A sample of water is measured with a 2 mL volumetric pipet. What volume
measurement should be recorded with the correct number of decimal places?

Answers

Answer 1

Answer:

Explanation:

A pipette is used to measure an exact volume of liquid; a pipette can only measure it's exact recommended volume (it can't measure more or less).

Hence, a 2-mL volumetric pipette can only measure 2 ml and would be recorded as 2.00 (ml). This is because simple volumes are usually recorded in two decimal places.


Related Questions

Gaseous methane (CH4) reacts with gaseous oxygen gas (O2) to produce gaseous carbon dioxide (CO2) and gaseous water (H2O). If 28.2 g of carbon dioxide is produced from the reaction of 15.1 g of methane and 81.2 g of oxygen gas, Calculate the percent yield of carbon dioxide. Be sure your answer has the correct number of significant digits in it.

Answers

Answer:

68.1% is percent yield of the reaction

Explanation:

The reaction of methane with oxygen is:

CH₄ + 2O₂ → CO₂ + 2H₂O

Where 2 moles of oxygen react per mole of CH₄

Percent yield is:

Actual yield (28.2g CO₂) / Theoretical yield * 100

To solve this question we need to find theoretical yield finding limiting reactant :

Moles CH₄:

15.1g CH₄ * (1mol / 16.04g) = 0.9414 moles

Moles O₂:

81.2g * (1mol / 32g) = 2.54 moles

For a complete reaction of 0.9414 moles of CH₄ are needed:

0.9414 moles CH₄ * (2 mol O₂ / 1mol CH₄) = 1.88 moles of O₂. As there are 2.54 moles, O₂ is in excess and CH₄ is limiting reactant

In theoretical yield, the moles of methane added = Moles of CO₂ produced. That is 0.9414 moles CO₂. In grams = Theoretical yield:

0.9414 moles CO₂ * (44.01g / mol) = 41.43g CO₂

Percent yield: 28.2g CO₂ / 41.43g CO₂ * 100=

68.1% is percent yield of the reaction

Choose the one statement that is true of the noble gases.A.They are very reactive.B.Their valence shells are full of electrons.C.They are unstable.D.They are liquids at room temperature.

Answers

B. Their valence shell are full of electrons

That is the main characteristic of noble gases, and it is because of this that they are very stable, very unreactive and they have very low condensation temperature.

help whats 2+2 i really don't know what the answer is i think it 1,250 but idk

Answers

Answer:

its 4

Explanation:

Answer:

4 is the answer

Explanation:

2 fingers plus 2 fingers is 4 fingers, Not 1,250

Which statement best summarizes how a parasite such as a tapeworm causes disease?

Answers

Answer:

Parasites take nutrients from another organism's body.

Explanation:

What is the ph value of human saliva​

Answers

The ph value of human saliva is between 6.2-7.6 with 6.7 being the average pH

ph value of human saliva is 7 and 6

Provide an example of a Food Chain.

Answers

Answer: Diamond is the name ^-^

A food chain only follows just one path as animals find food. eg: A hawk eats a snake, which has eaten a frog, which has eaten a grasshopper, which has eaten grass. A food web shows the many different paths plants and animals are connected. eg: A hawk might also eat a mouse, a squirrel, a frog or some other animal.

Hope this helps ^_^

A diver has about 0.05L of gas dissolved in his blood while swimming underwater (at a pressure of 7.05atm). He returns too quickly to the surface, quickly (at a pressure of 1.60atm). What is the new volume within his blood?


Answers

Answer:

0.22 L is the new volume within his blood

Explanation:

Given that,

Initial volume, V1=0.05 L

Initial pressure, P1=7.05 atm

Final pressure, P2=1.6 atm

We need to find the new volume within his blood. Let the new volume be V₂. It is based on the concept of Boyle's law. According to Boyle's law,

P1V1=P2V2V2=P1V1P2V2=7.05×0.051.6V2=0.22 L

So, the new volume is 0.22 L.

Which of the following technique is used to purify the impurities that are not very different in chemical properties of element? [a] Gas chromatography [b] Column chromatography [c] TLC [d] HPLC​

Answers

Answer:

Explanation: Liquid Chromatography  

I'm sorry if i'm wrong

Under perfect conditions, which of these statements would you expect to be true about the magnitude of the potential (E"cell) for the CulMg voltaic cells in Part A when compared to the reduction potential for the Cu electrode? It may be helpful to refer to Appendix E of your lab manual The cell potential should be less than zero The cell potential should be greater than zero but less than the reduction potential for Cu The cell potential should be greater than the reduction potential for Cu The cell potential should be zero

Answers

The cell potential should be greater than the reduction potential for Cu.

It is given that,

The cell potential should be zero.

Because here we are considering the Cu-Cu cell so there would not be any potential difference and hence 0 E° cell value.

As we know that the reduction potential of copper is 0.34 V and the reduction potential of Mg is -2.37V

If we calculate the E°cell then,

E°cell= E(cathode)- E(anode)

Here copper is acting as the cathode and Mg as the anode

So, E°cell= 2.71V

So, the cell potential should be greater than the reduction potential for Cu.

Hence, option (c) is the correct choice.

For such more question of Reduction potential https://brainly.com/question/20040177

#SPJ4

Until a train is a safe distance from the station it must travel at 5 m/s Once the train is on open track it can speed up
to 45 mls. If it takes a train 8 seconds to reach 45 m/s, what is the acceleration of the train? (Round your answer to
the nearest whole number)
4 m/s2
5 m/s2
6 m/s2
7 m's?

Until a train is a safe distance from the station it must travel at 5 m/s Once the train is on open track

Answers

Answer:

5 m/s²

Explanation:

From the question given above, it took 8 s for the train to get to a speed of 45 m/s. This simply means the train was maintaining 5 m/s as it travels in order to get to an open track.

Thus, we obtained the following data from the question.

Initial velocity (u) = 5 m/s

Final velocity (v) = 45 m/s

Time (t) = 8 s

Acceleration (a) =.?

Acceleration is simply defined as the rate of change of velocity with time. Mathematically, it can be expressed as:

a = (v – u) /t

Where:

a is the acceleration.

v is the final velocity.

u is the initial velocity.

t is the time.

With the above formula, we can obtain the velocity of the train as follow:

Initial velocity (u) = 5 m/s

Final velocity (v) = 45 m/s

Time (t) = 8 s

Acceleration (a) =.?

a = (v – u) /t

a = (45 – 5) / 8

a = 40/8

a = 5 m/s²

Therefore, the acceleration of the train is 5 m/s².

Answer:

Its B =)

Explanation:

The intermediate shown converts a ketone or aldehyde into what functional group?

A organophosphane
B alkene
C alkyne
D 1,2 -di-ketone

The intermediate shown converts a ketone or aldehyde into what functional group?A organophosphaneB alkeneC

Answers

The intermediate shown converts a ketone or aldehyde into what functional group is Alkyne

What is meant by alkyne ?

Alkynes, a chemical compound. Alkynes are defined as molecules with a triple bond between two carbon atoms. One bond and two bonds combine to form the triple bond.

Alkynes are hydrocarbons that have triple bonds between carbon atoms. The typical formula for molecules with one triple bond is CnH2n-2 (and no rings). Alkynes undergo many of the same reactions as alkenes, but because the triple bond contains two p-bonds, they can react twice.

Due to the compound's unsaturation, two carbon atoms that form double bonds trade the excess electrons with regard to hydrogen atoms. Alkynes from the first component in the chain are additionally frequently referred to as ACETYLENES.

To learn more Alkynes refer to :

https://brainly.com/question/23819791

#SPJ1

Suppose a solution has a density of 1.87 g/mL. If a sample has a mass of 17.5 g the volume of the sample in mL is what?

Answers

The volume of the sample in mL is 9.36 mL.

We can use the formula:

Density = Mass/Volume

Rearranging the formula gives:

Volume = Mass/Density

Substituting the given values gives:

Volume = 17.5 g / 1.87 g/mL = 9.36 mL.

The bond angle in h2s is?

The bond angle in h2s is?

Answers

Answer:

90^0.

Explanation:

The bond angle in H2O is 105^0 and in H2S it is 90^0.

what are thetypes of luminous flame

Answers

Types of luminous flames:

1. Yellow Luminous Flame

2. Smoky Luminous Flame

3. Orange Luminous Flame

4. Blue Luminous Flame

Luminous flames are characterized by their visible glow, which is caused by the incomplete combustion of fuel. The presence of soot particles in the flame causes the emission of light. There are different types of luminous flames, which can be classified based on their fuel composition and burning conditions. Here are some common types of luminous flames:

1. Yellow Luminous Flame: This is the most common type of luminous flame, often seen in open fires, candles, and gas stoves. It appears yellow due to the presence of soot particles in the flame. Yellow flames indicate incomplete combustion of hydrocarbon fuels, such as methane, propane, or natural gas. The high carbon content in these fuels leads to the formation of soot, which emits visible light.

2. Smoky Luminous Flame: This type of flame is characterized by a significant amount of black smoke and soot production. It is commonly observed in poorly adjusted or malfunctioning burners or engines. The excessive presence of unburned fuel in the flame results in incomplete combustion and the emission of dark smoke particles.

3. Orange Luminous Flame: An orange flame indicates a higher combustion temperature compared to a yellow flame. It is often seen in more efficient burners or when burning fuels with a higher carbon content, such as oil or diesel. The higher temperature helps in burning more of the carbon particles, reducing the amount of soot and making the flame appear less yellow.

4. Blue Luminous Flame: A blue flame is typically associated with complete combustion. It indicates efficient burning of fuel, resulting in minimal soot formation. Blue flames are commonly observed in gas burners or Bunsen burners. The blue color is a result of the combustion of gases, such as methane, in the presence of sufficient oxygen.

It's important to note that the luminosity of a flame can vary depending on factors such as fuel-air mixture, combustion temperature, and the presence of impurities. Achieving complete combustion and minimizing the production of soot is desirable for efficient and cleaner burning processes.

for more questions on luminous

https://brainly.com/question/27163038

#SPJ8

100 Points} Name the following compounds from the structures given (images shown below)

1.

2.

3.

4.

5.

6.


Unfortunately, they're not multiple choice, so I have no possible answers to list, I believe 1. might be "2-methylhexane" but I'm unsure how to write the double bond that's shown in the structure, thanks! :)

Edit; the screenshots posted out of order, my apologies :(

100 Points} Name the following compounds from the structures given (images shown below)1.2.3.4.5.6.Unfortunately,
100 Points} Name the following compounds from the structures given (images shown below)1.2.3.4.5.6.Unfortunately,

Answers

Answer:

1.) There are 6 carbons in the longest possible parent chain (hex-). Since there is a double bond, this is an alkene.  The lowest possible carbon the double bond consists of is the 2nd carbon. There is also a methyl group on the 2nd carbon. All together, this makes the structure: 2-methyl-2-hexene.

2.) There are 9 carbons in the longest possible parent chain (non-). The lowest possible carbons the methyl groups are on are the 3rd and 5th carbons. The lowest possible carbon the ethyl group is located on is the 4th carbon. Remember, branches are listed alphabetically. All together, this makes the structure: 4-ethyl-3,5-dimethylnonane.

3.) There are 7 carbons in the longest possible parent chain (hept-). There is a triple bond, making this an alkyne. The lowest possible carbon the triple bond consists of is the 2nd carbon. The lowest possible carbon the methyl group is on is the 4th carbon. All together, this makes the structure: 4-methyl-2-heptyne.

4.) There are 10 carbons in the longest possible parent chain (dec-). The lowest possible carbon the propyl group is on is the 5th carbon. All together, this structure is: 5-propyldecane.

5.) There are 4 carbons in the longest possible parent chain (but-). The lowest possible carbon the methyl group is on is the 2nd carbon. All together, this makes the structure: 2-methylbutane.

6.) There are 5 carbons in the longest possible parent chain (pent-). There is a double bond, making the molecule an alkene. The lowest possible carbon the double bond consists of is the 2nd carbon. The lowest possible carbon the methyl group is on is the 2nd carbon. All together, this makes the structure: 2-methyl-2-pentene.

An clement X has 2 electrons in K shell, 8 electrons in L shell and 5 electrons in i Size of X ion is greater than that of X atom though both contain the same protons. Give reason. ii) Write down the formula of one of the compounds of X where X is in -3 oxidation.​

Answers

Answer:

i) The size of X ion is greater than that of X atom even though both contain the same number of protons because the ion has fewer electrons compared to the atom. When an atom forms an anion (negative ion), it gains electrons, which causes increased electron-electron repulsion. This repulsion causes the electron cloud to expand, and as a result, the ion becomes larger than the neutral atom.

In the case of element X, when it forms an ion with a -3 charge, it will gain 3 more electrons, increasing the total number of electrons to 18. This will cause the size of the X ion to be larger than the neutral X atom.

ii) To determine the compound of X in the -3 oxidation state, we first need to determine the element's identity. We know that X has 15 electrons in total (2 in the K shell, 8 in the L shell, and 5 in the M shell). Therefore, X has an atomic number of 15, which corresponds to phosphorus (P).

Since phosphorus is in the -3 oxidation state, it gains 3 electrons and becomes P^3-. To form a compound, we need a cation that can balance the negative charge. A common example is aluminum (Al), which has a +3 charge (Al^3+). When phosphorus and aluminum combine, they form the compound aluminum phosphide with the formula AlP.

1. Write the IUPAC names for the following 1.1 1.2 N 1.3 O NO2 x Y ·0 OH 5​

Answers

1. The IUPAC name of N is nitrogen.

2. Nitrogen dioxide

3.The IUPAC name of O is oxygen

4.The IUPAC name of OH is hydroxyl.

The IUPAC name of ·0 is a radical. It is commonly found in organic chemistry and plays an important role in many reactions.

IUPAC names for the given compounds are:1.1. N: Nitrogen

The IUPAC name of N is nitrogen.

It is a non-metal and belongs to group 15 in the periodic table. It has an electronic configuration of 1s2 2s2 2p3.1.2. NO2: Nitrogen dioxide

Explanation: NO2 is a chemical compound that is formed by the combination of nitrogen and oxygen. It is a reddish-brown gas that has a pungent odor.

The IUPAC name of NO2 is nitrogen dioxide.1.3. O: Oxygen

Explanation: The IUPAC name of O is oxygen.

It is a non-metal and belongs to group 16 in the periodic table. It has an electronic configuration of 1s2 2s2 2p4.

X: UnknownExplanation: No IUPAC name can be given to an unknown compound as the structure and composition are not known.

Y: Hydroxyl Explanation: The IUPAC name of OH is hydroxyl.

It is a functional group that is composed of an oxygen atom and a hydrogen atom (-OH). It is commonly found in alcohols and phenols. ·0: RadicalExplanation: A radical is a molecule or an ion that contains an unpaired electron.

for more question on electronic configuration

https://brainly.com/question/26084288

#SPJ8

Note: The complete question is given below

Provide the IUPAC names for the following compounds:

CH3CH2CH(CH3)CH2CH2CH2CH3

C6H5CH(CH3)2

H2NCH2CH2CH2CH2CH2NH2

CH3CH2CH2CH2CH2OH

CH3CH2CH2CHOHCH3

39. Analyze What subscripts would you most likely use if
the following substances formed an ionic compound?
(Need help with this last question and it’s the only one I ask help for but teacher doesn’t want to help me)

39. Analyze What subscripts would you most likely use ifthe following substances formed an ionic compound?

Answers

Based on their valencies, the subscripts of the ionic compounds formed will be:

1 and 12 and 11 and 22 and 2

What subscripts would you most likely use if the following substances formed an ionic compound?

A. An alkali metal and a halogen.

An alkali metal and a halogen both have valencies of one.

Therefore the subscripts would be 1.

B. An alkali metal and a non-metal from group 16.

An alkali metal has a valency of 1 and a group 16 non-metal has a valency of 2.

By exchange of valencies, the subscript would be 2 and 1.

C. An alkaline earth metal and a halogen.

An alkaline earth metal has a valency of 2 and a halogen has a valency of 1.

By exchange of valencies, the subscripts would be 1 and 2.

D. An alkaline earth metal and a non-metal from group 16.

An alkaline earth metal has a valency of 2 and a non-metal from group 16 has a valency of 2.

By exchange of valencies, the subscripts would be 2 and 2.

Therefore, the subscripts of the ionic compounds formed will be:

1 and 12 and 11 and 22 and 2

Learn more about about valency at: https://brainly.com/question/2284519

which of the following solutions contains the greatest number of ions, assuming all these salts dissociate completely? A)400.0 ml of 0.10 m nacl. b) 300.0 ml of 0.10 m cacl2. C) 200.0 ml of 0.10 m fecl3. D) 800.0 ml of 0.10 m sucrose.

Answers

300.0 ml of 0.10 m CaCl₂ of the following solutions contains the greatest number of ions, assuming all these salts dissociate completely.

What are ions simple definition?

An is an atom or collection of atoms where the number of electrons and the number of protons are different. A positive ion, also known as a cation, is a particle that exists when the flow of atoms exceeds the number of protons. Ions are electrically charged particles that are created either by taking electrons out of neutral atoms to make positive ions or adding protons to neutral atoms to produce negative ions. The quantity of protons remains constant during the formation of an ion.

Briefing:

The number of moles in 300. mL of 0.10 M CaCl₂ is:

0.300 L * 0.10 Mol L = 0.030 mol

Each mole of CaCl₂ contains 3 moles of ions (1 Ca²⁺ and 2 Cl⁻). The moles of ions in 0.030 moles of CaCl₂ are:

0.30molNaCl * 3mol Ions / 1 mol NaCl = 0.90 mols

To know more about Ions visit:

https://brainly.com/question/14982375

#SPJ4

calculate the volume of hydrogen in the reaction of 73 grams of zinc and 73 grams of hydrochloric acid (under normal conditions) please help

Answers

The volume of hydrogen gas produced in the reaction of 73 grams of zinc and 73 grams of hydrochloric acid (under normal conditions) is approximately 22.4 liters.

To calculate the volume of hydrogen gas produced in the reaction of zinc and hydrochloric acid, we need to use the principles of stoichiometry and the ideal gas law.

First, let's write the balanced chemical equation for the reaction between zinc (Zn) and hydrochloric acid (HCl):

Zn + 2HCl →ZnCl2+ H2

From the equation, we can see that one mole of zinc reacts with two moles of hydrochloric acid to produce one mole of hydrogen gas. To determine the number of moles of zinc and hydrochloric acid, we need to convert the given masses into moles.

The molar mass of zinc (Zn) is approximately 65.38 g/mol, so 73 grams of zinc is equal to:

73 g Zn * (1 mol Zn / 65.38 g Zn) ≈ 1.116 mol Zn

Similarly, the molar mass of hydrochloric acid (HCl) is approximately 36.46 g/mol, so 73 grams of HCl is equal to:

73 g HCl * (1 mol HCl / 36.46 g HCl) ≈ 2.002 mol HCl

According to the balanced equation, the reaction produces one mole of hydrogen gas for every two moles of hydrochloric acid. Therefore, since we have 2.002 moles of HCl, we expect to produce half that amount, or approximately 1.001 moles of hydrogen gas.

To calculate the volume of hydrogen gas, we can use the ideal gas law, which states:

PV = nRT

Where P is the pressure, V is the volume, n is the number of moles, R is the ideal gas constant, and T is the temperature. In this case, we assume the reaction is conducted under normal conditions, which means a pressure of 1 atmosphere and a temperature of 273.15 Kelvin.

Rearranging the equation to solve for V, we have:

V = nRT / P

Substituting the values, we get:

V = (1.001 mol) * (0.0821 L·atm/(mol·K)) * (273.15 K) / (1 atm) ≈ 22.4 L

Therefore, the volume of hydrogen gas produced in the reaction is approximately 22.4 liters.

For more such information on: volume

https://brainly.com/question/29796637

#SPJ8

Convert 121 g/L of NaCl into mol/L

Answers

Explanation:

atomic mass of Na = 23 amu

atomic mass of Cl = 34.5 amu

so atomic mass of NaCl is about 57.5 amu

this means that 1 mol of NaCl has a mass of 57.5 g

meaning the ans is 121 / 57.5

Two different atoms have nine protons each and the same mass. However, one is neutral while the other has a negative charge. Describe what each atomic structure could be, listing the possible number and location of all subatomic particles.

Answers

Two different atoms have nine protons each and the same mass. However, one is neutral while the other has a negative charge then the atomic structure of the both atom are of same element but one of them is electrically neutral and other has a stable electronic configuration

An atom is said to be neutral because it has an equal number of electron and proton in it  and if two different atom have nine proton each and same the mass but one is neutral while the other has a negative charge and the mass of an atom is determined by the number of proton and neutron is present in its nucleus and since both the given atom have 9 proton and the same mass and they must also have the same number of neutron

This implies both the atom have the same nucleus but different charges so it can be concluded that they both the atom of the same element but one of them is electrically neutral and other has stable electronic configuration

Know more about protons

https://brainly.com/question/27874405

#SPJ1

You walk into the lab, and you find a beaker sitting on the bench labeled HNO3. However, the concentration is not given. Your instructor tells you to do a titration to determine the concentration of the acid. You find that is takes 27.60 mL of 1.00 M NaOH to neutralize 10.00 of the HNO3. What is the concentration oft the HNO3?

HNO3 + NaOH
H2O + NaNO3

Answers

The concentration of the HNO₃ solution needed to neutralize the 27.60 mL of 1.00 M NaOH is 2.76 M

How do i determine the concentration of the HNO₃ solution?

The balanced equtaion is given below:

HNO₃ + NaOH —> H₂O + NaNO₃

Mole ratio of the HNO₃ (nA) = 1Mole ratio of the NaOH (nB) = 1

Now, we shall obtain the concentration of the HNO₃ solution needed for the neutralization reaction. This is shown below:

Volume of HNO₃ (Va) = 10 mLVolume of NaOH (Vb) = 27.60 mLConcentration of NaOH (Cb) = 1.00 M Concentration of HNO₃ (Ca) =?

CaVa / CbVb = nA / nB

(Ca × 10) / (1 × 27.6) = 1

(Ca × 10) / 27.6 = 1

Cross multiply

Ca × 10 = 27.6

Divide both side by 10

Ca = 27.6 / 10

Ca = 2.76 M

Thus, the concentration of the HNO₃ solution needed is 2.76 M

Learn more about titration:

https://brainly.com/question/27817549

#SPJ1

which of the following would be a valid hypothesis for a scientific investigation about food shopping decision affect food security?

A spending more money on food results in food of higher nutritional value

B why do people shop at supermarkets more often than local farmers markets

C how is the cost of a food related to its nutritional value

D I prefer the taste of foods purchase from local farmer market​

Answers

Answer: Learning is essential to our existence. Just like food nourishes our bodies, information and continued learning nourishes our minds. ... Today, continuous learning forms a necessary part in acquiring critical thinking skills and discovering new ways of relating to people from different cultures.

Explanation: Learning is essential to our existence. Just like food nourishes our bodies, information and continued learning nourishes our minds. ... Today, continuous learning forms a necessary part in acquiring critical thinking skills and discovering new ways of relating to people from different cultures.

A valid hypothesis is one that is testable and falsifiable by experimental findings. Thus, A would be the right option.

What are hypotheses?

Hypotheses are general statements with no experimental tests. They can be tested using experiments and be falsifiable if found wanting.

Food security refers to constant access to food of adequate nutritional value by the populace of a place. The access must be both in terms of availability and economic affordability.

If the cost of food has a relationship with their nutritional values, this will definitely affect the food security of a place.

Thus, the only falsifiable hypothesis would be "spending more money on food results in food of higher nutritional value".

More on hypotheses can be found here: https://brainly.com/question/17173491

#SPJ2

What do you think his hypothesis was?
a. Maggots grow through spontaneous
generation.
b. Maggots come from eggs laid by flies.
c. Maggots find their way into woods and
meats.
d. The problem cannot be solved.

Answers

His hypothesis was that b) maggots come from eggs laid by flies.

Redii demonstrated that maggots do not spontaneously generate from rotting meat. He placed three jars containing rotting meat, each covered with different kinds of material. One jar was covered with a fine cloth, one with gauze, and one with cork.

Flies were observed landing on all three jars of meat, but after eight days, only the jar covered with the gauze had maggots on the meat. Redii observed the maggots on the meat and concluded that they had not spontaneously generated, but had come from the eggs of the flies that had landed on the meat.

From this, he concluded that maggots only form on meat that is exposed to the air, and not on meat that is sealed in a jar. This showed that it was not "spontaneous generation" that was creating the maggots, but rather that they were being laid by flies.

This is because he put meat in different locations and found that maggots only appeared where there were flies.

To know more about living organisms, click below:

https://brainly.com/question/17259533

#SPJ9

What are some different things that can cause weathering?

Answers

The sun and things like that

Answer:

not recycling can make a hole in the ozone layer

Explanation:

Frost Weathering. Frost weathering occurs in the presence of water, particularly in areas where the temperature is near...Thermal Stress. Thermal stress occurs when heat absorbed from the surrounding air causes a rock to expand.

Recycling keeps the ozone layer safe but if we stop recycling then we could  burn a hole in the ozone layer and it could get even more hotter outside we might start sweating more often

Hope this helps ♡

WHAT IS THE MASS OF AN OBJECT WHOSE
DENSITY IS 0.23 G/ML AND A VOLUME OF
22.5 ML?

Answers

Answer:

The answer is 5.18 g

Explanation:

The mass of a substance when given the density and volume can be found by using the formula

mass = Density × volume

From the question

volume = 22.5 mL

density = 0.23 g/mL

We have

mass = 0.23 × 22.5 = 5.175

We have the final answer as

5.18 g

Hope this helps you

Strontium hydroxide reacts with hydrobromic acid to produce Strontium bromide and
water.
Write and balance the chemical reaction above, use it for problems 1-4 below:
1. If 5.50 moles of strontium hydroxide were consumed, how much moles of water are
produced?
2. Find the mass of hydrobromic acid used to produce 7.50 moles water.
3. If 10.8 g of strontium hydroxide were used, how much moles of strontium bromide are
produced?
4. If 13.3 g of hydrobromic acid were consumed, find the mass of the water produced.

Answers

The chemical reaction for the reaction of strontium hydroxide with hydrobromic acid is:

Sr(OH)2 + 2 HCl --> SrCl2 + 2 H2O

To find the moles of water produced when 5.50 moles of strontium hydroxide are consumed, we need to apply the law of conservation of mass. The mass of water produced is equal to the mass of strontium hydroxide consumed. Since strontium hydroxide has a molar mass of 142 g/mol and water has a molar mass of 18 g/mol, 1 mol of strontium hydroxide can produce 9 mol of water. Therefore, 5.50 moles of strontium hydroxide can produce 49.5 mol of water.

Similarly, 7.50 moles of water can be produced by reacting 18 moles of hydrobromic acid with strontium hydroxide. Hydrobromic acid has a molar mass of 79.9 g/mol, so 18 moles of hydrobromic acid would have a mass of 79.9 * 18 = 1435.2 g.

To find the moles of strontium bromide produced when 10.8 g of strontium hydroxide is used, we need to apply the law of conservation of mass again. The mass of the strontium bromide produced is equal to the mass of strontium hydroxide consumed. Since strontium bromide has a molar mass of 410 g/mol and strontium hydroxide has a molar mass of 142 g/mol, 1 mol of strontium bromide can consume 3.23 moles of strontium hydroxide. Therefore, 10.8 g of strontium hydroxide can produce 10.8 / 3.23 = 3.34 moles of strontium bromide.

Finally, to find the mass of water produced when 13.3 g of hydrobromic acid is consumed, we need to apply the law of conservation of mass yet again. The mass of the water produced is equal to the mass of hydrobromic acid consumed. Since hydrobromic acid has a molar mass of 79.9 g/mol, 13.3 g of hydrobromic acid would produce 13.3 / 79.9 = 0.166 moles of water.

Identify the type of friction acting in each scenairo

Answers

A surfer rides an ocean wave is fluid friction

A bowling ball travels down a bowling lane rolling friction

A baseball flies through the air is air resistance

A hose rests on the edge of a truck is static friction.

What is friction?

Friction is described as the force resisting the relative motion of solid surfaces, fluid layers, and material elements sliding against each other.

Static friction is that force that keeps an object at rest.

It is that  friction experienced when individuals try to move a stationary object on a surface, without actually triggering any relative motion between the body and the surface on which it is on.

Learn more about  friction at: https://brainly.com/question/24338873

#SPJ1

Complete question:

dentify the type of friction acting in each scenario.

A surfer rides an ocean wave.

A bowling ball travels down a bowling lane.

A baseball flies through the air.

A hose rests on the edge of a truck.

OPTIONS:

air resistance

fluid

rolling

sliding

static

This anion rapidly undergoes an intramolecular proton transfer; which the negatively charged oxygen atom abstracts the nearby acidic proton Draw the cunro GoC showing proton transter reaction; and modify the given structure to draw the product of that proton transfer Lone pairs are not required in the product: Identify which side of the equilibrium is favored and explain vour answer O The forward direction tavored because the anion in the product is stabilized by resonance, making the product weaker base. O The reverse direction is favored because the anion in the product is stabilized by resonance, making the product stronger base O The forward direction favored because the anion in the reactant on the more electronegative atom, making the reactant weaker base. O The reverse direction is favored because the anion in the reactant on the more electronegative atom, making the reactant stronger base.

Answers

agriculture. The largest source of pollution to the Bay comes from agricultural runoff, which contributes roughly 40 percent of the nitrogen and 50 percent of the phosphorus entering the Chesapeake Bay.

Airborne nitrogen is one of the most significant polluters of the Chesapeake Bay and its tributaries. Excess nitrogen may drive the growth of algae blooms, preventing sunlight from reaching underwater grasses and creating low-oxygen "dead zones" that smother marine life. Nitrogen and phosphorus occur naturally in aquatic habitats, but human activities such as fertilizer usage, wastewater management, fossil fuel combustion, and soap and detergent discharge inject excess nutrient pollution into ecosystems quicker than ecosystems can respond. 1At Home and Around the Neighborhood: Fertilizers, yard and pet waste, and some soaps and detergents contain nitrogen and phosphorus and, if not utilized or disposed of appropriately, can contribute to nutrient contamination.

learn more about Chesapeake Bay  here:

https://brainly.com/question/14295402

#SPJ4

Other Questions
What is the molarity of a solution prepared by dissolving 120. 0 g of NaOH in sufficient water to make a solution with a total volume of 9. 60 liters? The level of analysis for the General environment is the _____ level: macro industry firm resource / capability Given the DNA sequence and three restriction enzymes (Hindill, Pstl and BamHI), write out the sequence of the digestion products for both DNA strands when the DNA sequence is subjected to digestion by a mixture of three restriction enzymes? 5 CTGTTACTGCAGCTAACGTGGATCCGGTCAATCTTCA 3 Restriction recognition sequences (1 - the cleavage site): Hindiri 5-A|AGCTT-3 3-TTCGA|A-5 BamHI 5-G|GATCC-3 3-CCTAG|G-5 Pst! 5-CTGCA G-3' 3-G|ACGTC-5 is 18/42 rational or irrational 2.The expression (x^19)(x^-33) is equivalent to (x^p) What is the value of p? as inventory and property plant and equipment on the balance sheet are consumed, they are reflected: A test has twenty questions worth 100 points. The test consists True/False questions worth 3 points each and multiple choice questions worth 11 points each. Howmany multiple choice questions are on the test? In the mid-1300s, John Wycliffe wasa critic of the Protestant Church.a reverend in the Protestant Church.a critic of the Catholic Church.a leader in the Catholic Church. how much interest is earned in the fourth year by $1,000 invested under compound interest at an annual effective interest rate of 5%? The land area in a region that is producing resources and absorbing pollutionBiocapacityEcological FootprintThe CommonsEnvironmental ImpactHow much forest cover does Canada currently have compared to the forests that covered Canada in the 1600s?1%50%5%70% The table shows some values of x and y that satisfy the equation. A 112 mL sample of an unknown concentration of the base bariumhydroxide requires 177 mL of 2.44 M of the acid HC to reach theequivalence point in a titration. What was the concentration of theor . Anthony proposed an experiment during which he would test the friction created when a skateboard is rolled along a flat surface. He selected three different surfaces (carpet, tile, and concrete) each with three different textures (dry, wet, and icy). His teacher told him that he would need to clarify his experiment before his project would be approved. Which of the following best describes why Anthony's project was rejected? A. Anthony's project has two independent variables. B. Anthony does not have a problem that can be tested. C. The skateboard will not be able to roll along the carpet. D. The friction created by a skateboard cannot be measured. What is an informative essay? You were walking on the sidewalk with your friend suddenly you heard a familiar voice that surprised you narrate what happened next (120 words) please find circumfrence and area and list the squares (cm, cm2, cm3) thanks What is the name of the act that protects you, the consumer, so that you do not have to pay if you do not receive the items you purchased?A. The Consumer Act B. The Credit Protection Agency Act C. The Purchasing Power Act D. The Truth in Lending Act a programmer working for the us government is tasked with writing a program to detect fraudulent voter registration. the programmer tries to run the program on their work computer and realizes the computer is too slow to process all of the voter registration records in time for the next election. they decide to use distributed computing to improve the performance. how could a distributed computing so In an inverse variation, y = 4 when x = 8. Write an inverse variation equation that showsthe relationship between x and y. The Dietary Reference Intakes (DRI) committee recommends a diet that provides _____ percent of its calories from protein.