6NaCl + Ba3P2 - 3BaCl₂ + 2Na3P
If 17 moles sodium phosphide is produced, how many moles of sodium chloride is needed?
Round to the nearest hundredths.

Answers

Answer 1
From the balanced chemical equation:

6NaCl + Ba3P2 -> 3BaCl₂ + 2Na3P

We can see that for every 2 moles of Na3P, we need 6 moles of NaCl. This means there is a 3:1 molar ratio between NaCl and Na3P.

If 17 moles of Na3P is produced, we can calculate the moles of NaCl needed as follows:

17 moles Na3P * (6 moles NaCl / 2 moles Na3P) = 51 moles NaCl

Therefore, approximately 51 moles of sodium chloride are needed.

Related Questions

Identify the substance that has formula mass of 133.5amu.
(a) MgCI
b)SCI
c)BCI
D) AICI​

Answers

The calculated formula masses to 133.5 amu, we find that the substance with a formula mass closest to 133.5 amu is (d) AlCl3. Therefore, the answer is option D.

To identify the substance with a formula mass of 133.5 amu, we need to calculate the formula mass of each given substance and compare it to 133.5 amu.

(a) MgCl2:

The formula mass of MgCl2 can be calculated by adding the atomic masses of magnesium (Mg) and chlorine (Cl).

Mg: atomic mass = 24.31 amu

Cl: atomic mass = 35.45 amu

Formula mass of MgCl2 = (24.31 amu) + 2(35.45 amu) = 95.21 amu

(b) SCl:

The formula mass of SCl can be calculated by adding the atomic masses of sulfur (S) and chlorine (Cl).

S: atomic mass = 32.07 amu

Cl: atomic mass = 35.45 amu

Formula mass of SCl = 32.07 amu + 35.45 amu = 67.52 amu

(c) BCl:

The formula mass of BCl can be calculated by adding the atomic mass of boron (B) and chlorine (Cl).

B: atomic mass = 10.81 amu

Cl: atomic mass = 35.45 amu

Formula mass of BCl = 10.81 amu + 35.45 amu = 46.26 amu

(d) AlCl3:

The formula mass of AlCl3 can be calculated by adding the atomic mass of aluminum (Al) and 3 times the atomic mass of chlorine (Cl).

Al: atomic mass = 26.98 amu

Cl: atomic mass = 35.45 amu

Formula mass of AlCl3 = 26.98 amu + 3(35.45 amu) = 133.78 amu. Option D

For more such questions on masses visit:

https://brainly.com/question/24191825

#SPJ8

The q of a system that releases 12.4J of heat to surroundings is _____J.

a.) 12.4
b.) -12.4
c.) 0
d.) not enough info

If you explain why I'll give brainly!!​

Answers

Answer: B.) -12.4

Explanation: This is because the sign of heat transfer is determined by the system's perspective. In this case, the system is releasing heat to the surroundings, which means that heat is flowing out of the system, making the heat transfer negative. The magnitude of the heat transfer is 12.4 J.

Select two compounds below that can be used to make a buffer solution. Aacetic acid Bformate ion Csulfite ion Dcarbonate ion Eacetate ion Fhydrogen sulfide

Answers

Answer: Two compounds below that can be used to make a buffer solution are acetic acid and acetate ion.

Explanation:

A solution that helps in resisting change in pH when a small amount of acid or base is added to it is called a buffer solution.

A buffer solution consists of a mixture of weak acid and its conjugate base.

Acetic acid has a chemical formula \(CH_{3}COOH\) and its conjugate base is \(CH_{3}COO^{-}\).

This base is also called acetate ion.

Acetic acid is a weak acid because it dissociates weakly when added to a solvent like water.

Therefore, acetic acid and acetate ion will form a buffer solution.

Thus, we can conclude that two compounds below that can be used to make a buffer solution are acetic acid and acetate ion.

FILL IN THE BLANK. match these vocabulary terms to their meanings. resethelp while a dipeptide has two amino acids, a ____ has many.target 1 of 5 many chemical reactions, called ____ synthesis reactions, occur by removing water.target 2 of 5 the central part of an atom is called the ____.target 3 of 5 nonpolar covalent compounds do not dissolve in water, meaning they are ____.target 4 of 5 ionic compounds readily dissolve in water, meaning they are ____.

Answers

While a dipeptide has two amino acids, a polypeptide has many. many chemical reactions, called dehydration synthesis reactions, occur by removing water. The central part of an atom is called the nucleus.

Nonpolar covalent compounds do not dissolve in water, meaning they are hydrophobic. Ionic compounds readily dissolve in water, meaning they are hydrophilic.

Hydrophilic materials draw or absorb water, whereas hydrophobic materials resist it. The chemical composition and surface roughness, among other things, affect a material's hydrophobic or hydrophilic properties. Hydrophobic materials include things like magic sand, lotus leaves, and nano-tex fabric.

to know more about hydrophilic visit

https://brainly.com/question/30074618

#SPJ4

if two substance are at the same temperature, their enthalpy

Answers

Answer:

cannot be measure

Hope this helps :) !!!

Elements in Group IV of the Periodic Table exhibit two oxidation states, namely +2and +4, in their compounds. Illustrate, with two cases, the truth of the followingstatement:*For the Group IV elements, the stability of the +2 oxidation state relative to the +4oxidation state increases with relative atomic mass.'

Answers

The group IV elements are:

Carbon (C)

Silicon (Si)

Germanium (Ge)

Tin (Sn)

Lead (Pb)

The reason why they exhibit two oxidation states is because they have the following outer electronic structure (n being the period number):

\(ns^2np^1_{x^{}}np^1_y\)

Closer to the bottom of the group it is harder for the 2 electros in the s orbital to be involved in bonding. This is known a the inert pair effect and it is explained because when the atoms in group 4 lose the p electrons they contract, drawing the electrons closer to the nucleus, makeing it more energetically difficult to remove the s electrones.

This effect is greater with heavier elements.

Therefore the most common oxidation state for carbon (the lighter element of the group) is +4.

An example is the formation of carbon tetrachloride:

\(C+2Cl_2\text{ }\rightarrow CCl_4\)

For lead (a heavier element) the most common oxidation state is +2. An example is the decomposition of Lead(IV) chloride:

\(\text{PbCl}_4\text{ }\rightarrow PbCl_2+Cl_2\)

How many molecules of methane, CH4 in 3.7 moles of
methane?

Answers

Answer:

\(1 \: mole \: contains \: 6.02 \times {10}^{23} \: molecules \\ 3.7 \: moles \: contain \: (3.7 \times 6.02 \times {10}^{23} ) \\ = 2.23 \times {10}^{24} \: molecules\)

The synthesis of carbohydrates can be particularly difficult because of the large number of chiral centers and OH functional groups present.
a. True
b. False

Answers

True The synthesis of carbohydrates can be particularly difficult because of the large number of chiral centers and OH functional groups present.
a. True
b. False

If you titrate 35 drops of vinegar to the equivalence point with 43 drops of 0.600M sodium hydroxide what is the concentration of the vinegar?

Answers

To determine the concentration of vinegar (acetic acid) based on the titration with sodium hydroxide, we need to use the concept of stoichiometry and the volume and concentration of the sodium hydroxide solution.

Let's assume that each drop of the sodium hydroxide solution is approximately 0.03 mL. Based on this assumption, the volume of sodium hydroxide solution used would be:

Volume of NaOH = 43 drops × 0.03 mL/drop = 1.29 mL

Now, we need to determine the moles of sodium hydroxide used in the titration. Using the volume and concentration of the sodium hydroxide solution:

Moles of NaOH = Volume of NaOH (L) × Concentration of NaOH (mol/L)

             = 1.29 mL × (1 L / 1000 mL) × 0.600 mol/L

             = 0.000774 mol

Since acetic acid (CH3COOH) and sodium hydroxide (NaOH) react in a 1:1 molar ratio, the moles of acetic acid present in the vinegar can be determined as well:

Moles of CH3COOH = Moles of NaOH = 0.000774 mol

Finally, we need to calculate the concentration of acetic acid (vinegar) in the solution. Assuming the volume of vinegar is 1 L:

Concentration of CH3COOH = Moles of CH3COOH / Volume of CH3COOH

                      = 0.000774 mol / 1 L

                      = 0.000774 M

Therefore, the concentration of the vinegar (acetic acid) is approximately 0.000774 M.

Zoe left her water bottle capped and in her bedroom. She came back some time later to realize that the bottle was “sweating” and left a ring of liquid on her nightstand


Explain thoroughly the science behind why Zoe’s water bottle is sweating

Answers

Answer:

Condensation

Explanation:

Zoe is quite keen to have noticed what we call condensation. Air contains many components, one of those being water vapor. Like how sugar is soluble in water, water can be said to be "soluble" in air. Water will evaporate into the air to a certain extent. The higher the temperature of the air, the more water the air can hold. If the air has more water that it can hold (potentially because of a temperature decrease), the extra water will come out of the air. Zoe's water bottle was cold, and because the air around Zoe's bottle had cooled down, the air can not hold as much water as it could when it was warm, so the air deposited the extra water in the form of liquid water onto the bottle, giving the illusion that her bottle was sweating.

Please help!!!!!
Please help!!!!!

Please help!!!!!Please help!!!!!

Answers

Answer:

1.B

2.A

3. B

Explanation:

1. A chemical bond is the physical phenomenon of chemical substances being held together by attraction of atoms to each other through sharing

2. so 2 is electrons of one atom are transferred permanently to another atom.meaning the answer is A

3. is When atoms combine by forming covalent bonds, the resulting collection of atoms is called a molecule. We can therefore say that a molecule is the simplest unit of a covalent compound.

A chemical bond is an attraction between two atoms.

A ionic bond is A bond formed when atoms transfer electrons.


How many electrons does the ion 3517C1- have?

How many electrons does the ion 3517C1- have?

Answers

Answer:

18

Explanation:

4 (NH4)3PO4+ 3 Pb(NO3)4 → 1Pb3(PO4)4+ 12 NH4NO3
If I start with 78.3L Pb(NO3)4, how many grams of NH4NO3 will be produced?

Answers

Answer:

for more details are in the pic

4 (NH4)3PO4+ 3 Pb(NO3)4 1Pb3(PO4)4+ 12 NH4NO3If I start with 78.3L Pb(NO3)4, how many grams of NH4NO3

Which of the following processes are spontaneous under standard conditions? Select all that apply. Multiple select question. A gas is compressed into a small volume. A soluble salt dissolves when it is mixed with water. Iron rusts when it exposed to salty water. A match continues to burns after it is lit. Water moves up into a water tower.

Answers

Spontaneous processes are processes such as;  a soluble salt dissolves when it is mixed with water, iron rusts when it exposed to salty water and a match continues to burns after it is lit.

A spontaneous process is a process that occurs without external input of energy or does not require a continuous input of energy once the process has gotten underway.

Among the options the processes which are spontaneous under standard conditions of 1 atm, 298 K and 1 M are;

A soluble salt dissolves when it is mixed with water.Iron rusts when it exposed to salty water. A match continues to burn after it is lit.

Learn more: https://brainly.com/question/6505878

What is heat transferred from movement of fluids in a circular motion called

Answers

Answer: it's known as heat transfer

Explanation: Heat always moves from a warmer substance to a cooler substance. For example, holding an ice cube will make your hand begin to feel cold in a few seconds. But is the coldness in the ice cube moving to your hand? No! Since cold is the absence of heat, it’s the heat in your hand that moves to the ice cube. This is one of the ways that heat is transferred.

According to the concept of thermal energy, heat transfer in a circular motion is called as convection.

What is thermal energy?

Thermal energy is defined as a type of energy which is contained within a system which is responsible for temperature rise.Heat is a type of thermal energy.It is concerned with the first law of thermodynamics.

Thermal energy arises from friction and drag.It includes the internal energy or enthalpy of a body of matter and radiation.It is related to internal energy and heat .It arises when a substance whose molecules or atoms are vibrating faster.

These vibrating molecules and atoms collide and as a result of which heat is generated in a substance , more the collision of particles , higher is the thermal energy.There are three types of thermal energy.

Learn more about thermal energy,here:

https://brainly.com/question/3022807

#SPJ6

what are some Observations of basalt rock sample

Answers

basalt is generally an extrusive formed rock with very little quartz and a lot more iron.
It's what our oceanic crust is made out of, and many lava flows like the one seen up right.

Many basalt rocks form sills underground cross cutting rock formations

The irreversible isomerization A
B was carried out in a batch reactor and the following concentration time data were obtained:

Time vs Concentration data in a Batch reactor
t 0 3 5 8 10 12 15 7.5

mol/h 4 2.89 2.25 1.45 1.0 0.65 0.25 0.07
Determine the reaction order,
, and the specific reaction a rate constant, k, using any method of your choice.

The irreversible isomerization A B was carried out in a batch reactor and the following concentration

Answers

The reaction order and specific reaction rate constant can be determined by performing the kinetics experiment on irreversible polymerization A. Kinetic experiments can be used to investigate the rate and mechanism of chemical reactions. Chemical kinetics is the study of chemical reactions' speed and pathway.

The term "kinetics" refers to the study of reaction rates, which are determined by measuring the concentration of reactants and products as a function of time.Kinetics experiments can be used to determine the reaction rate and order of reaction. A chemical reaction's rate is defined as the change in the concentration of a reactant or product per unit time. The order of a reaction refers to the number of molecules that must react to produce a product. The order of reaction can be determined by measuring the initial rate of the reaction as a function of concentration.Methods for determining the reaction rate order include the initial rate method, the half-life method, and the integrated rate method. The initial rate method determines the reaction order by measuring the initial rate of the reaction at different reactant concentrations. The half-life method determines the reaction order by measuring the time it takes for the reactant concentration to decrease by half.The integrated rate method determines the reaction order by measuring the concentration of the reactant or product at different times.The specific rate constant can be determined by using the Arrhenius equation, which relates the rate constant to the activation energy, temperature, and frequency factor. The frequency factor can be determined by measuring the rate constant at different temperatures.

For such more question on polymerization

https://brainly.com/question/1602388

#SPJ8


Which would be another way to make the ice melt faster

Which would be another way to make the ice melt faster

Answers

Answer:

d because ur heating the ice and causing friction

WHEN YOU SEE A BLUE CAR WHAT COLER IS BEING REFLECTED

Answers

Answer:

violet

Explanation:

just violet

oh and you spelled "COLER" wrong, its color or colour if you live somewhere else

Please help answer!!!​

Please help answer!!!

Answers

Answer:

C stays the same ez

Explanation:

What is temperature?

Answers

Answer: Temperature is an objective measurement of how hot or cold an object is. It can be measured with a thermometer or a calorimeter. It is a means of determining the internal energy contained within a given system.

Explanation:

Answer:

Temperature is a physical quantity that expresses hot and cold

Explanation:

Temperature is a physical quantity that expresses hot and cold. This is how the air feels and how hot/cold something is. The less tight the atoms are, the hotter something is. The more tight the atoms are, the cooler something is.

What is the molar mass of Na3 Po4… I need help with this question

What is the molar mass of Na3 Po4 I need help with this question

Answers

Answer:

\(164\text{ g/mol}\)

Explanation:

Here, we want to get the molar mass of the given molecule

To calculate this, we need the atomic masses of the individual atoms

We have 3 atoms present:

For Sodium (Na), the atomic mass is approximately 23 amu

For Phosphorus, the atomic mass is approximately 31 amu

For Oxygen, the atomic mass is approximately 16 amu

We have 3 atoms of sodium, 1 atom of phosphorus, and 4 atoms of oxygen

Adding the values, we have it that:

\(3(23)\text{ + 31 + 4\lparen16\rparen = 164 g/mol}\)

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Please I need help thank you

Please I need help thank you

Answers

Answer:

its sodium hydroxide

Explanation:

What is the mass of 6.02 x 10^^24

molecules of hydrogen, H2? The molar

mass of H2 is 2.02 g/mol.

A- 2.02 g H2

B- 2.98 x 10^24 g H2

C- 10.0 g H2

D- 1.22 x 10^25 g H2

Answers

Mole measures the number of elementary entities of a given substance that are present in a given sample. The mass of hydrogen is 20.2gram.

What is mole?

The SI unit of amount of substance in chemistry is mole. The mole is used to measure the quantity of amount of substance.

Given number of atoms= 6.02 x 10²⁴atoms

we know one mole of any element contains 6.022×10²³ atoms which is also called Avogadro number

mole =given number of atoms ÷ 6.022×10²³(Avogadro number)

Substituting the values

mole=6.02 x 10²⁴÷ 6.022×10²³

mole = 10 mole

Mole = mass ÷Molar mass

Molar mass = 2.02 g/mol

Substituting the given values

10= mass ÷ 2.02 g/mol

Mass = 20.2gram

Therefore, mass of hydrogen is 20.2gram.

To know more about mole, here:

https://brainly.com/question/15209553

#SPJ1

If others adopted similar habits, how might the world of science change?

Answers

Answer:

Explanation:

Smoking a cigarette, snorting cocaine, or drinking yourself into oblivion are all easy habits to adopt because they light up your brain with the neurotransmitter …

Do step 3 as outlined in the lab guide. Record your results in the appropriate blanks.

A =
B =
C =
D =
E =
F =
G =
H =

Answers

Some tips to follow when doing lab practical are:

Avoid parallax errorsRecord your observations and data accuratelyUse the appropriate lab equipment.

How do we know?

From the table, Column 1 represents the time in half-life cycles, ranging from the initial state to 8 cycles. Column 2 shows the predicted number of radioactive atoms at each time point, based on the assumption that the number of atoms reduces by half in each half-life cycle.

Column 3 represents the simulated number of radioactive atoms at each time point and corresponds to the predicted values of the simulation.

In conclusion, the results as outlined in the lab guide are A=  27 B=  16 C=  9 D=  4 E=  2 F=  2 G=  0 H= 0.

Learn more about half-life cycles at:

https://brainly.com/question/15976750

#SPJ1

#complete question:

Do step 3 as outlined in the lab guide. Record your results in the appropriate blanks. A = B = C = D = E = F = G = H = A 3-column table with 9 rows. Column 1 is labeled Time half-life cycles, n with entries Initial, 1, 2, 3, 4, 5, 6, 7, 8. Column 2 is labeled Predicted radioactive atoms with entries 100, 50, 25, 13, 6, 3, 2, 1, 0. Column 3 is labeled Simulated radioactive atoms with entries 100, A, B, C, D, E, F, G, H.

How many liters of carbon dioxide can be produced if 37.8 grams of carbon disulfide react with excess oxygen gas at 28.85 degrees Celsius and 1.02 atmospheres?

CS2(l) + 3O2(g) yields CO2(g) + 2SO2(g)


2.78 liters
5.95 liters
12.1 liters
11.9 liters

Answers

The volume of carbon dioxide produced is approximately (d) 11.9 liters.

To determine the amount of carbon dioxide (C\(O_2\)) produced when 37.8 grams of carbon disulfide (C\(S_2\)) reacts with excess oxygen gas (\(O_2\)), we need to use stoichiometry and the given balanced chemical equation:

C\(S_2\)(l) + 3\(O_2\)(g) → C\(O_2\)(g) + 2S\(O_2\)(g)

First, we calculate the number of moles of C\(S_2\) using its molar mass:

Molar mass of (C\(S_2\)) = 12.01 g/mol (C) + 32.07 g/mol (S) × 2 = 76.14 g/mol

Number of moles of (C\(S_2\)) = mass / molar mass = 37.8 g / 76.14 g/mol ≈ 0.496 mol

From the balanced equation, we can see that the stoichiometric ratio between (C\(S_2\)) and C\(O_2\) is 1:1. Therefore, the number of moles of C\(O_2\) produced will also be 0.496 mol.

Now we can use the ideal gas law to calculate the volume of C\(O_2\) at the given temperature and pressure. The ideal gas law equation is:

PV = nRT

where P is the pressure, V is the volume, n is the number of moles, R is the ideal gas constant (0.0821 L·atm/mol·K), and T is the temperature in Kelvin.

Converting the temperature from Celsius to Kelvin:

T(K) = 28.85°C + 273.15 = 302 K

Using the ideal gas law:

V = nRT / P = (0.496 mol) × (0.0821 L·atm/mol·K) × (302 K) / (1.02 atm) ≈ 11.9 L

The correct answer is 11.9 liters.

for more questions on carbon dioxide

https://brainly.com/question/26150306

#SPJ8

- How many grams are in 1.4 x 10¹5 atoms of calcium?

Answers

Answer:

40 g= 6.022×10²³

x=1.4×10¹⁵

x=40g×6.022×10²³/1.4×10¹⁵

x=17.77×10⁸

What separation technique would most likely be used if a solvent were
saved?
A. Melting point separation
B. Distillation separation
C. Density separation
O D. Chromatography separation

Answers

I believe distillation is used to separate solvents of different kind as long as it is heated to its boiling temp

The statement, that describes separation technique would most likely be used if a solvent were saved is "distillation separation."

What is separation technique?

Separation techniques are methods for separating two different states of matter, such as liquid and solid. Methods that employ variations in physical qualities to separate the components of a mixture, such as evaporation, distillation, filtration, and chromatography, can be used to physically separate the components of a mixture.

Simple distillation is a technique for removing a solvent from a solution. Water, for example, can be extracted from salt solution by simple distillation. If a solvent was saved, the separation procedure would most likely be used is distillation.

Hence the correct option is B.

Learn more about separation technique here

https://brainly.in/question/31842951

#SPJ2

Other Questions
Use the following chemical equation to answer the question. What is the limiting reactant for this equation based on the previous question? Cuando el ejrcito de Boabadil perdi ante el ejrcito de Fernando e Isabel, su madre le dijo: "No llores como mujer por lo que no pudiste defender como hombre". Por qu dijo esto? A cmo z-tranche: a. receives payments prior to all other tranches b. receives payments after all other tranches c. receives payments on a pro-rata basis with other tranches d. does not receive payments XYZ company is situated in Ghana. They have been commissioned your organisation to design a database for them. The database is expected to keep data on employees, customers, suppliers, and products. Important records on employees such as employee's ID, date of birth, and dependants are expected to be captured in the database. Products information such as product's ID, name of product, manufacturing and expiring data, and name of supplier are expected to be captured. The company receives suppliers from different organisations, hence, it would like the database to capture relevant details of these suppliers. Each supplier supplies only one type of product for the company. Every customer is assigned one sales representative, yet sales representatives maybe assigned up to ten customers. Customers can order an unlimited number of good. Properly represent all entities, relationships, constraints, and appropriate keys in an E-R diagram that can readily be used in a database. How should this sentence be changed? Aunt Elizabeths dog had to have its broken leg set by a veterinarian. A. Change Elizabeths to Elizabeths and delete the apostrophe in its B. Change Elizabeths to Elizabeths C. Change its to its D. No change needs to be made to this sentence individuals who are ________ will not be successful in the new career paradigm Four small spheres, each of which you can regard as a point of mass 0.200 kg, are arranged in a square 0.400 m on a side and connected by light rods a)Find the moment of inertia of the system about an axis through the center of the square, perpendicular to its plane (an axis through point O). b)Find the moment of inertia of the system about an axis bisecting two opposite sides of the square (an axis along the line AB). c)Find the moment of inertia of the system about an axis that passes through the centers of the upper left and lower right spheres and through point O. The mass of a hoop of radius 1.0 m is 6.0 kg. It rolls across a horizontal surface with a speed of 10.0 m/s. (a) How much work is required to stop the hoop? (b) If the hoop starts up a surface at 30 to the horizontal with a speed of 10.0 m/s, how far along the incline will it travel before stopping and rolling back down? URGENTOne point of interest between the Democratic Republic of the Congo and Madagascar is Mount Kilimanjaro. What is interesting about this location? Only 1 paragraph is required. T/F the illustrator eyedropper tool can select attributes from one object and apply them to another but cannot simply sample rgb color values like the photoshop eyedropper tool. Assume that the firm for which you work faces a demand function given by:P=20-2Qand a total cost function:TC=100-2Q^3-100Q+34Q^2a) Find the profit maximizing level of output (Q)b) What price should you charge for your product?c) Based on your answers in the previous two questions, how much profit is this firm making at the profit maximizing level of output? Consider a population of foxes and rabbits. The number of foxes and rabbits at time t are given by f(t) and r(t) respectively. The populations are governed by the equations df = 7f - 8r dt dr = 4f 5 r. dt a. Find the general solution to this system of equations, giving functions for the number of foxes and the number of rabbits. Do not merge any arbitrary constants. f(t) = = r(t) = b. If the population starts with 11 foxes and 5 rabbits, what is the particular solution? f(t) = = r(t) = A project that will provde annual cash flows of $2,900 for nine years costs $9,600 today.A. At a required return of 8 percent, what is the NPV of the project? (Do not round intermediate calculations and round your answer to 2 decimal places, e.g., 32.16.B. At a required return of 29 percent, what is the NPV of the project? (A negative answer should be indicated by a minus sign. Do not round intermediate calculations and round your answer to 2 decimal places, e.g., 32.16.)C. At what discount rate would you be indifferent between accepting the project and rejecting it? (Do not round intermediate calculations and enter your answer as a percent rounded to 2 decimal places, e.g., 32.16.) devise a 6-step synthesis of a carboxylic acid from ethyne using the reagents provided. ethyne is a carbon carbon triple bond, bonded to two hydrogens. three reagents convert this to the main intermediate, an alkene with three bonds to hydrogen and one bond to a propyl group. three more reagents convert this to the product, which is a carboxylic acid bonded to a four carbon chain. I need some help with this Similar to the mutation question about gastrin in class, if a mutation stops the ability for pepsinogen to respond to the presence of pepsin, what would happen to pepsin production:A.Pepsin production would continue as usualB.Total pepsin quantity would be determined by the amount of pepsinogen already present and stomach acid contentC.Pepsinogen would no longer be produced since it relies on mucus productionD.Gastrin would begin digesting proteins instead it is important to project an organizations growth rate when designing information systems. T/F? advances in health care technology are having a significant impact not only on how health care organizations do business, but also on their internal need for storing information. True or False Which of the following would not be acted upon by pancreatic juice secreted into the intestinal tract?a. fatsb. fibersc. protiend. carbohydrates PLEASE HELP! whoever answers right get brainliest!!!