A 5.0-L sample of sulfur hexafluoride (SF6) is stored at a temperature of 250.0 K and a pressure of 67.0 Pa. If the pressure is decreased to 60.0 Pa, what will the new temperature be?

Answers

Answer 1

Answer:279.1 K

Explanation:

You'll be using Gay-Lussac's Law for this. P1/T1=P2/T2

I have a class for this, and one of the practice questions was formatted this way, so I used that format and substituted said numbers as needed

P1:67 Pa

P2:60 Pa

T1:250 K

T2:?

I really hope this helps!

A 5.0-L Sample Of Sulfur Hexafluoride (SF6) Is Stored At A Temperature Of 250.0 K And A Pressure Of 67.0

Related Questions

what is your definition of science?

**ANSWER AND ILL GIVE YOU BRAINLIEST ANSWER**

Answers

1 : knowledge about the natural world that is based on facts learned through experiments and observation. 2 : an area of study that deals with the natural world (as biology or physics) 3 : a subject that is formally studied the science of linguistics.

Identify the stronger acid in each pair.
A. HCN or H3O+
HCN
H3O+
They are the same in acidic properties.
B. H2SO4 or HCN
H2SO4
HCN
They are the same in acidic properties.
C. HS? or H2S
HS?
H2S
They are the same in acidic properties.

Answers

A. In this pair, H3O+ is the stronger acid because it can donate a proton more easily than HCN.
B. H2SO4 is the stronger acid in this pair because it is a strong acid, while HCN is a weak acid.
C. HS? is the stronger acid in this pair because it has a greater positive charge on the sulfur atom, making it more acidic than H2S.

The stronger acid in each pair.


A. Between HCN and H3O+, the stronger acid is H3O+. H3O+ is a stronger acid due to its higher ability to donate a proton.

B. Between H2SO4 and HCN, the stronger acid is H2SO4. H2SO4 is a stronger acid because it has a higher degree of ionization and can donate more protons than HCN.

C. Between HS- and H2S, the stronger acid is H2S. H2S is a stronger acid because it more readily donates a proton compared to HS-.

Learn more about stronger acid

brainly.com/question/31147529

#SPJ11

A chemist is studying the rate of the Haber synthesis: N2 + 3H2 2NH3

Starting with a closed reactor containing 1. 25 mol/L of N2 and 0. 50 mol/L of H2, the chemist finds that the H2 concentration has fallen to 0. 25 mol/L in 44 seconds. What is the N2 concentration after 44 seconds?

Answers

The concentration of the nitrogen after 44 seconds is 0.0175 mol/L.

What is the concentration of the nitrogen after 44 second?

We know that the rate of reaction has to do with how fast or slow that the reaction is progressing. If the reaction is not progressing that fast we could say that the rate of reaction is slow but if the reaction is moving on quite fast we could say that the rate of the reaction is fact.

Having said this, we can see that the reaction that we have here is the Haber process and it involves the combination of the hydrogen and the nitrogen to form the product of the reaction.

Rate of consumption of hydrogen = 0. 25 mol/L - 0. 50 mol/L /44 s

= -5.68 * 10^-3  mol/Ls-1

For the nitrogen molecule we would now have;

3/2 *  -5.68 * 10^-3  = M - 1.25/44

Let M be the final concentration of the nitrogen

-8.5* 10^-3 + 0.026 = M

M = 0.0175 mol/L

Learn more about concentration:https://brainly.com/question/10725862

#SPJ1

Ali notices that the electrical cord on his microscope is frayed near the plug. He takes the microscope to his teacher and asks for permission to use another one.

Answers

Yes, Ali did the correct job by taking the microscope to his teacher and asks for permission to use another one.

We should never use equipment with frayed or damaged electrical cord and should inform our teacher or lab assistant immediately. This situation comes under measure lab safety rules.These and all other electrical equipment used in lab settings provide a risk of electric shock injuries, fires from faulty installations or maintenance, and fires from sparks acting as an ignition source for flammable or combustible chemicals.Discover where your electrical panels and shut-off switches are so you can immediately turn off the power in an emergency. Always provide at least three feet of space around electrical panels so that people can easily access them.Working with damaged equipment or electric cord can lead to big accidents in the labs.

It shows Ali followed lab safety rule properly.

Learn more about lab safety rules here:

https://brainly.in/question/13414900

#SPJ9

which micropipette should you use to most accurately dispense 125 microliters of solution?

Answers

An adjustable-volume micropipette with a range of 0.5-10 μL would be the most accurate for dispensing 125 μL of solution.

What is the micropipette ?

A micropipette is a precision instrument used to accurately measure and transfer very small volumes of liquid, typically between 0.5 µL and 10 mL. It is commonly used in laboratories to prepare samples for chemical analysis and in medical applications to dispense precise amounts of medication. The micropipette is composed of a plunger, a tip, and a cylinder. The plunger is used to draw liquid into the tip, and the cylinder is used to release the liquid. The micropipette is usually operated using a thumbwheel or a push button that controls the plunger. The tip of the micropipette is designed to fit a range of different sized microtubes, allowing for accurate and repeatable transfer of liquids. The micropipette can be calibrated for accuracy, making it an invaluable tool for laboratories that need precise measurements of liquids.

To learn more about micropipette

https://brainly.com/question/28425080

#SPJ4

Which particle is NOT made up of quarks?
A: a proton
B: a neutron
C: an electron

Answers

Answer: C: an electron

Explanation:

Answer:

C: electrons

Explanation:

When a piece of aluminum is placed in a 25-mL graduated cylinder that contains 10.5 mL of water, the water level rises to 13.5 mL. What is the mass of the aluminum?

Answers

Answer:

Mass of the sample of aluminium = m

Volume of the aluminium = V

Density of the aluminum = d = 2.7 g/mL

Initial level of water mark in cylinder = 10.0 mL

Final level of water after sample is immersed = 18.0 mL

Volume occupied by the sample = V = 18.0 mL - 10.0 mL = 8.0 mL

Explanation:

pls mark me as the brainliest

Answer:

The mass of the aluminium sample is 21.6 grams.

Explanation:

Mass of the sample of aluminium = m

Volume of the aluminium = V

Density of the aluminum = d = 2.7 g/mL

Initial level of water mark in cylinder = 10.0 mL

Final level of water after sample is immersed = 18.0 mL

Volume occupied by the sample = V = 18.0 mL - 10.0 mL = 8.0 mL

The mass of the aluminium sample is 21.6 grams.

You are asked to make 12 moles of iron(Fe) from iron oxide and carbon monoxide.

Fe2O3(s) + 3CO(g)→2Fe(l) + 3CO2(g)

Approximately how many moles of iron oxide(Fe2O3) is used?

Answers

From the equation we can see that

1mol of Fe2O_3 gives 2mol Fe

Moles of Fe=12

Moles of Fe_2O_3:-

122=6mols

As per the given balanced chemical equation, one mole of iron oxide gives 2 moles of metallic iron. Therefore, 6 moles of Fe₂O₃ is required to produce 12 moles of iron.

What is iron (III) oxide ?

Iron is a transition metal showing variable oxidation states. Iron is highly reactive towards oxygen  and water. Iron reacts with oxygen gives iron oxide Fe₂O₃ which is an important ore of iron.

The reaction of iron oxide with carbon monoxide gives metallic iron and carbon dioxide. As per the given balanced chemical equation of this reaction 1 mole of Fe₂O₃ gives 2 moles of Fe.

Hence, number of moles of Fe₂O₃ required to produce 12 moles of Fe is calculated as follows:

Moles of Fe₂O₃ = 12/2 = 6 moles.

Therefore, 6 moles of Fe₂O₃ is required to produce 12 moles of Fe.

Find more on Fe₂O₃:

https://brainly.com/question/2349775

#SPJ2

Count the total number of atoms in the chemical formula 5H2O2

Answers

Answer:

20 atoms

Explanation:

There are 4 in H2O2 because of 2 hydrogens and 2 oxygens.

Then, multiply by 5 because the coefficient is 5, therefore there are 5 H2O2 molecules.

5 x 4 = 20

The total number of atoms in the chemical formula 5H₂O₂ is 20.

What do you mean by the chemical formula ?

The term chemical formula is defined as a way of presenting information about the chemical proportions of atoms that represent a particular chemical compound or molecule, applying chemical element symbols, numbers, and sometimes also other symbols, such as parentheses, dashes, brackets, commas.

There are three types of chemical formula that are structural, molecular and empirical chemical formula.

There are four atoms in H₂O₂ because of two atoms of hydrogen and two atoms of oxygen. Then, multiply by five because the coefficient is five, therefore there are 5 H₂O₂ molecules.We get,

= 5 x 4

= 20

Thus, The total number of atoms in the chemical formula 5H₂O₂ is 20.

To learn more about the chemical formula, follow the link;

https://brainly.com/question/29031056

#SPJ6

Which of the following has the larger atomic radius?
O Cs
O Ca
O Li
O Ba

Answers

Cs has the larger atomic radius

Hope it helps

The abundance of 3 isotopes of magnesium of mass numbers 24,25 and 26 are 78.6%, 10.1%, and 11.3% respectively. What is the relative atomic mass of magnesium?

Answers

This is really asking for the average mass of a magnesium atom, so multiply the masses by their respective abundance (converting percentage to decimal equivalent), add those products together, and viola! Note: the masses on amu’s are absolute (infinite significant figures. The abundance’s have 3 sig figs, and so should your answer…)

24 x 0.790 = 19.0 amu

25 x 0.100 = 2.50 amu

26 x 0.110 = 2.86 amu

(Because of the 19.0, the sig figs go only to the 1/10 decimal place)

19.0 + 2.5 + 2.9 = 24.4 amu or g/mole
3.3K viewsView 1 upvoteAnswer requested by
Janu Pedia

1





Profile photo for DuckDuckGo
DuckDuckGo
·
Follow
Tired of being tracked online? We can help.Jan 12
Promoted

can you pair electrons in degenerate orbitals before filling each orbital halfway

Answers

When degenerate orbitals are being filled, single electrons are placed into each degenerate orbital before they are paired with another electron in the same orbital.

which cells carry nutrients from food to the rest of the cells in the body?​

Answers

Answer: The circulatory system.

Explanation: The circulatory system, which is part of the "cardiovascular" system, is one of the eleven organ systems of the human body. Its main function is to transport nutrients to cells and wastes from cells (Figure 3.4. 1). This system consists of the heart, blood, and blood vessels.

The blood cells carry nutrients from food to the rest of the cells in the body.

What is the circulatory system?

The human circulatory system moves important nutrients and minerals throughout the body and metabolic waste products out from the body. The human circulatory system contains blood, blood vessels, heart, and lymph.

The human circulatory system provides essential nutrients, minerals, oxygen, and hormones to different parts of the body and is responsible for collecting toxins from the cells and tissues to be purified or eliminated from the body.

The human circulatory system contains a wide network of blood vessels. These constitute arteries, veins, and capillaries. The primary function of blood vessels is to transport nutrients and oxygenated blood to all parts of the body.

The Circulatory system helps in sustaining all the organ systems and transports blood, nutrients, oxygen, and hormones throughout the body. It secures cells from pathogens and acts as an interface for cell to cell interaction.

Learn more about the Circulatory system, here:

https://brainly.com/question/10103458

#SPJ2

How many grams are in 0.44 moles of C2H6?

Answers

Answer: Im pretty sure it is 13.23037759999987 because I just used a calculator.

Explanation:

Answer:

13.23 grams C2H6

Explanation:

Convert 0.44 moles to grams

13.23 g C2H6

Hope this helps!

Describe what happened in the experiment. Use your observations in your description. Be sure use the relationship between pressure and volume of a gas to explain your observations.

Answers

Answer:

This relationship between temperature and pressure is observed for any sample of gas confined to a constant volume. I find that temperature and pressure are linearly related. If the temperature on the kelvin scale increases by a certain factor, the gas pressure increases by the same factor. On the can is the warning “Store only at temperatures below 120 °F (48.8 °C). Do not incinerate.” The can contains an amount of isobutane gas at a constant volume, so if the temperature increased by heating, the pressure will increase proportionately. High temperature could lead to high pressure, causing the can to burst. Just like,  The gas in the can is initially at 24°C,  and the can has a volume of 350 mL.  If we fill a balloon with air and seal it,  If we put the balloon in a refrigerator, the gas inside gets cold and the balloon shrinks. If we make the balloon very cold, it will shrink a great deal, and it expands again when it warms up. Temperature is sometimes measured with a gas thermometer by observing the change in the volume of the gas as the temperature changes at constant pressure. A volume change caused by a temperature change at constant pressure means we should use Charles’s law. Decreasing the volume of a contained gas will increase its pressure, and increasing its volume will decrease its pressure. In fact, if the volume increases by a certain factor, the pressure decreases by the same factor, and vice versa.  The earth’s atmosphere exerts a pressure, as does any other gas. Although we do not normally notice atmospheric pressure, we are sensitive to pressure change, for example, when your ears “pop” during take off and landing while flying, or when you dive underwater.  Although the force of each collision is very small, any surface of appreciable area experiences a large number of collisions in a short time, which can result in a high pressure. In fact, normal air pressure is strong enough to crush a metal container when not balanced by equal pressure from inside the container.  Atmospheric pressure is caused by the weight of the column of air molecules in the atmosphere above an object, such as the tanker car. At sea level, this pressure is roughly the same as that exerted by a full-grown African elephant standing on a doormat, or a typical bowling ball resting on your thumbnail. These may seem like huge amounts, and they are, but life on earth has evolved under such atmospheric pressure. If you actually perch a bowling ball on your thumbnail, the pressure experienced is twice the usual pressure, and the feeling is unpleasant.

Explanation:

A contained gas's pressure rises as its volume decreases, while its pressure falls as its volume rises. In fact, if the volume increases by a certain factor, so does the pressure, and vice versa. The earth's atmosphere, like any other gas, exerts pressure.

What is the relationship between pressure and volume in gas?

Boyle's Law describes the relationship between pressure and volume. The volume of a gas decreases as the pressure on it increases because the gas particles are forced closer together. As the pressure on a gas decreases, the volume of the gas increases because the gas particles can now move farther apart.

As a result, volume is inversely proportional to pressure. A straight line is obtained by plotting pressure (p) against the reciprocal of volume (1/V), the gradient of which is the constant in Boyle's Law. The number of gas particles per unit volume increases as volume decreases.

The pressure-volume relationship of a confined gas is inversely proportional. This relationship is demonstrated by the data collected and the graphs plotted.

Thus, A contained gas's pressure rises as its volume decreases, while its pressure falls as its volume rises.

To learn more about pressure and volume, follow the link;

https://brainly.com/question/5018408

#SPJ2

What is the mass of 1.84 mol NaCl? Give your answer to the correct number of significant figures. (Molar mass of NaCl = 58.44 g/mol) 1.84 mol NaCl = g NaCl

Answers

Answer:

108

Explanation:

Correct on edg2020

Answer:

108

Explanation:

1.84 mol NaCl  times 58.44 g NaCl all over 1 mol NaCl= 108g NaCl.

The Mol NaCl from the 108 cancles the mol NaCl from the one, leaving the 58.44 g mol NaCl.

1.84 times 58.44 g NaCl= 107.5=108

Use the change of base rule to find the logarithm to four decimal places. log 143.2 O 0.2213 O 4.5186 2.2593 O
0.4771

Answers

Using the change of base rule to find the logarithm to four decimal places. the correct answer is 11.4235.

To find the logarithm of 143.2 using the change of base rule, we can choose any base we prefer. Let's use base 10 and natural logarithm (base e) for this calculation.

First, we'll use the change of base formula, which states that log(base b) x = log(base c) x / log(base c) b. In this case, we'll calculate log(base 10) 143.2.

We'll use the natural logarithm (ln) as our intermediary step. The natural logarithm of 143.2 can be calculated as ln(143.2).

Using a calculator, we find that ln(143.2) is approximately 4.9628.

Next, we need to calculate log(base 10) e, which is the logarithm of e with base 10. Using a calculator, we find log(base 10) e is approximately 0.4343.

Finally, we apply the change of base formula:

log(base 10) 143.2 ≈ ln(143.2) / log(base 10) e
                ≈ 4.9628 / 0.4343
                ≈ 11.4235

Rounding to four decimal places, the logarithm of 143.2 using base 10 is approximately 11.4235.


Learn more about logarithm here :-

https://brainly.com/question/30226560

#SPJ11

what is the symbol of the element located in period 3 with the following lewis dot structure:

Answers

The symbol of the element located in period 3 with the following Lewis dot structure would depend on the specific structure in question.

However, generally speaking, elements in period 3 of the periodic table include sodium (Na), magnesium (Mg), aluminum (Al), silicon (Si), phosphorus (P), sulfur (S), chlorine (Cl), and argon (Ar). These elements have different Lewis dot structures based on their number of valence electrons and electron configuration. For example, sodium has one valence electron and would have a Lewis dot structure of Na: •. Silicon has four valence electrons and would have a Lewis dot structure of Si: ••••. Knowing the number of valence electrons and the electron configuration can help determine the Lewis dot structure and ultimately, the symbol of the element in question.

To know more about Lewis dot structure visit:

https://brainly.com/question/28652824

#SPJ11

A4
notebook
(d) Ionic bonds often have some covalent character. This is influenced by the sizes and
charges of the ions involved. State how these two factors must change, for positive
ions and then for negative ions, to increase the covalent character in an ionic bond.
(i) Positive ions:
[1]
(ii) Negative ions:
[1]

Answers

Positive ions must shrink and have a stronger positive charge in order to increase the covalent nature of an ionic connection. Smaller ions can approach negatively charged ions, increasing their attraction and increasing the likelihood that electrons will be transferred.

The attraction between the two ions is increased by a stronger positive charge on the ion, increasing the likelihood that electrons will be transferred.

Negative ions must expand and have a stronger negative charge in order to increase the covalent nature of an ionic connection. The electrical attraction between the two ions is lessened as a result of larger ions putting more space between themselves and the positive ions.

It is more difficult for the electrons to be entirely transferred from one ion to the other when the ion has a higher negative charge, which leads to some degree of electron sharing between the two ions.

Ionic bonds

Positively charged ions and negatively charged ions can form ionic bonds, which are defined by the transfer of electrons from one ion to another.

These ionic bonds, however, can have a covalent nature, which means that the two ions share some electrons to some extent.

The sizes and charges of the ions involved have an impact on the covalent nature of an ionic bond.

A smaller size and a larger positive charge will increase the covalent nature of the binding when positive ions are present.

This is due to the fact that smaller ions are more attracted to one another since they can be brought closer to one another.

learn more about Ionic bonds here

https://brainly.com/question/13526463

#SPJ1

what happened to the ionization energy of hydrogen"H" when its electron affinity​

Answers

Electron affinity increases upward for the groups and from left to right across periods of a periodic table because the electrons added to energy levels become closer to the nucleus, thus a stronger attraction between the nucleus and its electrons.

How many copper atoms are in a 70g copper

Answers

Answer:

x=6.634×1023atoms

Explanation:

The quantity of atoms within the mass of copper is determined by multiplying the quantity of moles by the Avogadro's Number:

x=(70g63.546gmol)(6.022×1023atomsmol)

x=6.634×1023atoms

Answer:

6.64x10^23 atoms.

Explanation:

From Avogadro's hypothesis, 1 mole of any substance contains 6.02x10^23 atoms. This implies that 1 mole of Cu also contains 6.02x10^23 atoms.

1 mole of Cu = 63.5g

If 63.5g of Cu contains 6.02x10^23 atoms,

Then 70g of Cu will contain = (70x6.02x10^23) /63.5 = 6.64x10^23 atoms.

Therefore, there are 6.64x10^23 atoms in 70g oh Cu

Consider this coffee cup calorimetry experiment: a. 100 mL of water at 86.0 ∘

C was poured into 100 mL of water at 23.5 ∘

C in a coffee cup calorimeter, and the temperature of the contents of the calorimeter equilibrated to 53.5 ∘

C before beginning to fall to room temperature. Calculate the heat capacity of the calorimeter. (The density and specific heat of water or any aqueous solution can be assumed to be 1.00 g/mL and 4.184 J/g⋅ ∘

C, respectively) b. 100 mL of 2.00M acetic acid was added to 100 mL of 2.00MNaOH at 23.5 ∘

C and the temperature of the solution equilibrated to 36.3 ∘

C. Calculate an enthalpy of neutralization for acetic acid, using the calculated heat capacity of the coffee cup.

Answers

The heat capacity of the calorimeter is 419 J/∘C. The heat capacity can be measured for a specific quantity of a substance or for a system containing that substance.

What is Heat Capacity?

Heat capacity is a physical property of a substance that describes how much heat energy is required to raise the temperature of that substance by one degree Celsius or one Kelvin. The heat capacity of a substance is typically represented by the symbol C and has units of joules per degree Celsius or joules per Kelvin.

To calculate the heat capacity of the calorimeter, we can use the formula:

q = CΔT

where q is the heat absorbed or released, C is the heat capacity of the calorimeter, and ΔT is the change in temperature.

In this case, the heat absorbed by the cooler water is equal to the heat released by the warmer water:

q = -q = -mCΔT

where m is the mass of water (100 g or 100 mL), and ΔT is the temperature change (86.0 - 53.5 = 32.5 ∘C).

Using the specific heat of water, we can calculate the heat absorbed by the cooler water:

q = mCΔT = (100 g)(4.184 J/g⋅ ∘C)(32.5 ∘C) = 13630 J

Therefore, the heat capacity of the calorimeter can be calculated as:

C = q/ΔT = 13630 J/32.5 ∘C = 419 J/∘C

To know more about Heat Capacity, visit;

https://brainly.com/question/21406849

#SPJ4

Predict how an amino acid with the chemical formula c5h9no4 is transported through the water-based blood stream to all body cells that need it. This amino acid.

Answers

The amino acid with the chemical formula C5H9NO4 is transported through the water-based bloodstream to all body cells that need it via active transport mechanisms.

How does active transport facilitate the transportation of amino acids to body cells?

Active transport plays a crucial role in transporting amino acids with the chemical formula C5H9NO4 to body cells. Active transport is a process that requires energy expenditure to move substances across the cell membrane against their concentration gradient. In the case of amino acids, specific carrier proteins embedded in the cell membrane facilitate their transport.

These carrier proteins bind to the amino acids and undergo conformational changes, allowing the amino acids to be transported across the cell membrane. This process occurs against the concentration gradient, meaning that amino acids are transported from areas of lower concentration to areas of higher concentration. The energy required for active transport is typically provided by ATP (adenosine triphosphate), the cell's primary energy currency.

Learn more about chemical formula

brainly.com/question/32018188

#SPJ11

he source of starting materials for synthetic polymers is primarily
A) plants.
B) petroleum and natural gas.
C) recycled plastics.
D) animals.

Answers

Answer:

He source of starting materials for synthetic polymers is primarily petroleum and natural gas.

Explanation:

The primary source of starting materials for synthetic polymers is petroleum and natural gas. These fossil fuels contain hydrocarbon molecules that serve as the building blocks for the production of various synthetic polymers. The process involves extracting and refining crude oil and natural gas to obtain the desired hydrocarbon compounds, which are then used as feedstocks in polymer synthesis.

Petroleum-based starting materials, such as ethylene and propylene, are extensively used in the production of polymers like polyethylene and polypropylene, respectively. These polymers have a wide range of applications, including packaging materials, plastic bags, bottles, and various other plastic products.

While plants can be a source of some natural polymers, such as cellulose or starch, which are used in applications like paper, textiles, and biodegradable packaging, they are not the primary source for the production of synthetic polymers. Synthetic polymers, which account for a significant portion of the plastics and synthetic materials used in modern society, are primarily derived from petroleum and natural gas feedstocks.

Recycled plastics (option C) can be used as a secondary source of materials for polymer production. By recycling and processing used plastic products, the plastic can be reprocessed and used as a feedstock in the production of new polymers. However, recycled plastics currently make up a relatively smaller proportion of the overall raw materials used for synthetic polymers.

Animals (option D) are not a significant source of starting materials for synthetic polymers. While certain natural polymers, such as collagen or keratin, are derived from animal sources, they are not commonly used as feedstocks for the production of synthetic polymers on a large scale.

Learn more about petroleum and natural gases here, https://brainly.com/question/9247574

#SPJ11

calculate the volume occupied by 6.4g of oxygen, 02 at stp?,​

Answers

Answer:

4.9 L O₂

General Formulas and Concepts:

Atomic Structure

Reading a Periodic TableMolesSTP (Standard Conditions for Temperature and Pressure) = 22.4 L per mole at 1 atm, 273 K

Stoichiometry

Using Dimensional Analysis

Explanation:

Step 1: Define

Identify variables

[Given] 6.4 g O₂ at STP

[Solve] L O₂

Step 2: Identify Conversions

[STP] 1 mol = 22.4 L

[PT] Molar Mass of O: 16.00 g/mol

Molar Mass of O₂: 2(16.00) = 32.00 g/mol

Step 3: Convert

[DA] Set up:                                                                                                       6.4 g O2(1 mol O232.00 g O2)(22.4 L O21 mol O2)[DA] Divide/Multiply [Cancel out units]:                                                           4.48 L O2

Step 4: Check

Follow sig fig rules and round. We are given 2 sig figs.

4.48 L O₂ ≈ 4.9 L O₂

What is the molecular formula of ammonia calcium carbonate.​

Answers

Answer: The molecular formula of ammonia is NH3.

Explanation:

Ammonia and calcium carbonate are two separate compounds, each with their own molecular formulas.

The molecular formula of ammonia is NH3. It consists of one nitrogen (N) atom bonded to three hydrogen (H) atoms.

The molecular formula of calcium carbonate is CaCO3. It consists of one calcium (Ca) atom bonded to one carbonate ion (CO3), which in turn consists of one carbon (C) atom bonded to three oxygen (O) atoms.

Therefore, there is no single molecular formula for "ammonia calcium carbonate" as it refers to a combination of two distinct compounds.

How many moles of NaF are produced in the resction between sodium bromide and calcium fluoride when 550 grams of sodium bromide are used

Answers

Answer: 5 moles of NaF would be produced when 550 grams of Sodium bromide are used.

Explanation:

From the question, the balanced chemical formula is illustrated below:

2NaBr + CaF2 → 2NaF + CaBr2

From the equation above;

Molecular mass of NaBr = 23 + 80 = 103g/ mol

Molecular mass of CaF2= 40+ (19×2)= 78g/ mol

Molecular mass of NaF = 23+19 = 42g/ mol

From the balanced chemical equation;

2 moles of NaBr reacted with 1mole of CaF to give 2 moles of NaF.

That is, 2 moles of NaBr= 2× 103 = 206g

2moles of NaF = 2×42= 84g

If 206g of NaBr yielded 84g of NaF

Therefore 550g of NaBr will yield Xg of NaF

X= 550×84/206

X= 224.27g of NaF

But 42g = 1 mole of NaF

Therefore 224.27g = X mole of NaF

X= 224.27 ×1/42

X is approximately 5moles.

What term describes the relationship between the mass and volume of a substance?

Answers

Answer:

Density

Explanation:

Density is a physical property that describes the relationship between mass and volume. Density is the amount of matter in a given space, or volume.

Answer:

The relationship between the mass and volume of a substance is known as its density. Density is defined as the mass of a substance per unit volume. In other words, it is a measure of how much matter is packed into a given space. The density of a substance is determined by dividing its mass by its volume. For example, if a substance has a mass of 10 grams and a volume of 2 cubic centimeters, its density would be 10 grams / 2 cubic centimeters = 5 grams/cubic centimeter. Density is an important physical property of substances, as it can be used to identify and classify different materials and understand their behavior.

pls award brainliest!

Explanation:

Lead ions can be removed from solution by precipitation with sulfate ions. Suppose a solution contains lead(II) nitrate.

Lead ions can be removed from solution by precipitation with sulfate ions. Suppose a solution contains

Answers

1) List the compounds involved in the reaction.

Lead (II) nitrate

Potassium sulfate

Lead (II) sulfate

Potassium nitrate.

2) Write the formula of every compound.

Lead (II) nitrate: Pg(NO3)2

Potassium sulfate: K2SO4

Lead (II) sulfate: PbSO4

Potassium nitrate: KNO3

3) Write the chemical equation

.

Pb(NO3)2+K2SO4PbSO4+KNO3

List the elements (or polyatomic ions) in the reactants.

Pb: 1

NO3: 2

K: 2

SO4: 1

List the elements (or polyatomic ions) in the products.

Pb: 1

NO3: 1

K: 1

SO4: 1

Balance K.

Pb(NO3)2+K2SO4PbSO4+2KNO3

List the elements (or polyatomic ions) in the reactants.

Pb: 1

NO3: 2

K: 2

SO4: 1

List the elements (or polyatomic ions) in the products.

Pb: 1

NO3: 2

K: 2

SO4: 1

4) Balanced chemical equation.

Pb(NO3)2(aq)+K2SO4(aq)PbSO4(s)+2KNO3(aq)

.

Please help! Worth 20 points and I’ll give brainliest.

Please help! Worth 20 points and Ill give brainliest.

Answers

-138.7 kJ/mol is the answer, ive done this question before
Other Questions
Fill in the blanks to explain Herrs goal. Is these correct ??? Insurers must screen all marketing plans to ensure that an advertisement does NOT use as the name of any kind of an annuity contract any phrase that. Simplify (7/2a)*(5/a^2) In 'Harry Potter'. Professor Snape's first name, Severus, means serious, strict, and severe. The character of Professor Snape is also serious andstrict. This is an example of which of the following?Denotation and connotation working togetherO DenotationConnotationDenotation and connotation opposing each other using the data, calculate the growth rate in cells ml hour of the bacterial population between hours 2 and 4. 3 Ba(ClO3)2 + 1 Al2(SO4)3 - 3 Basoa + 2 Al(ClO3)3What is the percent yield of a reaction that was expected to yield 45. 8 grams of Baso, andyielded 38. 4 grams of Baso? How are Hadith related to the sunnah Given the equation 4square root of x minus 3 = -12, solve for x and identify if it is an extraneous solution.A. x = 0, solution is extraneousB. x = 0, solution is not extraneousC. x = 12, solution is extraneousD. x = 12, solution is not extraneous 1Chapter TestFind the length of QS. Explain how you found your answer.1.2.Q12R19SExplain Hi guys can you answer my math question The drag force, Fd, imposed by the surrounding air on a vehicle moving with velocity V is given by Fd=CdArhoV2/2 where Cd is a constant called the drag coefficient, A is the projected frontal area of the vehicle, and rho is the air density. An automobile is moving at V=30 miles per hour with Cd=0.28,A=25ft2, and rho=0.075lb/ft3. Determine the force, in lbf, and the power, in hp, required to overcome aerodynamic drag. Step 1 Determine the force, in Ibf, required to overcome aerodynamic drag. Fd= lbf what did roosevelt request from business leaders in exchange for the adoption of an antideflation program 2x-10+2x-5=3x+1Find XSeriously I can't with Algebra _______1) Ophiolites are A) a sequence of rocks that are typically found in collisional orogens, B) a sequence of rocks that have a gross chemical similarity to oceanic lithosphere, C) a sequence of rocks whose seismic velocities are similar to those of oceanic lithosphere, D) A, B, & Cor E) none of the above. _______2) Layering of continental crust is poorly defined and reflects its complex geological history. T/F 3) Transfer of heat in the lithosphere is primarily by the process of A) advection, B) conduction, C) convection, D) conflation, or E) A & B. what is 2+2 i got 5 but my math teacher says its wrong I have a math test tomorrow I need very much help spanish:lo que es 2 2 tengo 5, pero mi profesor de matemticas dice que est mal tengo una prueba de matemticas maana necesito mucha ayuda The great depression of the 1930 impacted which of the following areas If a wave is traveling at a constant speed, and the frequency decreases, what would happen to the wavelength?A. It would increase.B. It would decrease.C. It would remain constant.D. It would drop to zero. Collecting ducts within the kidney tubules cut in cross section would reveal what type of epithelium? The following statements are about elements in the Periodic Table. 1 Their atoms have a full outer shell of electrons. 2 They are unstable .3 They are found in Group 4 They are present in small quantities in the air. Which statements are correct for the noble gases? * A) 1, 2 and 3 B) 1, 2 and 4 C) 1,3 and 4 D) 2, 3 and 4 How does the speaker's use of Spanish names for foodmost affect the tone and meaning of this excerpt?Read the excerpt from Justice Sotomayor's speech "ALatina Judge's VoiceFor me, a very special part of my being Latina is themucho pilaitas de arroz, gandtes y pernice, beansand pork--that I have eaten at countless family holidaysand special events. My Latina identity also includes,because of my particularly adventurous taste buds,morcilla, pig intestines: patitas de cerdo con garbanza,pigs feet with beans, and la lengua y orejas deCharito, pigs tongue and ears. I bet the MexicanAmericans in this room are thinking that Puerto Ricanshave unusual food tastes. Some of us, ke me, doIt shows her strong connection to her heritageI demonstrates how unusual Puerto Rican food is.texemplifies a frustration with the United States.It deliberately excludes non-Spanish speakers.