calculate the energy as follows:

E = (6.626 x 10⁻³⁴ J·s) * (3.00 x 10⁸ m/s) / (1460 x 10⁸ m)
E ≈ 1.36 x 10¹⁹ J

For Part B, visible light with a wavelength of 505 nm:

E = (6.626 x 10³⁴ J·s) * (3.00 x 10⁸ m/s) / (505 x 10⁻⁹ m)
E ≈ 3.92 x 10⁻¹⁹ J

For Part C, ultraviolet radiation with a wavelength of 135 nm:

E = (6.626 x 10⁻³⁴ J·s) * (3.00 x 10⁸ m/s) / (135 x 10⁻⁹ m)
E ≈ 1.47 x 10⁻¹⁸ J

To know more about photons visit-

https://brainly.com/question/33017722

#SPJ11

To determine the energy of 1.10 mol of photons, we use the equation E = hc/λ, where E is the energy, h is Planck's constant, c is the speed of light, and λ is the wavelength of the light in meters.
For each type of light, we convert the given wavelength from nanometers to meters and use the equation to calculate the energy per photon. Finally, we multiply this value by Avogadro's number to get the energy for 1.10 mol of photons.

The energy of photons can be determined using the equation E = hc/λ, where E is the energy, h is Planck's constant (6.626 x \(10^{-34}\) J·s), c is the speed of light (3.00 x \(10^8\) m/s), and λ is the wavelength of the light in meters.

Part A: Infrared radiation (1460 nm)
To find the energy of 1.10 mol of infrared photons, we need to convert the wavelength from nanometers (nm) to meters (m).
1460 nm = 1460 x 10^-9 m

Now we can use the equation E = hc/λ:
E = (6.626 x \(10^{-34}\) J·s)(3.00 x \(10^8\) m/s) / (1460 x \(10^{-9}\) m)

Calculating this equation will give us the energy per photon in Joules (J). Multiply this value by Avogadro's number (6.022 x \(10^{23}\)) to get the energy for 1.10 mol of photons.

Part B: Visible light (505 nm)
Similarly, we convert the wavelength of visible light from nanometers (nm) to meters (m):
505 nm = 505 x \(10^{-9}\) m

Using the same equation, E = hc/λ, we can calculate the energy per photon in Joules (J) for visible light.

Part C: Ultraviolet radiation (135 nm)
Again, we convert the wavelength of ultraviolet radiation from nanometers (nm) to meters (m):
135 nm = 135 x \(10^{-9}\) m

Using the equation E = hc/λ, we can calculate the energy per photon in Joules (J) for ultraviolet light.

Learn more about Ultraviolet radiation: https://brainly.com/question/30556527

#SPJ11

Answer: 15910 meters

Explanation:

1 kilometer = 1000 meters

15.91 kilometers * 1000 meters/1 kilometer =

15.91 * 1000/1=

15.91*1000=15910 meters

Neutral pH is 7, thus The H+ and OH- concentrations are therefore equivalent for a pH of 7. Given that the concentrations are equivalent, the ratio is 1.

To learn more about ratio refer to:

https://brainly.com/question/30214457

#SPJ1

Answer:

Deposition

Explanation:

It’s breaking down the rock :]

Answer:

deposition

Explanation:

Ap3x