4521 kg into milligrams

11.) Non polar, equally, Charged.

12.) Ionic, Cation, Positive, anion, negative

13.) electronegative, Polar

14.) So

15. weak, HCl or N2

A covalent bond between C and H is Non Polar. It is called that,because electrons are shared Equally between these two atoms.C and H,are not Charged

12. An Ionic bond is formed when an electron is transferred from one atom to another.

The atom that loses an electron is called Cation and has charge positive. The

atom that gains an electron is called anion and has negative charge.

13. A hydrogen bond is formed between a H in one molecule and an Electronegative atom in

another molecule. The H can make an H-bond only if it is found in a Polar covalent

bond, in its own molecule.

H-bonds give So many of its special properties.

A van der Waals interaction is the Weak type of bond. All molecules form these

bonds. These interactions become important when found in great numbers. The often help the

3D shape of large molecules such as HCL or N2

Learn more about covalent bond here:

https://brainly.com/question/3447218

#SPJ9

The waves that  has the greatest wavelength is Wavelength shown with 1 wavelength stretched over a long distance.

A wave could be a disturbance or variety that voyages through a medium or space, carrying vitality without transporting matter. Waves can take different shapes and happen totally different sorts of waves, counting mechanical waves and electromagnetic waves.

Mechanical waves require a medium to propagate, meaning they require a substance like water, discuss, or a strong fabric to transmit the wave. Illustrations of mechanical waves incorporate water waves, sound waves, and seismic waves. In these waves, particles of the medium sway or vibrate in a design, exchanging energy from one molecule to another.

Electromagnetic waves, on the other hand, don't require a medium and can travel through vacuum, such as in space. Electromagnetic waves comprise of electric and attractive areas swaying opposite to each other and to the heading of wave engendering. Illustrations of electromagnetic waves incorporate obvious light, radio waves, microwaves, infrared waves, bright waves, X-rays, and gamma beams.

Learn more about waves  below.

https://brainly.com/question/26116832

#SPJ1

Hope this answer helps you

Answer:

thanks for the points thank you

Answer:

CaCl3 is the limited reagent

Explanation:

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Answer:

Stamen

Explanation:

Answer:

stamen

Explanation:

The stamen is the male reproductive organ. It consists of a pollen sac (anther) and a long supporting filament.

The percent by mass of the fluorine in the compound is 46.472%.

We know that the percent by mass has to do with the ratio of the total mass of the atom that is part of the compound and the total molar mass of the compound multiplied by one hundred.

The question in this case has demanded that we ought to obtain the mass percent of fluorine from the compound that we can be able to identify from the formula of the compound that is shown here as xenon hexa fluoride.

Mass of the compound can be obtained from; 131 + 6(19)

= 245 g/mol

The total mass of the fluorine atom in the compound is 114 g

Thus we have the use of;  114 /245 * 100/1

= 46.472%

The percent  by mass is now gotten for the fluorine atom as 46.472%.

Learn more about percent by mass:https://brainly.com/question/5394922

#SPJ1

The process of dissolved solute particles being surrounded by the  water molecules in an aqueous solution is called solvation or hydration.

Solvation occurs when water molecules surround and interact with solute particles, usually ions or polar molecules, forming a stable solution. The water molecules surround the solute particles, with their polar ends facing the solute, creating a layer of water molecules around the solute particles, effectively dispersing and stabilizing them throughout the solution.

Solvation is a key process in many chemical and biological reactions that occur in aqueous solutions, as it helps to facilitate the dissolution of solutes and influences their properties and behavior in solution.

To know more about Solvation here

https://brainly.com/question/30648328

#SPJ1

--The given question is incomplete, the complete question is

"The process of dissolved solute particles being surrounded by water molecules in an aqueous solution is called ----------- ."--

The beach at Antibes, France, is made mostly of small, smooth rocks that have been worn down by being pushed against one another by the energy of the sea water.

The geological process of erosion occurs when earthen materials are pushed and worn away by natural forces such as wind or water. Although it does not necessitate movement, a similar process known as weathering dissolves or disintegrates rock.

Weathering occurs when rocks and minerals on the Earth's surface disintegrate or dissolve. Weathering is caused by a variety of factors such as water, ice, acids, salts, plants, animals, and temperature swings. After a rock has been broken down, a process known as erosion transports the shards of rock and mineral away. The Earth's rocks are all too soft to endure weathering and erosion.

To know more about erosion visit:

brainly.com/question/30587260

#SPJ9

The property which is least helpful in identifying a sample of matter is option D. Volume.

Property including melting factor, boiling factor, density, solubility, color, odor, and so on. is bodily houses. residences that describe how a substance modifications identity to produce a new substance are chemical houses.

The reactivity of a substance is a chemical property as opposed to physical assets. The purpose qualifies as a chemical property as it is predicated on its electron configuration to decide how it's going to behave around different substances.

A matter is an attribute of depending this is unbiased its chemical composition. Density, color, hardness, melting and boiling points and electric conductivity are all examples of physical properties.

Learn more about the matter here:-https://brainly.com/question/3998772

#SPJ1

Answer: D Volume

Explanation:

The mass of 4.35 moles of potassium chloride is 324.14 grams. Potassium chloride (KCl) is a chemical compound made up of potassium and chlorine.

Potassium chloride (KCl) is a chemical compound composed of potassium and chlorine. It is commonly used as a salt substitute for people on low-sodium diets, as well as a fertilizer, a source of potassium in food additives, and a component of some medical solutions. Potassium chloride can also be used in the production of various chemicals, including explosives and pharmaceuticals.

The molar mass of potassium chloride (KCl) is 74.55 g/mol (39.10 g/mol for K and 35.45 g/mol for Cl).

To calculate the mass of 4.35 moles of KCl, we can use the following formula:

mass = moles × molar mass

So, the mass of 4.35 moles of KCl is:

mass = 4.35 moles × 74.55 g/mol

mass = 324.14 g

To know more about potassium chloride please refer: https://brainly.com/question/22528097

#SPJ1

Answer:

A lot

Explanation:

BillBill's recipe for onion soup calls for 4.0 lb of thinly sliced onions . if an onion has an average mass of 115 g , how many onions does Bill need ?

The following are categorized into polar or nonpolar molecules:

a) Beryllium chloride (BeCl₂) is a nonpolar molecule. The Be-Cl bond is polar due to the electronegativity difference between beryllium and chlorine, but the molecule is linear with the two polar bonds pointing in opposite directions, resulting in a net dipole moment of zero.

b) Hydrogen sulphide (H₂S) is a polar molecule. The H-S bond is polar due to the electronegativity difference between hydrogen and sulfur, and the molecule has a bent shape, resulting in a net dipole moment that is not zero.

c) Sulphur trioxide (SO₃) is a nonpolar molecule. The S-O bonds are polar due to the electronegativity difference between sulfur and oxygen, but the molecule is trigonal planar with the three polar bonds pointing in different directions, resulting in a net dipole moment of zero.

d) Water (H₂O) is a polar molecule. The H-O bond is polar due to the electronegativity difference between hydrogen and oxygen, and the molecule has a bent shape, resulting in a net dipole moment that is not zero.

e) Trichloromethane (CHCl₃) is a polar molecule. The C-Cl bonds are polar due to the electronegativity difference between carbon and chlorine, and the molecule has a tetrahedral shape, resulting in a net dipole moment that is not zero.

Find out more on polar or nonpolar here: https://brainly.com/question/17118815

#SPJ1

Answer:

A

Explanation:

the 2nd artical is against global warming while the first one uses scientific evidence

Answer:

Joints

Explanation:

Without joints we would not be able to bend our arms or legs. Hence option C is correct.

Bending is defined as the behavior of a thin structural element under an external load that is applied perpendicular to the element's longitudinal axis. Plants and their parts are thought to bend as a result of a flexure process in which the curvature of the plant part changes. The plant organs' collenchyma gives them flexibility and elasticity, preventing them from breaking when bent.

The force required to bend, straighten, and support joints is applied by muscles to the bones. Muscles act in pairs of flexors and extensors because they may pull on bones but not put them back into place. The extensor muscle relaxes and stretches as the flexor muscle contracts to bend the joint.

Thus, without joints we would not be able to bend our arms or legs. Hence option C is correct.

To learn more about bending, refer to the link below:

https://brainly.com/question/1788488

#SPJ2

Answer:

C4H9

Explanation:

If H = 15.88%

Then C = 100.00 – 15.88 = 84.12

Divide each % value by respective atomic mass

H = 15.88/1 = 15.88

C = 84.12/12 = 7.01

Divide through by smaller value

H = 15.88/7.01 = 2.26

C = 7.01/7.01 = 1

Remove fraction , multiply by 4

H = 9

C = 4

Empirical formula = C4H9

The hydrocarbon could be ( C4H9)2 = C8H18 = octane.

The temperature of the gas in Kelvin, after its volume is reduced to 2,450 mL, is approximately 143.27 K.

To determine the temperature of the gas in Kelvin after its volume is reduced, we can use the combined gas law, which relates the initial and final conditions of pressure, volume, and temperature for a given amount of gas.

The combined gas law equation is:

(P₁ * V₁) / T₁ = (P₂ * V₂) / T₂

Where P₁ and P₂ are the initial and final pressures, V₁ and V₂ are the initial and final volumes, T₁ is the initial temperature in Kelvin, and T₂ is the final temperature in Kelvin.

Given that the initial volume V₁ is 3,480 mL, the initial temperature T₁ is -70.0 °C (which needs to be converted to Kelvin), and the final volume V₂ is 2,450 mL, we can substitute these values into the equation.

To convert -70.0 °C to Kelvin, we add 273.15 to it, resulting in T₁ = 203.15 K.

Now we can solve for T₂:

(T₂ * V₁) / T₁ = V₂

T₂ = (V₂ * T₁) / V₁ = (2,450 mL * 203.15 K) / 3,480 mL

Simplifying the equation, we find:

T₂ ≈ 143.27 K

Therefore, the temperature of the gas in Kelvin, after its volume is reduced to 2,450 mL, is approximately 143.27 K.

For more question on temperature

https://brainly.com/question/4735135

#SPJ8

6.349 g mass of anhydrous magnesium sulfate will remain.

A mole is defined as 6.02214076 × 1023 of some chemical unit, be it atoms, molecules, ions, or others. The mole is a convenient unit to use because of the great number of atoms, molecules, or others in any substance.

Molar mass MgSO₄.7 H₂O = 246.52 g/mol

\(Moles =\frac{mass}{molar \;mass}\)

\(Moles =\frac{13.0 g}{246.52}\)

0.0527 moles

Molar mass MgSO₄ = 120.4 g/mol

Mass of anhydrous magnesium sulfate :

( 0.0527 x 120.4 ) => 6.349 g

Learn more about moles here:

https://brainly.com/question/8455949

#SPJ1

Answer:

To calculate the amount of solute (NaNO3) that will be left after the saturated solution is evaporated to dryness, we need to use the solubility of NaNO3 in water at 30 degrees Celsius. The solubility of NaNO3 in water at 30 degrees Celsius is 88.0 g/100 mL. First, we need to convert the 50 grams of water to milliliters. The density of water at 30 degrees Celsius is 0.996 g/mL. Therefore: 50 g ÷ 0.996 g/mL = 50.2 mL So, we have 50.2 mL of water in which the solubility of NaNO3 is 88.0 g/100 mL. To calculate the amount of NaNO3 that will be left after the solution is evaporated to dryness, we can

Answer:

A:Itasca

A:ItascaB:Hubbard

A:ItascaB:HubbardC:Douglas

A:ItascaB:HubbardC:DouglasD:Grand Marais

E:Two harbors

F:Duluth

Answer:

Duluth, Twin Harbors and Grand Marais because they are on the coast of the lake.

Explanation:

Answer:

its sodium hydroxide

Explanation:

The model of Neils Bohr postulates that electrons in atoms are found in specific energy levels. Transition from a higher to a lower energy level produces an emission spectrum characteristic of elements.

According to Bohr's model of the atom, an electron in atom exists in distinct energy levels. Electrons can be promoted from lower to higher energy levels when they absorb energy. The electrons are unstable in this higher energy excited state hence they quickly return to the ground state emitting energy. This emission is characteristic of elements.

The following statements are true based on the Bohr model;

Learn more: https://brainly.com/question/24556237

Answer:

The actual concentration of the hydrochloric acid is 1.2M

Explanation:

The formula to be used here is that of concentration (popularly used during titration);

CₐVₐ/CbVb =nₐ/nb

where Cₐ is the concentration of acid (supposed to be 1.0 M but unsure)

Vₐ is the volume of acid (100 ml)

Cb is the concentration of base (1.3 M)

Vb is the volume of base (89.13 ml)

nₐ is the volume of acid

nb is the volume of base

The equation for the reaction described in the question is

HCl + NaOH ⇒ NaCl + H₂O

we can see from the above equation the ratio of the number of moles for both the acid and the base is 1:1

Thus;

Cₐ × 100/1.3 × 89.13 =1/1

Cₐ = 1.3 × 89.13/100

Cₐ = 1.2M

The actual concentration of the hydrochloric acid is 1.2M

The number of moles in 235000 molecules of methane is 3.9 × 10⁻¹⁹ mol.

A mole can be defined as a standard unit that is utilized to find a given count of particles. The particles counted are chemically the same and individually distinct.

A mole can be used to determine quantities of atoms, molecules, ions, or other particular particles. The number of particles in 1 mole is 6.023 ×10 ²³ which is known as Avogadro’s constant.

Given, the number of molecules of methane = 235,000

The mass of one mole of methane = 16 g

The number of molecules in one mole of methane =  6.023 × 10²³

235000 molecules of methane have moles = 235000/6.023 × 10²³

= 3.9 × 10⁻¹⁹ mol

Learn more about the mole, here:

brainly.com/question/26416088

#SPJ1

\({ \qquad\qquad\huge\underline{{\sf Answer}}} \)

The given statement is false ~

As we know, large distances can only be measured by using larger units like kilometers, miles, or other units, and it's much convenient. so, it's so different if we were to measure that distance using small unit like " decimeters "

I hope that was reasonable for you to understand, let me know if you have any questions ~

Answer:

b

Explanation:

Higher temperatures tend to increase the rate of a chemical reaction because the particles move faster and therefore collide more often.

Rate of reaction tells about the speed of the reaction or at what duration of time a reaction gets completed.

When we increases the temperature of any chemical reaction, then the kinetic energy of the molecules increases, due to which they move fast in the chemical reaction. Due to this random and fast movement molecules get collide with each other rapidly and easily form the product.

Hence option (c) is correct i.e. particles move faster and therefore collide more often when temperature increases.

To learn more about rate of reaction, visit the below link:

https://brainly.com/question/19513092

Answer:

27.3 g HCl

Explanation:

**Be sure to arrange the conversion in a way that allows for the cancellation of units.

(Step 1)

Convert milliliters (mL) to liters (L).

1,000 mL = 1 L

 250 mL                1 L
---------------  x  -----------------  =  0.25 L
                         1,000 mL

(Step 2)

Use the molarity ratio to find the moles of HCl.

Molarity = moles / L

3 M = moles / 0.25 L

0.75 = moles

(Step 3)

Convert moles to grams using the molar mass of HCl.

Molar Mass (HCl): 1.008 g/mol + 35.453 g/mol

Molar Mass (HCl): 36.461 g/mol

0.75 moles HCl             36.461 g
--------------------------  x  --------------------  =  27.3 g HCl
                                         1 mole

The mixture contains 8.89% ammonium chloride.

Percent ammonium chloride = (mass of ammonium chloride / total weight of mixture) x 100

Percent ammonium chloride = (0.942 g / 10.618 g) x 100

Percent ammonium chloride = 8.89%

So, the mixture contains 8.89% ammonium chloride.

What is the amount?

The amount of substance (n) means the number of particles or elementary entities in a sample. It is also called the chemical amount. The unit for the amount of substance is the mole. An elementary entity is the smallest amount of a substance that can exist.

How do you find the percentage of a mixture in chemistry?

To know more about percentage composition:

https://brainly.com/question/26150306

#SPJ1