500.0 liters of a gas are prepared at 700 mm Hg and 200 C. The gas is placed into a tank under high pressure. What is the volume of the gas?

Answers

Answer 1

Answer: 143*tank temperature/tank pressure L

Explanation: too few data. Need to know the pressure and what if any, temperature change.

tank volume = (tank temp/tank pressure)*(500*200/700) = 143*tank temp/tank pressure L

At constant temperature, (500*700)/tank temp

e.g. at 1400mm Hg, 500*700/1400 = 250L


Related Questions

What is the limiting reactant for the following reaction given we have 2.6 moles of HCI and 1.4 moles of
Ca(OH)2?
Reaction: 2HCI + Ca(OH)2 → 2H2O + CaCl2

Answers

2HCI is the answer.
Let me know if it’s correct!

How to balance this equation using algebraic method Cu + HNO3 = Cu(NO3)2 + NO2 +H2O

Answers

1) Write the chemical equation.

\(Cu+HNO_3\rightarrow Cu(NO_3)_2+NO_2+H_2O\)

Step 1: assign letters to stoichiometric coefficients.

\(ACu_{}+BHNO_3\rightarrow CCu(NO_3)_2+DNO_2+EH_2O_{}\)

Step 2: list the elements involved in the reaction.

Cu: 1A = 1C

H: 1B = 2E

N: 1B = 2C + 1D

O: 3B = 6C + 2D + 1E

Step 3: assign an arbitrary number to one of the letters. Let's try C = 1.

Cu: 1A = 1C

1*A = 1*(1)

A = 1

Let's try E = 2.

H: 1B = 2E

1*B = 2*(2)

B = 4

Replace C and B in 1B = 2C + 1D

N: 1B = 2C + 1D

1*(4) = 2*(1) + 1D

4 = 2+ 1*D

D = 4-2 = 2

Step 4: replace the letter in the chemical equation and check.

\(Cu+4HNO_3\rightarrow Cu(NO_3)_2+2NO_2+2H_2O\)

.

4 grams of N is how many moles of N?

Answers

Answer:

0.285577616426424

Explanation:

Hope this helps!

Metal plating is done by passing a current through a metal solution. For example, an item can become gold plated by attaching the item to a power source and submerging it into an Au³⁺ solution. The item itself serves as the cathode, at which the Au³⁺ ions are reduced to Au(s). A piece of solid gold is used as the anode and is also connected to the power source, thus completing the circuit. What mass of gold is produced when 15.1 A of current are passed through a gold solution for 31.0 min?

Answers

Answer:

172 g

Explanation:

Let's consider the reduction of Au³⁺ to Au.

Au³⁺(aq) + 3 e⁻ → Au(s)

In order to find the mass of gold produced, we will use the following relations.

1 min = 60 s1 A = 1 C/sThe charge of 1 mole of electrons is 96,468 C (Faraday's constant).1 mole of Au is deposited when 3 moles of electrons circulate.The molar mass of Au is 196.97 g/mol.

The mass of gold produced when 15.1 A of current are passed through a gold solution for 31.0 min is:

\(31.0min \times \frac{60s}{1min} \times \frac{15.1C}{s} \times \frac{1mole^{-} }{96,468C} \times \frac{3molAu}{1mole^{-} } \times \frac{196.97gAu}{1molAu} = 172 gAu\)

What happens to the rate of reaction as the reactants get used up in a reaction?

Answers

Answer:So, when a reactant gets used up, its concentration decreases, and so the total reaction rate decreases. As you can see here, more products equal less reagents (reactants), and so the reaction rate decreases.

Explanation: i hope this helps!! :)))

In a protein molecule, the number of amino acid molecules may be as few as
5
5,000
500
50

Answers

In a protein molecule, the number of amino acid molecules may be as few as d. 50.

Proteins are large macromolecules composed of chains of amino acids. These amino acids are linked together through peptide bonds to form the primary structure of a protein. The number of amino acids present in a protein molecule can vary greatly and depends on the specific protein.

Proteins can range in size from small peptides composed of just a few amino acids to large complex proteins containing thousands of amino acids. The minimum number of amino acids required for a protein to be considered functional is typically around 50. This is because proteins need a certain length and structural complexity to carry out their specific functions.

Proteins play vital roles in living organisms and are involved in various biological processes such as enzyme catalysis, cell signaling, structural support, and immune response. The specific number and sequence of amino acids in a protein molecule determine its unique structure and function.

Therefore, while some proteins may consist of as few as 50 amino acids, larger and more complex proteins can contain thousands of amino acids, enabling them to perform intricate and diverse functions within living systems. Therefore, Option D is correct.

The question was incomplete. find the full content below:

In a protein molecule, the number of amino acid molecules may be as few as

a. 5

b. 5,000

c. 500

d. 50

Know more about amino acid here:

https://brainly.com/question/14351754

#SPJ8

A 125-g piece of metal is heated to 288c and dropped into 85.0 g of water at 12.0 c tge metal and water come to the same temperature of 24.0 c what is the specific heat, in j/g c, of the metal?

Answers

The specific heat is 0.134 J/gC

This is example in which energy (in the form of heat) is conserved.  Your metal is at a higher temperature than the water so it will lose heat, which we can calculate using q=mass x specific heat capacity x ΔT.  The heat is then transferred to the water.  One way to set up your calculation is: q metal + qH2O = 0

mass metal =  125 g

specific heat =  x

ΔT = 24 C - 288 C

mass water = 88 g

specific heat = 4.184 J/gC

ΔT = 24C-12C

125 g(x)(-264 C) + 88g(4.184J/gC)(12C)=0

-3300x + 4418.304 = 0

 x = 0.134 J/gC

Learn more about specific heat here;

https://brainly.com/question/11297584

#SPJ9

1. A student observed a silver, shiny, ductile metal during a lab. Which type of property did
the student observe?
A.Physical property
B.Chemical property
C.Both A and B
D.Neither A or B

Answers

Answer:

ok

Explanation:

Answer:

B

Explanation:

Sorry if wrong, brainliest if right please

In an Experiment a fuel raised the temperature of 500g of water by 4 degree C.
a) work out the energy released in the experiment.( It takes 4.2J of energy to raise the temperature of 1g of water by 1 degree C)

Answers

Answer:

The energy released in the experiment is (500g)(4 degrees C)(4.2 J/g-degree C) = 8,400 J.

Explanation:

20 POINTS!! WIL GIVE BRAINLEST

1 pargarph about scientific experimentation

Answers

Scientific experimentation to provide the basis for scientific knowledge

A scientific experiment is any process in which measurements are used and tests are carried out to verify or refute a hypothesis and the hypothesis is a proposition that appears to be true, but has not yet been corroborated, and from which an investigation can be developed and experiment plays many roles in science and one of its important roles is to test theories and to provide the basis for scientific knowledge and it can also call for a new theory, either by showing that an accepted theory is incorrect, or by exhibiting a new phenomenon that is in need

Know more about scientific experimentation

https://brainly.com/question/26493990

#SPJ1

Using the balanced equation CaC₂(ş) + 2 H₂O(1) --> C₂H₂(g) + Ca(OH)₂(aq) how many moles of Ca(OH)2 would be produced if 3.5 moles of H₂O are consumed?​

Answers

Answer:

1.75 moles

Explanation:

According to CaC₂(s) + 2 H₂O(l) --> C₂H₂(g) + Ca(OH)₂(aq)

2 moles of H20 will produce 1 mole of Ca(OH)2

therefore 3.5 moles of H2O will produce 3.5 x (1/2) = 1.75 moles of Ca(OH)2

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

What is the formula for Acetic acid? (PLS USE ONE OF A,C, or, D) i have a test retake don’t let me down !

What is the formula for Acetic acid? (PLS USE ONE OF A,C, or, D) i have a test retake dont let me down

Answers

Answer:

C

Explanation:

POSSIBLE POINTS
A bar magnet, its magnetic field lines, and multiple compasses that show the direction of the magistic field are

Answers

From the magnet's south pole to its north pole, field lines move inside it. The magnetic field lines are closed curves as a result.

How can a magnetic field line be used to determine the magnetic field's direction?

A compass needle can be used to determine the direction of magnetic field lines at a location. The magnetic field direction at a given location is shown by the compass needle's north end.

What way does the magnetic field at a bar magnet's poles go?

Due to the magnetic field's continuous nature inside a bar magnet, it always points from the south pole to the north pole as the magnetic field arrives from the south pole from the outside and exits from the north pole.

To know more about magnetic field lines visit :-

https://brainly.com/question/17011493

#SPJ1

ILL GIVE BRAINLIEST!

ILL GIVE BRAINLIEST!

Answers

A because dormant volcanoes are volcanoes that have not erupted in a long time but are expected to erupt again in the future

Answer:

A since dormant volcanoes haven't erupted for a long time but are expected to erupt again in the future.

Explanation:

a pharmaceutical company wants to extract an ingredient from pomace supplied by a certain food processing plant. which process is the most efficient with the lowest environmental impact

A. Catalyst extraction
B. High pressure, high temperature water extraction
C. Organic solvent extraction
D. Enzyme extraction

Answers

Answer: high pressure, high temperature water extraction

Explanation:

Answer:

C). high pressure, high temperature water extraction

Explanation:

which of the following mathematical relationships are correct for an aqueous solution at 25oc? select all that apply.pH = -log[H3O+]
pOH + pH = 14.00H3O+, A-
HA

Answers

The correct mathematical relationships for an aqueous solution at 25°C are: 1. pH = -log[\(H_{3} O\)+] , 2. pOH + pH = 14.00

An aqueous solution is a solution in which the solvent is water. Such a solution is normally transparent because the solute is usually not enough to scatter light. An aqueous solution is often referred to as a hydrothermal solution in the geology and hydrology fields. An aqueous solution refers to a solution that is dissolved in water. The most common solvent on Earth is water, and it's where most biochemical reactions take place.

In chemistry, biochemistry, and pharmacology, aqueous solutions are commonly used. The properties of an aqueous solution are determined by the solute and the solvent, just as they are in other types of solutions. In an aqueous solution, pH is defined as the negative logarithm (base 10) of the concentration of hydrogen ions. Hence, for an aqueous solution 25°C, the mathematical relationships that are correct are:

pH = -log[\(H_{3} O\)+]pOH + pH = 14.00, as pH + pOH = 14.00.

Know more about   aqueous solution     here:

https://brainly.com/question/19587902

#SPJ11

Where does the oil in cars come from?
SUBJECT: AQUATIC SCIENCE

Answers

The oil from cars is gotten from crude oil.

Crude oil and its sources:

The car is an automobile that is mainly used for transportation purposes. It is made up of both electrical and mechanical parts.

The mechanical part of the car is driven by the engine which is the heart of the car.

The engine is made up of adjacent moving parts that need to be frequently lubricated through the engine oil.

The engine oil is gotten from crude oil, which is a mixture of hydrocarbons  that exist in liquid phase in natural underground reservoirs.

Therefore, the oil from cars is gotten from crude oil.

Learn more about crude oil here:

https://brainly.com/question/14260176

Which statement describes the law of conservation of energy? A. All systems will exchange matter and energy with their surroundings. B. All systems can exchange energy, but not matter, with their surroundings. C. Energy cannot be created nor destroyed, but it changes from one form to another. D. Energy is destroyed in most chemical reactions when new products are formed.


\\\\\

Answers

Answer:

C, energy cannot be created nor destroyed.

Explanation:

How many moles of Aluminum are in 54.0 grams of Aluminum (Al)

How many moles of Aluminum are in 54.0 grams of Aluminum (Al)

Answers

Answer:

2 moles!

Explanation:

Hi i hope this helped! I researched it and 2 moles was what came up first.

why does lead exist in a higher amount in brown algae than plankton?​

Answers

Lead levels in plankton and algae are high, mostly as a result of environmental pollution brought on by human activity. While it is true that some brown algae species have the ability to accumulate heavy metals like lead.

Plankton and algae have high levels of lead, mostly as a result of environmental contamination brought on by human activities including mining, industrial operations, and the burning of fossil fuels.

Due to the fact that plankton and algae take up trace quantities of lead from the surrounding water, their tissues contain greater concentrations of the metal.

Learn more about brown algae, here:

https://brainly.com/question/31714795

#SPJ1

What is the IUPAC name of the following substance?

What is the IUPAC name of the following substance?

Answers

The International Union of Pure and Applied Chemistry (IUPAC) provides a standard system for naming organic compounds.

It is essential to learn this nomenclature system to communicate correctly about the chemical structures of compounds and how they relate to each other. Here is the IUPAC name of the following substance.Below is the structure of the given compound: In the given compound, there are four carbon atoms that are connected with single bonds. Carbon atoms are also attached to hydrogen atoms. Since it has four carbons in the main chain, the root name will be "but-". The functional group present in the molecule is the carboxylic acid group (-COOH), which gives the suffix "-oic acid." Therefore, the IUPAC name of the given substance is Butanoic acid.Thus, the IUPAC name of the given compound is Butanoic acid. It is essential to know the IUPAC naming of organic compounds to communicate correctly about the chemical structures of the compounds.

for such more questions on Chemistry

https://brainly.com/question/29886197

#SPJ8

19. A girl is ice skating and has 35 kgm/s of momentum. After she bumps into a
friend, she has 25 kgm/s of momentum. How much did she give her friend?

Answers

Answer:

15 kgm/s of momentum

Explanation:

35kgm/s-25 kgm/s = 10 kgm/s

What mass of sugar C12H22O11 is required to provide 2.50 x 1023 molecules of O2?

Answers

Answer:

342.29648 g/mol

Explanation:

Mass of sugar C₁₂H₂₂O₁₁ is required to provide 2.50 x 10²³ molecules of O₂ is 11.84.

What is mole concept?

Avogadro's number is the number of units in one mole of any substance and equals to 6.02214076 × 10²³. The units can be electrons, atoms, ions, or molecules.

No. of moles is defined as a particular no. of particles that we can calculate with the help of Avogadro’s number.

Mass of a particular product is also find out by stoichiometry of a reaction as per the no. of mole given in the reaction.

Reaction is-

C₁₂H₂₂O₁₁ + 12O₂ → 12CO₂ + 11H₂O

1 mole of C₁₂H₂₂O₁₁ forms 12 moles of O₂.

12 × 6.02214076 × 10²³ molecules of O₂ formed by 342.3 g of C₁₂H₂₂O₁₁.

1 molecule of O₂ formed by 4.73 × 10⁻²³  g of C₁₂H₂₂O₁₁.

2.50 × 10²³ molecules of O₂ formed by 11.84 g of C₁₂H₂₂O₁₁.

Therefore, Mass of sugar C₁₂H₂₂O₁₁ is required to provide 2.50 x 10²³ molecules of O₂ is 11.84.

Learn more about mole concept, here:

https://brainly.com/question/31123980

#SPJ2

Octane (C8H18) undergoes combustion according to the following thermochemical equation:2C8H18(l) + 25O2(g) → 16CO2(g) + 18H2O(l), ΔH°rxn= –11,020 kJ/mol.Calculate the standard enthalpy of formation of octane.Given: ΔH°f[CO2(g)] = –393.5 kJ/mol and ΔH°f[H2O(l)] = –285.8 kJ/mol

Answers

The standard enthalpy of formation of octane is -250.40 kJ.

What is standard enthalpy?

The energy released or spent when one mole of a substance is formed is measured by the standard enthalpy of formation.

2 C₈H₁₈ (l) + 25 O₂ (g) → 16 CO₂ (g) + 18 H₂O (l)

The ΔH°rxn  will be given by:

ΔH°rxn = 16 ΔH°f (CO₂ (g)) + 18 ΔH°f (H₂O (l))  -  (2 ΔH°f (C₈H₁₈) (l) + 25 ΔH°f O₂ (g))

ΔH°rxn and all the  ΔH°fs except for O₂ which is zero and the ΔH°(C₈H₁₈) (l) is then calculated:

On substituting the values:

-1.0940 × 10⁴ kJ = 16 mol x (-393.5 kJ/mol) + 18mol x  (-285.8 kJ/mol) - 2 (ΔH°f (C₈H₁₈) (l) -1.094 x10⁴ kJ

= -6296 kJ + ( -5144.40 kJ ) - 2(ΔH°f(C₈H₁₈) (l)

-500.40 kJ/2 = ΔH°f(C₈H₁₈) (l)

-250.40 kJ =  ΔH°f(C₈H₁₈) (l)

Thus, the standard enthalpy of formation of octane is -250.40 kJ.

To learn more about standard enthalpy, refer to the below link:

https://brainly.com/question/11417334

#SPJ1

What mass of NaCl is needed to produce a 26.4 mol/L with a 1.7 L volume?

Answers

we would need 2625.13 grams (or 2.62513 kilograms) of NaCl.

To calculate the mass of NaCl required to produce a 26.4 mol/L solution with a 1.7 L volume, we need to use the formula that relates the mass of solute, moles of solute, and molarity:Molarity (M) = moles of solute / liters of solution Rearranging this formula, we get:moles of solute = Molarity (M) x liters of solutionWe can use this formula to find the moles of NaCl needed:moles of NaCl = 26.4 mol/L x 1.7 L = 44.88 molNow, we can use the molar mass of NaCl to convert from moles to grams. The molar mass of NaCl is 58.44 g/mol:mass of NaCl = moles of NaCl x molar mass of NaClmass of NaCl = 44.88 mol x 58.44 g/mol = 2625.13 gTo produce a 26.4 mol/L solution with a 1.7 L volume.

for more question on NaCl

https://brainly.com/question/23269908

#SPJ8

If the density of a diamond is 3.5g/cm3, what would be the mass of a diamond whose volume is 0.5 cm3?

Answers

Answer:

1.75 g

Explanation:

as density ×volume =mass

3.5×0.5=mass

mass=1.75 g

plz mark as brainliest if it helps

The mass of the diamond which has a density of 3.5g/cm3 is \(1.75kg\)

Density is given as:\(3.5g/cm3\)having a volume of \(0.5 cm^3\)But we know that Density can be regarded as the the ratio of mass to that of volume of that particular object.let us represent this mathematically as;\(Density=\) \(\frac{ mass }{ volume }\)we can make Mass the subject of the formula to find the mass\(Mass= ( Density * volume)\)Then let us substitute the give value, then we will have

\(= ( 3.5*0.5)\)\(= 1.75kg\)

Therefore, the mass is\(1.75kg\)

Learn more at:https://brainly.com/question/14940265?referrer=searchResults

Bauxite must go through two processes to produce aluminum metal. The yield of the Bayer process, which extracts aluminum oxide from bauxite, is 40 percent The yield of converting aluminum oxide to aluminum is 50 percent. Determine the yield in grams of aluminum from one cubic meter of bauxite ore.

Answers

The yield of aluminium obtained from 1 m^3 of bauxite is 419810 g

What is a Percent yield

A percent yield of a substance measures the amount of the substance actually obtained as a percentage ratio of expected yield.

Percent yield = actual yield / expected yield × 100%

How to calculate the mass of aluminium obtained from bauxite

From the data given:

40 % of the bauxite is converted to aluminium oxide.

Volume of bauxite = 1 m^3

40 % of 1 m^3 = 0.4 m^3

volume of aluminium oxide = 0.4 m^3

density of aluminium oxide = 3965 kg/m^3

Using mass = density × volume

mass of aluminium oxide = 0.4 × 3965 kg

mass of aluminium oxide = 1586 kg

Formula of aluminium oxide is Al203

molar mass of aluminium oxide = 102 g

percentage mass of aluminium in one mole of aluminium oxide = mass of aluminium / mass of aluminium oxide × 100 %

Percentage mass of aluminium in aluminium oxide = 54/102 × 100

Percentage mass of aluminium in aluminium oxide = 52.94 %

Expected mass of aluminium from aluminium oxide = 52.94 × 1586

Expected mass of aluminium = 839.62 kg

Actual yield = 40 % × 839.62

Actual yield of aluminium = 419.81 kg

mass of aluminium in grams = 419810 g

Therefore, mass of aluminium obtained from 1 m^3 of bauxite is 419810 g

Learn more about percent yield at: https://brainly.com/question/8638404

What is the 3 step in the water cycle

Answers

Answer:

3 steps are

evaporation

condensation

precipitation

Describe a situation in which you might need to convert the units of a measurement, and what information you would need to do so.

Answers

Converting the units of a measurement is an essential skill that everyone should have. In our daily life, there are numerous situations where we might need to convert the units of measurement. One of the common examples can be when baking. To get the desired outcome, it is crucial to have the right amount of ingredients.

However, the recipe might require a different unit of measurement than what we have in our kitchen. For instance, the recipe might ask for one cup of flour, but we only have grams of flour in our kitchen. Therefore, to follow the recipe and get the desired outcome, we need to convert the grams into cupsAnother example where we might need to convert the units of a measurement is when dealing with currencies. If we are traveling abroad, we might need to convert our home country's currency into the currency of the country we are visiting to know how much it is worth. For instance, if we are from the United States and we are traveling to Mexico, we might need to convert our U.S. dollars to Mexican pesos.To convert the units of a measurement, we need to know the conversion factors. Conversion factors are ratios of two equivalent measures. For instance, to convert grams to cups, we need to know the conversion factor between grams and cups. Similarly, to convert U.S. dollars to Mexican pesos, we need to know the conversion factor between the two currencies. The conversion factor is the information we need to convert the units of a measurement. It is the relationship between the two units of measurements that help us convert them.

For such more question on measurement

https://brainly.com/question/24842282

#SPJ8

Other Questions
how many moles of Mg is 3.5 x 10^27 atoms of Mg Identify whether the given statements about climate change and economic growth are true or false by dragging and dropping the relevant word into the bins provided. Poorer countries have historically been responsible for the bulk of world carbon emissions because of poor technology and environmental regulations. Air and water quality in developed countries is generally much better today than it was several decades ago. Tackling climate change issues is likely to only modestly dent long-term economic growth. Carbon emissions are negatively correlated with economic growth. Answer Bank True False IS the headache from a CSF leak worse on sitting up or lying down? just need an answer for part c thank you so much Name of the vector and the species of the parasite that cause the disease Malaria in Africa Need this in 10 minutes will leave upvoteQuestion 9 2 pts Your friend is thinking about buying shares of stock in a company. You have been tracking the closing prices of the stock shares for the past 90 trading days. Which type of graph for the data would be best to show your friends ?a. pareto chartb. time-series graphc.circle graphd.none of these choicese. histogram" please answer all!!!Consider the reaction: CaCO3(s) CaO(s) + CO(g) Using standard thermodynamic data at 298K, calculate the entropy change for the surroundings when 1.91 moles of CaCO3(s) react at standard conditions. Why do you think governments would use propaganda, especially during wartime? How strongly do you think propaganda influences peoples opinions? Do you think that people can recognize propaganda as soon as they see it? Click this link to visit the O*NET page for the Athletic Trainers career. Scroll to the Wages & Employment link. According to O*NET, what is the projected growth for Athletic Trainers between 2012 and 2022?average (10 to 19 percent)faster than average (15 to 21 percent)much faster than average (29 percent or higher)slower than average (3 to 9 percent) Describe how a low pressure cell in the Southern hemisphere will differ from one in the Northern hemisphere Find the measure of DC if m Define the word regionalism in your own words. In your Psychology 101 class, you have scores of 82 and 84 on your two tests. For you to get the grade of B, the average of the two tests and the final exam, which counts as two tests, must be greater than or equal to 80 and less than 90. Find the range of the scores that you need on the final exam to get a B. are 2x + 4 and 4x + 2 equivalent? Landslides are an example of Explain why cnidarians are considered more "advanced" than poriferans. Please help with this problem A scientist is growing two species of bacteria. She defines a variable t that represents the number of days after the growth begins. The number of bacteria after t days is defined by: Species A: y=10002^(t/3) Species B: y=10002^3t(a) how many bacteria does each species start out with? It is given that -7, h, k, 20,... are the first 4 terms of an arithmetic progression.Find the value of h and k.A. h=11 k= 2B. h=2 k=11C. h=5 k=13D. h=13 k = 5 The hypotenuse of an isosceles right triangle is centimeters longer than either of its legs. Find the exact length of each side. (Hint: An isosceles right triangle is a right triangle whose legs are the same length.)