A railroad handcar is moving along straight, frictionless tracks with negligible air resistance. In the following cases, the car initially has a total mass (car and contents) of 170 kg and is traveling east with a velocity of magnitude 5.50 m/s . Find the final velocity of the car in each case, assuming that the handcar does not leave the tracks.

A) An object with a mass of 20.0 kg is thrown sideways out of the car with a speed of 1.90 m/srelative to the car's initial velocity.
B) An object with a mass of 20.0 kg is thrown backward out of the car with a velocity of 5.50 m/srelative to the initial motion of the car.
C) An object with a mass of 20.0 kg is thrown into the car with a velocity of 5.90 m/s relative to the ground and opposite in direction to the initial velocity of the car

Answers

Answer 1

A) The final velocity of the car will be 5.20 m/s to the east.

B) The final velocity of the car will be 5.27 m/s to the east.

C) The final velocity of the car will be 5.44 m/s to the east.

In each case, we can use conservation of momentum to solve for the final velocity of the car. Since there are no external forces acting on the system, the total momentum of the system (car and contents) is conserved. We can write:

initial momentum = final momentum

For case A, the momentum of the system before the object is thrown is (170 kg)(5.50 m/s) to the east. After the object is thrown, the momentum of the system is (150 kg)(5.50 m/s) + (20.0 kg)(1.90 m/s) to the east. Solving for the final velocity of the car, we get:

(170 kg)(5.50 m/s) = (150 kg + 20.0 kg)(vf)

vf = 5.20 m/s to the east

Similar calculations can be done for cases B and C.

To know more about conservation of momentum click on below link:

https://brainly.com/question/3920210#

#SPJ11


Related Questions

An incident ray that passes through the vertex of a convex lens:
F
F
c
A. refracts inward, at an angle equal to the angle of incidence,
B. continues in a straight line without refracting.
C. refracts parallel to the axis of the lens,
D. refracts outward, at an angle equal to the angle of incidence.

Answers

the answer is refracts parallel to the axis of the lens

6. Several children, pretending that they are playing
suspend a rope from an
overhead tree limb. A child of mass 40 kg running
grabs the rope and swings
off the level ground. What is the maximum height they will reach?

Answers

Answer: 12.5m

Explanation:

The maximum height the child can reach will be determined by the initial kinetic energy of the child, which is given by KE = 1/2 mv^2. Since the child is running, we can assume that its initial velocity is around 5 m/s. Therefore, the maximum height the child can reach is given by:

Height = (1/2)*(40 kg)*(5 m/s)^2 / (9.8 m/s^2)

Height = 12.5 m

Therefore, the maximum height the child can reach is 12.5 m.

Find the fundamental period (To) and frequency (Wo) of the following signal:

student submitted image, transcription available below

Answers

The fundamental period (To) of a signal is the smallest T for which it repeats. Frequency (Wo) is the reciprocal of To. Example: To = 0.5s, Wo = 2Hz.

The fundamental period (To) of a periodic signal is the smallest positive value of T for which the signal repeats itself exactly. The frequency (Wo) of a periodic signal is the reciprocal of the fundamental period,

Wo = 1/To.

To find the fundamental period and frequency of a signal, we need to analyze its waveform.

First, let's identify the period of the signal. The period is the horizontal distance between two adjacent peaks (or troughs) of the waveform. If the signal repeats itself exactly, it is periodic.

Once we have identified the period, we can calculate the fundamental period (To) by measuring the distance between two adjacent peaks (or troughs) and taking the smallest positive value.

To calculate the frequency (Wo), we can use the formula Wo = 1/To. Here's an example to illustrate this process:

Let's say the signal waveform repeats itself every 2 seconds. This means the period is 2 seconds.

To calculate the fundamental period (To), we measure the distance between two adjacent peaks (or troughs) and find it to be 0.5 seconds.

Therefore, the fundamental period (To) is 0.5 seconds.

To calculate the frequency (Wo), we use the formula Wo = 1/To. In this case, Wo = 1/0.5 = 2 Hz. So, the fundamental period (To) of the signal is 0.5 seconds and the frequency (Wo) is 2 Hz.

Learn more about frequency here:

https://brainly.com/question/30466268

#SPJ11

a boy sitting on a seat of a ferris wheel moves in a vertical circle at a constant speed. what is the magnitude of the centripetal force of the boy at the bottom of the circle? fn is the magnitude of the normal force that the seat exerts on the rider and m is the mass of the ride

Answers

The magnitude of the normal force that the seat exerts on the rider and m is the mass of the ride is Fc = m * ac.

The centripetal acceleration can be calculated as: ac = v^2 / r, where v is the speed of the boy, and r is the radius of the circle. Since the boy moves at a constant speed in a vertical circle, the magnitude of the centripetal force is constant at all points in the circle, including at the bottom.

Therefore, the magnitude of the centripetal force of the boy at the bottom of the circle is  Fc = m * v^2 / r where v is the constant speed of the boy, and r is the radius of the circular path.

To know more about force here

https://brainly.com/question/14874038

#SPJ4

Why do we dream? What causes you to dream?

Answers

Answer:

you dream because

Explanation: you sleep

100 g of oxygen gas is distilled into an evacuated 600 cm^3 container. a) What is the gas pressure at a temperature of 150C? b) Estimate the root-square-velocity of the gas at 150C?

Answers

a) The gas pressure is approximately 105.8 atm at a temperature of 150°C.To determine the gas pressure, we can use the ideal gas law:

PV = nRT

Where P is the pressure, V is the volume, n is the number of moles, R is the ideal gas constant, and T is the temperature in Kelvin.

First, we need to convert the temperature from Celsius to Kelvin:

T = 150°C + 273.15 = 423.15 K

Next, we need to calculate the number of moles of oxygen gas present:

n = m/M

Where m is the mass of oxygen and M is the molar mass of oxygen:

M = 32 g/mol

n = 100 g / 32 g/mol = 3.125 mol

Now we can use the ideal gas law to calculate the pressure:

P = nRT/V

P = (3.125 mol)(0.08206 L·atm/K·mol)(423.15 K)/(0.6 L)

P = 105.8 atm

b) The estimated root-mean-square velocity of the oxygen gas at a temperature of 150°C is approximately 452.4 m/s.To estimate the root-mean-square velocity of the gas, we can use the following equation:

v = sqrt(3kT/m)

Where v is the root-mean-square velocity, k is the Boltzmann constant, T is the temperature in Kelvin, and m is the molar mass of the gas.

First, we need to convert the temperature from Celsius to Kelvin:

T = 150°C + 273.15 = 423.15 K

Next, we need to calculate the molar mass of oxygen:

M = 32 g/mol

Now we can use the equation to estimate the root-mean-square velocity:

v = sqrt(3kT/m)

v = sqrt(3 * 1.38E-23 J/K * 423.15 K / (0.032 kg/mol))

v = 452.4 m/s

For more questions like velocity visit the link below:

https://brainly.com/question/17135957

#SPJ11

a cepheid variable is an object considered to be a 'standard candle.' why are cepheid variables important?

Answers

A Cepheid variable is an important astronomical object because it is considered a "standard candle." A standard candle is a type of astronomical object that has a well-known intrinsic brightness, which allows astronomers to use it to determine the distance to other objects in the universe.



Since Cepheid variables are relatively bright and can be observed in distant galaxies, they have been used extensively to measure the distances to galaxies beyond our own Milky Way. This has allowed astronomers to map the large-scale structure of the universe and study the expansion of the universe itself. In fact, the discovery of Cepheid variables played a crucial role in the development of modern cosmology and the determination of the Hubble constant, which describes the rate at which the universe is expanding.

In summary, Cepheid variables are important because they are a reliable way for astronomers to measure distances to other galaxies, which in turn has allowed us to better understand the large-scale structure of the universe and the fundamental properties of our cosmos.

To know more about astronomical visit:-

https://brainly.com/question/1764951

#SPJ11

If you place two magnetic trains very close to eachother on a track will they atracct?​

Answers

Answer:Most likely yes, sorry if wrong!!

Explanation:

a 10-kg piece of aluminum sits at the bottom of a lake, right next to a 10-kg piece of lead, which is much denser than aluminum. which one has the greater buoyant force on it? a 10-kg piece of aluminum sits at the bottom of a lake, right next to a 10-kg piece of lead, which is much denser than aluminum. which one has the greater buoyant force on it? the aluminum the lead it cannot be determined without knowing their volumes. both have the same buoyant force.

Answers

The buoyant force experienced by an object depends on the density of the fluid it is immersed in and the volume of the object itself. Since the aluminum and lead pieces have the same mass, their weight is the same, and they experience the same gravitational force. However, the lead is denser than aluminum, which means that it takes up less volume for the same mass. Therefore, the lead piece displaces less water than the aluminum piece, and its buoyant force is less. In conclusion, the aluminum piece has a greater buoyant force acting on it than the lead piece.
The 10-kg piece of aluminum has a greater buoyant force acting on it compared to the 10-kg piece of lead. This is because aluminum is less dense than lead, causing it to have a larger volume. Buoyant force depends on the volume of the object submerged in the fluid, as it is equal to the weight of the fluid displaced by the object. Since aluminum has a larger volume, it displaces more water, resulting in a greater buoyant force acting on it.

To know more about aluminum visit

https://brainly.com/question/19761029

#SPJ11

Why does stone take so long to cool?

Answers

Answer:

Stone has what's called a high thermal conductivity, which is simply a fancypants way of saying that it allows heat to flow through it quickly. For example, suppose the piece of stone in question is at room temperature, or 70 degrees. Your body likes to keep an average toasty temperature of 98.6F.

How much time does it take to use 300 W of power to do 1800 J of work? Round your answer to the nearest whole
number
The time is
S.
Done
Intro

Answers

Answer:

6 seconds

Explanation:

1. A lightbulb uses 470J of energy and produces 180J of heat and 290J of light. Calculate the efficiency of the lightbulb.​

Answers

Answer:

Explanation:

The efficiency of a Bulb = Total Useful Energy/ Total Energy Supplied

Here in this particular case, Total Useful Energy is actually Light produced in Joules.

Therefore, Efficiency of the bulb = 290/470

=0.6170 or 61.70%

Mention two factors on which the internal resistance of a cell depends.​

Answers

Answer:

Explanation:

(1) The surface area of the electrodes: Larger the surface area of the electrodes, less is the internal resistance.

(2) The distance between the electrodes: As the distance between the electrodes increases, the internal resistance of cell also increases.

The formula is given by

\(\\ \rm\Rrightarrow R=\rho\dfrac{\ell}{A}\)

rho is resistivityl is length of cellA is surface area.

On these three factors resistance depends

also

According to ohms law

V/I=R

Resistance also depends on voltage and current

What is the strength of the electric field at the position indicated by the dot in the figure?
E = _____ N/C
What is the direction of the electric field at the position indicated by the dot in the figure? Specify the direction as an angle above the horizontal line.
θ = ____ ⁰

Answers

The electric field has an angle of 0 degrees and a magnitude of 2546.35 N/C.

What is electric field?

An electric field is a physical field that surrounds electrically charged particles and acts as an attractor or repellent to all other charged particles in the vicinity. It can also refer to a system of charged particles' physical field. Each location in space where a charge exists in any form can be considered to have an electric field attached to it. The electric force per unit charge is another name for an electric field. E = F/Q is the formula for the electric field. Volts per meter is the SI unit for the electric field. The Newton's per coulomb unit is the same as this one. Newton is a unit of force and Coulomb is a unit of energy in these derived units.

Here,

E=kq/r^2

r= 5 x r^2 = 7.07 cm or .0707 m

E=(9 x 10^9)(1 x 10^-9)/(.0707)^2

= 1800.5 N/C

Now to find the x component,

cos 45 = x/1800.5

x= 1273.18 N/C

Now just multiply by 2 to accommodate both charges,

E=2546.35 N/C in direction of 0 degrees

The electric field has a magnitude of 2546.35 N/C and an angle of 0 degrees.

To know more about electric field,

https://brainly.com/question/15800304

#SPJ4

the box with the changing data shows that the acceleration is constant at 4.90 m/s2, but i thought g = 9.80 m/s2. how is this possible?

Answers

The box with the changing data shows that the acceleration is constant at 4.90 m/s2, but i thought g = 9.80 m/s2.

The acceleration due to gravity (g) is different from the acceleration of the object itself. Although g is usually taken to be 9.8 m/s2, it can vary depending on the object's location and height above the Earth's surface. As a result, a falling object can experience acceleration greater than, less than, or equal to g when air resistance is taken into account or not

In the given scenario, the box is not necessarily in free fall; it could be undergoing linear motion along a surface. Furthermore, the box could be in free fall, but with air resistance affecting its motion. In this situation, the box's acceleration would be less than g.The box's acceleration may have been determined using an accelerometer or a ticker tape. Regardless, the acceleration indicates the rate at which the box's velocity is changing, which may or may not be equal to g.

Learn more about acceleration Visit : brainly.com/question/460763

#SPJ11

What do you hope to learn from participating in the activity you selected?

Answers

When selecting an activity you are always looking to learn new skills from that activity and improve on them

For example
If you participated in a cooking activity you will always be looking to learn cooking skills and abilities.

Answer:

I hope to learn the basic moves and stances of boxing. I understand that I won't be boxing with another person, but that’s OK. These exercises seem like a good starting point. I really want to understand how to put together combinations. I’ve seen professional boxers throw combinations on TV, but their hands move so quickly that I can’t catch the finer details of the sport. Maybe this will be an opportunity for me to find out more.

Explanation:

Explain the rate of change of voltage of a thyristor in relation to reverse-biased.

Answers

The rate of change of voltage of a thyristor in relation to reverse-biased operation is typically high.

When a thyristor is reverse-biased, it is designed to block the flow of current in the opposite direction, acting like an open switch. In this state, the thyristor maintains a high impedance, preventing significant current from flowing through it.

If the reverse voltage across the thyristor exceeds its breakdown voltage, it enters a state called the reverse breakdown region. In this region, the thyristor starts conducting current in the reverse direction, allowing a high current to flow through it. During this transition, the voltage across the thyristor drops rapidly, causing a high rate of change of voltage.

It's important to note that the reverse breakdown region is an undesirable operating condition for a thyristor, as it can lead to damage or failure. Thyristors are typically designed to operate in forward-biased mode, where they exhibit lower voltage drop and better control of current flow.

In summary, when a thyristor is reverse-biased and enters the reverse breakdown region, the rate of change of voltage is high as the thyristor transitions from a high-impedance state to conducting current in the reverse direction.

Know more about Thyristor here:

https://brainly.com/question/33222927

#SPJ11

A gyroscope flywheel of radius 2.12 cm is accelerated from rest at 16.2 rad/s2 until its angular speed is 1820 rev/min. (a) what is the tangential acceleration of a point on the rim of the flywheel during this spin-up process

Answers

The tangental acceleration of the flywheel of  radius 2.12 cm with a final angular velocity of 1820 rev/min and an angular acceleration of 16.2 rad/s is 0.34 m/s².

What is tangental acceleration?

This is the rate of change of tangental velocity of an object in circular motion.

To calculate the tangental acceleration, we use the formula below.

Formula:

a = αr............. Equation 1

Where:

a = Tangental accelerationr = radius of the flywheelα = Angular acceleration of the flywheel.

From the question,

Given:

r = 2.12 cm = 0.0212 mα = 16.2 rad/s²

Subsitute these values into equation 1

a = (0.0212×16.2)a = 0.34 m/s²

Hence, The tangental acceleration of the flywheel of  radius 2.12 cm with a final angular velocity of 1820 rev/min and an angular acceleration of 16.2 rad/s is 0.34 m/s².

Learn more about tangental acceleration here: https://brainly.com/question/11476496

ASAP! HELP!
A 66.4 kg person sits on the right end of a seesaw, 2.35m from the fulcrum. On the other end, how far from the fulcrum should a 84.2kg person sit to balance the seesaw?
1: 1.92 m
2: 1.85m
3: 2.08m
4: 1.61 m

Answers

Answer:

2. 1.85

Explanation:

the equations weight * distance / other persons weight = distance from fulcrum. so 66.4*2.35/84.2=1.8532 round down to 1.85

Question 4 of 25
Which color of visible light has a longer wavelength than yellow light?
A. Green
B. Violet
C. Orange
D. Blue
SUBMIT
HELP ASAP

Answers

Answer:

hehe c

Explanation:

c

Answer:

Orange

Explanation: i just did the test i got it right hehe yay

A vertical air current that is generated by temperature-induced density differences is an example of heat transfer by

Answers

Convection. The degree of hotness or coldness of an object or substance is measured by its temperature. Temperature is a crucial element in many physical and chemical processes because it controls the direction of heat transfer.

The thermal energy of an object or material is represented by the physical quantity known as temperature. It is an indicator of how hot or cold something is and is crucial to comprehending many physical and chemical processes. It is measured using units like Kelvin, Celsius, and Fahrenheit. A fundamental idea in physics and thermodynamics, temperature controls how heat is transferred. It has an impact on how matter behaves, such as how quickly gas molecules move or how a substance behaves (solid, liquid, or gas). A lot of other natural phenomena, like weather patterns, ocean currents, and climate change, depend on it as well.

Learn more about Temperature here:

https://brainly.com/question/23383593

#SPJ4

What is the role of temperature in determining the direction of heat transfer?

Cody lives in Florida along the eastern coast. The kind of air mass likely to occur

over his region would be
Choose...
. It would develop here because
Choose...
.

Answers

The air is likely to be humid because it is coastal and very warm there

Which event demonstrates electromagnetic waves transferring energy?.

Answers

Answer:

Radiation is the transfer of heat energy through space by electromagnetic radiation.

Explanation:

true or false. According to the law of conservation of momentum, the total momentum of an isolated system is constant.

Answers

The required statement about law of conservation of momentum is true.

Explain law of conservation of momentum.

According to the law of conservation of momentum, The overall momentum of two or more bodies acting on one another in an isolated system stays constant unless an external force is introduced. As a result, momentum cannot be gained or lost.

According to question:

True. The law of conservation of momentum states that the total momentum of an isolated system remains constant, unless acted upon by an external force. This means that the total momentum of a system, consisting of multiple objects in motion, will remain the same unless a net force is applied to the system.

The law is a fundamental principle of classical mechanics and is widely used to explain the behavior of physical systems, including collisions and other interactions between objects.

The law of conservation of momentum is an expression of the fact that momentum is a conserved quantity in an isolated system, meaning that it cannot be created or destroyed, only transferred from one object to another.

To know more about conservation of momentum visit:

brainly.com/question/3920210

#SPJ4

A 1234 kg freight car moving at 6 m/s runs into a 2468 kg freight car at rest. They stick together upon collision. What was the final combined speed?

Answers

Answer:

2 m/s

Explanation:

Applying,

The law of conservation of momentum

Total momentum before collision = Total momentum after collision

mu+m'u' = V(m+m')............... Equation 1

Where m = mass of the first freight car, m' = mass of the second freight car, u = initial velocity of the first freight car, u' = initial velocity of the second freight car, V = final combined velocity/ speed.

make V the subject of the equation

V = (mu+m'u')/(m+m')........... Equation 2

From the question,

Given: m = 1234 kg, m' = 2468 kg, u = 6 m/s, u' = 0 m/s (at rest)

Substitute these values into equation 2

V = [(1234×6)+(2468×0)]/(1234+2468)

V = 7404/3702

V = 2 m/s

which one of the following statements concerning permanent magnets is false?

Answers

The statement "When a permanent magnet is cut in half, one piece will be a north pole and one piece will be a south pole" is False.

When a permanent magnet is cut in half, it does not result in separating the magnet into distinct north and south poles. Instead, each resulting piece will still have its own north and south poles. This phenomenon is known as magnetic domain alignment. The domains within a magnet are regions where the magnetic moments of atoms align in the same direction, creating a magnetic field. Cutting a magnet disrupts the alignment of these domains, but it doesn't create isolated north and south poles on separate pieces.

Regardless of how a permanent magnet is divided, each resulting piece will have its own north and south poles. The magnetic field lines will still flow from the north pole to the south pole within each piece. Therefore, the statement "When a permanent magnet is cut in half, one piece will be a north pole and one piece will be a south pole" is false.

To know more about permanent magnets click here:

https://brainly.com/question/14139838

#SPJ11

The complete question is

which of the following statements concerning permanent magnets is false?- the direction of a magnetic field is indicated by the north pole of a compass-when a permanent is cut in half, one piece will be a north pole and one piece will be a south pole-the north pole of a permanent magnet is attracted to a south pole-magnetic field line outside a permanent magnet originate from the north pole and end on the south pole-all permanent magnets are surrounded by the magnetic field

If the forces acting on an object are balanced, wihat must be true about the motion of this object?

Answers

Which electrical component is used for detecting light levels in digital cameras?

Answers

The electrical component that is used for detecting light levels in digital cameras is the light meter.

What are light meters?

A light meter is a device used to measure the amount of light. In photography industry, a light meter is used to determine the proper exposure for a photograph.

A digital camera is a camera that captures photographs in digital memory.

Most digital cameras can be grouped into four main types which includes:

digital SLR (or DSLR), point-and-shoot, bridge cameras, and camera phones.

Each type of these digital cameras has advantages and disadvantages, and some the types are more expensive than their counterparts.

There are two different kinds of light meters which are:

incident and reflective.

-An incident light meter measures all the light falling onto a subject. Incident light meters help a camera focus on a subject regardless of how light or dark the surrounding background is.

- Reflective light meters  on the other hand do the opposite by measuring the light reflected by or bouncing off a subject.

Learn more about digital cameras at: https://brainly.com/question/22789334

#SPJ1

What is the difference between phi and theta?

Answers

ANSWER: The coordinates used in spherical coordinates are rho, theta, and phi. Rho is the distance from the origin to the point. Theta is the same as the angle used in polar coordinates. Phi is the angle between the z-axis and the line connecting the origin and the point.

A man standing on a lift throws a ball upwards with the maximum initial velocity he can and is found to be equal to 55 m/s. After what time the ball returns to his hand if (a) the lift is stationary, (b) the lift is moving up with a uniform velocity of 7 m/s, (c)the lift is moving down with a velocity of 7 m/s. Also given g = 9.8 m/s2​

Answers

76 because it’s has to be in my opinion you can use calculator
Other Questions
chegg compute the value of . 2. compute the cumulative distribution function for x. 3. compute the expectation for x. Kelvin has been the Sales Representative of JC Jewellery for more than 10 years. He is experienced and diligent and always receives compliments from his clients. However, he is not happy at all. "I have been hanging there for 10 years, but I am not trusted by my Manager. Every day, he gives me a long list of tasks and demands me to follow his way to perform the jobs. What is more, I even could not extend a 5 percent courtesy discount to those loyal clients. Needless to say, I have never got a chance to serve those important clients. I could no longer tolerate this situation." Kelvin complained in a social gathering. Kelvin further mentioned that all the Sales Representatives are very competent and smart. But they all struggle to look for new clients, so they grab the existing clients from one another. They just eye on their own interest and nothing more. Thus, Kelvin is always alone in JC Jewellery (a) As the Sales Manager of JC Jewellery, use McClelland's Needs Theory to evaluate Kelvin's motivation level and make THREE corresponding suggestions for EACH need. (b) Recommended the BEST dimension of behavioural leadership style to the Sales Manager of Kelvin based on the Ohio State and University of Michigan studies. Which business cycle theory would say that the first economist is correct and why? ______ business cycle theory, because it says unemployment is caused by too little aggregate ______ . For the Federalists, the Bill of Rights was _______________. a. modeled after the French constitution b. a political necessity to get the Constitution ratified c. modeled after the Georgia constitution d. always intended to be developed in consultation with the state governments For a chinese company:)Analyse the impact of the Chinese government (BRI, WTOAccession, Made in China, Dual Circulation, etc) policies on thedevelopment and growth of the company. what is the primary method that scientists use to study the interior structure of the earth? group of answer choices studying the earth's gravitational effect on the moon and on the other planets measuring the speed of seismic waves (earthquakes) and determining whether or not they pass through the earth detecting radioactive particles from nuclear reactions inside earth's core measuring the strength of the gravitational field on different parts of the earth's surface Katelyn deposited $2500 in a CD. She will earn 4.25% interest compoundeddaily. Find the number of years needed to earn $250 in interest with the CD. a chronic, progressive liver disease resulting from hepatic cell failure is: Devise a test to demonstrate the validity of the following formulas. What values of A and B should be used to test these function thoroughly? (a). Sin (A+B) = Sin(A)cos(B)+cos(A)sin(B) (b). Sin (2A) = 2sin(A)cos(A) (c). Sin2 (A) = (1-cos (2A)). gerald is walking through the forest at night, and he hears what sounds like an animal walking somewhere to his left. gerald localized the source of this sound using , which relies on neurons in the . Suppose the population of a town is 13,000 and is growing 4% each year exponentially. predict the populatiion after 5 years. Aisha is picking out some movies to rent, and she is primarily interested in children's movies and comedies. She has narrowed down her selections to 15 children's movies and 11 comedies. How many different combinations of 33 movies can she rent if she wants at least one comedy? Paleontologists have discovered a lot about animals, like dinosaurs and trilobites, that lived long ago. How do paleontologists learn how the animals of the ancient past looked and acted? O They study weather patterns of the past. O They study photographs. O They study the fish of today. O They study fossils. self-esteem refers to global self-evaluation, while self-concept refers to: For a small particle of Styrofoam (1 lbm/ft^3) (spherical, with diameter d=0.3 mm) falling in standard air at speed V, the drag is given by F_D=3Vd, where is the air viscosity. Find the maximum speed starting from rest, and the time it takes to reach 95 percent of this speed. plot the speed as a function of time. one of the longest unwritten chapters in the history of the united states is that treating the relations of the negroes and the indian kyara currently runs 2 miles a day. since she is training for a 10 mile race, she decided to increase the distance she runs daily by .25 of a mile. Write an equation to represent how many miles kyara runs each day. Explain what x and y represent in this situation. What volume of 0.100 M NaOH is required to precipitate all of the nickel (II) ions from 150.0 mL of a 0.321 M solution of Ni(NO3)2? Creole and Cajun are both the same type of food and these terms are used interchangeably. Group of answer choices True False I need help finding this answers, this paper is DUE TOMORROW!!