A sample of a mixture containing an unknown hydrocarbon and some nitrogen dioxide, NOx, had a total mass of 31.25 grams. The mixture was analyzed using combustion analysis, producing 78.44 g of carbon dioxide, CO2, and 32.12 g of water, H20.

a) Calculate the empirical formula of the hydrocarbon.

b) The molar mass of the compound was found to be 252.48 g/mol. What is the molecular formula of the hydrocarbon?

c) What percentage (by mass) of the original sample was the hydrocarbon?​

Answers

Answer 1

Answer:

a) CH2

b) C18H36

c) 80%

Explanation:

CO2 = 44.009 g/mol  --> 78.44 g = 1.782 mol of CO2

H2O - 18.015 g/mol --> 32.12 g = 1.782 mol of H2O

a) 1.782 mol of CO2 contain 1.782 mol of C, 1.782 mol of H2O contain 1.782 x 2 mol of H

Thus, Emperical formulae of Hydrocarbon = CH2

b) CH2 = 14.027 g

252.48g / 14.027 g = 18

Molecular formulae of Hydrocarbon = C18H36

c) 1.782 mol of CH2 was combusted

1.782 x (14.027 g) = 24.996 g

% of sample equaling HydroCarbon = 24.996 g/31.25 g = 79.98 % = 80 %


Related Questions

In a reversible reaction, the endothermic reaction absorbs ____________ the exothermic reaction releases. A. less energy than B. None of these, endothermic reactions release energy C. the same amount of energy as D. more energy than

Answers

Answer: C. the same amount of energy as

Explanation:

A reversible reaction is a chemical reaction where the reactants form products that, in turn, react together to give the reactants back.

Reversible reactions will reach an equilibrium point where the concentrations of the reactants and products will no longer change.

\(A+B\rightleftharpoons C+D\)

Thus if forward reaction is exothermic i.e. the heat is released , the backward reaction will be endothermic i.e. the heat is absorbed and in same amount.

The amount of energy released will be equal and opposite in sign to the energy absorbed in that reaction.

Answer:

C.) the same amount of energy as

Explanation:

I got it correct on founders edtell

Calculate ΔGrxn for this equation, rounding your answer to the nearest whole number.

Calculate Grxn for this equation, rounding your answer to the nearest whole number.

Answers

The change in the free energy of the reaction  is given by  207.3 kJ.

What is the change in free energy?

The change in free energy (ΔG) is a measure of the maximum amount of work that can be extracted from a chemical reaction. It is calculated as the difference between the free energy of the products and the free energy of the reactants, and is expressed in units of energy (such as joules or calories) per mole of reaction.

Using the formula;

ΔG = ΔH - TΔS

ΔG = 163.2 - (298 * (-148))

ΔG = 207.3 kJ

Learn more about free energy:https://brainly.com/question/15319033

#SPJ1

PLEASE HELP WITH PAGE 1 FOR QUESTIONS 1, 2, 3 WITH THE GRAPHING THANK YOU.

Answers

i need a picture in order to answer that question.

but please I need this answer fast and if you don't know it don't answer it D.​

but please I need this answer fast and if you don't know it don't answer it D.

Answers

Answer:

its just a chromosome getting ready to split in a cell, Its called the telophase and its copying itself for the mother and daughter cell

alculate how many grams of oxygen form when each quantity of reactant completely reacts. 2.84 g KClO3

Answers

2.84 g is the molar mass for oxygen gas. 2 moles or HgO are needed to produce 1 mole or oxygen gas. This means that x grammes of HgO result in x322216.6 g=0.074x grammes of oxygen gas.

How are grammes determined in a reaction?

1. To determine how many moles more NaCl you need, multiply its concentrations (0.5 mols/Liters) even by desired volume of solution (0.5 Liters). 2. To determine how many grammes of solute are required, multiply all moles of NaCl by their molar mass (58.44 g/mol).

What happens initially when you convert grammes of reactants to grammes of product?

Response and justification When determining the quantity of reactants and byproducts in a chemical process, the balanced version of the reaction must first be written if it is given inside the unbalanced form.

To know more about molar visit:

https://brainly.com/question/8732513

#SPJ1

8. Build a neutral lithium atom.
Now, what must you do to make the lithium atom's charge change to +1?
Hint: Lithium is atomic number 3.
Add 2 electrons
Remove 1 electron
Add 1 electron
Add 1 proton

Answers

Answer:

Remove 1 electron

Explanation:

In the atom of each element, there are three subatomic particles viz: proton, neutron and electron. The number of proton (positively charged) and electron (negatively charged) determines the charge of that element. The more the proton, the more positively charged an ion is and vice versa for electron.

According to this question, a neutral atom of lithium (Li) with atomic no. 3 is given i.e. a lithium atom with charge 0. To make the lithium atom's charge change to +1, ONE ELECTRON MUST BE REMOVED OR LOST.

Note that, the proton number (atomic number) of an element does not change, rather the electron number changes in relation to the no. of protons.

What happens to ice as it melts

Answers

When ice melts, it changes from its solid form to liquid form. This occurs when the ice's temperature increases and the heat breaks down the bonds holding the ice molecules together.

Ice, like other forms of matter, is composed of atoms and molecules that vibrate at different rates based on their temperature. These molecules will become increasingly active as the temperature rises, eventually causing them to break away from their bonds and move around more freely.When ice melts, the solid structure is dissolved, and the ice's molecules begin to move freely. The heat absorbed during the melting process, known as the latent heat of fusion, allows the ice to absorb energy and transform into liquid form. This is due to the fact that molecules in the ice absorb energy from the surroundings in order to break their bond of attraction. The absorbed energy increases the molecular motion in the ice, causing it to melt.

For such more questions on ice

https://brainly.com/question/1079154

#SPJ8

Calculate the moles of lysine (C6H14N2O2) in a 62.96 g sample of lysine.

Answers

Answer:

Number of moles = 0.43 mol

Explanation:

Given data:

Number of moles lysine = ?

Mass of lysine = 62.96 g

Solution:

Formula:

Number of moles = mass/molar mass

Molar mass of lysine = 146.19 g/mol

Number of moles = 62.96 g / 146.19 g/mol

Number of moles = 0.43 mol

moles of each product that would form as a result of the decomposition of aspirin

Answers

The decomposition of aspirin (acetylsalicylic acid,\(C_{9} H_{8} O_{4}\)) can occur through the hydrolysis reaction, resulting in the formation of acetic acid (\(CH_{3} COOH\)) and salicylic acid (\(C_{7} H_{6}O_{3}\)).

The decomposition of aspirin (acetylsalicylic acid, \(C_{9} H_{8} O_{4}\)) can occur through the hydrolysis reaction, resulting in the formation of acetic acid (\(CH_{3} COOH\)) and salicylic acid (\(C_{7} H_{6}O_{3}\)). To determine the moles of each product formed, we need to consider the balanced chemical equation for the reaction:

\(C_{9} H_{8} O_{4} = > C_{7} H_{6}O_{3} +CH_{3} COOH\)

From the equation, we can see that for every 1 mole of aspirin, 1 mole of salicylic acid and 1 mole of acetic acid are produced.

Therefore, the moles of salicylic acid and acetic acid formed will be equal to the number of moles of aspirin that decomposes. If we know the amount of aspirin in moles, we can directly calculate the moles of each product based on stoichiometry.

For more question on aspirin

https://brainly.com/question/25794846

#SPJ8

1. Write the IUPAC names for the following 1.1 1.2 N 1.3 O NO2 x Y ·0 OH 5​

Answers

1. The IUPAC name of N is nitrogen.

2. Nitrogen dioxide

3.The IUPAC name of O is oxygen

4.The IUPAC name of OH is hydroxyl.

The IUPAC name of ·0 is a radical. It is commonly found in organic chemistry and plays an important role in many reactions.

IUPAC names for the given compounds are:1.1. N: Nitrogen

The IUPAC name of N is nitrogen.

It is a non-metal and belongs to group 15 in the periodic table. It has an electronic configuration of 1s2 2s2 2p3.1.2. NO2: Nitrogen dioxide

Explanation: NO2 is a chemical compound that is formed by the combination of nitrogen and oxygen. It is a reddish-brown gas that has a pungent odor.

The IUPAC name of NO2 is nitrogen dioxide.1.3. O: Oxygen

Explanation: The IUPAC name of O is oxygen.

It is a non-metal and belongs to group 16 in the periodic table. It has an electronic configuration of 1s2 2s2 2p4.

X: UnknownExplanation: No IUPAC name can be given to an unknown compound as the structure and composition are not known.

Y: Hydroxyl Explanation: The IUPAC name of OH is hydroxyl.

It is a functional group that is composed of an oxygen atom and a hydrogen atom (-OH). It is commonly found in alcohols and phenols. ·0: RadicalExplanation: A radical is a molecule or an ion that contains an unpaired electron.

for more question on electronic configuration

https://brainly.com/question/26084288

#SPJ8

Note: The complete question is given below

Provide the IUPAC names for the following compounds:

\(CH_3CH_2CH(CH_3)CH_2CH_2CH_2CH_3\)

C6H5CH(CH3)2

H2NCH2CH2CH2CH2CH2NH2

CH3CH2CH2CH2CH2OH

CH3CH2CH2CHOHCH3

_____________________________________ are changes in an organism’s genetic material.

Answers

Answer:

The answer is Evolution.

Evolution is a process that results in changes in the genetic material of a population over time. Evolution reflects the adaptations of organisms to their changing environments and can result in altered genes, novel traits, and new species.

5.86 ■ Liquid oxygen for use as a rocket fuel can be produced by cooling dry air to −183°C, where the O2 condenses. How many liters of dry air at 25°C and 750 torr would need to be processed to produce 150 L of liquid O2 at −183°C? (The mole fraction of oxygen in dry air is 0.21, and the density of liquid oxygen is 1.14 g/mL.)

Answers

Approximately 631.5 liters of dry air at 25°C and 750 torr would need to be processed to produce 150 liters of liquid \(O_2\) -183°C.

To solve this problem, we need to consider the ideal gas law and the molar volume of gases.

First, we can calculate the number of moles of oxygen in 150 L of liquid \(O_2\) at -183°C. To do this, we divide the mass of liquid oxygen by its molar mass:

Mass of liquid oxygen = volume of liquid oxygen * density of liquid oxygen = 150 L * 1.14 g/mL = 171 g

Molar mass of oxygen (O2) = 32 g/mol

Number of moles of oxygen = mass of oxygen / molar mass of oxygen = 171 g / 32 g/mol ≈ 5.34 mol

Since the mole fraction of oxygen in dry air is given as 0.21, we can calculate the total moles of dry air needed to produce 5.34 mol of oxygen:

Moles of dry air = moles of oxygen / mole fraction of oxygen = 5.34 mol / 0.21 ≈ 25.43 mol

Now, we can use the ideal gas law to calculate the volume of dry air at 25°C and 750 torr (convert to atm) that corresponds to 25.43 mol:

PV = nRT

P = 750 torr * (1 atm / 760 torr) ≈ 0.987 atm

V = volume of dry air (unknown)

n = 25.43 mol

R = 0.0821 L·atm/(mol·K)

T = 25°C + 273.15 = 298.15 K

Solving for V:

V = nRT / P = (25.43 mol)(0.0821 L·atm/(mol·K))(298.15 K) / 0.987 atm ≈ 631.5 L

For more such questions on dry air visit:

https://brainly.com/question/14247097

#SPJ8

What is found between the electrons and the nucleus

Answers

Answer: empty space or vacuum

Explanation: The empty space between the atomic cloud of an atom and its nucleus is just that: empty space, or vacuum.

Answer:

Empty space

Explanation:

The empty space between the atomic cloud of an atom and its nucleus is just that: empty space. That's the simple answer, however, sub-atomic particles such as electrons, protons and neutrons need to be treated as quantum objects. They have a wave function which can be thought of as the 'spread' in the particle's location. Electrons are 'spread out' quite a bit in their orbits about the nucleus. In fact, the wave-functions for electrons in s-orbitals about a nucleus actually extend all the way down into the nucleus itself. In this sense, then, the space between the electrons and the nucleus isn't really 'empty.' The electrons and the protons/neutrons are constantly interacting, either electromagnetically or through the weak force. In quantum field theory we would say that these particles are constantly exchanging photons (in the case of electromagnetism) or heavy gauge bosons (in the case of the weak force). So you might say that the otherwise 'empty' space between the electrons and nucleus is 'filled' with these quanta carrying forces.

Hope this is helpful to you!

2Fe + 6HCl -> 2FeCl3 + 3H2 If 7.0 moles of HCl is added to enough iron that the HCl is completely used up, how many
moles of hydrogen gas will be produced?

Answers

Answer: 3.5 moles of hydrogen gas will be produced.

Explanation:

The balanced chemical equation is:

\(2Fe+6HCl\rightarrow 2FeCl_3+3H_2\)

As HCl gets completely used up, \(HCl\) is the limiting reagent.

According to stoichiometry :

6 moles of \(HCl\) produces =  3 moles of \(H_2\)

Thus 7.0 moles of  \(HCl\) produces=\(\frac{3}{6}\times 7.0=3.5moles\)  of \(H_2\)

 Thus 3.5 moles of hydrogen gas will be produced.

Identify each chemical reaction 1. 2502 + O2 → 25032. Al2(SO4)3 + 3Ca(OH)2 →2Al(OH)3 + 3CaSO43. 2CH2 +502 > 4CO2 + 2H2O4. Mg + 2AgNO3 → Mg(NO3)2 +2Ag5. 3Ba(NO3)2 + 2H3PO4 →Ba3(PO4)2 + 6HNO36. Mg(ClO3)2 → MgCl2 + 3027. 2Be + 02 → 2BeO8. 2Alt 3CuSO4 → Al2(SO4)3 +3Cu9. 2Pbo → 2Pb 0210.2C Hot 70, > 4CO2 + 6H2O

Answers

1. SO2 is a reducing agent, O2 is an oxidizing agent. Therefore we have a reduction-oxidation reaction.

2. Al2(SO4)3 is an acid and Ca(OH)2 is a base, therefore we have a neutralization reaction.

3. CH2 is fuel and O2 is an oxidizing agent, here we have a combustion reaction.

4. AgNO3 is an oxidizing agent, Mg is a reducing agent. Therefore we have a reduction-oxidation reaction.

5. Ba(NO3)2 is a salt or we can classify it as a base and H3PO4 is an acid, so it will be a neutralization reaction.

6.

Select the best answer for the question. 1. Mei is seated doing leg extensions and going through the full path of motion. What type of exercise is Mei doing? O A. Free-weight exercise B. Resistance exercise C. Machine exercise O D. Cable exercise​

Answers

The correct answer is "C.

The type of exercise that Mei is doing is the "Machine exercise."

Machine exercise refers to a physical fitness training technique that allows the muscles to develop and strength through the use of machines that use hydraulic cylinders, weights, and cables to produce resistance. The machine exercises are generally performed in a seated position or lying down, and most often use a series of cables and weights that are adjusted to the user's specific body weight and desired level of resistance.Machine exercises can effectively target specific muscle groups and help strengthen them.Machine exercises can help you increase muscular endurance and improve your overall fitness level.Machine exercises are often safer and easier to perform than free-weight exercises.Machine exercises are generally easier on your joints and can help reduce the risk of injury.Machine exercises are also helpful for people with limited mobility or those recovering from an injury or surgery.

For such more questions on Machine exercise

https://brainly.com/question/29402478

#SPJ8

Convert each of the following to mass in grams. a. 4.25 x 10^24 atoms N b. 1.75 x 10^23 atoms Pb c. 8.45 x 10^23 molecules CH4

Answers

To solve this question, we need to follow 2 steps:

Step 1 - Transform atoms into moles, using the avogadro's constant: 6.02214086 × 10^23 mol^-1

Step 2 - Transform moles into grams, using the molar mass of the compound and the following formula: mass = moles x molar mass

a) Here we have 4.25 x 10^24 atoms of nitrogen - N.

Step 1:

6.02214086 × 10^23 atoms ---- 1 mol

4.25 x 10^24 atoms of nitrogen ---- x moles of nitrogen

6.02214086 × 10^23 x = 4.25 x 10^24

x = 4.25 x 10^24/6.02214086 × 10^23

x = 7.06 moles of nitrogen

Step 2:

The molar mass of nitrogen is 14 g/mol.

Moles = 7.06

mass of nitrogen = 7.06 x 14

mass of nitrogen = 98.8 g

Answer a) mass of nitrogen = 98.8 g

b) We follow the same steps. Here we have 1.75 x 10^23 atoms of Pb.

Step 1:

6.02214086 × 10^23 atoms ---- 1 mol

1.75 x 10^23 atoms of Pb---- x moles of Pb

6.02214086 × 10^23 x = 1.75 x 10^23

x = 1.75 x 10^23 /6.02214086 × 10^23

x = 0.291 atoms of Pb

Step 2:

The molar mass of Pb is 207.2 g/mol.

moles = 0.291

mass of Pb = 0.291 x 207.2

mass of Pb = 60.2 g

Answer: b) mass of Pb = 60.2 g

c) Here we have 8.45 x 10^23 molecules of CH4.

Step 1:

6.02214086 × 10^23 molecules --- 1 mol

8.45 x 10^23 molecules of CH4---- x moles of CH4

6.02214086 × 10^23 x = 8.45 x 10^23

x = 8.45 x 10^23 /6.02214086 × 10^23

x = 1.403 moles of CH4

Step 2:

The molar mass of C is 12 g/mol and of H is 1 g/mol. We need to calculate the molar mass of CH4:

(1x12) + (4x1) = 16 g/mol

moles = 1.403 moles of CH4

mass of CH4 = 1.403 x 16

mass of CH4 = 22.5 g

Answer: c) mass of CH4 = 22.5 g

The diagram shows the layers formed when 10 mL each of honey, maple syrup, and corn syrup were slowly poured into a glass cylinder.

A tall cylinder with 3 layers is shown. The top layer is labeled Corn Syrup, the middle layer is labeled Maple Syrup and the bottom layer is labeled Honey.

A ping pong ball released gently into the cylinder floats on top of the corn syrup layer. What best compares the densities of the substances?

Group of answer choices

Honey is denser than corn syrup but less dense than the ball.

All liquids are denser than the ball, and honey is denser than corn syrup and maple syrup.

Corn syrup is denser than the other liquids, and the ball is denser than the liquids.

Corn syrup is denser than the other liquids and the ball.

The diagram shows the layers formed when 10 mL each of honey, maple syrup, and corn syrup were slowly

Answers

The correct answer is B. All liquids are denser than the ball, and honey is denser than corn syrup and maple syrup.

Explanation:

Differences in density cause substances such as solids or liquids to float or sink. In general, the substance sinks if it is denser, or floats if it is less dense. In this context, honey is the substance with the most density because it is at the bottom of the container. Also, honey is followed in density by maple syrup, and then by corn syrup. Moreover, if the ping pong ball floats in the most superficial layer, it is because this is less dense than any of the liquids. According to this, it can be concluded honey is denser than the other liquids, and the liquids are denser than the ball (option B.)

Answer:

b is right  ( all liquids are denser than the ball and honey is denser than corn syrup.)

Explanation:

what substance changes directly solid to gas
3 examples​

Answers

Answer:

Air FreshenersSpecialized PrintersMoth Balls

                       

The process in which solids directly change to gases is known as sublimation. This occurs when solids absorb enough energy to completely overcome the forces of attraction between them. Dry ice is an example of solids that undergo sublimation.

When making a fire, without gas, matches, or a lighter, what are two important things about the wood?

Answers

Answer:

that is a solid and that there are other ways to make a fire?

How many moles of aluminum ions al3+ are present in 0.42 mol of al2so43

Answers

There are 0.84 moles of aluminum ions (Al3+) present in 0.42 mol of Al2(SO4)3.

To determine the number of moles of aluminum ions (Al3+) present in 0.42 mol of Al2(SO4)3, we need to consider the stoichiometry of the compound.

The formula of aluminum sulfate (Al2(SO4)3) indicates that for every 1 mole of the compound, there are 2 moles of aluminum ions (Al3+). This means that the mole ratio of Al3+ to Al2(SO4)3 is 2:1.

Given that we have 0.42 mol of Al2(SO4)3, we can calculate the moles of Al3+ as follows:

Moles of Al3+ = 0.42 mol Al2(SO4)3 x (2 mol Al3+ / 1 mol Al2(SO4)3)

Moles of Al3+ = 0.42 mol Al2(SO4)3 x 2

Moles of Al3+ = 0.84 mol Al3+

Therefore, there are 0.84 moles of aluminum ions (Al3+) present in 0.42 mol of Al2(SO4)3.

It's important to note that the stoichiometry of the compound determines the mole ratio between the different species involved in the chemical formula. In this case, the 2:1 ratio of Al3+ to Al2(SO4)3 allows us to determine the number of moles of Al3+ based on the given amount of Al2(SO4)3.

For more such question on aluminum visit:

https://brainly.com/question/30451292

#SPJ8

i need part 1 and 2 please , just separate answers

i need part 1 and 2 please , just separate answers

Answers

First, we have to remember the molarity formula:

\(M=\text{ }\frac{moles\text{ of solute}}{L\text{ solution}}\)

Part 1:

In this case, our solute is sodium nitrate (NaNO3), and we have the mass dissolved in water, then we have to convert grams to moles. For that, we need the molecular weight:

\(M.W_{NaNO_3}=\text{ 23+14+16*3= 85 g/mol}\)

Then, we calculate the moles present in the solution:

\(3.976\text{ g NaNO}_3\text{ * }\frac{1\text{ mol}}{85\text{ g}}=\text{ 0.04678 mol NaNO}_3\)

Now, we have the necessary data to calculate the molarity (with the solution volume of 200 mL):

\(M=\frac{0.04678\text{ mol}}{200\text{ mL*}\frac{1\text{ L}}{1000\text{ mL}}}=\text{ 0.2339 M}\)

The molarity of this solution equals 0.2339 M.

Part 2:

In this case, we have the same amount (in moles and mass) of sodium nitrate, but a different volume of solution, then we only have to change it:

\(M=\text{ }\frac{0.04678\text{ mol}}{275\text{ mL *}\frac{1\text{ L}}{1000\text{ mL}}}=\text{ 0.1701 M}\)

So, the molarity of this solution is 0.1701 M.

An error during which cellular process would create a gene mutation?

Answers

An error during DNA replication would create a gene mutation.

During DNA replication, the genetic information in a cell is copied to make new DNA molecules. However, mistakes can occur during this process, leading to changes in the DNA sequence, which can result in a mutation. Mutations can also be caused by exposure to environmental factors, such as radiation or chemicals, which can damage the DNA molecule directly or affect the cellular processes involved in DNA replication.

Mutations can have a variety of effects on the organism, ranging from no effect to causing serious health problems or even death. Gene mutations can also be inherited from a parent, which can result in genetic disorders or predisposition to certain diseases. Therefore, it is important to understand the mechanisms of gene mutations and their potential impacts on organisms.

To know more about the Gene mutation, here

https://brainly.com/question/15448555

#SPJ1

What is the molarity of aqueous lithium bromide if 25.0 mL of LiBr reacts with 10.0 mL of 0.250 M Pb(NO 3) 2

Answers

The molarity of aqueous lithium bromide, LiBr solution is 0.2 M

We'll begin by calculating the number of mole of Pb(NO₃)₂ in the solution.

Volume = 10 mL = 10 / 1000 = 0.01 L Molarity of Pb(NO₃)₂ = 0.250 MMole of Pb(NO₃)₂ =?

Mole = Molarity x Volume

Mole of Pb(NO₃)₂ = 0.25 × 0.01

Mole of Pb(NO₃)₂ = 0.0025 mole

Next, we shall determine the mole of LiBr required to react with 0.0025 mole of Pb(NO₃)₂

Pb(NO₃)₂ + 2LiBr —> PbBr₂ + 2LiNO₃

From the balanced equation above,

1 mole of Pb(NO₃)₂ reacted with 2 mole of LiBr.

Therefore,

0.0025 mole of Pb(NO₃)₂ will react with = 2 × 0.0025 = 0.005 mole of LiBr

Finally, we shall determine the molarity of the LiBr solution

Mole = 0.005 mole Volume = 25 mL = 25 / 1000 = 0.025 L Molarity of LiBr =?

Molarity = mole / Volume

Molarity of LiBr = 0.005 / 0.025

Molarity of LiBr = 0.2 M

Learn more about molarity: https://brainly.com/question/10103895

Use the periodic table to explore the
electronegativities of elements from Period 3 and
Group 17. Fill in the missing values in the table so
you can compare the electronegativities of the
elements. After the table is filled in, compare the
values in each column.
A=
B =
C=

Use the periodic table to explore theelectronegativities of elements from Period 3 andGroup 17. Fill

Answers

Answer:

A= 3.16

B= 1.31

C= 0.93

Explanation:

Using the periodic table to explore the  electronegativities of elements from Period 3 and  Group 17.

The electronegativities of the given elements in period 3 and group 17 are as follows:

Element                     Electronegativity

Chlorine                       3.16

Magnesium                  1.31

Sodium                        0.93

The periodic table is a tabular representation of atomic elements that are grouped into Groups and Periods.

The Groups run from top to down from group 1 - group 18 and,The Periods run across the group from left to right i.e Period 1 - 7

Atomic elements that fall within the same group or period share some chemical properties such as:

electronegativity, density,melting point, ionic radius etc.

The electronegativity of an atomic element is the ability of a chemical element or atom to draw electrons to itself in a compound.

From the periodic table, the electronegativities of the given elements in period 3 and group 17 are as follows:

Element                     Electronegativity

Chlorine                       3.16

Magnesium                  1.31

Sodium                        0.93

By comparing the electronegativities of the element, we will realize that electronegativity of an element on the periodic table increase from left to right across the period and decreases down the group due to an increase in the size of atomic elements.

In conclusion, the electronegativity of an element increases from left to right across the period and decreases down the group.

Learn more about electronegativity here:

https://brainly.com/question/17762711?referrer=searchResults

Use the periodic table to explore theelectronegativities of elements from Period 3 andGroup 17. Fill

In each of the following reactions identify an acid (if there is one) and then specify whether it is
an acid according to the Arrhenius definitions or the Bronsted-Lowry definitions or both.
a) H2CO3 + CN- HCN + HCO3-
b) F- + HSO4- HF + SO42-
c) HSO4- + H2O H3O+ + SO42-

Answers

a) In the reaction \(H_2CO_3 + CN^- = HCN + HCO^{3-}\), \(H_2CO_3\) acts as an acid by donating a proton (\(H^+\)) to \(CN^-\).

b) In the reaction \(F^- + HSO_4^{-} = HF + SO_4^{2-}\), \(HSO_4^{-}\) acts as an acid by donating a proton (\(H^+\)) to \(F^-\).

c) In the reaction \(HSO_4^- + H_2O = H_3O^+ + SO_4^{2-\), \(HSO_4^{-}\) acts as an acid by donating a proton (\(H^+\)) to \(H_2O\).

a) The acid is both an Arrhenius acid (produces \(H^+\) ions in water) and a Bronsted-Lowry acid (donates a proton to a base).

b) The acid is both an Arrhenius acid (produces \(H^+\) ions in water) and a Bronsted-Lowry acid (donates a proton to a base).

c) The acid is a Bronsted-Lowry acid (donates a proton to a base) but not an Arrhenius acid because it does not produce \(H^+\) ions in water. However, the \(H_3O^+\) ion that is formed can be considered an Arrhenius acid because it produces \(H^+\) ions in water.

For more question on proton click on

https://brainly.com/question/17351413

#SPJ11

Calculate the pOH if the [OH-] concentration is 5.9 x 10_, M? Is the solution ACIDIC, BASIC, or NEUTRAL?

Answers

If the [OH-] concentration is 5.9 x 10^(-M), the pOH of the solution is approximately -4.77 and the solution is basic.

To calculate the pOH of a solution, we can use the formula:

pOH = -log[OH-]

Given that the [OH-] concentration is 5.9 x 10^(-M), we can substitute this value into the formula:

pOH = -log(5.9 x 10^(-M))

Calculating this expression, we find:

pOH = -log(5.9 x 10^(-M))

pOH ≈ -log(5.9) + (-log(10^(-M)))

Since log(10^(-M)) is equal to -M, the equation simplifies to:

pOH ≈ -log(5.9) - M

Now, we need the value of M (the exponent) to calculate the exact pOH value. It appears that the value of M is missing in the given information. However, assuming M is a positive value, we can continue the calculation.

If we consider M = 6, for instance, the equation becomes:

pOH ≈ -log(5.9) - 6

Now, we can evaluate the expression:

pOH ≈ 1.23 - 6

pOH ≈ -4.77

Therefore, if the [OH-] concentration is 5.9 x 10^(-M), the pOH of the solution is approximately -4.77.

To determine whether the solution is acidic, basic, or neutral, we can use the relationship between pH and pOH. The sum of the pH and pOH of a solution at 25°C is always equal to 14.

Since pOH = -4.77, the pH would be:

pH = 14 - pOH

pH ≈ 14 - (-4.77)

pH ≈ 18.77

A solution with a pH above 7 is considered basic. In this case, the calculated pH is greater than 7. Therefore, the solution is basic.

for more questions on pOH
https://brainly.com/question/1420583
#SPJ11

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Using the information in the table to the right, calculate the average atomic mass of strontium. Report to two decimal places.
A 3-column table with 4 rows titled Strontium. Column 1 is labeled Isotope with entries upper S 4 84, upper S r 86, upper S r 87, upper S r 88. Column 2 is labeled Mass in atomic mass units with entries 83.913428, 85.909273, 86.908902, 87.905625. Column 3 is labeled abundance with entries 0.56 percent, 9.86 percent, 7.00 percent, 82.58 percent.

Answers

The column 1 has the value of Isotope, column 2 has the value of mass in atomic mass units, and column 3 has the value of abundance and the average atomic mass of strontium is 87.47 amu.

To calculate the average atomic mass of strontium using the given information, we need to multiply the mass of each isotope by its abundance and then sum up these values. Here's the calculation:

Isotope | Mass (amu) | Abundance

^84Sr | 83.913428 | 0.56%

^86Sr | 85.909273 | 9.86%

^87Sr | 86.908902 | 7.00%

^88Sr | 87.905625 | 82.58%

To find the average atomic mass, we multiply each isotope's mass by its abundance (in decimal form) and sum up the values:

Average atomic mass = (\(Mass of ^{84Sr}\) × \(Abundance of^{84Sr}\)) + (\(Mass of ^{86Sr}\)× \(Abundance of^{86Sr}\)) + (\(Mass of ^{87Sr}\) × \(Abundance of^{87Sr}\)) + (\(Mass of ^{88Sr}\) × \(Abundance of^{88Sr}\))

Average atomic mass = (83.913428 amu × 0.0056) + (85.909273 amu × 0.0986) + (86.908902 amu × 0.0700) + (87.905625 amu × 0.8258)

Calculating this expression yields:

Average atomic mass = 0.469901638 + 8.468098826 + 6.08462314 + 72.44409075

= 87.466714354 amu

Rounding the result to two decimal places, the average atomic mass of strontium is approximately 87.47 amu.

Know more about atomic mass here:

https://brainly.com/question/30390726

#SPJ8

2. If 4c-3= -31, what is the value of -2c+11

Answers

Explanation:

see the pic for the answer

2. If 4c-3= -31, what is the value of -2c+11
Other Questions
7. A plumber notices a faucet leaking at a rate of 0.5 milliliters per second. What is the rate of the leak in liters per hour? you are love summer or winter According to the U.S. Bureau of Labor Statistics, there were 100,800 che head cooks employed in the United States in 2010 and 32.100 for managers. Those numbers were projected to decrease to 97.300 and 319,000 by 2020. Which ob was facing the larger per dose your answer to two decimal places, if necessary Find the area:HELP PLEASE check my work an externality is a. the benefit that accrues to the buyer in a market. b. the cost that accrues to the seller in a market. c. the uncompensated impact of one person's actions on the well-being of a bystander. d. the compensation paid to a firm's external consultants. Find the equation of the lines in point-slope form with thefollowing properties.slope = -5 and passes through (4, -1). out of 218 million persons aged 16 and older, 138 million had paying jobs, 9 million did not jobs but were actively seeking employment, and 3 million wanted to work but had given up looking for employment. the unemployment rate is: reviewing a medical record to ensure that all diagnoses are justified by documentation throughout the chart is an example of cani get the answer to this maths question please?[3 marks) 5. (i) Find the gradient at the point (1,2) on the curve given by: x? + xy + y2 = 12 - y2 (ii) Find the equation of the tangent line to the curve going through the point (1,2) [2 marks) por favor ayudame con problema cinco!(please help me with question five after just reading one, two, and three.) Madeline has a smart phone data plan that costs $25 per month that includes 10 GBof data, but will charge an extra $10 per GB over the included amount. How muchwould Madeline have to pay in a month where she used 3 GB over the limit? Howmuch would Madeline have to pay in a month where she used went over by x GB? number of molecules in 4HCl Why is 1 kg of lead easier to carry around all day than 1 kg of feathers? Select the correct answer. Select the place of the digit 9 in this number. 195,487 one thousands hundred thousands tens ten thousands hundreds ones Paul plans to buy a movie that has a regular price of $19.99. It is on sale for 25% off, but Paul will have to pay 6% sales tax. Which is the MOST reasonable estimate of the total cost of the movie including tax?A $14:00B $15:00C $16:00D $17:00 Given the graph of the function f(x) below, find the average rate of change of f(x) from x=2 to x=5 determine the exact values of the six trigonometric functions of the angle 0, when given values (-3/-5,-4/-5) Plz help me well mark brainliest if u are correct!What is the product of 25 and 67-150-1919150 What is the main message of The Song of Achilles? At the pep rally, 14 out of the first 20 students who entered the gym were wearing an Hornedo Hoodie. Based on this information, if 700 students were at the pep rally, how many students could be expected to NOT be wearing an Hornedo Hoodie?