40 grams of KCI are dissolved in 100 mL of water at 45C. How many additional grams of KCI are needed to make the solution saturated at 80 C?

Answers

Answer 1

According to the question 32 g of KCI are needed to make the solution saturated at 80 C

What is solution saturated?

Solution saturated is a term used to describe a solution that has reached its maximum solute concentration and can no longer dissolve any more solute. This occurs when the number of solute particles in the solution is equal to the number of solvent molecules. When the solution is saturated, any additional solute added to it will simply form a precipitate or settle out of the solution.

At 80°C, the saturation point of KCl is approximately 132 g/L, so in order to make the solution saturated, you need to add an additional 32 g of KCl. To calculate this, you can use the following equation:
(Saturation concentration at 80°C - Initial concentration at 45°C) x Volume = Additional grams of KCl
(132 g/L - 40 g/L) x 100 mL = 32 g.

To learn more about solution saturated
https://brainly.com/question/530542
#SPJ1


Related Questions

What happens when KCl is dissolved in water?
1.
KCI is the solute in a homogeneous mixture.
2.
KCl is the solute in a heterogeneous mixture.
3
KCI is the solvent in a homogeneous mixture.
4.
KCI is the solvent in a heterogeneous mixture.

Answers

Answer:

KCI is rhe solute in a homogeneous mixture

Answer:

1. KCI is the solute in a homogeneous mixture.

Explanation:

Given: H2 + O 2 → H2O1
the reaction occurs at ST.P a) Balance the chemical equation. (1 pts) b) Calculate the number of moles of the reactants needed to obtain 45 liner of H2O (2 pt) 4) Deduce the volume of the reactants (2 pts)​

Answers

a) The balanced chemical equation for the reaction is: 2H₂ + O₂ → 2H₂O

b) the number of moles of O₂ required is approximately 1.004 moles.

c)  approximately 45 liters of H₂ and 22.5 liters of O₂ are needed to obtain 45 liters of H₂O.

a) Balancing the chemical equation:

The balanced chemical equation for the reaction is: 2H₂ + O₂ → 2H₂O

b) Calculating the number of moles of the reactants needed to obtain 45 liters of H₂O:

From the balanced equation, we can see that for every 2 moles of H₂O produced, we need 2 moles of H₂ and 1 mole of O₂. Since the stoichiometry is based on moles, we need to convert the given volume of H2O into moles.

To convert volume to moles, we need to use the ideal gas law, PV = nRT. At standard temperature and pressure (STP), the molar volume of an ideal gas is 22.4 liters.

Given that we have 45 liters of H2O, we can calculate the number of moles as follows:

moles of H₂O = (volume of H₂O) / (molar volume at STP)

            = 45 liters / 22.4 liters/mol

            ≈ 2.008 moles of H₂O

Since the stoichiometry of the reaction is 2 moles of H₂O for every 2 moles of H₂, we need an equal number of moles of H₂. Therefore, the number of moles of H₂ required is also approximately 2.008 moles.

For O₂, since the stoichiometry is 1 mole of O₂ for every 2 moles of H₂O, we need half the number of moles of H₂O. Thus, the number of moles of O₂required is approximately 1.004 moles.

c)  the volume of the reactants:

Since the stoichiometry of the balanced equation is 2 moles of H₂for every 1 mole of O₂ and 2 moles of H₂O, we can deduce the volume of the reactants based on their molar volumes at STP.

For 2.008 moles of H₂, the volume can be calculated as follows:

volume of H₂= (moles of H₂) * (molar volume at STP)

            = 2.008 moles * 22.4 liters/mol

            ≈ 45 liters of H₂

For 1.004 moles of O₂, the volume can be calculated similarly:

volume of O₂= (moles of O₂) * (molar volume at STP)

            = 1.004 moles * 22.4 liters/mol

            ≈ 22.5 liters of O₂

Therefore, approximately 45 liters of H₂and 22.5 liters of O₂ are needed to obtain 45 liters of H₂O

for more questions on chemical
https://brainly.com/question/29886197
#SPJ8

A science teacher is planning a science lab in which students will identify conditions that do and do not speed up the time required for
sugar to dissolve in water. Which of the following conditions will NOT have an effect on the dissolving time?
B. stirring the water
D. magnetizing the sugar
E grinding the sugar
of heating the water

Answers

Answer: E

Explanation:

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Given the reaction at equilibrium:
2NO2(g) → N204(g) Heat of
reaction is -55.3 kJ) What type of
reaction is this?
O Endothermic
O Exothermic

Answers

When the equilibrium constant is higher than one, it indicates that the reaction prefers to produce products, whereas if the equilibrium constant is less than one, it indicates that the reaction prefers to produce reactants. If the equilibrium constant is equal to one, the reaction proceeds in both directions equally.

In a chemical reaction, exothermic reactions are defined as reactions that release heat into their environment. It implies that heat is given off when reactants are converted to products. At equilibrium, an exothermic reaction continues to be exothermic, meaning that heat is given off even after the reaction reaches a state of equilibrium.There are two types of reactions: exothermic and endothermic.

A reaction is classified as exothermic if it releases heat, and endothermic if it absorbs heat. The direction of the reaction is determined by whether it is exothermic or endothermic. At equilibrium, the reaction is no longer moving forwards or backwards. It's also worth noting that reactions can be exothermic in one direction and endothermic in the other.

The equilibrium constant (K) is defined as the ratio of the concentration of products to the concentration of reactants in the chemical reaction equation. It is used to express how much of the products is generated by the reaction in comparison to the reactants.  the equilibrium constant aids in the identification of the direction in which the reaction will proceed at equilibrium.

for more questions on equilibrium

https://brainly.com/question/3159758

#SPJ8

5. Students perform a chemical reaction in
a glass test tube. They notice that the test
tube feels cooler than it did before the
reactants were added.

b) What data could the students collect to
confirm the type of reaction?

c) Identify the system and the surroundings
in this investigation.

Answers

The data the students could collect to confirm the type of reaction is the temperature before and after the reaction.

The system is the reaction vessel and the surroundings are the laboratory environment.

What are chemical reactions?

Chemical reactions are reactions in which new substances called products are formed from one or more substances that undergo chemical change called reactants.

During a chemical reaction, heat changes occur as the reactants form products. The heat changes that occur may involve the release of heat by the chemical system to the surroundings or the absorption of heat from the surrounding by the chemical system.

A reaction in which heat is absorbed will feel cold to touch and is called an endothermic reaction.

A reaction in which heat is released to the surroundings will feel hot to touch and is called an exothermic reaction.

Learn more about exothermic and endothermic reactions at: https://brainly.com/question/14711757

#SPJ1

Given the reaction below, which is the being reduced?
Mg + Cl2 Right arrow. Mg2+ + 2Cl–
2CI–
CI2
Mg
Mg2+

Answers

In the given reaction, chlorine (\(Cl_{2}\)) is being reduced.

In the given reaction:

Mg + \(Cl_{2}\)→ \(Mg^2^+\) + 2\(Cl^-\)

The reactants are magnesium (Mg) and chlorine gas ( \(Cl_{2}\)), and the products are magnesium cations (\(Mg^2^+\)) and chloride anions (\(Cl^-\)).

To determine which species is being reduced, we need to compare the oxidation states (or oxidation numbers) of the elements before and after the reaction. The element that undergoes a decrease in oxidation state is being reduced.

In this reaction, the oxidation state of magnesium changes from 0 to +2. Since the oxidation state of magnesium increases, it is undergoing oxidation, not reduction.

On the other hand, the oxidation state of chlorine changes from 0 to -1. The chlorine atoms in  \(Cl_{2}\) have an oxidation state of 0, while in the chloride ions (\(Cl^-\)), the oxidation state is -1. Since the oxidation state of chlorine decreases, it is being reduced.

Therefore, in the given reaction, chlorine ( \(Cl_{2}\)) is being reduced. It gains electrons and undergoes a decrease in oxidation state from 0 to -1.

for more questions on reduced

https://brainly.com/question/14854495

#SPJ8

4.
The average Olympic runner has a mass of 67.8 kg and accelerates at 10.38
m/s2. What is the force accelerated by an Olympic runner?

Answers

Answer:

696.98 N

Explanation:

The force acting on an object given it's mass and acceleration can be found by using the formula

force = mass × acceleration

From the question we have

force = 67.8 × 10.28 = 696.984

We have the final answer as

696.98 N

Hope this helps you

pOH of the 0.001M NaOH solution is​

Answers

The pOH of the 0.001 M NaOH solution is approximately 3.

To determine the pOH of a solution, we need to know the concentration of hydroxide ions (OH-) in the solution.

In the case of a 0.001 M NaOH solution, we can assume that all of the NaOH dissociates completely in water to form Na+ and OH- ions. Therefore, the concentration of hydroxide ions in the solution is also 0.001 M.

The pOH is calculated using the equation:

pOH = -log[OH-]

Substituting the concentration of hydroxide ions, we have:

pOH = -log(0.001)

Using a calculator, we can evaluate the logarithm:

pOH ≈ 3

Therefore, the pOH of the 0.001 M NaOH solution is approximately 3.

Know more about  hydroxide ions   here:

https://brainly.com/question/28464162

#SPJ8

I need help answering number 14 A B and C. Thank you!

I need help answering number 14 A B and C. Thank you!

Answers

Answer:

Explanation:

TiO2 + C + 2 CI2 → TiCI4 + CO2

(a)

(2.16 mol TiO2) x (2 mol CI2 / 1 mol TiO2) x ( 70.9064 g C/mol) = 306 g CI2

(b)

(2.16 mol TIO2) x (1 mol C / 1 mol TiO2) x ( 12.01078 g C/mol)n= 25.9 g C

(c)

Use the law of conservation of mass:

(2.16 mol TiO2) x ( 79.8660 g TiO2/mol) + (306 g CI2 + 25.9 g C = 504 g total.

Hope this help!:)

If you want to distinguish between alkanes and alkenes using chemical reactions, which test: the combustion or the bromine is the better one? Explain your answer. Question 2: what you can use to wash the cloth contaminated by oil?

Answers

1) We could use the bromine water test to tell the difference between the alkane and the alkene

2) We can use a detergent to wash a cloth that is contaminated by oil.

What is an alkane?

The term alkane has to do with a hydrocarbon that is composed of only a straight chain compound there are no multiple bonds in the alkane molecule and this is the difference between the alkane and the alkene. The alkene is composed of double bonds. The alkene compounds are able to decolorize bromine water while the alkanes can not.

If you have a contaminated cloth, you can be able to wash it by the use of a detergent because it is able to lift off the grease or oil by the use of the hydrophobic tail of the detergent.

Learn more about alkane:https://brainly.com/question/18522493

#SPJ1

Nazeeh conducted an experiment to demonstrate the law of conservation of matter. He burned a strip of magnesium that had a beginning mass of 5.0 g over an open flame. The magnesium gave off a bright white light and smoke as it was being burned. The white ash that was left over had a mass of 4.5 g. Nazeeh concluded that his experiment did not uphold the law of conservation of matter.
What did Nazeeh NOT take into consideration when drawing his conclusion?
A
that some of the mass was lost to the air as light

B
that mass has absolutely no relationship to matter

C
that some of the mass was lost to the air as smoke

D
that ash has a lower mass than the strip of magnesium

Answers

Answer:

C

that some of the mass was lost to the air as smoke

Answer:

C

Explanation:

A: Light isn´t part of the mass of magnesium, light is energy, it doesn´t occupate space.

B: Mass clearly have a relationship with matter, if you increase the amout of mass, you will increase the amout of matter, one way or another.

C: It is correct, some of the mass was lost because hot gases tend to go up.

D: Yes, the ash has a lower mass than magnesium, but it is not because ash is lighter or something like that. It is because some of the ash was lost due to the air.

How many grams of oxygen would there be in 1.00 liter of oxygen at STP?

Answers

Answer

0 gram

Explination

1 liter of oxygen in grams 1 liter of oxygen equals 0 gram

calculate the volume in milliliters of 2.37M potassium hydroxide that contains 9.29g of solute.

Answers

The volume in millilitres of 2.37M potassium hydroxide that contains 9.29g of solute is 70mL.

How to calculate volume?

Volume of a solution can be calculated from the molarity, which is the concentration of a substance in solution, expressed as the number moles of solute per litre of solution.

Molarity = no of moles ÷ volume

no of moles = mass ÷ molar mass

Molar mass of pottasium hydroxide (KOH) = 56.1056 g/mol

moles = 9.29g ÷ 56.1056 g/mol = 0.166moles

2.37 = 0.166/V

V = 0.166 ÷ 2.37

V = 0.07L

Volume in millilitres = 70mL

Therefore, 70mL is the volume of the pottasium hydroxide solution.

Learn more about volume at: https://brainly.com/question/861096

#SPJ1

An ideal gas is contained in a closed assembly with an initial pressure and
temperature of 250 kN/m²and 75°C respectively, If the final volume of the system
is increased 1.8 times and the temperature drops to 18°C, determine the final
pressure of the gas.​

Answers

Answer: The final pressure is 116kPa or \(116kN/m^2\)

Explanation:

The combined gas equation is,

\(\frac{P_1V_1}{T_1}=\frac{P_2V_2}{T_2}\)

where,

\(P_1\) = initial pressure of gas = \(250kN/m^2=250kPa\)   \((1kN/m^2=1kPa)\)

\(P_2\) = final pressure of gas = ?

\(V_1\) = initial volume of gas = v ml

\(V_2\) = final volume of gas = \(1.8\times v=1.8vml\)

\(T_1\) = initial temperature of gas = \(75^0C=(75+273)K=348K\)

\(T_2\) = final temperature of gas = \(18^0C=(18+273)K=291K\)

Now put all the given values in the above equation, we get:

\(\frac{250kPa\times v}{348}=\frac{P_2\times 1.8v}{291}\)

\(P_2=116kPa\)

The final pressure is 116kPa or \(116kN/m^2\)

Briefly explain how will you describe which object is moving fast and which one is moving slow?

Answers

The object that shows fast motion is said to have a higher speed while the one with slow motion is said to have a slow speed.
Hope that helps it was on googIe

Draw a schematic diagram of a circuit with an output device, a energy source and a controller.

Answers

Answer:

ch∪pαpi munαn0?

Explanation:

Gallium chloride is formed by the reaction of 2.6 L of a 1.44 M solution of HI according to the following equation: 2Ga + 6HCI-*2GaClg + 3H2
Outline the steps necessary to determine the mass of gallium chloride.
Step 1: start with the end in mind.
[ Choose ]
Step 2: cancel out the units from step 1.
[ Choose ]
Step 3: cancel out the units from step 2.
[ Choose ]
Step 4: cancel out the units from step 3
[ Choose ]
Step 5: multiply the top
[ Choose 1
Step 6: divide the top by the bottom.
[ Choose ]
Step 7: write your answer with the correct number of significant figures and correct unit[s).
[ Choose ]

Gallium chloride is formed by the reaction of 2.6 L of a 1.44 M solution of HI according to the following

Answers

The mass of the gallium chloride that was produced is given as 220 g.

What is stoichiometry?

Stoichiometry involves the use of chemical equations and balancing those equations to ensure that the same number and types of atoms are present on both sides of the equation. The coefficients in the balanced chemical equation represent the stoichiometric coefficients, which indicate the relative amounts of reactants and products that are involved in the reaction.

We know that;

Number of moles of HCI = 1.44 M * 2.6 L

= 3.744 moles

If 6 moles of HCI reacts produces 2 moles of GaCl3

3.744 moles of HCl producs 3.744 * 2/6

= 1.248 moles

Mass of the GaCl3 = 1.248 * 176 g/mol

= 220 g

Learn more about stoichiometry:https://brainly.com/question/30215297

#SPJ1

.What is the effective number of bonds between the sulfur atom and each oxygen atom in the sulfate ion

Answers

Answer:

The effective number of bonds in sulfate ion is 1.5

Explanation:

The number of chemical bonds between two atoms is known as the bond order.

In covalent bonds between two atoms, a single bond has a bond order of one, a double bond has a bond order of two, a triple bond has a bond order of three.

If there are more than two atoms in a molecule, the effective number of bonds can be determined by applying the following steps:

1. Draw the Lewis structure.

2. Count the total number of bonds.

3. Count the number of bond groups between individual atoms.

4. Divide the number of bonds between atoms by the total number of bond groups in the molecule.

For the sulfate ion, the resonance structure is shown in the attachment below. From the structure;

Total number of bonds = (2 × 2) + (2 × 1) = 6

Total number of bond groups = 4

Effective number of bonds = 6/4 = 1.5

Therefore, the effective number of bonds in sulfate ion is 1.5

.What is the effective number of bonds between the sulfur atom and each oxygen atom in the sulfate ion

in the reaction above, pyruvate: select one: a. reduces nad b. oxidizes nad c. reduces acetyl coa d. oxidizes acetyl coa

Answers

The correct answer to this question is pyruvate oxidizes in case of the aerobic respiration to generally form acetyl Coenzyme A or CoA which involves three major steps decarboxylation along with the reduction of the NAD+, and at the last attachment of CoA.

In the cellular inner space or the matrix, pyruvate is usually modified in a series of steps:

Step 1 : Pyruvate mostly loses the carboxyl group, which is then usually liberated as a carbon dioxide molecule, generally leaving a two-carbon molecule in its original place.

Step 2 : The two-carbon molecule from step 1 is further changed and oxidised, and then NAD+ takes up the all the lost electrons to create NADH.

Step 3 : Coenzyme A (CoA), an organic susbstance generated usually from the vitamin B5, is then joined with the oxidised two-carbon molecul. an acetyl group, to form the acetyl CoA. The role or the work of acetyl CoA, also designated as a carrier molecule, in this process is to transport the formed acetyl group to the citric acid cycle.

For more information about pyruvate click here:

brainly.com/question/28320299

#SPJ4

What occurs during a solar elcipse

Answers

Answer:

the moon gets infront of the sun

Answer:

A solar eclipse happens when the moon moves in front of the Sun as seen from a location on Earth. During a solar eclipse, it gets dimer and dimmer outside as more and more of the Sun is covered by the Moon. During a total eclipse, the entire Sun is covered for a few minutes and it becomes very dark outside. The temperature outside also drops.

What are all the possible metabolites for the clofibrate structure through metabolism pathways like hydrolysis, alkylation, conjugation, oxidation etc. ?

Answers

Clofibrate is a lipid-lowering pharmaceutical that has been utilized to treat hyperlipidemia. Its metabolism system includes different pathways such as hydrolysis, oxidation, conjugation, and others.

What  are a few potential metabolites of clofibrate?

Metabolites are little molecules that are produced during the process of  metabolism in living living beings.

Clofibrate hydrolysis metabolite:

2-(4-Chlorophenoxy)-2-methylpropanoic acid (phenoxyisobutyric acid)

Clofibrate oxidation metabolites:

4-Chlorophenylacetic acid4-Chlorobenzaldehyde4-Chlorophenylacetyl-CoA

Clofibrate alkylation metabolites:

No specific alkylation metabolites have been widely reported for clofibrate.

Clofibrate conjugation metabolites:

Glucuronide conjugatesSulfate conjugates

Conclusively, the relative abundance and significance of each metabolite can vary among individuals.

Learn more about metabolites

https://brainly.com/question/14422941

#SPJ1

Which of the following is a balanced equation?

A. Na + Cl2 → NaCl

B. 2Na + Cl2 → NaCl

C. Na + Cl2 → 2NaCl

D. 2Na + Cl2 → 2NaC

Answers

it would be D unless the 2NaC was cut off on accident, if its Carbon than no

D. 2Na + Cl2 → 2NaCl

Calculate the cell potential for the following reaction that takes place in an electrochemical cell at 25°C.

Cu(s) | Cu2+(aq, 0.0032 M) || Cu2+(aq, 4.48 M) | Cu(s)
Calculate the cell potential for the following reaction that takes place in an electrochemical cell at 25°C.

Cu(s) | Cu2+(aq, 0.0032 M) || Cu2+(aq, 4.48 M) | Cu(s)
+0.186 V
0.00 V
+0.093 V
+0.34 V
+0.052 V

Answers

Okay, let's solve this step-by-step:

1) The standard reduction potentials for Cu2+/Cu are: E°Cu2+/Cu = +0.34 V.

This is the reduction potential when [Cu2+] = 1 M and [Cu] = 1 M.

2) The actual reduction potential (Ered) depends on the concentrations of oxidized and reduced species.

Here,

[Cu2+] = 4.48 M on the right side.

[Cu2+] = 0.0032 M on the left side.

3) Ered = E° + 0.0591 log([oxidized]/[reduced]) (Nernst equation)

So for the right side:

Ered = +0.34 + 0.0591 log(4.48/1) = +0.34 + 0.186 = +0.526 V

And for the left side:

Ered = +0.34 + 0.0591 log(0.0032/1) = +0.34 - 0.093 = +0.247 V

4) The cell potential (Ecell) is the difference between the two half-cell potentials:

Ecell = +0.526 - 0.247 = +0.279 V

So the cell potential for the given reaction at 25°C is +0.279 V.

Let me know if you have any other questions!

In x-ray studies of crystalline peptides, Linus Pauling and Robert Corey found that the C—N bond in the peptide link is intermediate in length (1.32 Å) between a typical C—N single bond (1.49 Å) and a C=N double bond (1.27 Å). They also found that the peptide bond is planar (all four atoms attached to the C—N group are located in the same plane) and that the two α-carbon atoms attached to the C—N are always trans to each other (on opposite sides of the peptide bond).

Required:
a. What does the length of the C—N bond in the peptide linkage indicate about its strength and its bond order (i.e., whether it is single, double, or triple)?
b. What do the observations of Pauling and Corey tell us about the ease of rotation about the C—N peptide bond?

Answers

Answer:

The C-N bond is a double bond.

There is no free rotation about the C-N bond

Explanation:

Linus Pauling and Robert Corey carried out a painstaking study of the bond lengths of peptide bonds as well as the stereo chemistry of atoms and groups around the peptide bonds in the crystal structures of molecules containing one or a few peptide bonds.

Their findings indicate that the bond length of the C-N bond in crystalline peptides is intermediate in length (1.32 Å) between a typical C—N single bond (1.49 Å) and a C=N double bond (1.27 Å). This is because the peptide bond has some double bond character as a result of resonance involving the C=O and -NH moieties of the amide.

As a result of resonance as shown above, the peptide bonds are found to be planar hence free rotation about the C-N bond is hindered. The peptide bond is mostly found in the trans configuration because it is more energetically favourable than the cis configuration.

Summarily, owing to the existence of a partial double bond character between the α carbon and the amine nitrogen in the peptide, there is no free rotation around the C-N bond.

Using the weather radar map shown here, infer at which lettered point the most likely tornado formation and damage would
occur.
es )
A)
А
B)
B
C С
D
D

Using the weather radar map shown here, infer at which lettered point the most likely tornado formation

Answers

Answer:

c

Explanation:

this is because it makes sense

Answer:

d

Explanation:

Solar and wind energy are both intermittent resources that cannot be relied upon for a constant stream of energy production. Explain why developing better ways to store energy is an important part of making these energy sources more practical to use.

Answers

By removing the need to build additional transmission lines and equipment, energy storage may reduce costs for utilities and their customers.

By removing the need to build additional transmission lines and equipment, energy storage may reduce costs for utilities and their customers. Energy storage's inherent ability to offer backup power in the event of grid failure is a feature that both residential consumers and commercial owners find highly desirable.

To know more about energy, here:

https://brainly.com/question/1932868

#SPJ1

An isomer of C3H7O undergoes one step oxidation reaction. Answer the following questions due to this reaction.
a) Write a full symbol equation for this reaction.b) Name the proper reagent and catalyst for this reaction.c) Why do you think there is no need to remove the product from the reaction vessel?

Answers

Answer:

C3H7O + O2 → CO2 + H2O

Explanation:

a) The full symbol equation for the oxidation reaction of an isomer of C3H7O can be represented as:

C3H7O + O2 → CO2 + H2O

b) The proper reagent for this oxidation reaction is O2 (oxygen gas). The catalyst required for this reaction depends on the specific conditions. Common catalysts used for oxidation reactions include transition metals such as platinum (Pt), palladium (Pd), or copper (Cu).

c) There is no need to remove the product (CO2 and H2O) from the reaction vessel because they are typically in the gas or liquid phase and do not significantly interfere with the reaction. The product gases can be easily vented out of the vessel, while the liquid water can be left in the reaction mixture. Additionally, the product CO2 is a stable and inert gas, which does not pose any hazards in most cases. Therefore, it is often not necessary to remove the products after the reaction is complete.

A sample of pure acetic acid, CH3COOH, contains 1.40x10^23 carbon atoms. How many moles of acetic acid are in the sample. Explain

Answers

Taking into account the definition of Avogadro's number, 0.116 moles of acetic acid are in the sample.

Avogadro's Number

Avogadro's Number or Avogadro's Constant is called the number of particles that make up a substance (usually atoms or molecules) and that can be found in the amount of one mole of said substance. Its value is 6.023×10²³ particles per mole. Avogadro's number applies to any substance.

Amount of moles of acetic acid that contains 1.40×10²³ carbon atoms

Then you can apply the following rule of three: if 6.023×10²³ atoms are contained in 1 mole of carbon, then 1.40×10²³ atoms are contained in how many moles of carbon?

amount of moles of carbon= (1.40×10²³ atoms × 1 mole)÷ 6.023×10²³ atoms

amount of moles of carbon= 0.232 moles

So, the amount of moles of carbon in acetic acid that contains 1.40×10²³ carbon atoms is 0.232 moles.

On the other side, the small subscripts placed to the right of some symbol indicate the number of moles of the element that are found in the compound.

So, in pure acetic acid, CH₃COOH, are present 2 moles of carbon in 1 mole of acetic acid.

Then you can apply the following rule of three: if 2 moles of carbon are present in 1 mole of acetic acid, then 0.232 moles of carbon are contained in how many moles of acetic acid?

\(amount of moles of acetic acid=\frac{0.232 moles of carbonx1 mole of acetic acid}{2 moles of carbon}\)

amount of moles of acetic acid= 0.116 moles

In summary, 0.116 moles of acetic acid are in the sample.

Learn more about Avogadro's Number:

brainly.com/question/1445383?referrer=searchResults

brainly.com/question/1528951?referrer=searchResults

A flask contains the system below at equilibrium. Addition of which of the following reagents would increase the solubility of Cu(OH)2?

Cu(OH)2 (s) = Cu2+ (aq) + 2 OH- (ag)

Answers

Adding an acidic reagent would increase the solubility of Cu(OH)2.

The solubility of Cu(OH)2 is governed by Le Chatelier's principle, which states that a system at equilibrium will shift to counteract any imposed changes. In this case, Cu(OH)2 is a basic compound and adding an acidic reagent would introduce more H+ ions into the system.

The OH- ions produced by the dissociation of Cu(OH)2 would combine with the H+ ions from the acidic reagent to form water, effectively removing OH- ions from the system. To maintain equilibrium, more Cu(OH)2 would dissolve, leading to an increase in its solubility.

When an acidic reagent is added, it increases the concentration of H+ ions in the solution. According to the equilibrium equation, Cu(OH)2 (s) ⇌ Cu2+ (aq) + 2 OH- (ag), the OH- ions are the product of the dissociation of Cu(OH)2.

By adding more H+ ions through an acidic reagent, the system will shift to the right to consume the excess H+ ions. This shift will result in an increase in the concentration of Cu2+ ions and OH- ions, leading to an increased solubility of Cu(OH)2. Therefore, adding an acidic reagent will effectively increase the solubility of Cu(OH)2.

for such more questions on  reagent

https://brainly.com/question/26905271

#SPJ8

Other Questions
Which of the following are advantages of having children in one's twenties?The parents have more physical energy.The mother is likely to have fewer health problems.The parents are less likely to build up expectations for their children. what caused the widespread depletion of biological resources in the caribbean? i was playing tennis the whole evening identify the tense What do these red/yellow/orange-precipitate reactions have in common? (choosethe best answer)They all made the same color.They all have a barium (Ba+2) cation.They all have a chromate (CrO4-2) ion.They all have a chloride ( C1-1) ion. The following is also an example of what?"Land created in common,dream nourished in common."A)epistropheB)OonamonapiaC)assonanceD)personificationMore than one answer from above Order the following in sequence of function during replication 3 Primase < 1 telomerase < 4 DNA polymerase < 2 single strand binding protein how does the de broglie wavelength of an electron change if its momentum increases?a. The de Broglie wavelength of the electron increases.b. The de Broglie wavelength of the electron decreases.c. The de Broglie wavelength of the electron is unchanged. calculate the molarity of a kcl solution made by dissolving 28.4 g of kcl in a total volume of 500. ml. Supercells are often responsible for which of the following? O a Large hail O b. Significant tornadoes O c. Damaging non-tornadic winds d. Extremely heavy rainfall O e. All of the above Members of a soccer team raised $1511 to go to a tournament. They rented a bus for $933.50 and budgeted $38.50 per player for meals. Determine the number of players the team can bring to the tournament.hurry pls The data below represents the number of runners on each cross country team in the Northern Conference. 121212, 151515, 151515, 171717, 191919, 191919, 202020, 222222, 242424 Which box plot correctly summarizes the data? A cohort study has an advantage over a case control study when the exposure in question is: A. Clinically relevant B. one-time exposure C.Common D.Different by age group E.Rare Value: 1What are the following structures examples of? Respiratory Tract. Gastrointestinal Tract. Mucous Membranes Skin Lesions/Cuts/Abrasions what are the following structures examples of respiratory tract Castrian no tetrad, mucous membrane skin lesions, cuts abrasion 1. Which option correctly describes the reactants and products of a chemical reaction?A The mass of the reactants must be equal to the mass of the products. The total number of moles of the reactants can be more or less than the total number of moles of the products.B The mass of the reactants can be more or less than the mass of the products. The total number of moles of the reactants must be equal to the total number of moles of the products.C The mass of the reactants can be more or less than the mass of the products. The total number of moles of the reactants can also be more or less than the total number of moles of the products.D The mass of the reactants must be equal to the mass of the products. The total number of moles of the reactants must also be equal to the total number of moles of the products. Imagine that you were writing a poem about this vase.what topics would you discuss Which of these exercises best works the Quadriceps?Leg extensionLeg curlCable low rowOverhead extension Why was life in ghettos difficult for the Jews?A. Jews were not permitted to bond with each other.B. The Jews did not get adequate food.C. The Jews had to undertake hard labor.D. The Jews were separated from their families. assume that the numbers 1,2,...,n are randomly given to players labeled 1,2,...,n. initially, player 1 and player 2 compare their numbers. the one with the largest number wins and compares her number with player 3, and so on. find the probability that player 1 wins m times. Find an equation of the plane tangent to the following surface at the given point. 7xy +yz +4xz - 48 = 0; (2,2,2) The equation of the tangent plane at (2,2,2) is ... = 0.Find an equation of the plane tangent to the following surface at the given point. yze^xz + 7 = 0; (0, - 7,1) An equation of the tangent plane at (0, - 7,1) is ... = 0. Find an equation of the plane tangent to the following surface at the given point. z = 4 - 4x^2 - 2y^2; (2,3,-30) z = ...?Find an equation for the plane that is tangent to the surfacez = In (x^2 + y^3) at the point P(0,1,0). The equation of the plane is ... = 0 what two methods were commonly used in the spreading of islam