Answer:
a. 4.45 g
Explanation:
To calculate the mass of chlorine in 5 g of CHCl3, we need to first determine the molar mass of CHCl3 and the mass percentage of chlorine in CHCl3.
The molar mass of CHCl3 can be calculated as follows:
M(CHCl3) = M(C) + M(H) + M(Cl) x 3
= 12.01 g/mol + 1.01 g/mol + 35.45 g/mol x 3
= 119.38 g/mol
The mass percentage of chlorine in CHCl3 can be calculated as follows:
Mass of chlorine in CHCl3 = M(Cl) x 3 = 35.45 g/mol x 3 = 106.35 g/mol
Mass percentage of chlorine in CHCl3 = (106.35 g/mol / 119.38 g/mol) x 100% = 89.0%
Therefore, in 5 g of CHCl3, the mass of chlorine can be calculated as follows:
Mass of chlorine in 5 g of CHCl3 = 5 g x 89.0% = 4.45 g
Therefore, the mass of chlorine in 5 g of CHCl3 is 4.45 g.
The end point in a titration of a 41.9mL sample of aqueous HCl was reached by addition of 18.35mL of 0.773 M NaOH titrant. What is the molarity of the HCl?
To determine the (gt-l) strength of an HCl solution: HCI Strength = HCI Molarity HCI -M mol wt. 36,5 Result: HCl solution molarity HCl solution strength = 2.
Can you determine the endpoint of a titration?We know the volume of acid (which we took originally) and the volume of base (which we recorded at the endpoint), as well as the concentration of base, so we can compute the concentration of acid. As a result, the endpoint of an acid-base titration is measured by a change in colour. Titration is a volumetric measurement.
The pH of the solution generated by adding one drop of 2 M HCl to 100 mL of water would thus be 3.
learn more about Titration
https://brainly.com/question/13307013
#SPJ1
If 0.5 moles of A are reacted with an excess of B, how many grams of C can be produced during this reaction if the molar mass
of compound C is 46 g/mol?
2A + 2B-3C
34.5 grams of C can be produced during this reaction if the molar mass
of compound C is 46 g/mol.
The balanced chemical equation for the given reaction is:
2A + 2B - 3C
From the equation, we can see that 2 moles of A react with 2 moles of B of to produce 3 moles of C. Therefore, 0.5 moles of A will react with (0.5/2) * 2 = 0.5 moles of B to produce of (0.5/2) * 3 = 0.75 moles of C.
To calculate the mass of C produced, we can use the formula:
mass = moles * molar mass
Substituting the values, we get:
mass of C = 0.75 moles * 46 g/mol
= 34.5 g
Therefore, 34.5 grams of C can be produced during this reaction.
Learn more about molar mass here
https://brainly.com/question/22997914
#SPJ1
select the chemical equation below that is balanced
Answer:
cucl⁴h2o45 hco4kso4(nh4)Calculate the volume in mL of 0.589 M NaOH needed to neutralize 52.1 mL of 0.821 M HCl in a titration.
Answer:
72.6 mL
Explanation:
A quick way to solve this titration problem when you have a monoprotic acid is to use the Dilution equation, M1V1=M2V2.
.589(x)=.821(52.1)
X=72.6 mL
1. Describe a situation in which you might need to convert the units of a measurement, and
what information you would need to do so.
How do you think rocks form?
Answer:
Through gradual accumulation of sediments
Explanation:
Plsss help I will be giving branliest to most helpful answer
calculate the volume in milliliters of 2.37M potassium hydroxide that contains 9.29g of solute.
The volume in millilitres of 2.37M potassium hydroxide that contains 9.29g of solute is 70mL.
How to calculate volume?Volume of a solution can be calculated from the molarity, which is the concentration of a substance in solution, expressed as the number moles of solute per litre of solution.
Molarity = no of moles ÷ volume
no of moles = mass ÷ molar mass
Molar mass of pottasium hydroxide (KOH) = 56.1056 g/mol
moles = 9.29g ÷ 56.1056 g/mol = 0.166moles
2.37 = 0.166/V
V = 0.166 ÷ 2.37
V = 0.07L
Volume in millilitres = 70mL
Therefore, 70mL is the volume of the pottasium hydroxide solution.
Learn more about volume at: https://brainly.com/question/861096
#SPJ1
List any two uses of Brass , Bronze , Sulphur , Iodine
BRASS :It is easy to form into various shapes, a good conductor of heat, and generally resistant to corrosion from salt water. 1 pipes and 2 tubes, 3 screws, 4 cartridge casings for firearms.
BRONZE :for bearings because of its friction properties, and as 1 musical instruments ,2 and medals
Sulphur :1 making car batteries, 2 fertilizer
IODINE :1 Iodine regulates skin moisture levels and aids in the healing of cuts and scars through cellular regeneration. 2 Iodine also regulates the hormones responsible for acne breakouts.3 Treating thyroid cancer.
Referring to your benzene model, explain why there is no directionality for a substituent group bonded directly to a benzene ring.
The benzene molecule is flat and planar. As a result of this planarity, the substituent is also in the plane of molecule and do not show any directionality.
What is the benzene moleculeThe benzene molecule is a flat and planar molecule owing to the fact that all the bond lengths and bond angles in the molecules are the same. This results from resonance in the molecule.
Hence, owing to the planarity of the molecule, the substituent is also in the plane of molecule and do not show any directionality.
Learn more about benzene: https://brainly.com/question/7284916
Which of the following conclusions can be drawn from the curves in the
energy diagram?
OA. The reaction represented by curve B will go faster than the curve A
reaction.
OB. The molecules represented in curve A have higher kinetic energy
than curve B.
C. The reaction represented by curve B has a larger equilibrium
constant than curve A.
OD. The reaction represented by curve A requires less added energy
than curve B.
SUBMIT
A metal has a density of 11.3 g/cm^3. If a sample of this metal has a mass of 25.210 g, then its volume must be ?
Taking into account the definition of density, the volume of an object with a mass of 25.210 mL and a density of 11.3\(\frac{g}{cm^{3} }\) is 2.23 cm³.
First of all, density is defined as the property that matter, whether solid, liquid or gas, has to compress into a given space.
In other words, density is a quantity that relates the mass and volume of a substance. Then, the expression for the calculation of density is the quotient between the mass of a body and the volume it occupies:
\(density=\frac{mass}{volume}\)
Density, according to the International System of Units, is usually expressed in kilogram per cubic meter (\(\frac{kg}{m^{3} }\))or gram per cubic centimeter (\(\frac{g}{cm^{3} }\)).
In this case, you know:
density= 11.3 \(\frac{g}{cm^{3} }\)mass= 25.210 gvolume= ?Replacing in the definition of density:
\(11.3\frac{g}{cm^{3} }=\frac{25.210g}{volume}\)
Solving:
volume× 11.3 \(\frac{g}{cm^{3} }\)=25.210 g
\(volume=\frac{25.210g}{11.3\frac{g}{cm^{3} }}\)
volume= 2.23 cm³
In summary, the volume of an object with a mass of 25.210 mL and a density of 11.3\(\frac{g}{cm^{3} }\) is 2.23 cm³.
Learn more about density:
brainly.com/question/952755?referrer=searchResults brainly.com/question/1462554?referrer=searchResultsIdentify the following elements.
a. An excited state of this element has the electron configuration 1s22s22p53s1.
b. The ground-state electron configuration is [Ne]3s23p4.
c. An excited state of this element has the electron configuration [Kr]5s24d65p26s1.
d. The ground-state electron configuration contains three unpaired 6p electrons.
The following elements are,
1. Sodium
2. Sulfur
3. Zinc
4. Polonium
a. The element is sodium (Na). The excited state electron configuration indicates that one electron from the 3s orbital has been excited to the 3p orbital.
b. The element is sulfur (S).
c. The element is zinc (Zn). The excited state electron configuration indicates that one electron from the 4s orbital has been excited to the 4p orbital.
d. The element is polonium (Po). The ground-state electron configuration for Po is [Xe] 6s24f145d106p4. The presence of three unpaired 6p electrons indicates that the electron configuration of Po in its ground state is [Xe] 6s24f145d106p3.
Sodium, Sulfur, Zinc, and Polonium are the given elements respectively.
To know more about electron configuration click here:
brainly.com/question/29757010
#SPJ4
What is the process of making an object by adding new layers onto one another?
In chemical, deposition is the process of building an object by putting fresh layers on top of one another.
What is deposition?Deposition includes the direct transformation of a vapor into a solid without first going through the liquid phase. A layer of substance is added to the surface of a substrate during deposition; the substrate might be solid or liquid.
This method is employed in many different contexts, including the creation of protective coatings, optical coatings, and thin films for electrical devices. A number of methods, such as atomic layer deposition, physical vapor deposition, and chemical vapor deposition (CVD), can be used to deposit material (ALD).
What is Vaporizing?A phase change from the liquid phase to the vapor phase is called vaporization (or vaporization) of an element or molecule. Both evaporation and boiling result in sublimation. Boiling is a bulk phenomenon, whereas evaporation is a surface phenomenon.
To know more about Deposition
https://brainly.com/question/2800536
#SPJ1
in the reaction above, pyruvate: select one: a. reduces nad b. oxidizes nad c. reduces acetyl coa d. oxidizes acetyl coa
The correct answer to this question is pyruvate oxidizes in case of the aerobic respiration to generally form acetyl Coenzyme A or CoA which involves three major steps decarboxylation along with the reduction of the NAD+, and at the last attachment of CoA.
In the cellular inner space or the matrix, pyruvate is usually modified in a series of steps:
Step 1 : Pyruvate mostly loses the carboxyl group, which is then usually liberated as a carbon dioxide molecule, generally leaving a two-carbon molecule in its original place.
Step 2 : The two-carbon molecule from step 1 is further changed and oxidised, and then NAD+ takes up the all the lost electrons to create NADH.
Step 3 : Coenzyme A (CoA), an organic susbstance generated usually from the vitamin B5, is then joined with the oxidised two-carbon molecul. an acetyl group, to form the acetyl CoA. The role or the work of acetyl CoA, also designated as a carrier molecule, in this process is to transport the formed acetyl group to the citric acid cycle.
For more information about pyruvate click here:
brainly.com/question/28320299
#SPJ4
A student claims that signals transmitted by wireless computer networks are more beneficial than signals transmitted by other devices. Which statement supports the student’s claim?
im giving brainliest and 11 points
Answer: The wireless signals can carry large amounts of data at high radio frequencies.
Explanation: the others don’t specify the kind of signal
The solubility of oxygen in water A. allows for a greater concentration of O2 in water than in air. B. is responsible for thermoclines. C. is greater in cool liquid water than in warm liquid water. D. isn't significantly dependent on temperature
The ans should be C. ( if i'm not wrong )
This is because the solubility of oxygen increases when temperature in the water is cooler. Cold water can hold more dissolved oxygen than warm water, thus having a higher concentration of oxygen.
Answer:
C. is greater in cool liquid water than in warm liquid water.
Explanation:
explain the importance of the periodic table
Answer:
the importance of the periodic table are,
To summarize, the periodic table is important because it is organized to provide a great deal of information about elements and how they relate to one another in one easy-to-use reference. The table can be used to predict the properties of elements, even those that have not yet been discovered.
Explanation:
hope its help for you
thank you
have nice day
what volume litters of oxygen would be ptoduced in the electrolysis which forms 548 litters of hydrogen both gases measured at stp?
The ideal gas law may be used to determine the volume of oxygen created in the electrolysis that produces 548 litres of hydrogen at STP (Standard Temperature and Pressure). PV = nRT, where P is the pressure, V is the volume, n is the number of moles, R is the gas constant, and T is the temperature, according to the ideal gas equation.
The pressure is 1 atm, the temperature is 273 K, and the number of moles of hydrogen is 548/22.4 = 24.5 in this example. We may compute the volume of oxygen created by rearranging the ideal gas law: V = nRT/P = 24.5*0.082*273/1 = 483.3 litres.
As a result, the volume of oxygen created in the electrolysis at STP that produces 548 litres of hydrogen is 483.3 litres.
Learn more about oxygen at:
https://brainly.com/question/2272415
#SPJ1
Isopropyl alcohol (c3h7OH) burns in air according to this equation:
2C3H7OH + 9O2 -> 6CO2 + 8H2O
a) calculate the moles of oxygen needed to react with 3.40 mol C3H7OH
b) find the moles of each product formed when 3.40 mol C3H7OH reacts with oxygen
Answer:
a) 15.3 mol O₂
b) 10.2 mol CO₂; 13.6 mol H₂O
Explanation:
Step 1: Write the balanced equation
2 C₃H₇OH + 9 O₂ ⇒ 6 CO₂ + 8 H₂O
Step 2: Calculate the moles of O₂ that react with 3.40 moles of C₃H₇OH
The molar ratio of C₃H₇OH to O₂ is 2:9. The moles of O₂ required are 9/2 × 3.40 mol = 15.3 mol
Step 3: Calculate the moles of CO₂ produced from 3.40 moles of C₃H₇OH
The molar ratio of C₃H₇OH to CO₂ is 2:6. The moles of CO₂ produced are 6/2 × 3.40 mol = 10.2 mol
Step 4: Calculate the moles of H₂O produced from 3.40 moles of C₃H₇OH
The molar ratio of C₃H₇OH to H₂O is 2:8. The moles of H₂O produced are 8/2 × 3.40 mol = 13.6 mol
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
What is the density of a piece of granite whose volume is 20 mL and mass is 53
grams?
3.05 g/mL
2.75 g/mL
4.0 g/mL
2.65 g/mL
2.65g/ml is the density of a piece of granite whose volume is 20 mL and mass is 53grams. Density is the mass of a specific material per unit volume.
What is density?Density is the mass of a specific material per unit volume. Density is defined as d = M/V, in which d represents density, M is weight, as well as V is volume. Density is generally expressed in grams every cubic centimetre. Water, for example, has a density of 1 gram per square centimeter, but Earth has a density of 5.51 kilograms per cubic centimetre.
Density is sometimes measured in kilos per cubic centimeter (in metre-kilogram-second or SI units). The density of air, for example, is 1.2 kilos per cubic metre.
density = mass / volume
=53/ 20
=2.65g/ml
Therefore, 2.65g/ml is the density of a piece of granite whose volume is 20 mL and mass is 53grams.
To learn more about density, here:
https://brainly.com/question/13434141
#SPJ1
Does anyone know the answer to this question
Answer:
A
Explanation:
If Hydrogen is H₂ There will be two silver
and is Carbon is C There will only be one gray
and if Oxygen is O₃ There will be three red
Identify all the signs of a chemical change in the description below:
A clear liquid is placed in a beaker and heated. As the liquid is heated, bubbles form and, gradually, the liquid decreases in the container.
Answer:
When a substance undergoes changes in its chemical composition or combines with another substance to form a new substance is referred to as chemical change. In contrast, physical change is defined as the change in appearance or state of matter and not the chemical composition of the substance.
Explanation:
When a clear liquid is boiled or heated, the kinetic energy of the molecules increases, and the evaporation of the liquid takes place faster. For example, evaporation is a type of physical change, in which the liquid is heated to form bubbles or vapors. These vapors rise in the air and decrease the volume of the liquid. In this process, the liquid has only changed its state of matter (liquid to gas) and not the chemical composition. Thus, there is no chemical change taking place in the heating of water and only physical change is taking place.
The irreversible isomerization A
B was carried out in a batch reactor and the following concentration time data were obtained:
Time vs Concentration data in a Batch reactor
t 0 3 5 8 10 12 15 7.5
mol/h 4 2.89 2.25 1.45 1.0 0.65 0.25 0.07
Determine the reaction order,
, and the specific reaction a rate constant, k, using any method of your choice.
The reaction order and specific reaction rate constant can be determined by performing the kinetics experiment on irreversible polymerization A. Kinetic experiments can be used to investigate the rate and mechanism of chemical reactions. Chemical kinetics is the study of chemical reactions' speed and pathway.
The term "kinetics" refers to the study of reaction rates, which are determined by measuring the concentration of reactants and products as a function of time.Kinetics experiments can be used to determine the reaction rate and order of reaction. A chemical reaction's rate is defined as the change in the concentration of a reactant or product per unit time. The order of a reaction refers to the number of molecules that must react to produce a product. The order of reaction can be determined by measuring the initial rate of the reaction as a function of concentration.Methods for determining the reaction rate order include the initial rate method, the half-life method, and the integrated rate method. The initial rate method determines the reaction order by measuring the initial rate of the reaction at different reactant concentrations. The half-life method determines the reaction order by measuring the time it takes for the reactant concentration to decrease by half.The integrated rate method determines the reaction order by measuring the concentration of the reactant or product at different times.The specific rate constant can be determined by using the Arrhenius equation, which relates the rate constant to the activation energy, temperature, and frequency factor. The frequency factor can be determined by measuring the rate constant at different temperatures.For such more question on polymerization
https://brainly.com/question/1602388
#SPJ8
Reaction: 2K2O+4MnO2+3O2(g) 4KMnO4 (aq)
If you start with 291(g) of MnO2, how many moles of NaOH will you start with? (The molar mass of MnO2 is 87 for every 1 mole)
The number of moles of \(MnO_2\) required is 3.345 moles.
In the given reaction, the balanced equation shows that for every 4 moles of \(MnO_2\), 4 moles of \(KMnO_4\) are produced. Therefore, we can use the stoichiometry of the reaction to calculate the moles of \(MnO_2\) and the moles of \(KMnO_4\)
Given:
Mass of \(MnO_2\) = 291 g
Molar mass of\(MnO_2\) = 87 g/mol
To find the moles of \(MnO_2\), we use the formula:
Moles = Mass / Molar mass
Moles of \(MnO_2\) = 291 g / 87 g/mol = 3.345 mol
Now, since the stoichiometry of the reaction tells us that the ratio of \(MnO_2\)to \(KMnO_4\) is 4:4, we can conclude that 3.345 moles of \(MnO_2\)will produce an equal number of moles of \(KMnO_4\)
Therefore, the moles of \(KMnO_4\) produced will also be 3.345 mol.
However, the question asks for the moles of NaOH, which is not directly related to the given reaction. We cannot determine the moles of NaOH based on the information provided.
To find the moles of NaOH, we would need additional information or another relevant equation that includes NaOH.
Know more about moles here:
https://brainly.com/question/29367909
#SPJ8
A titration required 42.00 mL of 0.150 M NaOH. How many moles of NaOH is this?
Answer:
0.006342moles
Explanation:
1000ml of NaOH contain 0.151moles
42ml of NaOH contain (42*0.151)/1000 moles
=0.006342moles
How do hydrogen bonds affect heat capacity?
Significantly, hydrogen bonds have an impact on heat capacity. Heat capacity is the quantity of heat energy needed to raise a substance's temperature by a specific amount. Between molecules that include hydrogen linked to either nitrogen, oxygen, or fluorine atoms, hydrogen bonds are rather powerful intermolecular interactions.
How does the formation of hydrogen bonds affect heat?- Heat energy (increase in temperature) is required to break the hydrogen bonds so that water molecules can travel more quickly. Hydrogen bonds, like other bonds, must take heat in order to break and release heat when they create.
How can temperature change result from hydrogen bonding?What is the impact of hydrogen bonding on heat capacity?
Because of hydrogen bonds,the molecules "stickier," such that more heat (energy) is required to separate them. This phenomenon can be used to analyze boiling point of different molecules,
To know more about hydrogen bonds visit:-
brainly.com/question/17659933
#SPJ9
If you somehow subtracted a proton from a Zirconium atom, it would be?
Answer:
Yttrium
Explanation:
If you somehow subtracted a proton from a Zirconium atom, it would become a Yttrium atom.
When the number of protons in an atom changes a new element is directly formed. The difference between one atom and the other is the based on the number of protons they contain.
Therefore, when Zirconium loses a proton, it changes to Yttrium which is the atom before Zirconium.
Such reactions as this are very common with nuclear reactions. During a nuclear reaction, the nucleus of an atom changes stability.
What changes sodium pellets to liquid
Answer:
when placed in water, a sodium pellet catches on fire as hydrogen gas is liberated and sodium hydroxide forms. chemical change = fire is a sign of chemical reaction.
Explanation:
When placed in water the sodium pellets catch the fire and liberate the hydrogen gas. On mixing with water solid sodium forms a colorless basic solution.
What are the properties of sodium?Sodium is a soft metal. It is a very reactive element with a low melting point. Sodium reacts very quickly with water, snow, and ice to produce sodium hydroxide and hydrogen. It is an alkali metal and the sixth most abundant metal on earth. It has a silvery white color.
It has a strong metallic luster. On reacting with oxygen it produces sodium oxide which on reacting with the water produces sodium hydroxide.
It is used to improve the structure of certain alloys and soaps. It is also used in the purification of metals. Sodium is also present in sodium chloride, an important compound found in the environment.
To learn more about sodium, refer to the link:
https://brainly.com/question/29327783
#SPJ2